/**** 
* Plugins
****/ 
var tween = LK.import("@upit/tween.v1");
var storage = LK.import("@upit/storage.v1");

/**** 
* Classes
****/ 
var DinosaurImage = Container.expand(function (dinosaurName) {
	var self = Container.call(this);
	// Main dinosaur body
	var dinoBody = self.attachAsset(dinosaurName, {
		anchorX: 0.5,
		anchorY: 0.5
	});
	// Add red eyes
	var leftEye = self.attachAsset('redEye', {
		anchorX: 0.5,
		anchorY: 0.5
	});
	leftEye.x = -30;
	leftEye.y = -20;
	var rightEye = self.attachAsset('redEye', {
		anchorX: 0.5,
		anchorY: 0.5
	});
	rightEye.x = 30;
	rightEye.y = -20;
	return self;
});
var Fossil = Container.expand(function (fossilType) {
	var self = Container.call(this);
	var fossilGraphics = self.attachAsset(fossilType, {
		anchorX: 0.5,
		anchorY: 0.5
	});
	self.fossilType = fossilType;
	self.isCollected = false;
	self.points = fossilType === 'rareFossil' ? 500 : 100;
	self.down = function (x, y, obj) {
		if (!self.isCollected) {
			self.collectFossil();
		}
	};
	self.collectFossil = function () {
		self.isCollected = true;
		LK.getSound('fossilFound').play();
		// Apply dinosaur abilities
		if (selectedDinosaur === 'PYTHEREDON') {
			// PYTHEREDON collects 1 fossil per click (no level restriction)
			self.handlePytheredonCollection();
			return;
		} else if (selectedDinosaur === 'Mutated DIMETRODON') {
			// Mutated DIMETRODON collects 3 most valuable fossils every 3 levels
			if (currentLevelNumber % 3 === 0) {
				self.handleMutatedDimetrodonCollection();
				return;
			} else {
				// Regular collection on non-3rd levels
				// Add fossil to inventory
				playerInventory.push(self.fossilType);
				storage.playerInventory = playerInventory;
				// Award points based on extraction speed
				var speedBonus = Math.max(0, 100 - Math.floor(levelTimer / 100));
				var basePoints = self.points + speedBonus;
				// Apply upgrade bonus to points if dinosaur is selected and not hungry
				var totalPoints = basePoints;
				if (selectedDinosaur && canDinosaurUseAbilities(selectedDinosaur)) {
					totalPoints = Math.floor(basePoints * getPointsBonus(selectedDinosaur));
				}
				// Apply 2X MONEY effect if active
				if (doubleMoneyLevelsLeft > 0) {
					totalPoints *= 2;
				}
				LK.setScore(LK.getScore() + totalPoints);
				scoreText.setText('Score: ' + LK.getScore());
				self.animateCollection();
				return;
			}
		} else if (selectedDinosaur === 'DIMETRODON') {
			// DIMETRODON collects 2 fossils regardless of rarity (every level)
			self.handleDimetrodonCollection();
			return;
		}
		// Add fossil to inventory
		playerInventory.push(self.fossilType);
		storage.playerInventory = playerInventory;
		// Award points based on extraction speed
		var speedBonus = Math.max(0, 100 - Math.floor(levelTimer / 100));
		var basePoints = self.points + speedBonus;
		// Apply upgrade bonus to points if dinosaur is selected
		var totalPoints = basePoints;
		if (selectedDinosaur) {
			totalPoints = Math.floor(basePoints * getPointsBonus(selectedDinosaur));
		}
		// Apply 2X MONEY effect if active
		if (doubleMoneyLevelsLeft > 0) {
			totalPoints *= 2;
		}
		LK.setScore(LK.getScore() + totalPoints);
		scoreText.setText('Score: ' + LK.getScore());
		self.animateCollection();
	};
	self.handleDimetrodonCollection = function () {
		// DIMETRODON collects 2 fossils regardless of rarity
		var fossilsToCollect = 2;
		// Add current fossil first
		playerInventory.push(self.fossilType);
		// Add one more fossil of same type
		playerInventory.push(self.fossilType);
		storage.playerInventory = playerInventory;
		// Award bonus points for dual collection
		var basePoints = self.points * fossilsToCollect;
		var totalPoints = basePoints;
		if (doubleMoneyLevelsLeft > 0) {
			totalPoints *= 2;
		}
		LK.setScore(LK.getScore() + totalPoints);
		scoreText.setText('Score: ' + LK.getScore());
		self.animateCollection();
	};
	self.handlePytheredonCollection = function () {
		// PYTHEREDON collects 1 fossil per click
		playerInventory.push(self.fossilType);
		storage.playerInventory = playerInventory;
		// Award points for fossil collection
		var basePoints = self.points;
		var totalPoints = basePoints;
		if (selectedDinosaur && canDinosaurUseAbilities(selectedDinosaur)) {
			totalPoints = Math.floor(basePoints * getPointsBonus(selectedDinosaur));
		}
		// Apply 2X MONEY effect if active
		if (doubleMoneyLevelsLeft > 0) {
			totalPoints *= 2;
		}
		LK.setScore(LK.getScore() + totalPoints);
		scoreText.setText('Score: ' + LK.getScore());
		self.animateCollection();
	};
	self.handleMutatedDimetrodonCollection = function () {
		// Mutated DIMETRODON collects 3 most valuable fossils per level
		// Find available fossils from current level
		var availableFossils = [];
		for (var i = 0; i < currentLevel.fossils.length; i++) {
			if (!currentLevel.fossils[i].isCollected) {
				availableFossils.push(currentLevel.fossils[i]);
			}
		}
		// Sort by fossil value (descending)
		availableFossils.sort(function (a, b) {
			return b.points - a.points;
		});
		// Take up to 3 most valuable fossils
		var fossilsToCollect = Math.min(3, availableFossils.length);
		var totalPoints = 0;
		for (var j = 0; j < fossilsToCollect; j++) {
			playerInventory.push(availableFossils[j].fossilType);
			totalPoints += availableFossils[j].points;
			// Mark as collected
			availableFossils[j].isCollected = true;
			availableFossils[j].animateCollection();
		}
		storage.playerInventory = playerInventory;
		// Apply 2X MONEY effect if active
		if (doubleMoneyLevelsLeft > 0) {
			totalPoints *= 2;
		}
		LK.setScore(LK.getScore() + totalPoints);
		scoreText.setText('Score: ' + LK.getScore());
		self.animateCollection();
	};
	self.animateCollection = function () {
		// Animate collection
		tween(self, {
			scaleX: 1.5,
			scaleY: 1.5,
			alpha: 0
		}, {
			duration: 500,
			easing: tween.easeOut,
			onFinish: function onFinish() {
				currentLevel.fossilsCollected++;
				currentLevel.checkLevelComplete();
			}
		});
	};
	return self;
});
var Level = Container.expand(function (levelNumber) {
	var self = Container.call(this);
	self.levelNumber = levelNumber;
	self.blocks = [];
	self.fossils = [];
	self.fossilsCollected = 0;
	self.totalFossils = 0;
	self.blocksCollected = 0;
	self.totalBlocks = 0;
	self.createLevel = function () {
		// Create excavation site background
		var site = self.attachAsset('excavationSite', {
			anchorX: 0.5,
			anchorY: 0.5
		});
		site.x = 1024;
		site.y = 1000;
		// Get difficulty settings for this level
		var difficulty = getLevelDifficulty(levelNumber);
		var fossilCount = difficulty.fossilCount;
		var blocksPerRow = difficulty.gridWidth;
		var rows = difficulty.gridHeight;
		var rareChance = difficulty.rareChance;
		var fossilTypes = ['fossil1', 'fossil2', 'fossil3'];
		// Add rare fossil chance based on level difficulty
		if (Math.random() < rareChance) {
			fossilTypes.push('rareFossil');
		}
		self.totalFossils = fossilCount;
		// Create limestone blocks grid with scaling difficulty
		var startX = 1024 - blocksPerRow * 140 / 2 + 70; // Center the grid
		var startY = 600;
		var spacing = 140;
		var fossilPositions = [];
		for (var i = 0; i < fossilCount; i++) {
			var randomPos = Math.floor(Math.random() * (blocksPerRow * rows));
			while (fossilPositions.indexOf(randomPos) !== -1) {
				randomPos = Math.floor(Math.random() * (blocksPerRow * rows));
			}
			fossilPositions.push(randomPos);
		}
		var blockIndex = 0;
		for (var row = 0; row < rows; row++) {
			for (var col = 0; col < blocksPerRow; col++) {
				// Determine block type - 25% chance for ultra hard block, 30% chance for hard rock, 45% chance for limestone
				var random = Math.random();
				var blockType;
				if (random < 0.25) {
					blockType = 'ultraHardBlock';
				} else if (random < 0.55) {
					blockType = 'hardRock';
				} else {
					blockType = 'limestone';
				}
				var block = new LimestoneBlock(blockType);
				block.x = startX + col * spacing;
				block.y = startY + row * spacing;
				// Check if this block contains a fossil
				if (fossilPositions.indexOf(blockIndex) !== -1) {
					block.hasFossil = true;
					var fossilTypeIndex = Math.floor(Math.random() * fossilTypes.length);
					block.fossilType = fossilTypes[fossilTypeIndex];
				}
				self.blocks.push(block);
				self.addChild(block);
				blockIndex++;
			}
		}
		self.totalBlocks = self.blocks.length;
	};
	self.revealFossil = function (fossilType, x, y) {
		var fossil = new Fossil(fossilType);
		fossil.x = x;
		fossil.y = y;
		// Animate fossil appearance
		fossil.alpha = 0;
		fossil.scaleX = 0;
		fossil.scaleY = 0;
		self.fossils.push(fossil);
		self.addChild(fossil);
		tween(fossil, {
			alpha: 1,
			scaleX: 1,
			scaleY: 1
		}, {
			duration: 400,
			easing: tween.easeOut
		});
	};
	self.checkBlockCollection = function () {
		self.blocksCollected++;
		if (self.blocksCollected >= self.totalBlocks) {
			// All blocks collected, show any remaining fossils
			for (var i = 0; i < self.blocks.length; i++) {
				var block = self.blocks[i];
				if (block.hasFossil && !block.isCollected) {
					self.revealFossil(block.fossilType, block.x, block.y);
				}
			}
		}
	};
	self.checkLevelComplete = function () {
		if (self.fossilsCollected >= self.totalFossils) {
			LK.getSound('levelComplete').play();
			// Level completion bonus with scaling difficulty
			var baseLevelBonus = Math.floor(currentLevelNumber / 10) * 100; // Bonus increases every 10 levels
			var timeBonus = Math.max(0, 1000 + baseLevelBonus - Math.floor(levelTimer / 10));
			LK.setScore(LK.getScore() + timeBonus);
			scoreText.setText('Score: ' + LK.getScore());
			// Decrease power-up counters
			if (xrayLevelsLeft > 0) {
				xrayLevelsLeft--;
				storage.xrayLevelsLeft = xrayLevelsLeft;
			}
			if (doubleMoneyLevelsLeft > 0) {
				doubleMoneyLevelsLeft--;
				storage.doubleMoneyLevelsLeft = doubleMoneyLevelsLeft;
			}
			// Progress to next level after delay
			LK.setTimeout(function () {
				if (currentLevelNumber < maxLevels) {
					// Check if next level is a puzzle level
					if (isPuzzleLevel(currentLevelNumber + 1)) {
						startPuzzleLevel(currentLevelNumber + 1);
					} else {
						startLevel(currentLevelNumber + 1);
					}
				} else {
					// Game complete - reset progress
					storage.currentLevelNumber = 1;
					currentLevelNumber = 1;
					LK.showYouWin();
				}
			}, 2000);
		}
	};
	return self;
});
var LimestoneBlock = Container.expand(function (blockType) {
	var self = Container.call(this);
	self.blockType = blockType || 'limestone';
	// Use tan colored asset for ultra hard blocks
	var assetName = self.blockType === 'ultraHardBlock' ? 'ultraHardRock' : self.blockType;
	var blockGraphics = self.attachAsset(assetName, {
		anchorX: 0.5,
		anchorY: 0.5
	});
	self.hasFossil = false;
	self.fossilType = null;
	self.isCollected = false;
	self.hitsRequired = self.blockType === 'ultraHardBlock' ? 10 : self.blockType === 'hardRock' ? 5 : 3;
	self.currentHits = 0;
	self.down = function (x, y, obj) {
		if (!self.isCollected) {
			self.currentHits++;
			if (self.currentHits >= self.hitsRequired) {
				self.collectBlock();
			} else {
				// Show visual feedback for partial damage
				var damageAlpha = 1 - self.currentHits / self.hitsRequired * 0.6;
				blockGraphics.alpha = damageAlpha;
				LK.getSound('dig').play();
			}
		}
	};
	self.collectBlock = function () {
		// All dinosaurs now use normal collection - abilities only work via button press
		self.performCollection();
	};
	self.performCollection = function () {
		self.isCollected = true;
		LK.getSound('dig').play();
		// Animate collection
		tween(self, {
			scaleX: 0,
			scaleY: 0,
			alpha: 0
		}, {
			duration: 300,
			easing: tween.easeIn,
			onFinish: function onFinish() {
				if (self.hasFossil) {
					currentLevel.revealFossil(self.fossilType, self.x, self.y);
				}
				currentLevel.checkBlockCollection();
			}
		});
	};
	self.performTrexCollection = function () {
		// TREX roars and collects all fossils (every 10 levels)
		if (currentLevelNumber % 10 === 0) {
			// Create roar effect with screen shake animation
			var roarEffect = LK.getAsset('TREX', {
				anchorX: 0.5,
				anchorY: 0.5,
				scaleX: 3.0,
				scaleY: 3.0
			});
			roarEffect.x = 1024;
			roarEffect.y = 1000;
			roarEffect.alpha = 0.7;
			roarEffect.tint = 0xFF4500; // Orange roar effect
			currentLevel.addChild(roarEffect);
			// Animate roar effect with tween
			tween(roarEffect, {
				scaleX: 5.0,
				scaleY: 5.0,
				alpha: 0
			}, {
				duration: 2000,
				easing: tween.easeOut,
				onFinish: function onFinish() {
					roarEffect.destroy();
				}
			});
			// Collect all fossils on the level instantly
			for (var i = 0; i < currentLevel.blocks.length; i++) {
				var block = currentLevel.blocks[i];
				if (block.hasFossil && !block.isCollected) {
					// Instantly reveal and collect the fossil
					currentLevel.revealFossil(block.fossilType, block.x, block.y);
					// Mark block as collected
					block.isCollected = true;
					block.alpha = 0;
				}
			}
			// Break current block normally
			self.performCollection();
		} else {
			// Regular collection for non-10th levels
			self.performCollection();
		}
	};
	self.performSpinoCollection = function () {
		// SPINO tail strike breaks 3 blocks in a horizontal line (1 use per level)
		if (storage.spinoUsedThisLevel === undefined) storage.spinoUsedThisLevel = false;
		if (storage.spinoUsedThisLevel) {
			// Already used this level
			self.performCollection();
			return;
		}
		storage.spinoUsedThisLevel = true;
		// Create visual tail strike effect
		var tailStrikeEffect = LK.getAsset('SPINO', {
			anchorX: 0.5,
			anchorY: 0.5,
			scaleX: 2.0,
			scaleY: 2.0
		});
		tailStrikeEffect.x = self.x;
		tailStrikeEffect.y = self.y;
		tailStrikeEffect.alpha = 0.8;
		tailStrikeEffect.tint = 0x228B22; // Green tail strike effect
		currentLevel.addChild(tailStrikeEffect);
		// Animate tail strike effect
		tween(tailStrikeEffect, {
			scaleX: 3.5,
			scaleY: 1.5,
			alpha: 0
		}, {
			duration: 1000,
			easing: tween.easeOut,
			onFinish: function onFinish() {
				tailStrikeEffect.destroy();
			}
		});
		var blocksToBreak = [self];
		var currentIndex = currentLevel.blocks.indexOf(self);
		if (currentIndex !== -1) {
			var blocksPerRow = 8;
			var row = Math.floor(currentIndex / blocksPerRow);
			var col = currentIndex % blocksPerRow;
			// Add 2 blocks to the right
			for (var i = 1; i <= 2; i++) {
				if (col + i < blocksPerRow) {
					var blockIndex = row * blocksPerRow + (col + i);
					if (blockIndex < currentLevel.blocks.length) {
						var block = currentLevel.blocks[blockIndex];
						if (!block.isCollected) {
							blocksToBreak.push(block);
						}
					}
				}
			}
		}
		// Break all blocks
		for (var j = 0; j < blocksToBreak.length; j++) {
			blocksToBreak[j].performCollection();
		}
	};
	return self;
});

/**** 
* Initialize Game
****/ 
var game = new LK.Game({
	backgroundColor: 0x8B7D6B // Desert sand color
});

/**** 
* Game Code
****/ 
// Background rotation system - select different background each time
function selectNextBackground() {
	var availableBackgrounds = [0, 1, 2, 3]; // 4 different backgrounds
	// Remove last shown background from available options
	if (lastBackgroundIndex !== -1) {
		var lastIndex = availableBackgrounds.indexOf(lastBackgroundIndex);
		if (lastIndex !== -1) {
			availableBackgrounds.splice(lastIndex, 1);
		}
	}
	// Select random background from remaining options
	currentBackgroundIndex = availableBackgrounds[Math.floor(Math.random() * availableBackgrounds.length)];
	// Save current selection as last shown
	storage.lastBackgroundIndex = currentBackgroundIndex;
	lastBackgroundIndex = currentBackgroundIndex;
}
// Create dynamic backgrounds based on selection
function createBackground(backgroundIndex) {
	if (backgroundIndex === 0) {
		// 1. Current arid desert with gold and dinosaur bones
		var desertBackground = game.attachAsset('excavationSite', {
			anchorX: 0.5,
			anchorY: 0.5
		});
		desertBackground.x = 1024;
		desertBackground.y = 1366;
		desertBackground.alpha = 0.3;
		desertBackground.tint = 0xD2B48C; // Sandy brown color
		// Add scattered dinosaur bones and gold pieces
		for (var i = 0; i < 8; i++) {
			var bone = LK.getAsset('fossil2', {
				anchorX: 0.5,
				anchorY: 0.5,
				scaleX: 0.7,
				scaleY: 0.7
			});
			bone.x = 200 + Math.random() * 1648;
			bone.y = 1500 + Math.random() * 1000;
			bone.alpha = 0.4;
			bone.rotation = Math.random() * Math.PI * 2;
			game.addChild(bone);
		}
		// Add scattered gold pieces
		for (var j = 0; j < 6; j++) {
			var gold = LK.getAsset('rareFossil', {
				anchorX: 0.5,
				anchorY: 0.5,
				scaleX: 0.5,
				scaleY: 0.5
			});
			gold.x = 300 + Math.random() * 1448;
			gold.y = 1600 + Math.random() * 900;
			gold.alpha = 0.6;
			gold.tint = 0xFFD700; // Golden color
			game.addChild(gold);
		}
	} else if (backgroundIndex === 1) {
		// 2. Swampy forest with Spinosaurus and Sarcosuchus fossils
		var swampBackground = game.attachAsset('excavationSite', {
			anchorX: 0.5,
			anchorY: 0.5
		});
		swampBackground.x = 1024;
		swampBackground.y = 1366;
		swampBackground.alpha = 0.3;
		swampBackground.tint = 0x228B22; // Forest green color
		// Add shore trees along the edges using limestone blocks
		for (var t = 0; t < 10; t++) {
			var tree = LK.getAsset('limestone', {
				anchorX: 0.5,
				anchorY: 0.5,
				scaleX: 0.6,
				scaleY: 1.5
			});
			// Place trees along the shore (top and bottom edges)
			if (t < 5) {
				// Top shore trees
				tree.x = 200 + t * 300;
				tree.y = 800 + Math.random() * 200;
			} else {
				// Bottom shore trees
				tree.x = 200 + (t - 5) * 300;
				tree.y = 2300 + Math.random() * 200;
			}
			tree.alpha = 0.4;
			tree.tint = 0x8B4513; // Brown color for tree trunks
			game.addChild(tree);
		}
		// Add SPINO fossils scattered around
		for (var s = 0; s < 4; s++) {
			var spinoFossil = LK.getAsset('SPINO', {
				anchorX: 0.5,
				anchorY: 0.5,
				scaleX: 0.8,
				scaleY: 0.8
			});
			spinoFossil.x = 300 + Math.random() * 1448;
			spinoFossil.y = 1600 + Math.random() * 800;
			spinoFossil.alpha = 0.3;
			spinoFossil.rotation = Math.random() * Math.PI * 2;
			game.addChild(spinoFossil);
		}
		// Add crocodile-like fossils (using BARYONYX as substitute for Sarcosuchus)
		for (var c = 0; c < 3; c++) {
			var crocFossil = LK.getAsset('BARYONYX', {
				anchorX: 0.5,
				anchorY: 0.5,
				scaleX: 0.6,
				scaleY: 0.6
			});
			crocFossil.x = 400 + Math.random() * 1248;
			crocFossil.y = 1700 + Math.random() * 700;
			crocFossil.alpha = 0.3;
			crocFossil.rotation = Math.random() * Math.PI * 2;
			game.addChild(crocFossil);
		}
	} else if (backgroundIndex === 2) {
		// 3. Snowy mountain with GIGA and Argentavis fossils (white background)
		var snowyBackground = game.attachAsset('excavationSite', {
			anchorX: 0.5,
			anchorY: 0.5
		});
		snowyBackground.x = 1024;
		snowyBackground.y = 1366;
		snowyBackground.alpha = 0.3;
		snowyBackground.tint = 0xFFFFFF; // White color for snowy mountain
		// Add GIGA fossils scattered around
		for (var g = 0; g < 3; g++) {
			var gigaFossil = LK.getAsset('GIGA', {
				anchorX: 0.5,
				anchorY: 0.5,
				scaleX: 0.8,
				scaleY: 0.8
			});
			gigaFossil.x = 300 + Math.random() * 1448;
			gigaFossil.y = 1600 + Math.random() * 800;
			gigaFossil.alpha = 0.3;
			gigaFossil.rotation = Math.random() * Math.PI * 2;
			game.addChild(gigaFossil);
		}
		// Add Argentavis fossils (using YUTY as substitute for Argentavis)
		for (var a = 0; a < 2; a++) {
			var argentavisFossil = LK.getAsset('YUTY', {
				anchorX: 0.5,
				anchorY: 0.5,
				scaleX: 0.6,
				scaleY: 0.6
			});
			argentavisFossil.x = 400 + Math.random() * 1248;
			argentavisFossil.y = 1700 + Math.random() * 700;
			argentavisFossil.alpha = 0.3;
			argentavisFossil.rotation = Math.random() * Math.PI * 2;
			game.addChild(argentavisFossil);
		}
		// Add snow patches using limestone blocks
		for (var s = 0; s < 8; s++) {
			var snowPatch = LK.getAsset('limestone', {
				anchorX: 0.5,
				anchorY: 0.5,
				scaleX: 1.2,
				scaleY: 1.2
			});
			snowPatch.x = 200 + Math.random() * 1648;
			snowPatch.y = 1500 + Math.random() * 1000;
			snowPatch.alpha = 0.4;
			snowPatch.tint = 0xF0F8FF; // Alice blue for snow patches
			snowPatch.rotation = Math.random() * Math.PI * 2;
			game.addChild(snowPatch);
		}
	} else if (backgroundIndex === 3) {
		// 4. Ocean floor with Megalodon and Mosasaurus fossils (light blue background)
		var oceanBackground = game.attachAsset('excavationSite', {
			anchorX: 0.5,
			anchorY: 0.5
		});
		oceanBackground.x = 1024;
		oceanBackground.y = 1366;
		oceanBackground.alpha = 0.3;
		oceanBackground.tint = 0x87CEEB; // Light blue color for ocean
		// Add Megalodon fossils (using TREX as substitute for Megalodon)
		for (var m = 0; m < 2; m++) {
			var megalodonFossil = LK.getAsset('TREX', {
				anchorX: 0.5,
				anchorY: 0.5,
				scaleX: 1.0,
				scaleY: 1.0
			});
			megalodonFossil.x = 300 + Math.random() * 1448;
			megalodonFossil.y = 1600 + Math.random() * 800;
			megalodonFossil.alpha = 0.3;
			megalodonFossil.rotation = Math.random() * Math.PI * 2;
			game.addChild(megalodonFossil);
		}
		// Add Mosasaurus fossils (using SPINO as substitute for Mosasaurus)
		for (var mo = 0; mo < 3; mo++) {
			var mosasaurusFossil = LK.getAsset('SPINO', {
				anchorX: 0.5,
				anchorY: 0.5,
				scaleX: 0.9,
				scaleY: 0.9
			});
			mosasaurusFossil.x = 400 + Math.random() * 1248;
			mosasaurusFossil.y = 1700 + Math.random() * 700;
			mosasaurusFossil.alpha = 0.3;
			mosasaurusFossil.rotation = Math.random() * Math.PI * 2;
			game.addChild(mosasaurusFossil);
		}
		// Add coral formations using fossil shapes
		for (var c = 0; c < 6; c++) {
			var coral = LK.getAsset('fossil3', {
				anchorX: 0.5,
				anchorY: 0.5,
				scaleX: 0.8,
				scaleY: 0.8
			});
			coral.x = 200 + Math.random() * 1648;
			coral.y = 1500 + Math.random() * 1000;
			coral.alpha = 0.4;
			coral.tint = 0xFF7F50; // Coral color
			coral.rotation = Math.random() * Math.PI * 2;
			game.addChild(coral);
		}
	}
}
// Select and create background
selectNextBackground();
createBackground(currentBackgroundIndex);
// Dinosaur images with red eyes and different skin colors
var gameState = 'nickname'; // 'nickname', 'playing'
var playerNickname = storage.playerNickname || '';
var alphabet = 'ABCDEFGHIJKLMNOPQRSTUVWXYZ';
var currentLetterIndex = 0;
var currentLevelNumber = storage.currentLevelNumber || 1;
var maxLevels = 200;
var currentLevel = null;
var levelTimer = 0;
var leaderboardTexts = [];
// Player data storage - Load persistent data from storage
var playerCoins = storage.playerCoins || 0;
var playerInventory = storage.playerInventory || [];
var dinosaurCollection = storage.dinosaurCollection || [];
var selectedDinosaur = storage.selectedDinosaur || null;
// Dinosaur hunger system - Load persistent data
var dinosaurHunger = storage.dinosaurHunger || {};
var lastFeedingCheck = storage.lastFeedingCheck || Date.now();
// Food inventory - Load persistent data
var leafFood = storage.leafFood || 0;
var meatFood = storage.meatFood || 0;
var fishFood = storage.fishFood || 0;
// Dinosaur diet mapping based on real-life diets
var dinosaurDiets = {
	'PARASOUROLUPHUS': 'leaf',
	// Herbivore - ate plants, leaves
	'PYTHEREDON': 'meat',
	// Carnivore - small predator
	'DIMETRODON': 'meat',
	// Carnivore - apex predator of its time
	'BARYONYX': 'fish',
	// Piscivore - fish eater with crocodile-like snout
	'ALLO': 'meat',
	// Carnivore - large predator
	'YUTY': 'meat',
	// Carnivore - feathered tyrannosaur
	'TREX': 'meat',
	// Carnivore - apex predator
	'SPINO': 'fish',
	// Piscivore - semi-aquatic fish eater
	'GIGA': 'meat',
	// Carnivore - massive predator
	'Mutated BARYONYX': 'fish',
	// Piscivore - enhanced fish eater
	'Mutated DIMETRODON': 'meat',
	// Carnivore - enhanced predator
	'Mutated PARASAUROLUPHUS': 'leaf' // Herbivore - enhanced plant eater
};
var feedingCosts = {
	'PARASOUROLUPHUS': 50,
	'PYTHEREDON': 75,
	'DIMETRODON': 100,
	'BARYONYX': 200,
	'ALLO': 300,
	'YUTY': 400,
	'TREX': 800,
	'SPINO': 600,
	'GIGA': 700,
	'Mutated BARYONYX': 500,
	'Mutated DIMETRODON': 600,
	'Mutated PARASAUROLUPHUS': 550
};
// Ensure storage is properly initialized
storage.playerCoins = playerCoins;
storage.playerInventory = playerInventory;
storage.dinosaurCollection = dinosaurCollection;
storage.selectedDinosaur = selectedDinosaur;
storage.dinosaurHunger = dinosaurHunger;
storage.lastFeedingCheck = lastFeedingCheck;
// Background rotation system - track last shown background
var lastBackgroundIndex = storage.lastBackgroundIndex || -1;
var currentBackgroundIndex = 0;
// Load persistent gamepass purchases
var xrayLevelsLeft = storage.xrayLevelsLeft || 0;
var doubleMoneyLevelsLeft = storage.doubleMoneyLevelsLeft || 0;
var doubleValueActive = storage.doubleValueActive || false;
var doubleSpawnChanceActive = storage.doubleSpawnChanceActive || false;
// Load persistent +1 SELECT gamepass purchases
// Note: passPurchases is already loaded from storage in the showBag function
// Daily gifts system - Load persistent data
var lastGiftDate = storage.lastGiftDate || 0;
var currentGiftDay = storage.currentGiftDay || 1;
var dailyGifts = [1000, 2000, 4000, 8000, 10000, 12000, 16000]; // 7 days of gifts
var dailyGiftClaimed = storage.dailyGiftClaimed || false;
// Trade system - Load persistent data
var dailyTradesLeft = storage.dailyTradesLeft || 5; // 5 trades per day
var lastTradeDate = storage.lastTradeDate || 0;
var currentTradeOffer = storage.currentTradeOffer || null;
var tradeRequestsReceived = storage.tradeRequestsReceived || [];
var activePlayers = ['Player1', 'Player2', 'Player3', 'Player4', 'Player5']; // Mock active players
// Puzzle and difficulty system
var puzzleLevels = [10, 20, 30, 40, 50, 60, 70, 80, 90, 100, 110, 120, 130, 140, 150, 160, 170, 180, 190, 200]; // Puzzle every 10 levels
var currentPuzzle = null;
var puzzleUIElements = [];
function isPuzzleLevel(levelNumber) {
	return puzzleLevels.indexOf(levelNumber) !== -1;
}
function getLevelDifficulty(levelNumber) {
	// Calculate difficulty scaling: more fossils, less time, harder patterns
	var baseFossils = 3;
	var bonusFossils = Math.floor(levelNumber / 20); // +1 fossil every 20 levels
	var totalFossils = Math.min(baseFossils + bonusFossils, 10); // Max 10 fossils
	var baseBlocks = 48; // 8x6 grid
	var bonusBlocks = Math.floor(levelNumber / 25) * 8; // +8 blocks every 25 levels
	var totalBlocks = Math.min(baseBlocks + bonusBlocks, 80); // Max 80 blocks (10x8 grid)
	var rareChance = Math.min(0.05 + levelNumber * 0.002, 0.25); // Increase rare fossil chance, max 25%
	return {
		fossilCount: totalFossils,
		blockCount: totalBlocks,
		rareChance: rareChance,
		gridWidth: Math.min(8 + Math.floor(bonusBlocks / 8), 10),
		gridHeight: Math.min(6 + Math.floor(bonusBlocks / 16), 8)
	};
}
// Stock system - Load persistent data (coming soon)
var stockUIElements = [];
var fossilRarities = {
	'fossil1': 'common',
	'fossil2': 'common',
	'fossil3': 'common',
	'rareFossil': 'rare'
};
var fossilValues = {
	'fossil1': 10,
	'fossil2': 15,
	'fossil3': 20,
	'rareFossil': 100
};
var dinosaurRarities = {
	'PARASOUROLUPHUS': 'common',
	'PYTHEREDON': 'common',
	'DIMETRODON': 'common',
	'BARYONYX': 'rare',
	'ALLO': 'rare',
	'YUTY': 'rare',
	'TREX': 'chromatic',
	'SPINO': 'legendary',
	'GIGA': 'legendary',
	'Mutated BARYONYX': 'legendary',
	'Mutated DIMETRODON': 'legendary',
	'Mutated PARASAUROLUPHUS': 'legendary'
};
// Dinosaur abilities - Original characteristics restored
var dinosaurAbilities = {
	'PARASOUROLUPHUS': 'slow_dig',
	// Very slow digging, takes more time to break blocks
	'PYTHEREDON': 'limited_fossil',
	// Can only collect 1 fossil per level regardless of upgrades
	'DIMETRODON': 'dual_fossil',
	// Collects 2 fossils regardless of rarity
	'BARYONYX': 'speed_dig',
	// 20% faster digging speed
	'YUTY': 'fast_dig',
	// 70% faster digging speed
	'ALLO': 'medium_speed_dig',
	// 40% faster digging speed
	'TREX': 'roar_collector',
	// Roars every 10 levels and collects all fossils
	'SPINO': 'line_breaker',
	// Tail strike breaks 3 blocks in horizontal line, 1 use per level
	'GIGA': 'super_miner',
	// Double mining speed
	'Mutated BARYONYX': 'ultra_fast_dig',
	// 90% faster digging speed
	'Mutated DIMETRODON': 'value_collector',
	// Collects 3 most valuable fossils per level
	'Mutated PARASAUROLUPHUS': 'improved_slow_dig'
	// Faster than regular PARASAUROLUPHUS but still slower than others
};
// Dinosaur egg contents
var commonEggDinosaurs = ['PARASOUROLUPHUS', 'PYTHEREDON', 'DIMETRODON'];
var rareEggDinosaurs = [{
	name: 'BARYONYX',
	chance: 0.45
}, {
	name: 'ALLO',
	chance: 0.35
}, {
	name: 'YUTY',
	chance: 0.20
}];
var legendaryEggDinosaurs = [{
	name: 'TREX',
	chance: 0.03
}, {
	name: 'SPINO',
	chance: 0.10
}, {
	name: 'GIGA',
	chance: 0.15
}, {
	name: 'Mutated BARYONYX',
	chance: 0.25
}, {
	name: 'Mutated DIMETRODON',
	chance: 0.17
}, {
	name: 'Mutated PARASAUROLUPHUS',
	chance: 0.30
}];
function openEgg(eggType) {
	var dinosaurName = '';
	if (eggType === 'common') {
		// Equal chance for all common dinosaurs
		dinosaurName = commonEggDinosaurs[Math.floor(Math.random() * commonEggDinosaurs.length)];
	} else if (eggType === 'rare') {
		// Weighted random selection for rare dinosaurs - apply 2X LUCK if active
		var randomValue = Math.random();
		var cumulativeChance = 0;
		for (var i = 0; i < rareEggDinosaurs.length; i++) {
			var currentChance = rareEggDinosaurs[i].chance;
			// Apply 2X LUCK effect if active
			if (doubleSpawnChanceActive) {
				currentChance *= 2;
			}
			cumulativeChance += currentChance;
			if (randomValue <= cumulativeChance) {
				dinosaurName = rareEggDinosaurs[i].name;
				break;
			}
		}
	} else if (eggType === 'legendary') {
		// Weighted random selection for legendary dinosaurs - apply 2X LUCK if active
		var randomValue = Math.random();
		var cumulativeChance = 0;
		for (var i = 0; i < legendaryEggDinosaurs.length; i++) {
			var currentChance = legendaryEggDinosaurs[i].chance;
			// Apply 2X LUCK effect if active
			if (doubleSpawnChanceActive) {
				currentChance *= 2;
			}
			cumulativeChance += currentChance;
			if (randomValue <= cumulativeChance) {
				dinosaurName = legendaryEggDinosaurs[i].name;
				break;
			}
		}
	}
	// Reset 2X LUCK effect after use
	if (doubleSpawnChanceActive) {
		doubleSpawnChanceActive = false;
		storage.doubleSpawnChanceActive = doubleSpawnChanceActive;
	}
	// Add to dinosaur collection
	dinosaurCollection.push(dinosaurName);
	storage.dinosaurCollection = dinosaurCollection;
	// Show congratulations popup
	showCongratulationsPopup(dinosaurName);
	return dinosaurName;
}
function showCongratulationsPopup(dinosaurName) {
	gameState = 'congratulations';
	// Hide all current UI
	hideAllStoreUI();
	hideAllMenuUI();
	hideAllGameUI();
	// Create congratulations display
	var congratsTitle = new Text2('TEBRİKLER!', {
		size: 100,
		fill: '#FFD700'
	});
	congratsTitle.anchor.set(0.5, 0.5);
	congratsTitle.x = 1024;
	congratsTitle.y = 600;
	game.addChild(congratsTitle);
	infoUIElements.push(congratsTitle);
	var winMessage = new Text2('KAZANDINIZ!', {
		size: 80,
		fill: '#FFFFFF'
	});
	winMessage.anchor.set(0.5, 0.5);
	winMessage.x = 1024;
	winMessage.y = 800;
	game.addChild(winMessage);
	infoUIElements.push(winMessage);
	// Add dinosaur image
	var dinoImage = new DinosaurImage(dinosaurName);
	dinoImage.x = 1024;
	dinoImage.y = 900;
	dinoImage.scaleX = 2;
	dinoImage.scaleY = 2;
	game.addChild(dinoImage);
	infoUIElements.push(dinoImage);
	var dinosaurMessage = new Text2(dinosaurName, {
		size: 60,
		fill: '#32CD32'
	});
	dinosaurMessage.anchor.set(0.5, 0.5);
	dinosaurMessage.x = 1024;
	dinosaurMessage.y = 1100;
	game.addChild(dinosaurMessage);
	infoUIElements.push(dinosaurMessage);
	var closeButton = game.attachAsset('startButton', {
		anchorX: 0.5,
		anchorY: 0.5
	});
	closeButton.x = 1024;
	closeButton.y = 1300;
	var closeButtonText = new Text2('TAMAM', {
		size: 35,
		fill: '#FFFFFF'
	});
	closeButtonText.anchor.set(0.5, 0.5);
	closeButtonText.x = 1024;
	closeButtonText.y = 1300;
	game.addChild(closeButtonText);
	infoUIElements.push(closeButton, closeButtonText);
	closeButton.down = function () {
		hideInfoScreen();
		gameState = 'nickname';
		showAllMenuUI();
		coinsText.setText('Coins: ' + playerCoins);
	};
}
// UI Element arrays for different game states
var menuUIElements = [];
var gameUIElements = [];
var storeUIElements = [];
var sellUIElements = [];
var bagUIElements = [];
var infoUIElements = [];
var giftsUIElements = [];
var tradeUIElements = [];
var stockUIElements = [];
// UI Elements
var nicknameText = new Text2('Enter Nickname: A', {
	size: 80,
	fill: '#FFFFFF'
});
nicknameText.anchor.set(0.5, 0.5);
nicknameText.x = 1024;
nicknameText.y = 800;
var instructionText = new Text2('Use arrows to select letters, ADD to add, DELETE to remove', {
	size: 45,
	fill: '#CCCCCC'
});
instructionText.anchor.set(0.5, 0.5);
instructionText.x = 1024;
instructionText.y = 900;
var scoreText = new Text2('Score: 0', {
	size: 60,
	fill: '#FFFFFF'
});
scoreText.anchor.set(0, 0);
var levelText = new Text2('Level: 1', {
	size: 60,
	fill: '#FFFFFF'
});
levelText.anchor.set(1, 0);
var timerText = new Text2('Time: 0', {
	size: 50,
	fill: '#FFFFFF'
});
timerText.anchor.set(0.5, 0);
// Nickname input elements
var leftArrow = game.attachAsset('arrowLeft', {
	anchorX: 0.5,
	anchorY: 0.5
});
leftArrow.x = 800;
leftArrow.y = 1000;
var rightArrow = game.attachAsset('arrowRight', {
	anchorX: 0.5,
	anchorY: 0.5
});
rightArrow.x = 1248;
rightArrow.y = 1000;
var startButton = game.attachAsset('startButton', {
	anchorX: 0.5,
	anchorY: 0.5
});
startButton.x = 1024;
startButton.y = 1200;
var startButtonText = new Text2('START', {
	size: 40,
	fill: '#FFFFFF'
});
startButtonText.anchor.set(0.5, 0.5);
startButtonText.x = 1024;
startButtonText.y = 1200;
var addButton = game.attachAsset('startButton', {
	anchorX: 0.5,
	anchorY: 0.5
});
addButton.x = 900;
addButton.y = 1100;
var addButtonText = new Text2('ADD', {
	size: 35,
	fill: '#FFFFFF'
});
addButtonText.anchor.set(0.5, 0.5);
addButtonText.x = 900;
addButtonText.y = 1100;
var deleteButton = game.attachAsset('deleteButton', {
	anchorX: 0.5,
	anchorY: 0.5
});
deleteButton.x = 1148;
deleteButton.y = 1100;
var deleteButtonText = new Text2('DELETE', {
	size: 35,
	fill: '#FFFFFF'
});
deleteButtonText.anchor.set(0.5, 0.5);
deleteButtonText.x = 1148;
deleteButtonText.y = 1100;
var storeButton = game.attachAsset('startButton', {
	anchorX: 0.5,
	anchorY: 0.5
});
storeButton.x = 650;
storeButton.y = 1300;
var storeButtonText = new Text2('STORE', {
	size: 35,
	fill: '#FFFFFF'
});
storeButtonText.anchor.set(0.5, 0.5);
storeButtonText.x = 650;
storeButtonText.y = 1300;
var sellButton = game.attachAsset('startButton', {
	anchorX: 0.5,
	anchorY: 0.5
});
sellButton.x = 1398;
sellButton.y = 1300;
var sellButtonText = new Text2('SELL', {
	size: 35,
	fill: '#FFFFFF'
});
sellButtonText.anchor.set(0.5, 0.5);
sellButtonText.x = 1398;
sellButtonText.y = 1300;
var shopButton = game.attachAsset('startButton', {
	anchorX: 0.5,
	anchorY: 0.5
});
shopButton.x = 1024;
shopButton.y = 1550;
var shopButtonText = new Text2('SHOP', {
	size: 35,
	fill: '#FFFFFF'
});
shopButtonText.anchor.set(0.5, 0.5);
shopButtonText.x = 1024;
shopButtonText.y = 1550;
var bagButton = game.attachAsset('startButton', {
	anchorX: 0.5,
	anchorY: 0.5
});
bagButton.x = 1024;
bagButton.y = 1650;
var bagButtonText = new Text2('BAG', {
	size: 35,
	fill: '#FFFFFF'
});
bagButtonText.anchor.set(0.5, 0.5);
bagButtonText.x = 1024;
bagButtonText.y = 1650;
var tradeButton = game.attachAsset('startButton', {
	anchorX: 0.5,
	anchorY: 0.5
});
tradeButton.x = 650;
tradeButton.y = 1750;
var tradeButtonText = new Text2('TRADE', {
	size: 35,
	fill: '#FFFFFF'
});
tradeButtonText.anchor.set(0.5, 0.5);
tradeButtonText.x = 650;
tradeButtonText.y = 1750;
var giftsButton = game.attachAsset('startButton', {
	anchorX: 0.5,
	anchorY: 0.5
});
giftsButton.x = 1398;
giftsButton.y = 1750;
var giftsButtonText = new Text2('GIFTS', {
	size: 35,
	fill: '#FFFFFF'
});
giftsButtonText.anchor.set(0.5, 0.5);
giftsButtonText.x = 1398;
giftsButtonText.y = 1750;
var stockButton = game.attachAsset('startButton', {
	anchorX: 0.5,
	anchorY: 0.5
});
stockButton.x = 1024;
stockButton.y = 1850;
var stockButtonText = new Text2('STOCK', {
	size: 35,
	fill: '#FFFFFF'
});
stockButtonText.anchor.set(0.5, 0.5);
stockButtonText.x = 1024;
stockButtonText.y = 1850;
var coinsText = new Text2('Coins: ' + playerCoins, {
	size: 50,
	fill: '#FFD700'
});
coinsText.anchor.set(0.5, 0.5);
coinsText.x = 1024;
coinsText.y = 1400;
// Add nickname UI to game and track as menu elements
game.addChild(nicknameText);
game.addChild(instructionText);
game.addChild(leftArrow);
game.addChild(rightArrow);
game.addChild(addButton);
game.addChild(addButtonText);
game.addChild(deleteButton);
game.addChild(deleteButtonText);
game.addChild(startButton);
game.addChild(startButtonText);
game.addChild(storeButton);
game.addChild(storeButtonText);
game.addChild(sellButton);
game.addChild(sellButtonText);
game.addChild(shopButton);
game.addChild(shopButtonText);
game.addChild(bagButton);
game.addChild(bagButtonText);
game.addChild(tradeButton);
game.addChild(tradeButtonText);
game.addChild(giftsButton);
game.addChild(giftsButtonText);
game.addChild(stockButton);
game.addChild(stockButtonText);
game.addChild(coinsText);
// Track menu UI elements
menuUIElements.push(nicknameText, instructionText, leftArrow, rightArrow, addButton, addButtonText, deleteButton, deleteButtonText, startButton, startButtonText, storeButton, storeButtonText, sellButton, sellButtonText, shopButton, shopButtonText, bagButton, bagButtonText, tradeButton, tradeButtonText, giftsButton, giftsButtonText, stockButton, stockButtonText, coinsText);
// Track game UI elements
gameUIElements.push(scoreText, levelText, timerText);
// Add game UI to GUI
LK.gui.topLeft.addChild(scoreText);
scoreText.x = 120;
scoreText.y = 20;
scoreText.visible = false;
LK.gui.topRight.addChild(levelText);
levelText.y = 20;
levelText.visible = false;
LK.gui.top.addChild(timerText);
timerText.y = 100;
timerText.visible = false;
function hideAllMenuUI() {
	for (var i = 0; i < menuUIElements.length; i++) {
		menuUIElements[i].visible = false;
	}
}
function showAllMenuUI() {
	for (var i = 0; i < menuUIElements.length; i++) {
		menuUIElements[i].visible = true;
	}
}
function hideAllGameUI() {
	for (var i = 0; i < gameUIElements.length; i++) {
		gameUIElements[i].visible = false;
	}
}
function showAllGameUI() {
	for (var i = 0; i < gameUIElements.length; i++) {
		gameUIElements[i].visible = true;
	}
}
function hideAllStoreUI() {
	for (var i = 0; i < storeUIElements.length; i++) {
		storeUIElements[i].destroy();
	}
	storeUIElements = [];
}
function hideAllSellUI() {
	for (var i = 0; i < sellUIElements.length; i++) {
		sellUIElements[i].destroy();
	}
	sellUIElements = [];
}
function hideAllBagUI() {
	for (var i = 0; i < bagUIElements.length; i++) {
		bagUIElements[i].destroy();
	}
	bagUIElements = [];
}
function hideAllInfoUI() {
	for (var i = 0; i < infoUIElements.length; i++) {
		infoUIElements[i].destroy();
	}
	infoUIElements = [];
}
function updateNicknameDisplay() {
	var currentLetter = alphabet[currentLetterIndex];
	var displayText = 'Enter Nickname: ' + playerNickname + currentLetter;
	nicknameText.setText(displayText);
	// Update instruction text to show current letter selection
	instructionText.setText('Current Letter: ' + currentLetter + ' - Use arrows to select, ADD to add, DELETE to remove');
}
function startLevel(levelNumber) {
	// Clean up previous level
	if (currentLevel) {
		currentLevel.destroy();
	}
	currentLevelNumber = levelNumber;
	storage.currentLevelNumber = currentLevelNumber;
	levelTimer = 0;
	// Reset SPINO usage for new level
	storage.spinoUsedThisLevel = false;
	// No special ability resets needed for original abilities
	// Create new level
	currentLevel = new Level(levelNumber);
	currentLevel.createLevel();
	game.addChild(currentLevel);
	levelText.setText('Level: ' + levelNumber + '/' + maxLevels);
}
function startPuzzleLevel(levelNumber) {
	// Clean up previous level
	if (currentLevel) {
		currentLevel.destroy();
	}
	if (currentPuzzle) {
		currentPuzzle.destroy();
	}
	currentLevelNumber = levelNumber;
	storage.currentLevelNumber = currentLevelNumber;
	levelTimer = 0;
	levelText.setText('Level: ' + levelNumber + ' (PUZZLE)');
	// Create dinosaur trivia puzzle
	createPuzzle(0, levelNumber);
}
function createPuzzle(puzzleType, levelNumber) {
	currentPuzzle = new Container();
	game.addChild(currentPuzzle);
	// All puzzles are now dinosaur trivia questions
	createDinosaurTriviaPuzzle(levelNumber);
}
function createDinosaurTriviaPuzzle(levelNumber) {
	// Create trivia questions with increasing difficulty based on level
	var triviaQuestions = [
	// Levels 10-30: Basic questions
	{
		question: "En güçlü theropod hangisidir?",
		answers: ["Tyrannosaurus Rex", "Velociraptor", "Compsognathus"],
		correct: 0,
		minLevel: 10
	}, {
		question: "En büyük sauropod hangisidir?",
		answers: ["Diplodocus", "Argentinasaurus", "Brachiosaurus"],
		correct: 1,
		minLevel: 10
	}, {
		question: "En hızlı dinozor hangisidir?",
		answers: ["Triceratops", "Ornithomimus", "Stegosaurus"],
		correct: 1,
		minLevel: 20
	},
	// Levels 40-70: Intermediate questions
	{
		question: "Spinosaurus'un beslenme türü nedir?",
		answers: ["Otçul", "Balık yiyen", "Et yiyen"],
		correct: 1,
		minLevel: 40
	}, {
		question: "En büyük uçan dinozor hangisidir?",
		answers: ["Pteranodon", "Quetzalcoatlus", "Archaeopteryx"],
		correct: 1,
		minLevel: 50
	}, {
		question: "Triceratops kaç boynuzludur?",
		answers: ["İki", "Üç", "Dört"],
		correct: 1,
		minLevel: 60
	},
	// Levels 80-120: Advanced questions
	{
		question: "Carnotaurus'un özel özelliği nedir?",
		answers: ["Boynuzları", "Kanatları", "Uzun kuyruğu"],
		correct: 0,
		minLevel: 80
	}, {
		question: "En küçük bilinen dinozor hangisidir?",
		answers: ["Microraptor", "Compsognathus", "Epidexipteryx"],
		correct: 0,
		minLevel: 100
	}, {
		question: "Therizinosaurus'un beslenme türü nedir?",
		answers: ["Et yiyen", "Otçul", "Her şey yiyen"],
		correct: 1,
		minLevel: 110
	},
	// Levels 130-200: Expert questions
	{
		question: "Dracorex'in anlamı nedir?",
		answers: ["Ejder Kralı", "Büyük Avcı", "Hızlı Koşucu"],
		correct: 0,
		minLevel: 130
	}, {
		question: "En uzun boyunlu dinozor hangisidir?",
		answers: ["Mamenchisaurus", "Supersaurus", "Giraffatitan"],
		correct: 0,
		minLevel: 150
	}, {
		question: "Parasaurolophus'un özel özelliği nedir?",
		answers: ["Ses çıkarması", "Zehirli dişleri", "Renkli tüyleri"],
		correct: 0,
		minLevel: 170
	}];
	// Filter questions appropriate for current level
	var availableQuestions = [];
	for (var i = 0; i < triviaQuestions.length; i++) {
		if (levelNumber >= triviaQuestions[i].minLevel) {
			availableQuestions.push(triviaQuestions[i]);
		}
	}
	// Select random question from available ones
	var selectedQuestion = availableQuestions[Math.floor(Math.random() * availableQuestions.length)];
	// Create puzzle title
	var puzzleTitle = new Text2('DİNOZOR BİLGİ YARIŞMASI', {
		size: 60,
		fill: '#FFD700'
	});
	puzzleTitle.anchor.set(0.5, 0.5);
	puzzleTitle.x = 1024;
	puzzleTitle.y = 300;
	currentPuzzle.addChild(puzzleTitle);
	puzzleUIElements.push(puzzleTitle);
	// Display question
	var questionText = new Text2(selectedQuestion.question, {
		size: 50,
		fill: '#FFFFFF'
	});
	questionText.anchor.set(0.5, 0.5);
	questionText.x = 1024;
	questionText.y = 600;
	currentPuzzle.addChild(questionText);
	puzzleUIElements.push(questionText);
	// Create answer buttons
	for (var a = 0; a < 3; a++) {
		var answerButton = currentPuzzle.attachAsset('startButton', {
			anchorX: 0.5,
			anchorY: 0.5
		});
		answerButton.x = 1024;
		answerButton.y = 900 + a * 150;
		currentPuzzle.addChild(answerButton);
		puzzleUIElements.push(answerButton);
		var answerText = new Text2(selectedQuestion.answers[a], {
			size: 40,
			fill: '#FFFFFF'
		});
		answerText.anchor.set(0.5, 0.5);
		answerText.x = 1024;
		answerText.y = 900 + a * 150;
		currentPuzzle.addChild(answerText);
		puzzleUIElements.push(answerText);
		// Add click handler with closure
		(function (answerIndex, correctIndex) {
			answerButton.down = function () {
				if (answerIndex === correctIndex) {
					solvePuzzle();
				} else {
					resetTriviaPuzzle();
				}
			};
		})(a, selectedQuestion.correct);
	}
}
function resetTriviaPuzzle() {
	// Reset puzzle on wrong answer
	createDinosaurTriviaPuzzle(currentLevelNumber);
}
function createSequencePuzzle(levelNumber) {
	// Sequence puzzle: Click fossils in correct order
	var puzzleTitle = new Text2('SEQUENCE PUZZLE - Click fossils in order!', {
		size: 60,
		fill: '#FFD700'
	});
	puzzleTitle.anchor.set(0.5, 0.5);
	puzzleTitle.x = 1024;
	puzzleTitle.y = 300;
	currentPuzzle.addChild(puzzleTitle);
	puzzleUIElements.push(puzzleTitle);
	var sequenceLength = Math.min(3 + Math.floor(levelNumber / 30), 8); // Longer sequences for higher levels
	var correctSequence = [];
	var playerSequence = [];
	var fossils = [];
	// Create sequence of fossils
	for (var i = 0; i < sequenceLength; i++) {
		var fossil = currentPuzzle.attachAsset('fossil' + (i % 3 + 1), {
			anchorX: 0.5,
			anchorY: 0.5
		});
		fossil.x = 300 + i * 150;
		fossil.y = 800;
		fossil.sequenceNumber = i + 1;
		fossils.push(fossil);
		correctSequence.push(i);
		puzzleUIElements.push(fossil);
		var numberText = new Text2(String(i + 1), {
			size: 40,
			fill: '#FFFFFF'
		});
		numberText.anchor.set(0.5, 0.5);
		numberText.x = fossil.x;
		numberText.y = fossil.y - 80;
		currentPuzzle.addChild(numberText);
		puzzleUIElements.push(numberText);
		// Add click handler
		(function (index, fossilObj) {
			fossilObj.down = function () {
				playerSequence.push(index);
				fossilObj.alpha = 0.5;
				if (playerSequence.length === sequenceLength) {
					checkSequence();
				}
			};
		})(i, fossil);
	}
	function checkSequence() {
		var correct = true;
		for (var i = 0; i < sequenceLength; i++) {
			if (playerSequence[i] !== correctSequence[i]) {
				correct = false;
				break;
			}
		}
		if (correct) {
			solvePuzzle();
		} else {
			resetSequencePuzzle();
		}
	}
	function resetSequencePuzzle() {
		playerSequence = [];
		for (var i = 0; i < fossils.length; i++) {
			fossils[i].alpha = 1;
		}
	}
}
function createPatternPuzzle(levelNumber) {
	// Pattern puzzle: Complete the fossil pattern
	var puzzleTitle = new Text2('PATTERN PUZZLE - Complete the pattern!', {
		size: 60,
		fill: '#FFD700'
	});
	puzzleTitle.anchor.set(0.5, 0.5);
	puzzleTitle.x = 1024;
	puzzleTitle.y = 300;
	currentPuzzle.addChild(puzzleTitle);
	puzzleUIElements.push(puzzleTitle);
	var gridSize = Math.min(3 + Math.floor(levelNumber / 50), 5); // Larger grids for higher levels
	var pattern = [];
	var playerPattern = [];
	// Generate pattern
	for (var i = 0; i < gridSize * gridSize; i++) {
		pattern.push(Math.random() > 0.5 ? 1 : 0);
	}
	// Show pattern briefly, then hide half of it
	for (var row = 0; row < gridSize; row++) {
		for (var col = 0; col < gridSize; col++) {
			var index = row * gridSize + col;
			var shouldShow = pattern[index] === 1;
			var isHidden = (row + col) % 2 === 1; // Checkerboard hiding pattern
			var fossil = null;
			if (shouldShow && !isHidden) {
				fossil = currentPuzzle.attachAsset('fossil1', {
					anchorX: 0.5,
					anchorY: 0.5
				});
			} else if (shouldShow && isHidden) {
				fossil = currentPuzzle.attachAsset('limestone', {
					anchorX: 0.5,
					anchorY: 0.5
				});
				fossil.isHiddenPattern = true;
				fossil.correctPattern = true;
			} else if (isHidden) {
				fossil = currentPuzzle.attachAsset('limestone', {
					anchorX: 0.5,
					anchorY: 0.5
				});
				fossil.isHiddenPattern = true;
				fossil.correctPattern = false;
			}
			if (fossil) {
				fossil.x = 700 + col * 100;
				fossil.y = 600 + row * 100;
				fossil.gridIndex = index;
				puzzleUIElements.push(fossil);
				if (fossil.isHiddenPattern) {
					(function (fossilObj) {
						fossilObj.down = function () {
							if (fossilObj.correctPattern) {
								fossilObj.destroy();
								var correctFossil = currentPuzzle.attachAsset('fossil1', {
									anchorX: 0.5,
									anchorY: 0.5
								});
								correctFossil.x = fossilObj.x;
								correctFossil.y = fossilObj.y;
								currentPuzzle.addChild(correctFossil);
								checkPatternComplete();
							} else {
								resetPatternPuzzle();
							}
						};
					})(fossil);
				}
			}
		}
	}
}
function checkPatternComplete() {
	// Simple check - if we get here from correct clicks, puzzle is solved
	solvePuzzle();
}
function resetPatternPuzzle() {
	// Reset puzzle on wrong click
	createPatternPuzzle(currentLevelNumber);
}
function createMemoryPuzzle(levelNumber) {
	// Memory puzzle: Remember fossil locations
	var puzzleTitle = new Text2('MEMORY PUZZLE - Remember the fossil locations!', {
		size: 60,
		fill: '#FFD700'
	});
	puzzleTitle.anchor.set(0.5, 0.5);
	puzzleTitle.x = 1024;
	puzzleTitle.y = 300;
	currentPuzzle.addChild(puzzleTitle);
	puzzleUIElements.push(puzzleTitle);
	var fossilCount = Math.min(3 + Math.floor(levelNumber / 40), 6);
	var memoryPositions = [];
	var revealedFossils = [];
	// Generate random positions
	for (var i = 0; i < fossilCount; i++) {
		var pos = {
			x: 400 + Math.floor(Math.random() * 5) * 150,
			y: 600 + Math.floor(Math.random() * 3) * 150
		};
		memoryPositions.push(pos);
		var fossil = currentPuzzle.attachAsset('fossil' + (i % 3 + 1), {
			anchorX: 0.5,
			anchorY: 0.5
		});
		fossil.x = pos.x;
		fossil.y = pos.y;
		fossil.memoryIndex = i;
		currentPuzzle.addChild(fossil);
		revealedFossils.push(fossil);
		puzzleUIElements.push(fossil);
	}
	// Hide fossils after showing them briefly
	LK.setTimeout(function () {
		for (var i = 0; i < revealedFossils.length; i++) {
			revealedFossils[i].alpha = 0;
		}
		createMemoryGrid();
	}, 2000);
	function createMemoryGrid() {
		var playerGuesses = 0;
		var correctGuesses = 0;
		for (var row = 0; row < 3; row++) {
			for (var col = 0; col < 5; col++) {
				var gridX = 400 + col * 150;
				var gridY = 600 + row * 150;
				var isCorrectPos = false;
				for (var p = 0; p < memoryPositions.length; p++) {
					if (memoryPositions[p].x === gridX && memoryPositions[p].y === gridY) {
						isCorrectPos = true;
						break;
					}
				}
				var gridBlock = currentPuzzle.attachAsset('limestone', {
					anchorX: 0.5,
					anchorY: 0.5
				});
				gridBlock.x = gridX;
				gridBlock.y = gridY;
				gridBlock.isCorrectMemory = isCorrectPos;
				currentPuzzle.addChild(gridBlock);
				puzzleUIElements.push(gridBlock);
				(function (blockObj) {
					blockObj.down = function () {
						playerGuesses++;
						if (blockObj.isCorrectMemory) {
							correctGuesses++;
							blockObj.tint = 0x00FF00; // Green for correct
						} else {
							blockObj.tint = 0xFF0000; // Red for wrong
						}
						if (playerGuesses === fossilCount) {
							if (correctGuesses === fossilCount) {
								solvePuzzle();
							} else {
								resetMemoryPuzzle();
							}
						}
					};
				})(gridBlock);
			}
		}
	}
}
function resetMemoryPuzzle() {
	createMemoryPuzzle(currentLevelNumber);
}
function createLogicPuzzle(levelNumber) {
	// Logic puzzle: Mathematical sequence
	var puzzleTitle = new Text2('LOGIC PUZZLE - Complete the sequence!', {
		size: 60,
		fill: '#FFD700'
	});
	puzzleTitle.anchor.set(0.5, 0.5);
	puzzleTitle.x = 1024;
	puzzleTitle.y = 300;
	currentPuzzle.addChild(puzzleTitle);
	puzzleUIElements.push(puzzleTitle);
	// Generate arithmetic sequence
	var startNum = Math.floor(Math.random() * 10) + 1;
	var step = Math.floor(Math.random() * 5) + 2;
	var sequence = [startNum, startNum + step, startNum + step * 2, startNum + step * 3];
	var missingIndex = Math.floor(Math.random() * 4);
	var correctAnswer = sequence[missingIndex];
	// Display sequence with missing number
	for (var i = 0; i < 4; i++) {
		var numText;
		if (i === missingIndex) {
			numText = new Text2('?', {
				size: 80,
				fill: '#FF0000'
			});
		} else {
			numText = new Text2(String(sequence[i]), {
				size: 80,
				fill: '#FFFFFF'
			});
		}
		numText.anchor.set(0.5, 0.5);
		numText.x = 600 + i * 150;
		numText.y = 700;
		currentPuzzle.addChild(numText);
		puzzleUIElements.push(numText);
	}
	// Create answer options
	var options = [correctAnswer];
	for (var j = 0; j < 3; j++) {
		var wrongAnswer;
		do {
			wrongAnswer = correctAnswer + (Math.floor(Math.random() * 10) - 5);
		} while (options.indexOf(wrongAnswer) !== -1 || wrongAnswer <= 0);
		options.push(wrongAnswer);
	}
	// Shuffle options
	for (var k = options.length - 1; k > 0; k--) {
		var randomIndex = Math.floor(Math.random() * (k + 1));
		var temp = options[k];
		options[k] = options[randomIndex];
		options[randomIndex] = temp;
	}
	// Display options
	for (var o = 0; o < options.length; o++) {
		var optionButton = currentPuzzle.attachAsset('startButton', {
			anchorX: 0.5,
			anchorY: 0.5
		});
		optionButton.x = 500 + o * 200;
		optionButton.y = 1000;
		currentPuzzle.addChild(optionButton);
		puzzleUIElements.push(optionButton);
		var optionText = new Text2(String(options[o]), {
			size: 60,
			fill: '#FFFFFF'
		});
		optionText.anchor.set(0.5, 0.5);
		optionText.x = optionButton.x;
		optionText.y = optionButton.y;
		currentPuzzle.addChild(optionText);
		puzzleUIElements.push(optionText);
		(function (answer) {
			optionButton.down = function () {
				if (answer === correctAnswer) {
					solvePuzzle();
				} else {
					resetLogicPuzzle();
				}
			};
		})(options[o]);
	}
}
function resetLogicPuzzle() {
	createLogicPuzzle(currentLevelNumber);
}
function solvePuzzle() {
	// Award bonus points for solving puzzle
	var puzzleBonus = 1000 * Math.floor(currentLevelNumber / 15);
	LK.setScore(LK.getScore() + puzzleBonus);
	scoreText.setText('Score: ' + LK.getScore());
	// Clean up puzzle
	hideAllPuzzleUI();
	currentPuzzle.destroy();
	currentPuzzle = null;
	// Continue to regular level
	startLevel(currentLevelNumber);
}
function hideAllPuzzleUI() {
	for (var i = 0; i < puzzleUIElements.length; i++) {
		puzzleUIElements[i].destroy();
	}
	puzzleUIElements = [];
}
function showStore() {
	gameState = 'store';
	// Hide all menu and game UI elements
	hideAllMenuUI();
	hideAllGameUI();
	// Create store display
	var storeTitle = new Text2('FOSSIL STORE', {
		size: 80,
		fill: '#FFFFFF'
	});
	storeTitle.anchor.set(0.5, 0.5);
	storeTitle.x = 1024;
	storeTitle.y = 200;
	game.addChild(storeTitle);
	storeUIElements.push(storeTitle);
	var backButton = game.attachAsset('startButton', {
		anchorX: 0.5,
		anchorY: 0.5
	});
	backButton.x = 1024;
	backButton.y = 1500;
	var backButtonText = new Text2('BACK', {
		size: 35,
		fill: '#FFFFFF'
	});
	backButtonText.anchor.set(0.5, 0.5);
	backButtonText.x = 1024;
	backButtonText.y = 1500;
	game.addChild(backButtonText);
	storeUIElements.push(backButton, backButtonText);
	// Sort and display inventory by rarity
	var rareFossils = [];
	var commonFossils = [];
	for (var i = 0; i < playerInventory.length; i++) {
		if (fossilRarities[playerInventory[i]] === 'rare') {
			rareFossils.push(playerInventory[i]);
		} else {
			commonFossils.push(playerInventory[i]);
		}
	}
	var allFossils = rareFossils.concat(commonFossils);
	var startY = 350;
	for (var j = 0; j < allFossils.length; j++) {
		var fossilName = allFossils[j];
		var rarity = fossilRarities[fossilName];
		var color = rarity === 'rare' ? '#FFD700' : '#FFFFFF';
		var fossilText = new Text2(fossilName + ' (' + rarity + ')', {
			size: 40,
			fill: color
		});
		fossilText.anchor.set(0.5, 0.5);
		fossilText.x = 1024;
		fossilText.y = startY + j * 60;
		game.addChild(fossilText);
		storeUIElements.push(fossilText);
	}
	backButton.down = function () {
		hideStore();
	};
}
function hideStore() {
	gameState = 'nickname';
	// Remove all store UI elements
	hideAllStoreUI();
	// Restore menu UI elements
	showAllMenuUI();
}
function showSell() {
	gameState = 'sell';
	// Hide all menu and game UI elements
	hideAllMenuUI();
	hideAllGameUI();
	// Create sell display
	var sellTitle = new Text2('SELL FOSSILS', {
		size: 80,
		fill: '#FFFFFF'
	});
	sellTitle.anchor.set(0.5, 0.5);
	sellTitle.x = 1024;
	sellTitle.y = 200;
	game.addChild(sellTitle);
	sellUIElements.push(sellTitle);
	var sellAllButton = game.attachAsset('startButton', {
		anchorX: 0.5,
		anchorY: 0.5
	});
	sellAllButton.x = 1024;
	sellAllButton.y = 1400;
	var sellAllButtonText = new Text2('SELL ALL', {
		size: 35,
		fill: '#FFFFFF'
	});
	sellAllButtonText.anchor.set(0.5, 0.5);
	sellAllButtonText.x = 1024;
	sellAllButtonText.y = 1400;
	game.addChild(sellAllButtonText);
	sellUIElements.push(sellAllButton, sellAllButtonText);
	var sellBackButton = game.attachAsset('startButton', {
		anchorX: 0.5,
		anchorY: 0.5
	});
	sellBackButton.x = 1024;
	sellBackButton.y = 1600;
	var sellBackButtonText = new Text2('BACK', {
		size: 35,
		fill: '#FFFFFF'
	});
	sellBackButtonText.anchor.set(0.5, 0.5);
	sellBackButtonText.x = 1024;
	sellBackButtonText.y = 1600;
	game.addChild(sellBackButtonText);
	// Add 2X MONEY use button
	var use2xMoneyButton = game.attachAsset('startButton', {
		anchorX: 0.5,
		anchorY: 0.5
	});
	use2xMoneyButton.x = 1024;
	use2xMoneyButton.y = 1500;
	var use2xMoneyButtonText = new Text2('2X MONEY (' + doubleMoneyLevelsLeft + ')', {
		size: 35,
		fill: '#FFFFFF'
	});
	use2xMoneyButtonText.anchor.set(0.5, 0.5);
	use2xMoneyButtonText.x = 1024;
	use2xMoneyButtonText.y = 1500;
	game.addChild(use2xMoneyButtonText);
	sellUIElements.push(sellBackButton, sellBackButtonText, use2xMoneyButton, use2xMoneyButtonText);
	// Calculate total value
	var totalValue = 0;
	for (var i = 0; i < playerInventory.length; i++) {
		var fossilValue = fossilValues[playerInventory[i]];
		if (doubleValueActive) {
			fossilValue *= 2;
		}
		totalValue += fossilValue;
	}
	var totalValueText = new Text2('Total Value: ' + totalValue + ' coins', {
		size: 50,
		fill: '#FFD700'
	});
	totalValueText.anchor.set(0.5, 0.5);
	totalValueText.x = 1024;
	totalValueText.y = 300;
	game.addChild(totalValueText);
	sellUIElements.push(totalValueText);
	sellAllButton.down = function () {
		playerCoins += totalValue;
		playerInventory = [];
		// Reset 2X VALUE effect after use
		if (doubleValueActive) {
			doubleValueActive = false;
			storage.doubleValueActive = doubleValueActive;
		}
		storage.playerCoins = playerCoins;
		storage.playerInventory = playerInventory;
		hideSell();
	};
	use2xMoneyButton.down = function () {
		if (doubleMoneyLevelsLeft > 0) {
			// Activate 2X MONEY effect for selling
			doubleValueActive = true;
			storage.doubleValueActive = doubleValueActive;
			// Update button text to show remaining uses
			use2xMoneyButtonText.setText('2X MONEY (' + doubleMoneyLevelsLeft + ')');
			// Recalculate and update total value display
			var newTotalValue = 0;
			for (var i = 0; i < playerInventory.length; i++) {
				var fossilValue = fossilValues[playerInventory[i]];
				if (doubleValueActive) {
					fossilValue *= 2;
				}
				newTotalValue += fossilValue;
			}
			totalValueText.setText('Total Value: ' + newTotalValue + ' coins');
		}
	};
	sellBackButton.down = function () {
		hideSell();
	};
}
function hideSell() {
	gameState = 'nickname';
	// Remove all sell UI elements
	hideAllSellUI();
	// Restore menu UI elements
	showAllMenuUI();
	coinsText.setText('Coins: ' + playerCoins);
}
function showShop() {
	gameState = 'shop';
	// Hide all menu and game UI elements
	hideAllMenuUI();
	hideAllGameUI();
	// Create shop display
	var shopTitle = new Text2('POWER-UP SHOP', {
		size: 80,
		fill: '#FFFFFF'
	});
	shopTitle.anchor.set(0.5, 0.5);
	shopTitle.x = 1024;
	shopTitle.y = 200;
	game.addChild(shopTitle);
	storeUIElements.push(shopTitle);
	// XRAY Power-up
	var xrayButton = game.attachAsset('purchaseButton', {
		anchorX: 0.5,
		anchorY: 0.5
	});
	xrayButton.x = 1024;
	xrayButton.y = 400;
	var xrayText = new Text2('XRAY - 500 Coins\nReveals all fossils for 1 level', {
		size: 35,
		fill: '#FFFFFF'
	});
	xrayText.anchor.set(0.5, 0.5);
	xrayText.x = 1024;
	xrayText.y = 400;
	// 2X MONEY Power-up
	var doubleMoneyButton = game.attachAsset('purchaseButton', {
		anchorX: 0.5,
		anchorY: 0.5
	});
	doubleMoneyButton.x = 1024;
	doubleMoneyButton.y = 550;
	var doubleMoneyText = new Text2('2X MONEY - 10000 Coins\nDouble money for 20 levels', {
		size: 35,
		fill: '#FFFFFF'
	});
	doubleMoneyText.anchor.set(0.5, 0.5);
	doubleMoneyText.x = 1024;
	doubleMoneyText.y = 550;
	// 2X VALUE Power-up
	var doubleValueButton = game.attachAsset('purchaseButton', {
		anchorX: 0.5,
		anchorY: 0.5
	});
	doubleValueButton.x = 1024;
	doubleValueButton.y = 700;
	var doubleValueText = new Text2('2X LUCK - 1250 Coins\nDouble egg chances', {
		size: 35,
		fill: '#FFFFFF'
	});
	doubleValueText.anchor.set(0.5, 0.5);
	doubleValueText.x = 1024;
	doubleValueText.y = 700;
	// Common Egg
	var commonEggButton = game.attachAsset('purchaseButton', {
		anchorX: 0.5,
		anchorY: 0.5
	});
	commonEggButton.x = 1024;
	commonEggButton.y = 1400;
	var commonEggText = new Text2('Sıradan Yumurta - 500 Coins\nCommon fossil guaranteed', {
		size: 35,
		fill: '#FFFFFF'
	});
	commonEggText.anchor.set(0.5, 0.5);
	commonEggText.x = 1024;
	commonEggText.y = 1400;
	// Common Egg Info Button
	var commonEggInfoButton = new Text2('❗', {
		size: 60,
		fill: '#FFD700'
	});
	commonEggInfoButton.anchor.set(0.5, 0.5);
	commonEggInfoButton.x = 1350;
	commonEggInfoButton.y = 1400;
	game.addChild(commonEggInfoButton);
	// Rare Egg
	var rareEggButton = game.attachAsset('purchaseButton', {
		anchorX: 0.5,
		anchorY: 0.5
	});
	rareEggButton.x = 1024;
	rareEggButton.y = 1550;
	var rareEggText = new Text2('Nadir Yumurta - 2000 Coins\nRare fossil guaranteed', {
		size: 35,
		fill: '#FFD700'
	});
	rareEggText.anchor.set(0.5, 0.5);
	rareEggText.x = 1024;
	rareEggText.y = 1550;
	// Rare Egg Info Button
	var rareEggInfoButton = new Text2('❗', {
		size: 60,
		fill: '#FFD700'
	});
	rareEggInfoButton.anchor.set(0.5, 0.5);
	rareEggInfoButton.x = 1350;
	rareEggInfoButton.y = 1550;
	game.addChild(rareEggInfoButton);
	// Legendary Egg
	var legendaryEggButton = game.attachAsset('purchaseButton', {
		anchorX: 0.5,
		anchorY: 0.5
	});
	legendaryEggButton.x = 1024;
	legendaryEggButton.y = 1700;
	var legendaryEggText = new Text2('Destansı - 10000 Coins\nLegendary guaranteed', {
		size: 35,
		fill: '#FF69B4'
	});
	legendaryEggText.anchor.set(0.5, 0.5);
	legendaryEggText.x = 1024;
	legendaryEggText.y = 1700;
	// Legendary Egg Info Button
	var legendaryEggInfoButton = new Text2('❗', {
		size: 60,
		fill: '#FFD700'
	});
	legendaryEggInfoButton.anchor.set(0.5, 0.5);
	legendaryEggInfoButton.x = 1350;
	legendaryEggInfoButton.y = 1700;
	game.addChild(legendaryEggInfoButton);
	// FEED button to navigate to food section
	var feedSectionButton = game.attachAsset('startButton', {
		anchorX: 0.5,
		anchorY: 0.5
	});
	feedSectionButton.x = 1024;
	feedSectionButton.y = 1000;
	var feedSectionButtonText = new Text2('FEED', {
		size: 35,
		fill: '#FFFFFF'
	});
	feedSectionButtonText.anchor.set(0.5, 0.5);
	feedSectionButtonText.x = 1024;
	feedSectionButtonText.y = 1000;
	// Back button
	var shopBackButton = game.attachAsset('startButton', {
		anchorX: 0.5,
		anchorY: 0.5
	});
	shopBackButton.x = 1024;
	shopBackButton.y = 1150;
	var shopBackButtonText = new Text2('BACK', {
		size: 35,
		fill: '#FFFFFF'
	});
	shopBackButtonText.anchor.set(0.5, 0.5);
	shopBackButtonText.x = 1024;
	shopBackButtonText.y = 1120;
	game.addChild(xrayText);
	game.addChild(doubleMoneyText);
	game.addChild(doubleValueText);
	game.addChild(commonEggText);
	game.addChild(rareEggText);
	game.addChild(legendaryEggText);
	game.addChild(feedSectionButtonText);
	game.addChild(shopBackButtonText);
	storeUIElements.push(xrayButton, xrayText, doubleMoneyButton, doubleMoneyText, doubleValueButton, doubleValueText, commonEggButton, commonEggText, commonEggInfoButton, rareEggButton, rareEggText, rareEggInfoButton, legendaryEggButton, legendaryEggText, legendaryEggInfoButton, feedSectionButton, feedSectionButtonText, shopBackButton, shopBackButtonText);
	// Purchase handlers
	xrayButton.down = function () {
		if (playerCoins >= 500) {
			playerCoins -= 500;
			storage.playerCoins = playerCoins;
			xrayLevelsLeft++;
			storage.xrayLevelsLeft = xrayLevelsLeft;
			hideShop();
		}
	};
	doubleMoneyButton.down = function () {
		if (playerCoins >= 10000) {
			playerCoins -= 10000;
			storage.playerCoins = playerCoins;
			doubleMoneyLevelsLeft += 20;
			storage.doubleMoneyLevelsLeft = doubleMoneyLevelsLeft;
			hideShop();
		}
	};
	doubleValueButton.down = function () {
		if (playerCoins >= 1250) {
			playerCoins -= 1250;
			storage.playerCoins = playerCoins;
			doubleSpawnChanceActive = true;
			storage.doubleSpawnChanceActive = doubleSpawnChanceActive;
			hideShop();
		}
	};
	// Common egg info handler
	commonEggInfoButton.down = function () {
		showCommonEggInfo();
	};
	// Egg purchase handlers
	commonEggButton.down = function () {
		if (playerCoins >= 500) {
			playerCoins -= 500;
			storage.playerCoins = playerCoins;
			// Open common egg and get dinosaur
			var dinosaurName = openEgg('common');
		}
	};
	// Rare egg info handler
	rareEggInfoButton.down = function () {
		showRareEggInfo();
	};
	rareEggButton.down = function () {
		if (playerCoins >= 2000) {
			playerCoins -= 2000;
			storage.playerCoins = playerCoins;
			// Open rare egg and get dinosaur
			var dinosaurName = openEgg('rare');
		}
	};
	// Legendary egg info handler
	legendaryEggInfoButton.down = function () {
		showLegendaryEggInfo();
	};
	legendaryEggButton.down = function () {
		if (playerCoins >= 10000) {
			playerCoins -= 10000;
			storage.playerCoins = playerCoins;
			// Open legendary egg and get dinosaur
			var dinosaurName = openEgg('legendary');
		}
	};
	// FEED button click handler - navigate to food section
	feedSectionButton.down = function () {
		showFeedSection();
	};
	shopBackButton.down = function () {
		hideShop();
	};
}
function showFeedSection() {
	gameState = 'feed';
	// Hide all shop UI elements
	hideAllStoreUI();
	// Create feed section display
	var feedTitle = new Text2('DİNOZOR YİYECEKLERİ', {
		size: 80,
		fill: '#FFFFFF'
	});
	feedTitle.anchor.set(0.5, 0.5);
	feedTitle.x = 1024;
	feedTitle.y = 200;
	game.addChild(feedTitle);
	storeUIElements.push(feedTitle);
	// Dinosaur Food Items
	var leafFoodButton = game.attachAsset('purchaseButton', {
		anchorX: 0.5,
		anchorY: 0.5
	});
	leafFoodButton.x = 1024;
	leafFoodButton.y = 400;
	var leafFoodText = new Text2('Yaprak Paketi - 250 Coins\n5 adet yaprak (Otçul dinozorlar)', {
		size: 35,
		fill: '#FFFFFF'
	});
	leafFoodText.anchor.set(0.5, 0.5);
	leafFoodText.x = 1024;
	leafFoodText.y = 400;
	var meatFoodButton = game.attachAsset('purchaseButton', {
		anchorX: 0.5,
		anchorY: 0.5
	});
	meatFoodButton.x = 1024;
	meatFoodButton.y = 550;
	var meatFoodText = new Text2('Et Paketi - 400 Coins\n5 adet et (Etçil dinozorlar)', {
		size: 35,
		fill: '#FFFFFF'
	});
	meatFoodText.anchor.set(0.5, 0.5);
	meatFoodText.x = 1024;
	meatFoodText.y = 550;
	var fishFoodButton = game.attachAsset('purchaseButton', {
		anchorX: 0.5,
		anchorY: 0.5
	});
	fishFoodButton.x = 1024;
	fishFoodButton.y = 700;
	var fishFoodText = new Text2('Balık Paketi - 300 Coins\n5 adet balık (Balık yiyen dinozorlar)', {
		size: 35,
		fill: '#FFFFFF'
	});
	fishFoodText.anchor.set(0.5, 0.5);
	fishFoodText.x = 1024;
	fishFoodText.y = 700;
	// Back to shop button
	var backToShopButton = game.attachAsset('startButton', {
		anchorX: 0.5,
		anchorY: 0.5
	});
	backToShopButton.x = 1024;
	backToShopButton.y = 850;
	var backToShopButtonText = new Text2('SHOP\'A GERİ DÖN', {
		size: 35,
		fill: '#FFFFFF'
	});
	backToShopButtonText.anchor.set(0.5, 0.5);
	backToShopButton.x = 1024;
	backToShopButton.y = 850;
	game.addChild(leafFoodText);
	game.addChild(meatFoodText);
	game.addChild(fishFoodText);
	game.addChild(backToShopButtonText);
	storeUIElements.push(leafFoodButton, leafFoodText, meatFoodButton, meatFoodText, fishFoodButton, fishFoodText, backToShopButton, backToShopButtonText);
	// Food purchase handlers
	leafFoodButton.down = function () {
		if (playerCoins >= 250) {
			playerCoins -= 250;
			storage.playerCoins = playerCoins;
			// Add 5 leaf food to inventory
			leafFood += 5;
			storage.leafFood = leafFood;
			hideFeedSection();
		}
	};
	meatFoodButton.down = function () {
		if (playerCoins >= 400) {
			playerCoins -= 400;
			storage.playerCoins = playerCoins;
			// Add 5 meat food to inventory
			meatFood += 5;
			storage.meatFood = meatFood;
			hideFeedSection();
		}
	};
	fishFoodButton.down = function () {
		if (playerCoins >= 300) {
			playerCoins -= 300;
			storage.playerCoins = playerCoins;
			// Add 5 fish food to inventory
			fishFood += 5;
			storage.fishFood = fishFood;
			hideFeedSection();
		}
	};
	backToShopButton.down = function () {
		hideFeedSection();
		showShop();
	};
}
function hideFeedSection() {
	gameState = 'nickname';
	// Remove all feed UI elements
	hideAllStoreUI();
	// Restore menu UI elements
	showAllMenuUI();
	coinsText.setText('Coins: ' + playerCoins);
}
function hideShop() {
	gameState = 'nickname';
	// Remove all shop UI elements
	hideAllStoreUI();
	// Restore menu UI elements
	showAllMenuUI();
	coinsText.setText('Coins: ' + playerCoins);
}
function showBag() {
	gameState = 'bag';
	// Check hunger status when opening bag
	checkDinosaurHunger();
	// Hide all menu and game UI elements
	hideAllMenuUI();
	hideAllGameUI();
	// Create bag display
	var bagTitle = new Text2('DINOSAUR BAG', {
		size: 80,
		fill: '#FFFFFF'
	});
	bagTitle.anchor.set(0.5, 0.5);
	bagTitle.x = 1024;
	bagTitle.y = 200;
	game.addChild(bagTitle);
	bagUIElements.push(bagTitle);
	// Calculate vomit limit (1 base slot only)
	var maxVomitSlots = 1;
	var vomitText = new Text2('Select Slots: ' + maxVomitSlots + ' available', {
		size: 35,
		fill: '#FFD700'
	});
	vomitText.anchor.set(0.5, 0.5);
	vomitText.x = 1024;
	vomitText.y = 280;
	game.addChild(vomitText);
	// Add coins display in bag
	var bagCoinsText = new Text2('Para: ' + playerCoins + ' coin', {
		size: 35,
		fill: '#FFD700'
	});
	bagCoinsText.anchor.set(0.5, 0.5);
	bagCoinsText.x = 1024;
	bagCoinsText.y = 320;
	game.addChild(bagCoinsText);
	// Add food inventory display
	var foodInventoryText = new Text2('Yiyecekler: Yaprak(' + leafFood + ') Et(' + meatFood + ') Balık(' + fishFood + ')', {
		size: 30,
		fill: '#32CD32'
	});
	foodInventoryText.anchor.set(0.5, 0.5);
	foodInventoryText.x = 1024;
	foodInventoryText.y = 360;
	game.addChild(foodInventoryText);
	bagUIElements.push(vomitText, bagCoinsText, foodInventoryText);
	// Get selected dinosaurs
	var selectedDinosaurs = [];
	if (storage.selectedDinosaurs && Array.isArray(storage.selectedDinosaurs)) {
		selectedDinosaurs = storage.selectedDinosaurs;
	} else if (selectedDinosaur) {
		selectedDinosaurs = [selectedDinosaur];
	}
	// Sort dinosaurs by rarity
	var chromaticDinos = [];
	var legendaryDinos = [];
	var rareDinos = [];
	var commonDinos = [];
	for (var i = 0; i < dinosaurCollection.length; i++) {
		var dino = dinosaurCollection[i];
		var rarity = dinosaurRarities[dino];
		if (rarity === 'chromatic') {
			chromaticDinos.push(dino);
		} else if (rarity === 'legendary') {
			legendaryDinos.push(dino);
		} else if (rarity === 'rare') {
			rareDinos.push(dino);
		} else {
			commonDinos.push(dino);
		}
	}
	var allDinos = chromaticDinos.concat(legendaryDinos).concat(rareDinos).concat(commonDinos);
	// Reorder dinosaurs to show selected ones at the bottom
	var unselectedDinos = [];
	var selectedDinosForDisplay = [];
	for (var k = 0; k < allDinos.length; k++) {
		if (selectedDinosaurs.indexOf(allDinos[k]) !== -1) {
			selectedDinosForDisplay.push(allDinos[k]);
		} else {
			unselectedDinos.push(allDinos[k]);
		}
	}
	var orderedDinos = unselectedDinos.concat(selectedDinosForDisplay);
	// Display all dinosaurs - unlimited storage, but limited vomit selection
	var startY = 350;
	var itemSpacing = 120; // Increased spacing between dinosaur entries
	for (var j = 0; j < orderedDinos.length; j++) {
		var dinoName = orderedDinos[j];
		var rarity = dinosaurRarities[dinoName];
		var color = '#87CEEB'; // Light blue for common/regular dinosaurs
		if (rarity === 'chromatic') color = getRandomColor(); // Rainbow for chromatic
		else if (rarity === 'legendary') color = '#FF0000'; // Red for legendary
		else if (rarity === 'rare') color = '#800080'; // Purple for rare  
		else if (rarity === 'common') color = '#00008B'; // Dark blue for common
		var isSelected = selectedDinosaurs.indexOf(dinoName) !== -1;
		var displayText = dinoName + ' (' + rarity + ')' + (isSelected ? ' [SELECTED]' : '');
		var dinoButton = game.attachAsset('startButton', {
			anchorX: 0.5,
			anchorY: 0.5
		});
		dinoButton.x = 1024;
		dinoButton.y = startY + j * itemSpacing;
		// Add dinosaur image
		var dinoImage = new DinosaurImage(dinoName);
		dinoImage.x = 700;
		dinoImage.y = startY + j * itemSpacing;
		dinoImage.scaleX = 0.8;
		dinoImage.scaleY = 0.8;
		game.addChild(dinoImage);
		bagUIElements.push(dinoImage);
		var dinoText = new Text2(displayText, {
			size: 35,
			fill: isSelected ? '#000000' : color
		});
		dinoText.anchor.set(0.5, 0.5);
		dinoText.x = 1024;
		dinoText.y = startY + j * itemSpacing;
		game.addChild(dinoText);
		// Add hunger status and feeding button
		var hungerStatus = getHungerStatus(dinoName);
		var hungerText = getHungerText(hungerStatus);
		var hungerColor = getHungerColor(hungerStatus);
		var hungerDisplay = new Text2(hungerText, {
			size: 25,
			fill: hungerColor
		});
		hungerDisplay.anchor.set(0.5, 0.5);
		hungerDisplay.x = 1024;
		hungerDisplay.y = startY + j * itemSpacing + 30;
		game.addChild(hungerDisplay);
		// Add feed button
		var feedButton = game.attachAsset('startButton', {
			anchorX: 0.5,
			anchorY: 0.5
		});
		feedButton.x = 1400;
		feedButton.y = startY + j * itemSpacing;
		feedButton.scaleX = 0.6;
		feedButton.scaleY = 0.6;
		// Get required food type and check availability
		var diet = dinosaurDiets[dinoName];
		var foodText = '';
		var hasRequiredFood = false;
		if (diet === 'leaf') {
			foodText = 'YAPRAK\n' + leafFood;
			hasRequiredFood = leafFood > 0;
		} else if (diet === 'meat') {
			foodText = 'ET\n' + meatFood;
			hasRequiredFood = meatFood > 0;
		} else if (diet === 'fish') {
			foodText = 'BALIK\n' + fishFood;
			hasRequiredFood = fishFood > 0;
		}
		if (!hasRequiredFood) {
			feedButton.alpha = 0.5;
		}
		var feedButtonText = new Text2(foodText, {
			size: 20,
			fill: hasRequiredFood ? '#FFFFFF' : '#888888'
		});
		feedButtonText.anchor.set(0.5, 0.5);
		feedButtonText.x = 1400;
		feedButtonText.y = startY + j * itemSpacing;
		game.addChild(feedButtonText);
		bagUIElements.push(dinoButton, dinoText, hungerDisplay, feedButton, feedButtonText);
		// Create closure for feeding
		(function (dinosaurName, feedingCost) {
			feedButton.down = function () {
				if (feedDinosaur(dinosaurName)) {
					// Refresh bag display to update hunger status and coins
					hideBag();
					showBag();
				}
			};
		})(dinoName, feedingCosts[dinoName]);
		// Create closure for selection - check vomit limit
		(function (dinosaurName) {
			dinoButton.down = function () {
				var currentIndex = selectedDinosaurs.indexOf(dinosaurName);
				if (currentIndex !== -1) {
					// Remove from selection
					selectedDinosaurs.splice(currentIndex, 1);
				} else {
					// Check if player can select dinosaurs - everyone gets 1 base slot only
					// If at selection limit, replace the first selected dinosaur
					if (selectedDinosaurs.length >= maxVomitSlots) {
						selectedDinosaurs.shift(); // Remove first selected dinosaur
					}
					selectedDinosaurs.push(dinosaurName); // Add new selection
				}
				// Update storage and backward compatibility
				storage.selectedDinosaurs = selectedDinosaurs;
				if (selectedDinosaurs.length > 0) {
					selectedDinosaur = selectedDinosaurs[0]; // Keep backward compatibility
					storage.selectedDinosaur = selectedDinosaur;
				} else {
					selectedDinosaur = null;
					storage.selectedDinosaur = null;
				}
				hideBag();
				showBag(); // Refresh to show selected at bottom
			};
		})(dinoName);
	}
	// Back button
	// Delete button
	var deleteButton = game.attachAsset('deleteButton', {
		anchorX: 0.5,
		anchorY: 0.5
	});
	deleteButton.x = 700;
	deleteButton.y = startY + orderedDinos.length * itemSpacing + 50;
	var deleteButtonText = new Text2('DELETE', {
		size: 35,
		fill: '#FFFFFF'
	});
	deleteButtonText.anchor.set(0.5, 0.5);
	deleteButtonText.x = 700;
	deleteButtonText.y = startY + orderedDinos.length * itemSpacing + 50;
	game.addChild(deleteButtonText);
	bagUIElements.push(deleteButton, deleteButtonText);
	var bagBackButton = game.attachAsset('startButton', {
		anchorX: 0.5,
		anchorY: 0.5
	});
	bagBackButton.x = 1348;
	bagBackButton.y = startY + orderedDinos.length * itemSpacing + 50;
	var bagBackButtonText = new Text2('BACK', {
		size: 35,
		fill: '#FFFFFF'
	});
	bagBackButtonText.anchor.set(0.5, 0.5);
	bagBackButtonText.x = 1348;
	bagBackButtonText.y = startY + orderedDinos.length * itemSpacing + 50;
	game.addChild(bagBackButtonText);
	bagUIElements.push(bagBackButton, bagBackButtonText);
	// Delete button handler
	deleteButton.down = function () {
		showDeleteMode();
	};
	bagBackButton.down = function () {
		hideBag();
	};
}
function showDeleteMode() {
	gameState = 'deleteMode';
	// Hide current bag UI
	hideAllBagUI();
	// Create delete mode display
	var deleteTitle = new Text2('DELETE DINOSAURS', {
		size: 80,
		fill: '#FF4444'
	});
	deleteTitle.anchor.set(0.5, 0.5);
	deleteTitle.x = 1024;
	deleteTitle.y = 200;
	game.addChild(deleteTitle);
	bagUIElements.push(deleteTitle);
	var deleteInstructionText = new Text2('Select dinosaurs to delete:', {
		size: 50,
		fill: '#FFFFFF'
	});
	deleteInstructionText.anchor.set(0.5, 0.5);
	deleteInstructionText.x = 1024;
	deleteInstructionText.y = 280;
	game.addChild(deleteInstructionText);
	bagUIElements.push(deleteInstructionText);
	// Sort dinosaurs by rarity for display
	var legendaryDinos = [];
	var rareDinos = [];
	var commonDinos = [];
	for (var i = 0; i < dinosaurCollection.length; i++) {
		var dino = dinosaurCollection[i];
		var rarity = dinosaurRarities[dino];
		if (rarity === 'legendary') {
			legendaryDinos.push(dino);
		} else if (rarity === 'rare') {
			rareDinos.push(dino);
		} else {
			commonDinos.push(dino);
		}
	}
	var allDinos = legendaryDinos.concat(rareDinos).concat(commonDinos);
	// Track selected dinosaurs for deletion
	var selectedForDeletion = [];
	// Display all dinosaurs with delete option
	var startY = 350;
	var itemSpacing = 120; // Increased spacing between dinosaur entries
	for (var j = 0; j < allDinos.length; j++) {
		var dinoName = allDinos[j];
		var rarity = dinosaurRarities[dinoName];
		var color = '#87CEEB'; // Light blue for common/regular dinosaurs
		if (rarity === 'legendary') color = '#FF0000'; // Red for legendary
		else if (rarity === 'rare') color = '#800080'; // Purple for rare
		else if (rarity === 'common') color = '#00008B'; // Dark blue for common
		var isSelectedForDeletion = selectedForDeletion.indexOf(dinoName) !== -1;
		var displayText = dinoName + ' (' + rarity + ')' + (isSelectedForDeletion ? ' [TO DELETE]' : '');
		var dinoButton = game.attachAsset('startButton', {
			anchorX: 0.5,
			anchorY: 0.5
		});
		dinoButton.x = 1024;
		dinoButton.y = startY + j * itemSpacing;
		var dinoText = new Text2(displayText, {
			size: 35,
			fill: isSelectedForDeletion ? '#FF4444' : color
		});
		dinoText.anchor.set(0.5, 0.5);
		dinoText.x = 1024;
		dinoText.y = startY + j * itemSpacing;
		game.addChild(dinoText);
		bagUIElements.push(dinoButton, dinoText);
		// Create closure for selection toggle
		(function (dinosaurName, textElement) {
			dinoButton.down = function () {
				var index = selectedForDeletion.indexOf(dinosaurName);
				if (index === -1) {
					// Add to deletion list
					selectedForDeletion.push(dinosaurName);
					textElement.setText(dinosaurName + ' (' + dinosaurRarities[dinosaurName] + ') [TO DELETE]');
					textElement.fill = '#FF4444';
				} else {
					// Remove from deletion list
					selectedForDeletion.splice(index, 1);
					var rarity = dinosaurRarities[dinosaurName];
					var color = '#87CEEB'; // Light blue for common/regular dinosaurs
					if (rarity === 'legendary') color = '#FF0000'; // Red for legendary
					else if (rarity === 'rare') color = '#800080'; // Purple for rare
					else if (rarity === 'common') color = '#00008B'; // Dark blue for common
					textElement.setText(dinosaurName + ' (' + rarity + ')');
					textElement.fill = color;
				}
			};
		})(dinoName, dinoText);
	}
	// Confirm delete button
	var confirmDeleteButton = game.attachAsset('deleteButton', {
		anchorX: 0.5,
		anchorY: 0.5
	});
	confirmDeleteButton.x = 700;
	confirmDeleteButton.y = startY + allDinos.length * itemSpacing + 50;
	var confirmDeleteText = new Text2('CONFIRM DELETE', {
		size: 30,
		fill: '#FFFFFF'
	});
	confirmDeleteText.anchor.set(0.5, 0.5);
	confirmDeleteText.x = 700;
	confirmDeleteText.y = startY + allDinos.length * itemSpacing + 50;
	game.addChild(confirmDeleteText);
	bagUIElements.push(confirmDeleteButton, confirmDeleteText);
	// Cancel delete button
	var cancelDeleteButton = game.attachAsset('startButton', {
		anchorX: 0.5,
		anchorY: 0.5
	});
	cancelDeleteButton.x = 1348;
	cancelDeleteButton.y = startY + allDinos.length * itemSpacing + 50;
	var cancelDeleteText = new Text2('CANCEL', {
		size: 35,
		fill: '#FFFFFF'
	});
	cancelDeleteText.anchor.set(0.5, 0.5);
	cancelDeleteText.x = 1348;
	cancelDeleteText.y = startY + allDinos.length * itemSpacing + 50;
	game.addChild(cancelDeleteText);
	bagUIElements.push(cancelDeleteButton, cancelDeleteText);
	// Event handlers
	confirmDeleteButton.down = function () {
		// Remove selected dinosaurs from collection
		for (var i = 0; i < selectedForDeletion.length; i++) {
			var dinoToDelete = selectedForDeletion[i];
			var index = dinosaurCollection.indexOf(dinoToDelete);
			if (index !== -1) {
				dinosaurCollection.splice(index, 1);
				// If deleted dinosaur was selected, clear selection
				if (selectedDinosaur === dinoToDelete) {
					selectedDinosaur = null;
					storage.selectedDinosaur = null;
				}
			}
		}
		// Save updated collection
		storage.dinosaurCollection = dinosaurCollection;
		// Return to bag view
		hideAllBagUI();
		showBag();
	};
	cancelDeleteButton.down = function () {
		// Return to bag view without deleting
		hideAllBagUI();
		showBag();
	};
}
function hideBag() {
	gameState = 'nickname';
	// Remove all bag UI elements
	hideAllBagUI();
	// Restore menu UI elements
	showAllMenuUI();
}
function showCommonEggInfo() {
	gameState = 'commonEggInfo';
	// Hide all shop UI elements
	hideAllStoreUI();
	// Create info display
	var infoTitle = new Text2('SIRADAN YUMURTA İÇERİĞİ', {
		size: 60,
		fill: '#FFFFFF'
	});
	infoTitle.anchor.set(0.5, 0.5);
	infoTitle.x = 1024;
	infoTitle.y = 200;
	game.addChild(infoTitle);
	infoUIElements.push(infoTitle);
	var infoText = 'PARASOUROLUPHUS - %33.33\n';
	infoText += 'Yavaş kazma (1 saniye gecikme)\n\n';
	infoText += 'PYTHEREDON - %33.33\n';
	infoText += 'Seviye başı sadece 1 fosil alır\n\n';
	infoText += 'DIMETRODON - %33.33\n';
	infoText += 'Nadirlık fark etmez 2 fosil alır';
	var infoDisplay = new Text2(infoText, {
		size: 40,
		fill: '#FFFFFF'
	});
	infoDisplay.anchor.set(0.5, 0.5);
	infoDisplay.x = 1024;
	infoDisplay.y = 600;
	game.addChild(infoDisplay);
	infoUIElements.push(infoDisplay);
	var backButton = game.attachAsset('startButton', {
		anchorX: 0.5,
		anchorY: 0.5
	});
	backButton.x = 1024;
	backButton.y = 1200;
	var backButtonText = new Text2('BACK', {
		size: 35,
		fill: '#FFFFFF'
	});
	backButtonText.anchor.set(0.5, 0.5);
	backButtonText.x = 1024;
	backButtonText.y = 1200;
	game.addChild(backButtonText);
	infoUIElements.push(backButton, backButtonText);
	backButton.down = function () {
		hideInfoScreen();
		showShop();
	};
}
function showRareEggInfo() {
	gameState = 'rareEggInfo';
	// Hide all shop UI elements
	hideAllStoreUI();
	// Create info display
	var infoTitle = new Text2('NADİR YUMURTA İÇERİĞİ', {
		size: 60,
		fill: '#FFFFFF'
	});
	infoTitle.anchor.set(0.5, 0.5);
	infoTitle.x = 1024;
	infoTitle.y = 200;
	game.addChild(infoTitle);
	infoUIElements.push(infoTitle);
	var infoText = 'BARYONYX - %45\n';
	infoText += '0.2x daha hızlı kaya kazma\n\n';
	infoText += 'ALLO - %35\n';
	infoText += '0.4x daha hızlı kaya kazma\n\n';
	infoText += 'YUTY - %20\n';
	infoText += '0.7x daha hızlı kaya kazma';
	var infoDisplay = new Text2(infoText, {
		size: 40,
		fill: '#FFFFFF'
	});
	infoDisplay.anchor.set(0.5, 0.5);
	infoDisplay.x = 1024;
	infoDisplay.y = 600;
	game.addChild(infoDisplay);
	infoUIElements.push(infoDisplay);
	var backButton = game.attachAsset('startButton', {
		anchorX: 0.5,
		anchorY: 0.5
	});
	backButton.x = 1024;
	backButton.y = 1200;
	var backButtonText = new Text2('BACK', {
		size: 35,
		fill: '#FFFFFF'
	});
	backButtonText.anchor.set(0.5, 0.5);
	backButtonText.x = 1024;
	backButtonText.y = 1200;
	game.addChild(backButtonText);
	infoUIElements.push(backButton, backButtonText);
	backButton.down = function () {
		hideInfoScreen();
		showShop();
	};
}
function showLegendaryEggInfo() {
	gameState = 'legendaryEggInfo';
	// Hide all shop UI elements
	hideAllStoreUI();
	// Create info display
	var infoTitle = new Text2('DESTANSI YUMURTA İÇERİĞİ', {
		size: 60,
		fill: '#FFFFFF'
	});
	infoTitle.anchor.set(0.5, 0.5);
	infoTitle.x = 1024;
	infoTitle.y = 200;
	game.addChild(infoTitle);
	infoUIElements.push(infoTitle);
	var infoText = 'TREX - %3 (Chromatic)\n';
	infoText += '??? ??? ???\n\n';
	infoText += 'SPINO - %10\n';
	infoText += '?\n\n';
	infoText += 'GIGA - %15\n';
	infoText += '?\n\n';
	infoText += 'Mutasyonlu BARYONYX - %25\n';
	infoText += '?\n\n';
	infoText += 'Mutasyonlu DIMETRODON - %17\n';
	infoText += '?\n\n';
	infoText += 'Mutasyonlu PARASAUROLUPHUS - %30\n';
	infoText += '?';
	// Add animated color-changing question marks for TREX ability
	var trexQuestionMarks = [];
	for (var q = 0; q < 3; q++) {
		var questionMark = new Text2('?', {
			size: 40,
			fill: getRandomColor()
		});
		questionMark.anchor.set(0.5, 0.5);
		questionMark.x = 950 + q * 40;
		questionMark.y = 450;
		game.addChild(questionMark);
		infoUIElements.push(questionMark);
		trexQuestionMarks.push(questionMark);
	}
	// Animate color changes for question marks
	var colorChangeTimer = LK.setInterval(function () {
		for (var i = 0; i < trexQuestionMarks.length; i++) {
			tween(trexQuestionMarks[i], {
				fill: getRandomColor()
			}, {
				duration: 500
			});
		}
	}, 600);
	// Store timer reference to clear it when hiding info screen
	infoUIElements.colorChangeTimer = colorChangeTimer;
	var infoDisplay = new Text2(infoText, {
		size: 30,
		fill: '#FFFFFF'
	});
	infoDisplay.anchor.set(0.5, 0.5);
	infoDisplay.x = 1024;
	infoDisplay.y = 700;
	game.addChild(infoDisplay);
	infoUIElements.push(infoDisplay);
	var backButton = game.attachAsset('startButton', {
		anchorX: 0.5,
		anchorY: 0.5
	});
	backButton.x = 1024;
	backButton.y = 1200;
	var backButtonText = new Text2('BACK', {
		size: 35,
		fill: '#FFFFFF'
	});
	backButtonText.anchor.set(0.5, 0.5);
	backButtonText.x = 1024;
	backButtonText.y = 1200;
	game.addChild(backButtonText);
	infoUIElements.push(backButton, backButtonText);
	backButton.down = function () {
		hideInfoScreen();
		showShop();
	};
}
function getRandomColor() {
	var colors = ['#FF0000', '#FF7F00', '#FFFF00', '#00FF00', '#0000FF', '#4B0082', '#9400D3'];
	return colors[Math.floor(Math.random() * colors.length)];
}
function hideInfoScreen() {
	// Clear color change timer if it exists
	if (infoUIElements.colorChangeTimer) {
		LK.clearInterval(infoUIElements.colorChangeTimer);
		infoUIElements.colorChangeTimer = null;
	}
	// Remove all info UI elements
	hideAllInfoUI();
}
function hideAllGiftsUI() {
	for (var i = 0; i < giftsUIElements.length; i++) {
		giftsUIElements[i].destroy();
	}
	giftsUIElements = [];
}
function hideAllTradeUI() {
	for (var i = 0; i < tradeUIElements.length; i++) {
		tradeUIElements[i].destroy();
	}
	tradeUIElements = [];
}
function hideAllStockUI() {
	for (var i = 0; i < stockUIElements.length; i++) {
		stockUIElements[i].destroy();
	}
	stockUIElements = [];
}
function checkDailyGift() {
	var currentDate = new Date();
	var today = Math.floor(currentDate.getTime() / (1000 * 60 * 60 * 24)); // Days since epoch
	var lastDate = storage.lastGiftDate || 0;
	if (today > lastDate) {
		// New day - reset gift status only when it's actually a new day
		storage.dailyGiftClaimed = false;
		dailyGiftClaimed = false;
		// Check if it's been more than 1 day - reset streak if so
		if (today > lastDate + 1) {
			storage.currentGiftDay = 1;
			currentGiftDay = 1;
		}
		storage.lastGiftDate = today;
		lastGiftDate = today;
	} else {
		// Same day - load existing gift claimed status from storage
		dailyGiftClaimed = storage.dailyGiftClaimed || false;
	}
}
function checkDailyTrades() {
	var currentDate = new Date();
	var today = Math.floor(currentDate.getTime() / (1000 * 60 * 60 * 24)); // Days since epoch
	var lastDate = storage.lastTradeDate || 0;
	if (today > lastDate) {
		// New day - reset trade count
		storage.dailyTradesLeft = 5;
		dailyTradesLeft = 5;
		storage.lastTradeDate = today;
		lastTradeDate = today;
	}
}
function canStartTrade() {
	checkDailyTrades();
	return dailyTradesLeft > 0;
}
function createTradeOffer(targetPlayer, offeredDinosaurs) {
	if (!canStartTrade() || offeredDinosaurs.length > 4) {
		return false;
	}
	var tradeOffer = {
		fromPlayer: playerNickname,
		toPlayer: targetPlayer,
		offeredDinosaurs: offeredDinosaurs,
		requestedDinosaurs: [],
		status: 'pending'
	};
	storage.currentTradeOffer = tradeOffer;
	currentTradeOffer = tradeOffer;
	return true;
}
function acceptTradeOffer(tradeOffer) {
	if (!canStartTrade()) {
		return false;
	}
	// Execute trade (mock implementation)
	dailyTradesLeft--;
	storage.dailyTradesLeft = dailyTradesLeft;
	// Clear current offer
	storage.currentTradeOffer = null;
	currentTradeOffer = null;
	return true;
}
function showGifts() {
	gameState = 'gifts';
	checkDailyGift();
	// Hide all menu and game UI elements
	hideAllMenuUI();
	hideAllGameUI();
	// Create gifts display
	var giftsTitle = new Text2('GÜNLÜK HEDİYELER', {
		size: 80,
		fill: '#FFFFFF'
	});
	giftsTitle.anchor.set(0.5, 0.5);
	giftsTitle.x = 1024;
	giftsTitle.y = 200;
	game.addChild(giftsTitle);
	giftsUIElements.push(giftsTitle);
	// Show weekly gift calendar
	var weekText = new Text2('Haftalık Döngü - Gün ' + currentGiftDay + '/7', {
		size: 50,
		fill: '#FFD700'
	});
	weekText.anchor.set(0.5, 0.5);
	weekText.x = 1024;
	weekText.y = 300;
	game.addChild(weekText);
	giftsUIElements.push(weekText);
	// Display all 7 days
	for (var day = 1; day <= 7; day++) {
		var dayButton = game.attachAsset('startButton', {
			anchorX: 0.5,
			anchorY: 0.5
		});
		dayButton.x = 200 + (day - 1) * 240;
		dayButton.y = 600;
		var isCurrentDay = day === currentGiftDay;
		var canClaim = isCurrentDay && !dailyGiftClaimed;
		var isPastDay = day < currentGiftDay;
		// Change button color based on status
		if (isPastDay) {
			dayButton.alpha = 0.5; // Already claimed
		} else if (canClaim) {
			dayButton.tint = 0x32CD32; // Green for claimable
		} else {
			dayButton.tint = 0x808080; // Gray for future days
		}
		var dayText = new Text2('Gün ' + day + '\n' + dailyGifts[day - 1] + ' Para', {
			size: 30,
			fill: canClaim ? '#000000' : '#FFFFFF'
		});
		dayText.anchor.set(0.5, 0.5);
		dayText.x = 200 + (day - 1) * 240;
		dayText.y = 600;
		game.addChild(dayText);
		var statusText = new Text2(isPastDay ? 'ALındı' : canClaim ? 'AL!' : 'Bekliyor', {
			size: 25,
			fill: canClaim ? '#000000' : isPastDay ? '#FFD700' : '#CCCCCC'
		});
		statusText.anchor.set(0.5, 0.5);
		statusText.x = 200 + (day - 1) * 240;
		statusText.y = 650;
		game.addChild(statusText);
		giftsUIElements.push(dayButton, dayText, statusText);
		// Add click handler for current day
		if (canClaim) {
			(function (giftAmount, dayNum) {
				dayButton.down = function () {
					// Claim gift
					playerCoins += giftAmount;
					storage.playerCoins = playerCoins;
					// Mark gift as claimed and save to storage immediately
					dailyGiftClaimed = true;
					storage.dailyGiftClaimed = true;
					// Move to next day, reset to 1 after day 7
					if (dayNum >= 7) {
						storage.currentGiftDay = 1;
					} else {
						storage.currentGiftDay = dayNum + 1;
					}
					currentGiftDay = storage.currentGiftDay;
					// Refresh gifts display
					hideGifts();
					showGifts();
				};
			})(dailyGifts[day - 1], day);
		}
	}
	// Back button
	var giftsBackButton = game.attachAsset('startButton', {
		anchorX: 0.5,
		anchorY: 0.5
	});
	giftsBackButton.x = 1024;
	giftsBackButton.y = 1500;
	var giftsBackButtonText = new Text2('BACK', {
		size: 35,
		fill: '#FFFFFF'
	});
	giftsBackButtonText.anchor.set(0.5, 0.5);
	giftsBackButtonText.x = 1024;
	giftsBackButtonText.y = 1500;
	game.addChild(giftsBackButtonText);
	giftsUIElements.push(giftsBackButton, giftsBackButtonText);
	giftsBackButton.down = function () {
		hideGifts();
	};
}
function hideGifts() {
	gameState = 'nickname';
	// Remove all gifts UI elements
	hideAllGiftsUI();
	// Restore menu UI elements
	showAllMenuUI();
	coinsText.setText('Coins: ' + playerCoins);
}
function showTrade() {
	gameState = 'trade';
	// Hide all menu and game UI elements
	hideAllMenuUI();
	hideAllGameUI();
	// Create trade display
	var tradeTitle = new Text2('TİCARET SİSTEMİ', {
		size: 80,
		fill: '#FFFFFF'
	});
	tradeTitle.anchor.set(0.5, 0.5);
	tradeTitle.x = 1024;
	tradeTitle.y = 200;
	game.addChild(tradeTitle);
	tradeUIElements.push(tradeTitle);
	// Coming soon message
	var comingSoonText = new Text2('YAKINDA GELİYOR', {
		size: 80,
		fill: '#FFD700'
	});
	comingSoonText.anchor.set(0.5, 0.5);
	comingSoonText.x = 1024;
	comingSoonText.y = 600;
	game.addChild(comingSoonText);
	tradeUIElements.push(comingSoonText);
	var comingSoonDesc = new Text2('Takas sistemi çok yakında aktif olacak!\nDaha fazla özellik için beklemede kalın.', {
		size: 50,
		fill: '#FFFFFF'
	});
	comingSoonDesc.anchor.set(0.5, 0.5);
	comingSoonDesc.x = 1024;
	comingSoonDesc.y = 800;
	game.addChild(comingSoonDesc);
	tradeUIElements.push(comingSoonDesc);
	// Back button
	var tradeBackButton = game.attachAsset('startButton', {
		anchorX: 0.5,
		anchorY: 0.5
	});
	tradeBackButton.x = 1024;
	tradeBackButton.y = 1500;
	var tradeBackButtonText = new Text2('BACK', {
		size: 35,
		fill: '#FFFFFF'
	});
	tradeBackButtonText.anchor.set(0.5, 0.5);
	tradeBackButtonText.x = 1024;
	tradeBackButtonText.y = 1500;
	game.addChild(tradeBackButtonText);
	tradeUIElements.push(tradeBackButton, tradeBackButtonText);
	tradeBackButton.down = function () {
		hideTrade();
	};
}
function showTradeSetup(targetPlayer) {
	gameState = 'tradeSetup';
	// Hide current trade UI
	hideAllTradeUI();
	// Create trade setup display
	var setupTitle = new Text2('TAKAS KURULUMU: ' + targetPlayer, {
		size: 70,
		fill: '#FFFFFF'
	});
	setupTitle.anchor.set(0.5, 0.5);
	setupTitle.x = 1024;
	setupTitle.y = 200;
	game.addChild(setupTitle);
	tradeUIElements.push(setupTitle);
	var instructionText = new Text2('En fazla 4 dinozor seçebilirsiniz', {
		size: 50,
		fill: '#FFD700'
	});
	instructionText.anchor.set(0.5, 0.5);
	instructionText.x = 1024;
	instructionText.y = 280;
	game.addChild(instructionText);
	tradeUIElements.push(instructionText);
	// Track selected dinosaurs for trade
	var selectedForTrade = [];
	// Display available dinosaurs
	var startY = 400;
	for (var i = 0; i < dinosaurCollection.length; i++) {
		var dinoName = dinosaurCollection[i];
		var rarity = dinosaurRarities[dinoName];
		var color = '#87CEEB';
		if (rarity === 'chromatic') color = getRandomColor();else if (rarity === 'legendary') color = '#FF0000';else if (rarity === 'rare') color = '#800080';else if (rarity === 'common') color = '#00008B';
		var isSelected = selectedForTrade.indexOf(dinoName) !== -1;
		var displayText = dinoName + ' (' + rarity + ')' + (isSelected ? ' [SEÇİLDİ]' : '');
		var dinoButton = game.attachAsset('startButton', {
			anchorX: 0.5,
			anchorY: 0.5
		});
		dinoButton.x = 1024;
		dinoButton.y = startY + i * 80;
		var dinoText = new Text2(displayText, {
			size: 35,
			fill: isSelected ? '#32CD32' : color
		});
		dinoText.anchor.set(0.5, 0.5);
		dinoText.x = 1024;
		dinoText.y = startY + i * 80;
		game.addChild(dinoText);
		tradeUIElements.push(dinoButton, dinoText);
		// Create closure for selection
		(function (dinosaurName, textElement) {
			dinoButton.down = function () {
				var index = selectedForTrade.indexOf(dinosaurName);
				if (index === -1) {
					// Add to selection if under limit
					if (selectedForTrade.length < 4) {
						selectedForTrade.push(dinosaurName);
						textElement.setText(dinosaurName + ' (' + dinosaurRarities[dinosaurName] + ') [SEÇİLDİ]');
						textElement.fill = '#32CD32';
					}
				} else {
					// Remove from selection
					selectedForTrade.splice(index, 1);
					var rarity = dinosaurRarities[dinosaurName];
					var color = '#87CEEB';
					if (rarity === 'chromatic') color = getRandomColor();else if (rarity === 'legendary') color = '#FF0000';else if (rarity === 'rare') color = '#800080';else if (rarity === 'common') color = '#00008B';
					textElement.setText(dinosaurName + ' (' + rarity + ')');
					textElement.fill = color;
				}
			};
		})(dinoName, dinoText);
	}
	// Send trade request button
	var sendRequestButton = game.attachAsset('purchaseButton', {
		anchorX: 0.5,
		anchorY: 0.5
	});
	sendRequestButton.x = 700;
	sendRequestButton.y = 1500;
	var sendRequestText = new Text2('TAKAS İSTEĞİ GÖNDER', {
		size: 30,
		fill: '#FFFFFF'
	});
	sendRequestText.anchor.set(0.5, 0.5);
	sendRequestText.x = 700;
	sendRequestText.y = 1500;
	game.addChild(sendRequestText);
	tradeUIElements.push(sendRequestButton, sendRequestText);
	sendRequestButton.down = function () {
		if (selectedForTrade.length > 0) {
			createTradeOffer(targetPlayer, selectedForTrade);
			hideTrade();
			showTrade(); // Return to main trade screen
		}
	};
	// Back button
	var setupBackButton = game.attachAsset('startButton', {
		anchorX: 0.5,
		anchorY: 0.5
	});
	setupBackButton.x = 1348;
	setupBackButton.y = 1500;
	var setupBackText = new Text2('GERİ', {
		size: 35,
		fill: '#FFFFFF'
	});
	setupBackText.anchor.set(0.5, 0.5);
	setupBackText.x = 1348;
	setupBackText.y = 1500;
	game.addChild(setupBackText);
	tradeUIElements.push(setupBackButton, setupBackText);
	setupBackButton.down = function () {
		hideTrade();
		showTrade(); // Return to main trade screen
	};
}
function hideTrade() {
	gameState = 'nickname';
	// Remove all trade UI elements
	hideAllTradeUI();
	// Restore menu UI elements
	showAllMenuUI();
}
function showStock() {
	gameState = 'stock';
	// Hide all menu and game UI elements
	hideAllMenuUI();
	hideAllGameUI();
	// Create stock display
	var stockTitle = new Text2('DİNOZOR STOKU', {
		size: 80,
		fill: '#FFFFFF'
	});
	stockTitle.anchor.set(0.5, 0.5);
	stockTitle.x = 1024;
	stockTitle.y = 200;
	game.addChild(stockTitle);
	stockUIElements.push(stockTitle);
	// Define dinosaur buy prices based on rarity and value (higher than sell prices)
	var dinosaurBuyPrices = {
		'PARASOUROLUPHUS': 1200,
		'PYTHEREDON': 1350,
		'DIMETRODON': 1500,
		'BARYONYX': 3750,
		'ALLO': 4500,
		'YUTY': 5250,
		'SPINO': 12000,
		'GIGA': 15000,
		'Mutated BARYONYX': 18000,
		'Mutated DIMETRODON': 22500,
		'Mutated PARASAUROLUPHUS': 27000
	};
	// Get all purchasable dinosaurs (all except TREX) - ordered by expensive dinosaur hierarchy
	// SPINO (1st), GIGA (2nd), Mutated DIMETRODON (3rd), Mutated BARYONYX (4th), then others by price
	var allDinosaurs = ['SPINO', 'GIGA', 'Mutated DIMETRODON', 'Mutated BARYONYX', 'Mutated PARASAUROLUPHUS', 'YUTY', 'ALLO', 'BARYONYX', 'DIMETRODON', 'PYTHEREDON', 'PARASOUROLUPHUS'];
	// No need to sort as we've manually ordered them by hierarchy
	// Show current coins
	var coinsDisplayText = new Text2('Mevcut Para: ' + playerCoins + ' coin', {
		size: 50,
		fill: '#FFD700'
	});
	coinsDisplayText.anchor.set(0.5, 0.5);
	coinsDisplayText.x = 1024;
	coinsDisplayText.y = 280;
	game.addChild(coinsDisplayText);
	stockUIElements.push(coinsDisplayText);
	// Show instruction
	var instructionText = new Text2('Satın almak istediğiniz dinozorları seçin (TREX satın alınamaz)', {
		size: 40,
		fill: '#CCCCCC'
	});
	instructionText.anchor.set(0.5, 0.5);
	instructionText.x = 1024;
	instructionText.y = 340;
	game.addChild(instructionText);
	stockUIElements.push(instructionText);
	// Track selected dinosaurs for buying
	var selectedForBuying = [];
	// Display purchasable dinosaurs
	var startY = 500;
	var itemSpacing = 120; // Increased spacing between dinosaur entries
	for (var n = 0; n < allDinosaurs.length; n++) {
		var dinoName = allDinosaurs[n];
		var rarity = dinosaurRarities[dinoName];
		var price = dinosaurBuyPrices[dinoName];
		// Get rarity color
		var color = '#87CEEB'; // Light blue for common
		if (rarity === 'chromatic') color = getRandomColor(); // Rainbow for chromatic
		else if (rarity === 'legendary') color = '#FF0000'; // Red for legendary
		else if (rarity === 'rare') color = '#800080'; // Purple for rare
		else if (rarity === 'common') color = '#00008B'; // Dark blue for common
		var displayText = dinoName + ' (' + rarity + ') - ' + price + ' coin';
		var canAfford = playerCoins >= price;
		var dinoButton = game.attachAsset('startButton', {
			anchorX: 0.5,
			anchorY: 0.5
		});
		dinoButton.x = 1024;
		dinoButton.y = startY + n * itemSpacing;
		// Dim button if can't afford
		if (!canAfford) {
			dinoButton.alpha = 0.5;
		}
		// Add dinosaur image
		var dinoImage = new DinosaurImage(dinoName);
		dinoImage.x = 400;
		dinoImage.y = startY + n * itemSpacing;
		dinoImage.scaleX = 0.6;
		dinoImage.scaleY = 0.6;
		if (!canAfford) {
			dinoImage.alpha = 0.5;
		}
		game.addChild(dinoImage);
		stockUIElements.push(dinoImage);
		var dinoText = new Text2(displayText, {
			size: 35,
			fill: canAfford ? color : '#666666'
		});
		dinoText.anchor.set(0.5, 0.5);
		dinoText.x = 1024;
		dinoText.y = startY + n * itemSpacing;
		game.addChild(dinoText);
		var statusText = new Text2(canAfford ? 'SATIN ALINABILìR' : 'YETERSìZ PARA', {
			size: 25,
			fill: canAfford ? '#32CD32' : '#FF4444'
		});
		statusText.anchor.set(0.5, 0.5);
		statusText.x = 1024;
		statusText.y = startY + n * itemSpacing + 25;
		game.addChild(statusText);
		stockUIElements.push(dinoButton, dinoText, statusText);
		// Create closure for purchase
		(function (dinosaurName, buyPrice, textElement, buttonElement, statusElement, imageElement) {
			dinoButton.down = function () {
				if (playerCoins >= buyPrice) {
					// Purchase dinosaur
					playerCoins -= buyPrice;
					storage.playerCoins = playerCoins;
					// Add dinosaur to collection
					dinosaurCollection.push(dinosaurName);
					storage.dinosaurCollection = dinosaurCollection;
					// Update display
					coinsDisplayText.setText('Mevcut Para: ' + playerCoins + ' coin');
					// Refresh stock display
					hideStock();
					showStock();
				}
			};
		})(dinoName, price, dinoText, dinoButton, statusText, dinoImage);
	}
	// Back button centered
	var stockBackButton = game.attachAsset('startButton', {
		anchorX: 0.5,
		anchorY: 0.5
	});
	stockBackButton.x = 1024;
	stockBackButton.y = startY + allDinosaurs.length * itemSpacing + 50;
	var stockBackButtonText = new Text2('BACK', {
		size: 35,
		fill: '#FFFFFF'
	});
	stockBackButtonText.anchor.set(0.5, 0.5);
	stockBackButtonText.x = 1024;
	stockBackButtonText.y = startY + allDinosaurs.length * itemSpacing + 50;
	game.addChild(stockBackButtonText);
	stockUIElements.push(stockBackButton, stockBackButtonText);
	// Event handlers
	stockBackButton.down = function () {
		hideStock();
	};
}
function hideStock() {
	gameState = 'nickname';
	// Remove all stock UI elements
	hideAllStockUI();
	// Restore menu UI elements
	showAllMenuUI();
	coinsText.setText('Coins: ' + playerCoins);
}
function checkDinosaurHunger() {
	var currentTime = Date.now();
	var timePassed = currentTime - lastFeedingCheck;
	// Check hunger every hour (3600000 ms)
	if (timePassed >= 3600000) {
		var hungerIncrease = Math.floor(timePassed / 3600000);
		// Initialize hunger for new dinosaurs and increase hunger for existing ones
		for (var i = 0; i < dinosaurCollection.length; i++) {
			var dinoName = dinosaurCollection[i];
			if (!dinosaurHunger[dinoName]) {
				dinosaurHunger[dinoName] = 0; // New dinosaurs start with 0 hunger
			} else {
				dinosaurHunger[dinoName] += hungerIncrease;
			}
		}
		// Update storage without removing any dinosaurs
		storage.dinosaurCollection = dinosaurCollection;
		storage.dinosaurHunger = dinosaurHunger;
		storage.lastFeedingCheck = currentTime;
		lastFeedingCheck = currentTime;
	}
}
function showStarvationNotification(starvedDinosaurs) {
	gameState = 'starvationNotification';
	hideAllMenuUI();
	hideAllGameUI();
	var notificationTitle = new Text2('DİNOZORLAR AÇLIKTAN ÖLDÜ!', {
		size: 80,
		fill: '#FF4444'
	});
	notificationTitle.anchor.set(0.5, 0.5);
	notificationTitle.x = 1024;
	notificationTitle.y = 400;
	game.addChild(notificationTitle);
	infoUIElements.push(notificationTitle);
	var starvedText = 'Açlıktan ölen dinozorlar:\n';
	for (var i = 0; i < starvedDinosaurs.length; i++) {
		starvedText += starvedDinosaurs[i] + '\n';
	}
	starvedText += '\nDinozorlarınızı düzenli olarak besleyin!';
	var notificationMessage = new Text2(starvedText, {
		size: 50,
		fill: '#FFFFFF'
	});
	notificationMessage.anchor.set(0.5, 0.5);
	notificationMessage.x = 1024;
	notificationMessage.y = 700;
	game.addChild(notificationMessage);
	infoUIElements.push(notificationMessage);
	var okButton = game.attachAsset('startButton', {
		anchorX: 0.5,
		anchorY: 0.5
	});
	okButton.x = 1024;
	okButton.y = 1000;
	var okButtonText = new Text2('TAMAM', {
		size: 35,
		fill: '#FFFFFF'
	});
	okButtonText.anchor.set(0.5, 0.5);
	okButtonText.x = 1024;
	okButtonText.y = 1000;
	game.addChild(okButtonText);
	infoUIElements.push(okButton, okButtonText);
	okButton.down = function () {
		hideInfoScreen();
		gameState = 'nickname';
		showAllMenuUI();
	};
}
function feedDinosaur(dinosaurName) {
	var diet = dinosaurDiets[dinosaurName];
	var hasFood = false;
	// Check if player has the required food type
	if (diet === 'leaf' && leafFood > 0) {
		leafFood--;
		storage.leafFood = leafFood;
		hasFood = true;
	} else if (diet === 'meat' && meatFood > 0) {
		meatFood--;
		storage.meatFood = meatFood;
		hasFood = true;
	} else if (diet === 'fish' && fishFood > 0) {
		fishFood--;
		storage.fishFood = fishFood;
		hasFood = true;
	}
	if (hasFood) {
		// Reset hunger to 0
		dinosaurHunger[dinosaurName] = 0;
		storage.dinosaurHunger = dinosaurHunger;
		return true;
	}
	return false;
}
function getHungerStatus(dinosaurName) {
	var hunger = dinosaurHunger[dinosaurName] || 0;
	if (hunger >= 20) return 'VERY_HUNGRY';
	if (hunger >= 12) return 'HUNGRY';
	if (hunger >= 6) return 'SOMEWHAT_HUNGRY';
	return 'FED';
}
function getHungerColor(status) {
	switch (status) {
		case 'VERY_HUNGRY':
			return '#FF0000';
		case 'HUNGRY':
			return '#FF8800';
		case 'SOMEWHAT_HUNGRY':
			return '#FFFF00';
		default:
			return '#00FF00';
	}
}
function getHungerText(status) {
	switch (status) {
		case 'VERY_HUNGRY':
			return 'ÇOK AÇ!';
		case 'HUNGRY':
			return 'AÇ';
		case 'SOMEWHAT_HUNGRY':
			return 'BIRAZ AÇ';
		default:
			return 'TOK';
	}
}
function canDinosaurUseAbilities(dinosaurName) {
	var hungerStatus = getHungerStatus(dinosaurName);
	// Dinosaurs can only use abilities when fed (not hungry)
	return hungerStatus === 'FED';
}
function startGame() {
	if (playerNickname.length === 0) {
		return;
	}
	// Check dinosaur hunger when starting game
	checkDinosaurHunger();
	storage.playerNickname = playerNickname;
	gameState = 'playing';
	// Hide menu UI elements
	hideAllMenuUI();
	// Show game UI elements
	timerText.visible = true;
	scoreText.visible = true;
	levelText.visible = true;
	// Show power-up purchase options
	purchaseOption1.visible = true;
	purchaseText1.visible = true;
	purchaseOption2.visible = true;
	purchaseText2.visible = true;
	purchaseOption3.visible = true;
	purchaseText3.visible = true;
	// Show XRAY use button
	xrayUseButton.visible = true;
	xrayUseText.visible = true;
	xrayUseText.setText('XRAY (' + xrayLevelsLeft + ')');
	// Show back to menu button
	backToMenuButton.visible = true;
	backToMenuText.visible = true;
	// Show ability button
	abilityUseButton.visible = true;
	abilityUseText.visible = true;
	// Start from saved level or level 1 if no save exists
	startLevel(currentLevelNumber);
}
// Event handlers
leftArrow.down = function (x, y, obj) {
	if (gameState !== 'nickname') {
		return;
	}
	currentLetterIndex = (currentLetterIndex - 1 + alphabet.length) % alphabet.length;
	updateNicknameDisplay();
};
rightArrow.down = function (x, y, obj) {
	if (gameState !== 'nickname') {
		return;
	}
	currentLetterIndex = (currentLetterIndex + 1) % alphabet.length;
	updateNicknameDisplay();
};
addButton.down = function (x, y, obj) {
	if (gameState !== 'nickname') {
		return;
	}
	// Add current letter to nickname
	if (playerNickname.length < 12) {
		playerNickname += alphabet[currentLetterIndex];
		updateNicknameDisplay();
	}
};
startButton.down = function (x, y, obj) {
	if (gameState !== 'nickname') {
		return;
	}
	startGame();
};
deleteButton.down = function (x, y, obj) {
	if (gameState !== 'nickname') {
		return;
	}
	if (playerNickname.length > 0) {
		playerNickname = playerNickname.slice(0, -1);
		updateNicknameDisplay();
	}
};
storeButton.down = function (x, y, obj) {
	if (gameState !== 'nickname') {
		return;
	}
	showStore();
};
sellButton.down = function (x, y, obj) {
	if (gameState !== 'nickname') {
		return;
	}
	showSell();
};
shopButton.down = function (x, y, obj) {
	if (gameState !== 'nickname') {
		return;
	}
	showShop();
};
bagButton.down = function (x, y, obj) {
	if (gameState !== 'nickname') {
		return;
	}
	showBag();
};
tradeButton.down = function (x, y, obj) {
	if (gameState !== 'nickname') {
		return;
	}
	showTrade();
};
giftsButton.down = function (x, y, obj) {
	if (gameState !== 'nickname') {
		return;
	}
	showGifts();
};
stockButton.down = function (x, y, obj) {
	if (gameState !== 'nickname') {
		return;
	}
	showStock();
};
game.down = function (x, y, obj) {
	// Game down handler for playing state only
};
// Game update loop
game.update = function () {
	if (gameState === 'playing') {
		levelTimer++;
		timerText.setText('Time: ' + Math.floor(levelTimer / 60));
		// Check dinosaur hunger periodically (every 30 seconds in-game)
		if (levelTimer % 1800 === 0) {
			checkDinosaurHunger();
		}
		// Slowly decrease score over time to encourage speed
		if (levelTimer % 120 === 0 && LK.getScore() > 0) {
			// Every 2 seconds
			LK.setScore(Math.max(0, LK.getScore() - 1));
			scoreText.setText('Score: ' + LK.getScore());
		}
		// Update ability button text based on selected dinosaur and level restrictions
		if (selectedDinosaur) {
			var buttonText = selectedDinosaur + ' ÖZELLİĞİ';
			var canUse = true;
			// Check if dinosaur is too hungry to use abilities
			if (!canDinosaurUseAbilities(selectedDinosaur)) {
				var hungerStatus = getHungerStatus(selectedDinosaur);
				buttonText = selectedDinosaur + ' (AÇ - BESLEYİN)';
				canUse = false;
			} else if (selectedDinosaur === 'TREX' && currentLevelNumber % 10 !== 0) {
				buttonText = 'TREX (' + (10 - currentLevelNumber % 10) + ' seviye)';
				canUse = false;
			} else if (selectedDinosaur === 'SPINO' && storage.spinoUsedThisLevel) {
				buttonText = 'SPINO (kullanıldı)';
				canUse = false;
			} else if (selectedDinosaur === 'GIGA') {
				buttonText = 'GIGA ÖZELLİĞİ';
			} else if (selectedDinosaur === 'Mutated DIMETRODON' && currentLevelNumber % 3 !== 0) {
				buttonText = 'M.DIMETRODON (' + (3 - currentLevelNumber % 3) + ' seviye)';
				canUse = false;
			} else if (selectedDinosaur === 'Mutated BARYONYX' && currentLevelNumber % 4 !== 0) {
				buttonText = 'M.BARYONYX (' + (4 - currentLevelNumber % 4) + ' seviye)';
				canUse = false;
			} else if (selectedDinosaur === 'Mutated PARASAUROLUPHUS') {
				var currentUsage = storage.mutatedParasaurolophusMatches || 0;
				if ((currentUsage + 1) % 2 !== 0) {
					buttonText = 'M.PARASAUR (' + (2 - (currentUsage + 1) % 2) + ' kullanım)';
					canUse = false;
				}
			}
			abilityUseText.setText(buttonText);
			abilityUseButton.alpha = canUse ? 1.0 : 0.5;
		} else {
			abilityUseText.setText('DİNOZOR SEÇ');
			abilityUseButton.alpha = 0.5;
		}
	}
};
// Power-up purchase options (shown when game is playing)
var purchaseOption1 = game.attachAsset('purchaseButton', {
	anchorX: 0.5,
	anchorY: 0.5
});
purchaseOption1.x = 1800;
purchaseOption1.y = 400;
purchaseOption1.visible = false;
var purchaseText1 = new Text2('XRAY\n500 Coins', {
	size: 30,
	fill: '#FFFFFF'
});
purchaseText1.anchor.set(0.5, 0.5);
purchaseText1.x = 1800;
purchaseText1.y = 400;
purchaseText1.visible = false;
game.addChild(purchaseText1);
var purchaseOption2 = game.attachAsset('purchaseButton', {
	anchorX: 0.5,
	anchorY: 0.5
});
purchaseOption2.x = 1800;
purchaseOption2.y = 520;
purchaseOption2.visible = false;
var purchaseText2 = new Text2('2X MONEY\n10000 Coins', {
	size: 30,
	fill: '#FFFFFF'
});
purchaseText2.anchor.set(0.5, 0.5);
purchaseText2.x = 1800;
purchaseText2.y = 520;
purchaseText2.visible = false;
game.addChild(purchaseText2);
var purchaseOption3 = game.attachAsset('purchaseButton', {
	anchorX: 0.5,
	anchorY: 0.5
});
purchaseOption3.x = 1800;
purchaseOption3.y = 640;
purchaseOption3.visible = false;
var purchaseText3 = new Text2('2X LUCK\n1250', {
	size: 30,
	fill: '#FFFFFF'
});
purchaseText3.anchor.set(0.5, 0.5);
purchaseText3.x = 1800;
purchaseText3.y = 640;
purchaseText3.visible = false;
game.addChild(purchaseText3);
// Track purchase UI elements as game UI
gameUIElements.push(purchaseOption1, purchaseText1, purchaseOption2, purchaseText2, purchaseOption3, purchaseText3);
// Purchase event handlers
purchaseOption1.down = function (x, y, obj) {
	if (gameState === 'playing' && playerCoins >= 500) {
		playerCoins -= 500;
		storage.playerCoins = playerCoins;
		xrayLevelsLeft++;
		storage.xrayLevelsLeft = xrayLevelsLeft;
		xrayUseText.setText('XRAY (' + xrayLevelsLeft + ')');
		// Show all fossils for current level
		if (currentLevel) {
			for (var i = 0; i < currentLevel.blocks.length; i++) {
				var block = currentLevel.blocks[i];
				if (block.hasFossil && !block.isCollected) {
					// Make blocks with fossils green and animate with tween
					tween(block, {
						tint: 0x00FF00
					}, {
						duration: 500,
						easing: tween.easeOut
					});
				}
			}
		}
	}
};
purchaseOption2.down = function (x, y, obj) {
	if (gameState === 'playing' && playerCoins >= 10000) {
		playerCoins -= 10000;
		storage.playerCoins = playerCoins;
		doubleMoneyLevelsLeft = 20;
		storage.doubleMoneyLevelsLeft = doubleMoneyLevelsLeft;
	}
};
purchaseOption3.down = function (x, y, obj) {
	if (gameState === 'playing' && playerCoins >= 1250) {
		playerCoins -= 1250;
		storage.playerCoins = playerCoins;
		doubleSpawnChanceActive = true;
		storage.doubleSpawnChanceActive = doubleSpawnChanceActive;
	}
};
// XRAY use button (shown when game is playing)
var xrayUseButton = game.attachAsset('purchaseButton', {
	anchorX: 0.5,
	anchorY: 0.5
});
xrayUseButton.x = 524; // Further left with more spacing
xrayUseButton.y = 2500; // Bottom of screen
xrayUseButton.visible = false;
var xrayUseText = new Text2('XRAY (' + xrayLevelsLeft + ')', {
	size: 30,
	fill: '#FFFFFF'
});
xrayUseText.anchor.set(0.5, 0.5);
xrayUseText.x = 524;
xrayUseText.y = 2500;
xrayUseText.visible = false;
game.addChild(xrayUseText);
// Back to menu button (shown when game is playing)
var backToMenuButton = game.attachAsset('purchaseButton', {
	anchorX: 0.5,
	anchorY: 0.5
});
backToMenuButton.x = 1524; // Further right with more spacing
backToMenuButton.y = 2500; // Bottom of screen, same level as XRAY
backToMenuButton.visible = false;
var backToMenuText = new Text2('MENÜYE GERİ DÖN', {
	size: 25,
	fill: '#FFFFFF'
});
backToMenuText.anchor.set(0.5, 0.5);
backToMenuText.x = 1524;
backToMenuText.y = 2500;
backToMenuText.visible = false;
game.addChild(backToMenuText);
// Track XRAY use and back to menu UI elements as game UI
gameUIElements.push(xrayUseButton, xrayUseText, backToMenuButton, backToMenuText);
// XRAY use button click handler
xrayUseButton.down = function (x, y, obj) {
	if (gameState === 'playing' && xrayLevelsLeft > 0) {
		xrayLevelsLeft--;
		storage.xrayLevelsLeft = xrayLevelsLeft;
		xrayUseText.setText('XRAY (' + xrayLevelsLeft + ')');
		// Show all fossils for current level
		if (currentLevel) {
			for (var i = 0; i < currentLevel.blocks.length; i++) {
				var block = currentLevel.blocks[i];
				if (block.hasFossil && !block.isCollected) {
					// Make blocks with fossils green and animate with tween
					tween(block, {
						tint: 0x00FF00
					}, {
						duration: 500,
						easing: tween.easeOut
					});
				}
			}
		}
	}
};
// Dinosaur ability use button (shown when game is playing)
var abilityUseButton = game.attachAsset('purchaseButton', {
	anchorX: 0.5,
	anchorY: 0.5
});
abilityUseButton.x = 1024; // Center bottom
abilityUseButton.y = 2500; // Bottom of screen
abilityUseButton.visible = false;
var abilityUseText = new Text2('DİNOZOR ÖZELLİĞİ', {
	size: 25,
	fill: '#FFFFFF'
});
abilityUseText.anchor.set(0.5, 0.5);
abilityUseText.x = 1024;
abilityUseText.y = 2500;
abilityUseText.visible = false;
game.addChild(abilityUseText);
// Track ability button as game UI
gameUIElements.push(abilityUseButton, abilityUseText);
// Ability use button click handler
abilityUseButton.down = function (x, y, obj) {
	if (gameState === 'playing' && selectedDinosaur && currentLevel) {
		// Check if dinosaur can use abilities (not too hungry)
		if (!canDinosaurUseAbilities(selectedDinosaur)) {
			// Dinosaur is too hungry to use abilities
			return;
		}
		// Use the selected dinosaur's ability
		if (selectedDinosaur === 'TREX') {
			// TREX roars and collects all fossils (only works every 10 levels)
			if (currentLevelNumber % 10 === 0) {
				// Create roar effect with screen shake animation
				var roarEffect = LK.getAsset('TREX', {
					anchorX: 0.5,
					anchorY: 0.5,
					scaleX: 3.0,
					scaleY: 3.0
				});
				roarEffect.x = 1024;
				roarEffect.y = 1000;
				roarEffect.alpha = 0.7;
				roarEffect.tint = 0xFF4500; // Orange roar effect
				currentLevel.addChild(roarEffect);
				// Animate roar effect with tween
				tween(roarEffect, {
					scaleX: 5.0,
					scaleY: 5.0,
					alpha: 0
				}, {
					duration: 2000,
					easing: tween.easeOut,
					onFinish: function onFinish() {
						roarEffect.destroy();
					}
				});
				// Collect all fossils on the level instantly
				for (var i = 0; i < currentLevel.blocks.length; i++) {
					var block = currentLevel.blocks[i];
					if (block.hasFossil && !block.isCollected) {
						// Instantly reveal and collect the fossil
						currentLevel.revealFossil(block.fossilType, block.x, block.y);
						// Mark block as collected
						block.isCollected = true;
						block.alpha = 0;
					}
				}
			}
		} else if (selectedDinosaur === 'SPINO') {
			// SPINO tail strike - find a random block and break 3 in line (1 use per level)
			if (storage.spinoUsedThisLevel) {
				// Already used this level, do nothing
				return;
			}
			if (currentLevel.blocks.length > 0) {
				storage.spinoUsedThisLevel = true;
				// Create visual tail strike effect
				var tailStrikeEffect = LK.getAsset('SPINO', {
					anchorX: 0.5,
					anchorY: 0.5,
					scaleX: 2.0,
					scaleY: 2.0
				});
				tailStrikeEffect.x = 1024;
				tailStrikeEffect.y = 1000;
				tailStrikeEffect.alpha = 0.8;
				tailStrikeEffect.tint = 0x228B22; // Green tail strike effect
				currentLevel.addChild(tailStrikeEffect);
				// Animate tail strike effect
				tween(tailStrikeEffect, {
					scaleX: 3.5,
					scaleY: 1.5,
					alpha: 0
				}, {
					duration: 1000,
					easing: tween.easeOut,
					onFinish: function onFinish() {
						tailStrikeEffect.destroy();
					}
				});
				var randomIndex = Math.floor(Math.random() * currentLevel.blocks.length);
				var block = currentLevel.blocks[randomIndex];
				if (!block.isCollected) {
					var blocksToBreak = [block];
					var blocksPerRow = 8;
					var row = Math.floor(randomIndex / blocksPerRow);
					var col = randomIndex % blocksPerRow;
					// Add 2 blocks to the right
					for (var j = 1; j <= 2; j++) {
						if (col + j < blocksPerRow) {
							var blockIndex = row * blocksPerRow + (col + j);
							if (blockIndex < currentLevel.blocks.length) {
								var nextBlock = currentLevel.blocks[blockIndex];
								if (!nextBlock.isCollected) {
									blocksToBreak.push(nextBlock);
								}
							}
						}
					}
					// Break all blocks
					for (var k = 0; k < blocksToBreak.length; k++) {
						blocksToBreak[k].performCollection();
					}
				}
			}
		} else if (selectedDinosaur === 'GIGA') {
			// GIGA breaks all rocks instantly every level
			// Create visual effect for GIGA ability
			var gigaEffect = LK.getAsset('GIGA', {
				anchorX: 0.5,
				anchorY: 0.5,
				scaleX: 2.5,
				scaleY: 2.5
			});
			gigaEffect.x = 1024;
			gigaEffect.y = 1000;
			gigaEffect.alpha = 0.8;
			gigaEffect.tint = 0x800080; // Purple effect for GIGA
			currentLevel.addChild(gigaEffect);
			// Animate GIGA effect with tween
			tween(gigaEffect, {
				scaleX: 4.0,
				scaleY: 4.0,
				alpha: 0
			}, {
				duration: 1500,
				easing: tween.easeOut,
				onFinish: function onFinish() {
					gigaEffect.destroy();
				}
			});
			// Break all rocks instantly
			for (var i = 0; i < currentLevel.blocks.length; i++) {
				var block = currentLevel.blocks[i];
				if (!block.isCollected) {
					block.currentHits = block.hitsRequired; // Set hits to required amount
					block.performCollection(); // Break the block instantly
				}
			}
		} else if (selectedDinosaur === 'Mutated DIMETRODON') {
			// Mutated DIMETRODON collects 3 most valuable fossils every 3 levels
			if (currentLevelNumber % 3 === 0) {
				// Find available fossils from current level
				var availableFossils = [];
				for (var i = 0; i < currentLevel.fossils.length; i++) {
					if (!currentLevel.fossils[i].isCollected) {
						availableFossils.push(currentLevel.fossils[i]);
					}
				}
				// Sort by fossil value (descending)
				availableFossils.sort(function (a, b) {
					return b.points - a.points;
				});
				// Take up to 3 most valuable fossils
				var fossilsToCollect = Math.min(3, availableFossils.length);
				for (var j = 0; j < fossilsToCollect; j++) {
					availableFossils[j].collectFossil();
				}
			}
		} else if (selectedDinosaur === 'Mutated BARYONYX') {
			// Mutated BARYONYX ability every 4 levels - reduce hit requirements for all blocks
			if (currentLevelNumber % 4 === 0) {
				for (var i = 0; i < currentLevel.blocks.length; i++) {
					var block = currentLevel.blocks[i];
					if (!block.isCollected) {
						// Set reduced hit requirements: normal blocks 1 hit, hard blocks 3 hits, ultra hard blocks 6 hits
						block.hitsRequired = block.blockType === 'ultraHardBlock' ? 6 : block.blockType === 'hardRock' ? 3 : 1;
					}
				}
			}
		} else if (selectedDinosaur === 'Mutated PARASAUROLUPHUS') {
			// Mutated PARASAUROLUPHUS ability every 2 matches with reduced hits
			var currentUsage = storage.mutatedParasaurolophusMatches || 0;
			currentUsage++;
			storage.mutatedParasaurolophusMatches = currentUsage;
			if (currentUsage % 2 === 0) {
				for (var i = 0; i < currentLevel.blocks.length; i++) {
					var block = currentLevel.blocks[i];
					if (!block.isCollected) {
						// Set reduced hit requirements: normal blocks 2 hits, hard blocks 4 hits, ultra hard blocks 7 hits
						block.hitsRequired = block.blockType === 'ultraHardBlock' ? 7 : block.blockType === 'hardRock' ? 4 : 2;
					}
				}
			}
		} else {
			// For other dinosaurs with no special button ability, show message or do nothing
		}
	}
};
// Back to menu button click handler
backToMenuButton.down = function (x, y, obj) {
	if (gameState === 'playing') {
		// Clean up current level
		if (currentLevel) {
			currentLevel.destroy();
			currentLevel = null;
		}
		// Reset game state
		gameState = 'nickname';
		// Hide game UI elements
		hideAllGameUI();
		// Show menu UI elements
		showAllMenuUI();
	}
};
// Initialize display
updateNicknameDisplay();
coinsText.setText('Coins: ' + playerCoins);
// Start background music
LK.playMusic('backgroundMusic');