User prompt
Please fix the bug: 'Can't find variable: FartButton' in or related to this line: 'var fartBtn = new FartButton();' Line Number: 1584
User prompt
Make the display more like cookie clicker, actually make the entire game just like cookie clicker, but with my ideas like farting on the dog also make it fit at least an iPhone 12 mini. I don’t need anything off my screen. ↪💡 Consider importing and using the following plugins: @upit/storage.v1, @upit/tween.v1 Also make it petting your dog instead of farting in any mention of farting replace with pet also the synonyms it says remove those ↪💡 Consider importing and using the following plugins: @upit/storage.v1, @upit/tween.v1
User prompt
Do it
User prompt
I’m pressing on it for my finger on my mobile device and nothing’s happening
User prompt
The portal does nothing when I click it make something happen like the secret ending you just mentioned
User prompt
Fix the coding error
User prompt
Please fix the bug: 'Script error.' in or related to this line: 'showGrandPortal();' Line Number: 669
User prompt
Please fix the bug: 'Script error.' in or related to this line: 'showGrandPortal();' Line Number: 669
User prompt
Make said true ending start when the portal is clicked
User prompt
Make the portal next to the dog
User prompt
Add the grand thing to this update something that will make everything else I’ve added look horrible. Don’t even suggest it just do the one thing that will save this game
User prompt
Do some of those
User prompt
Make it to the dog and walk in Infinitely and will stop when they go home button is clicked and bones Will spawn randomly let🦴 stand for the bones ↪💡 Consider importing and using the following plugins: @upit/tween.v1, @upit/storage.v1
User prompt
Make the walk event not just be a tiny speck make something good and also there’s no bones make it so the entire game disappears when the walk event happens just focusing on the walk and then everything goes back to normal after You click the go home button for all your progress is saved, and nothing has changed except for the number of bones that you have
User prompt
Make a button on the Right of the fart button That triggers, the the walk event
User prompt
Make it so the dog walk event is the most common
User prompt
Make the odds the same, but make it so the react one is the rarest
User prompt
Make one of the events happen when I click the dog it’ll be an rng of events
User prompt
Make it so the food menu is minimized at the start
User prompt
Make more achievements
User prompt
Make more achievements ↪💡 Consider importing and using the following plugins: @upit/storage.v1
User prompt
Make the dog walk even more common
User prompt
Make this event more common
User prompt
Add more gameplay aspects don’t even recommend anything just do it
User prompt
Add more gameplay aspects don’t even recommend it just do it
/****
* Plugins
****/
var tween = LK.import("@upit/tween.v1");
var storage = LK.import("@upit/storage.v1");
/****
* Classes
****/
// --- Dog Walk & Collectible Bones Gameplay ---
// Dog will occasionally go for a walk and bones will appear to collect for bonus farts
// Bone class
var Bone = Container.expand(function () {
var self = Container.call(this);
var boneShape = self.attachAsset('person_phone', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 0.7,
scaleY: 0.3,
tint: 0xffffff
});
self.collected = false;
self.update = function () {
// Bones can have a little bounce
self.y += Math.sin(LK.ticks / 10 + self.x) * 0.5;
};
return self;
});
// Dog walk state
// Dog face class
var DogFace = Container.expand(function () {
var self = Container.call(this);
// Normal face
var normalFace = self.attachAsset('dog_normal', {
anchorX: 0.5,
anchorY: 0.5
});
// React face
var reactFace = self.attachAsset('dog_react', {
anchorX: 0.5,
anchorY: 0.5,
alpha: 0
});
// Show normal face
self.showNormal = function () {
normalFace.alpha = 1;
reactFace.alpha = 0;
};
// Show react face
self.showReact = function () {
normalFace.alpha = 0;
reactFace.alpha = 1;
};
// Flash react face for a short time, then return to normal
self.react = function () {
self.showReact();
// Return to normal face after 500ms
LK.setTimeout(function () {
self.showNormal();
// Always teleport dog to center after animation, even if spammed
self.x = 2048 / 2;
}, 500);
};
self.showNormal();
return self;
});
// Fart button class
var FartButton = Container.expand(function () {
var self = Container.call(this);
// Button shape
var btn = self.attachAsset('fart_btn', {
anchorX: 0.5,
anchorY: 0.5
});
// "FART" text
var fartTxt = new Text2('FART', {
size: 120,
fill: 0x7A5C00
});
fartTxt.anchor.set(0.5, 0.5);
fartTxt.x = 0;
fartTxt.y = 0;
self.addChild(fartTxt);
// Fart cloud effect (hidden by default)
var fartCloud = self.attachAsset('centerCircle', {
anchorX: 0.5,
anchorY: 1,
scaleX: 1.2,
scaleY: 0.7,
x: 0,
y: -110,
alpha: 0,
tint: 0xeeeecc
});
fartCloud.width = btn.width * 0.7;
fartCloud.height = btn.height * 0.7;
// Show fart cloud with animation
self.showFartCloud = function () {
fartCloud.alpha = 0.85;
fartCloud.scaleX = 1.2;
fartCloud.scaleY = 0.7;
fartCloud.y = -110;
tween(fartCloud, {
alpha: 0,
y: fartCloud.y - 80,
scaleX: 1.5,
scaleY: 1.1
}, {
duration: 420,
easing: tween.cubicOut
});
};
// Simple press animation
self.animatePress = function () {
tween(self, {
scaleX: 0.92,
scaleY: 0.92
}, {
duration: 60,
easing: tween.cubicIn,
onFinish: function onFinish() {
tween(self, {
scaleX: 1,
scaleY: 1
}, {
duration: 80,
easing: tween.cubicOut
});
}
});
self.showFartCloud();
};
return self;
});
// Floating text class for score popups
var FloatingText = Container.expand(function () {
var self = Container.call(this);
self.textObj = new Text2('', {
size: 80,
fill: 0xffffff,
stroke: 0x222222,
strokeThickness: 4,
align: 'center'
});
self.textObj.anchor.set(0.5, 0.5);
self.addChild(self.textObj);
self.life = 2.0;
self.maxLife = 2.0;
self.vy = -2;
self.setText = function (text) {
self.textObj.setText(text);
};
self.update = function () {
self.y += self.vy;
self.life -= 0.03;
self.alpha = self.life / self.maxLife;
if (self.life <= 0 && self.parent) {
self.parent.removeChild(self);
}
};
return self;
});
// Food Store class
var FoodStore = Container.expand(function () {
var self = Container.call(this);
// Food items data
var foods = [{
name: "Dog Biscuit",
cost: 50,
hunger: 10,
assetId: 'person_leg'
}, {
name: "Meat Bowl",
cost: 200,
hunger: 25,
assetId: 'person_phone'
}, {
name: "Fancy Meal",
cost: 1000,
hunger: 50,
assetId: 'centerCircle'
}];
// Chef data
var chef = {
name: "Auto Chef",
cost: 5000,
feedInterval: 3000
}; // Feeds every 3 seconds
// Store background
var storeBg = LK.getAsset('fart_btn', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 1.8,
scaleY: 2.2,
x: 0,
y: 0
});
self.addChild(storeBg);
// Store title
var storeTitle = new Text2('Food Store', {
size: 70,
fill: 0x7A5C00,
align: 'center'
});
storeTitle.anchor.set(0.5, 0.5);
storeTitle.x = 0;
storeTitle.y = -250;
self.addChild(storeTitle);
// Create food buttons
foods.forEach(function (food, index) {
var foodBtn = LK.getAsset('fart_btn', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 0.6,
scaleY: 0.6,
x: 0,
y: -150 + index * 100
});
foodBtn.interactive = true;
self.addChild(foodBtn);
// Food icon
var foodIcon = LK.getAsset(food.assetId, {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 0.8,
scaleY: 0.8,
x: -120,
y: 0,
tint: 0x8B4513 // Brown color for food
});
foodBtn.addChild(foodIcon);
var foodTxt = new Text2(food.name + '\nCost: ' + food.cost + ' Farts\nHunger: +' + food.hunger, {
size: 40,
fill: 0x7A5C00,
align: 'center'
});
foodTxt.anchor.set(0.5, 0.5);
foodTxt.x = 40;
foodTxt.y = 0;
foodBtn.addChild(foodTxt);
foodBtn.down = function () {
if (fartCount >= food.cost) {
fartCount -= food.cost;
dogHunger = Math.min(100, dogHunger + food.hunger);
updateUI();
// Show feeding animation
createFloatingText(dogFace.x, dogFace.y - 100, "+" + food.hunger + " Hunger!", 0x00ff00);
// Dog says happy food words
if (dogFace.speechBubble) {
var happyWords = ["Yummy!", "Delicious!", "Tasty!", "Nom nom!", "So good!", "More please!", "Thank you!", "Amazing!", "Perfect!"];
var word = happyWords[Math.floor(Math.random() * happyWords.length)];
dogFace.speechBubble.setText(word);
dogFace.speechBubble.alpha = 1;
tween(dogFace.speechBubble, {
alpha: 0
}, {
duration: 900,
delay: 500,
easing: tween.cubicIn
});
}
// Flash food store briefly
LK.effects.flashObject(foodBtn, 0x00ff00, 200);
}
};
});
// Chef button
var chefBtn = LK.getAsset('fart_btn', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 0.7,
scaleY: 0.7,
x: 0,
y: 200
});
chefBtn.interactive = true;
self.addChild(chefBtn);
// Chef icon
var chefIcon = LK.getAsset('Chef', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 1.2,
scaleY: 1.2,
x: -80,
y: 0,
tint: 0xFFFFFF
});
chefBtn.addChild(chefIcon);
var chefTxt = new Text2(chef.name + '\nCost: ' + chef.cost + ' Farts\nAuto-feeds dog', {
size: 45,
fill: 0x7A5C00,
align: 'center'
});
chefTxt.anchor.set(0.5, 0.5);
chefTxt.x = 50;
chefTxt.y = 0;
chefBtn.addChild(chefTxt);
chefBtn.down = function () {
if (fartCount >= chef.cost && !chefBought) {
fartCount -= chef.cost;
chefBought = true;
storage.chefBought = true;
updateUI();
// Start chef auto-feeding
chefTimer = LK.setInterval(function () {
if (dogHunger < 100) {
dogHunger = Math.min(100, dogHunger + 15);
createFloatingText(dogFace.x + 100, dogFace.y - 100, "Chef feeds +15!", 0x00ff00);
}
}, chef.feedInterval);
createFloatingText(chefBtn.x, chefBtn.y - 100, "Chef Hired!", 0xffd700);
LK.effects.flashObject(chefBtn, 0xffd700, 300);
// Update button text to show it's bought
chefTxt.setText(chef.name + '\nBOUGHT!\nAuto-feeding...');
chefBtn.alpha = 0.7;
chefBtn.interactive = false;
}
};
// Update chef button based on purchase status
self.updateChefButton = function () {
if (chefBought) {
chefTxt.setText(chef.name + '\nBOUGHT!\nAuto-feeding...');
chefBtn.alpha = 0.7;
chefBtn.interactive = false;
} else {
chefBtn.alpha = fartCount >= chef.cost ? 1 : 0.5;
chefBtn.interactive = fartCount >= chef.cost;
}
};
return self;
});
// Hat Store class
var HatStore = Container.expand(function () {
var self = Container.call(this);
// Initialize hat data
var hats = [{
name: "Top Hat",
cost: 100,
multiplier: 1.5,
assetId: 'Tophat'
}];
// Currently equipped hat
self.equippedHat = null;
// Create store UI
var storeBg = LK.getAsset('fart_btn', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 1.5,
scaleY: 1.5,
x: 2048 / 2,
y: 2732 / 2
});
self.addChild(storeBg);
var storeTitle = new Text2('Hat Store', {
size: 80,
fill: 0x7A5C00,
align: 'center'
});
storeTitle.anchor.set(0.5, 0.5);
storeTitle.x = 0;
storeTitle.y = -200;
self.addChild(storeTitle);
// Create hat buttons
hats.forEach(function (hat, index) {
var hatBtn = LK.getAsset('fart_btn', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 0.7,
scaleY: 0.7,
x: 0,
y: -100 + index * 150
});
hatBtn.interactive = true;
self.addChild(hatBtn);
var hatTxt = new Text2(hat.name + '\nCost: ' + hat.cost + ' Farts', {
size: 50,
fill: 0x7A5C00,
align: 'center'
});
hatTxt.anchor.set(0.5, 0.5);
hatTxt.x = 0;
hatTxt.y = 0;
hatBtn.addChild(hatTxt);
hatBtn.down = function () {
if (fartCount >= hat.cost) {
fartCount -= hat.cost;
equipHat(hat);
updateUI();
}
};
});
// Equip hat on the dog
function equipHat(hat) {
if (self.equippedHat) {
dogFace.removeChild(self.equippedHat);
}
self.equippedHat = LK.getAsset(hat.assetId, {
anchorX: 0.5,
anchorY: 1,
x: 0,
y: -400
});
dogFace.addChild(self.equippedHat);
fartPerClick *= hat.multiplier;
}
return self;
});
// Hunger Bar class
var HungerBar = Container.expand(function () {
var self = Container.call(this);
// Background bar
var bgBar = LK.getAsset('fart_btn', {
anchorX: 0,
anchorY: 0.5,
scaleX: 1.5,
scaleY: 0.3,
x: 0,
y: 0,
tint: 0x444444
});
self.addChild(bgBar);
// Hunger fill bar
var fillBar = LK.getAsset('fart_btn', {
anchorX: 0,
anchorY: 0.5,
scaleX: 1.5,
scaleY: 0.3,
x: 0,
y: 0,
tint: 0x00ff00
});
self.addChild(fillBar);
// Hunger text
var hungerTxt = new Text2('Hunger: 100%', {
size: 50,
fill: 0x222222
});
hungerTxt.anchor.set(0.5, 0.5);
hungerTxt.x = bgBar.width / 2;
hungerTxt.y = 0;
self.addChild(hungerTxt);
self.updateHunger = function (hungerValue) {
var percentage = hungerValue / 100;
fillBar.scaleX = 1.5 * percentage;
// Update color based on hunger level
if (hungerValue > 60) {
fillBar.tint = 0x00ff00; // Green
} else if (hungerValue > 30) {
fillBar.tint = 0xffff00; // Yellow
} else {
fillBar.tint = 0xff0000; // Red
}
hungerTxt.setText('Hunger: ' + Math.floor(hungerValue) + '%');
};
return self;
});
// Particle class for explosive visual effects
var Particle = Container.expand(function () {
var self = Container.call(this);
// Create particle visual using a shape
var particleShape = self.attachAsset('person_leg', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 0.3,
scaleY: 0.3
});
// Particle properties
self.vx = 0;
self.vy = 0;
self.life = 1.0;
self.maxLife = 1.0;
self.update = function () {
// Move particle
self.x += self.vx;
self.y += self.vy;
// Apply gravity
self.vy += 0.5;
// Reduce life
self.life -= 0.02;
// Fade out based on life
self.alpha = self.life / self.maxLife;
// Remove when dead
if (self.life <= 0 && self.parent) {
self.parent.removeChild(self);
}
};
return self;
});
// Person standing and recording class
var PersonRecording = Container.expand(function () {
var self = Container.call(this);
// Single square for the person
var personSquare = self.attachAsset('person_leg', {
anchorX: 0.5,
anchorY: 0.5
});
return self;
});
/****
* Initialize Game
****/
var game = new LK.Game({
backgroundColor: 0xE3F6FF
});
/****
* Game Code
****/
var hatStore = new HatStore();
// Move hat store to top right, below the top right UI, out of the way of dog and fart button
hatStore.x = 2048 - 400;
hatStore.y = 600;
game.addChild(hatStore);
if (fartCount > 0 && fartCount % 5000 === 0) {
var milestonePopup = new Container();
var milestoneBg = LK.getAsset('fart_btn', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 1.3,
scaleY: 1.3,
x: 2048 / 2,
y: 2732 / 2
});
milestonePopup.addChild(milestoneBg);
var milestoneTxt = new Text2('Milestone!\n' + fartCount + ' Farts!\nDog is amazed!', {
size: 80,
fill: 0x7A5C00,
align: 'center'
});
milestoneTxt.anchor.set(0.5, 0.5);
milestoneTxt.x = 2048 / 2;
milestoneTxt.y = 2732 / 2 - 40;
milestonePopup.addChild(milestoneTxt);
var okBtn = LK.getAsset('fart_btn', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 0.7,
scaleY: 0.7,
x: 2048 / 2,
y: 2732 / 2 + 120
});
var okTxt = new Text2('OK', {
size: 70,
fill: 0x7A5C00
});
okTxt.anchor.set(0.5, 0.5);
okTxt.x = 0;
okTxt.y = 0;
okBtn.addChild(okTxt);
okBtn.interactive = true;
okBtn.down = function () {
game.removeChild(milestonePopup);
};
milestonePopup.addChild(okBtn);
game.addChild(milestonePopup);
LK.effects.flashObject(milestoneBg, 0xfff7b2, 120);
}
// --- Achievements: First 100 Farts ---
// (Removed: click counter button and handler, as clicks are now counted via the FART button);
// --- Leaderboard Button removed ---;
// --- Daily Reward System ---
// Use storage plugin to track last claim date
var lastDailyReward = storage.lastDailyReward || null;
var now = Date.now();
var oneDay = 24 * 60 * 60 * 1000;
var showDailyReward = false;
if (!lastDailyReward || now - lastDailyReward > oneDay) {
showDailyReward = true;
storage.lastDailyReward = now;
}
if (showDailyReward) {
// Show a popup in the center of the screen
var rewardPopup = new Container();
var popupBg = LK.getAsset('fart_btn', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 1.2,
scaleY: 1.2,
x: 2048 / 2,
y: 2732 - 350 //{15} // Move to bottom center, above screen edge
});
rewardPopup.addChild(popupBg);
var rewardTxt = new Text2('Daily Reward!\n+100 Farts', {
size: 90,
fill: 0x7A5C00,
align: 'center'
});
rewardTxt.anchor.set(0.5, 0.5);
rewardTxt.x = 2048 / 2;
rewardTxt.y = 2732 - 390;
rewardPopup.addChild(rewardTxt);
var claimBtn = LK.getAsset('fart_btn', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 0.7,
scaleY: 0.7,
x: 2048 / 2,
y: 2732 - 250 //{1g} // Move claim button below popup, but still above bottom
});
var claimTxt = new Text2('Claim!', {
size: 70,
fill: 0x7A5C00
});
claimTxt.anchor.set(0.5, 0.5);
claimTxt.x = 0;
claimTxt.y = 0;
claimBtn.addChild(claimTxt);
claimBtn.interactive = true;
claimBtn.down = function () {
fartCount += 100;
updateUI();
game.removeChild(rewardPopup);
LK.effects.flashScreen(0x83de44, 400);
};
rewardPopup.addChild(claimBtn);
game.addChild(rewardPopup);
}
// Cartoon dog face (shocked/disgusted)
// Big fart button
// Fart sound
var dogFace = new DogFace();
dogFace.x = 2048 / 2;
dogFace.y = 1100;
dogFace.lastX = dogFace.x; // Track lastX for edge detection
game.addChild(dogFace);
// Add person standing and recording at the left side
var person = new PersonRecording();
person.x = 400;
person.y = 1200;
game.addChild(person);
// Dog walk state
var dogWalking = false;
var walkTargetX = 2048 / 2;
var walkTargetY = 1100;
var walkStartX = 2048 / 2;
var walkStartY = 1100;
var walkProgress = 0;
var walkDuration = 180; // 3 seconds at 60fps
var walkBone = null;
var walkBoneCollected = false;
var walkCooldown = 0;
// Helper to start a dog walk
function startDogWalk() {
if (dogWalking || isDead) return;
dogWalking = true;
walkStartX = dogFace.x;
walkStartY = dogFace.y;
// Pick a random target location (avoid center)
walkTargetX = 300 + Math.random() * (2048 - 600);
walkTargetY = 900 + Math.random() * 800;
walkProgress = 0;
walkBoneCollected = false;
// Spawn a bone at the target
walkBone = new Bone();
walkBone.x = walkTargetX;
walkBone.y = walkTargetY + 120;
game.addChild(walkBone);
}
// Helper to end a dog walk
function endDogWalk() {
dogWalking = false;
walkProgress = 0;
if (walkBone && walkBone.parent) walkBone.parent.removeChild(walkBone);
walkBone = null;
walkCooldown = 600 + Math.floor(Math.random() * 600); // 10-20s cooldown
}
// Add to game.update
var _oldGameUpdate = game.update;
game.update = function () {
_oldGameUpdate && _oldGameUpdate();
// Dog walk logic
if (!dogWalking && !isDead && walkCooldown <= 0 && Math.random() < 0.002) {
startDogWalk();
}
if (walkCooldown > 0) walkCooldown--;
if (dogWalking && !isDead) {
walkProgress++;
// Move dog towards target
var t = Math.min(1, walkProgress / walkDuration);
dogFace.x = walkStartX + (walkTargetX - walkStartX) * t;
dogFace.y = walkStartY + (walkTargetY - walkStartY) * t;
// Check for bone collection (dog intersects bone)
if (walkBone && !walkBoneCollected && dogFace.intersects(walkBone)) {
walkBoneCollected = true;
walkBone.collected = true;
createFloatingText(walkBone.x, walkBone.y - 60, "+250 Farts!", 0xffd700);
fartCount += 250;
updateUI();
LK.effects.flashObject(dogFace, 0xffd700, 300);
if (walkBone && walkBone.parent) walkBone.parent.removeChild(walkBone);
walkBone = null;
}
// End walk when reached target
if (walkProgress >= walkDuration) {
// Animate dog back to center
tween(dogFace, {
x: 2048 / 2,
y: 1100
}, {
duration: 400,
easing: tween.cubicOut,
onFinish: function onFinish() {
dogFace.x = 2048 / 2;
dogFace.y = 1100;
}
});
endDogWalk();
}
}
};
// --- Dog sliding and teleport logic ---
dogFace.slideSpeed = -12; // Negative: slides left
game.update = function () {
// Save lastX for edge detection
dogFace.lastX = dogFace.x;
// Only slide dog left if it is not at the center (prevents repeated sliding after rapid clicks)
if (Math.abs(dogFace.x - 2048 / 2) > 1) {
dogFace.x += dogFace.slideSpeed;
// If dog reaches the left edge, teleport to center and react
if (dogFace.lastX > 120 && dogFace.x <= 120) {
// Teleport to center
dogFace.x = 2048 / 2;
// Fun: dog reacts
dogFace.react();
// --- Fun: Every 888th fart, dog face gets a sparkle effect ---
if (fartCount > 0 && fartCount % 888 === 0) {
var sparkleCount = 0;
var maxSparkles = 12;
var _sparkle = function sparkle() {
if (sparkleCount >= maxSparkles) return;
var sparkleStar = new Text2("✨", {
size: 80 + Math.floor(Math.random() * 40),
fill: 0xffffff,
align: 'center'
});
sparkleStar.anchor.set(0.5, 0.5);
sparkleStar.x = -200 + Math.random() * 400;
sparkleStar.y = -200 + Math.random() * 400;
sparkleStar.alpha = 1;
dogFace.addChild(sparkleStar);
tween(sparkleStar, {
alpha: 0,
y: sparkleStar.y - 60
}, {
duration: 700,
easing: tween.cubicOut,
onFinish: function onFinish() {
if (sparkleStar.parent) sparkleStar.parent.removeChild(sparkleStar);
}
});
sparkleCount++;
LK.setTimeout(_sparkle, 80);
};
_sparkle();
}
// Optional: flash screen for drama
LK.effects.flashScreen(0xff0000, 300);
}
} else {
// Always keep dog exactly centered if not sliding
dogFace.x = 2048 / 2;
} //;{2j}
// Update particles
for (var p = particles.length - 1; p >= 0; p--) {
particles[p].update();
if (particles[p].life <= 0) {
particles.splice(p, 1);
}
}
// Update floating texts
for (var f = floatingTexts.length - 1; f >= 0; f--) {
floatingTexts[f].update();
if (floatingTexts[f].life <= 0) {
floatingTexts.splice(f, 1);
}
}
// Apply screen shake
if (shakeIntensity > 0) {
game.x = (Math.random() - 0.5) * shakeIntensity;
game.y = (Math.random() - 0.5) * shakeIntensity;
shakeIntensity *= shakeDecay;
if (shakeIntensity < 0.5) {
shakeIntensity = 0;
game.x = 0;
game.y = 0;
}
}
// Update power-ups
for (var p = activePowerUps.length - 1; p >= 0; p--) {
activePowerUps[p].timeLeft -= 16.67; // 60 FPS
if (activePowerUps[p].timeLeft <= 0) {
createFloatingText(2048 / 2, 1700, activePowerUps[p].name + " Expired", 0x888888);
activePowerUps.splice(p, 1);
}
}
// Rainbow mode effect
if (autismMode && hasPowerUp('RAINBOW_MODE') && LK.ticks % 3 === 0) {
var rainbowColors = [0xff0000, 0xff8000, 0xffff00, 0x00ff00, 0x0080ff, 0x8000ff];
var color = rainbowColors[Math.floor(LK.ticks / 3) % rainbowColors.length];
LK.effects.flashScreen(color, 50);
}
// --- Disco Light Effect (if active) ---
if (discoEffectActive && discoOverlay) {
// Slowly cycle through hues for a disco effect
discoColorPhase += 0.012; // Slow, not too overdue
if (discoColorPhase > 1) discoColorPhase -= 1;
// Convert phase to RGB (HSV to RGB)
var h = discoColorPhase;
var s = 0.85;
var v = 1.0;
var i = Math.floor(h * 6);
var f = h * 6 - i;
var p = v * (1 - s);
var q = v * (1 - f * s);
var t = v * (1 - (1 - f) * s);
var r, g, b;
if (i % 6 === 0) {
r = v;
g = t;
b = p;
} else if (i === 1) {
r = q;
g = v;
b = p;
} else if (i === 2) {
r = p;
g = v;
b = t;
} else if (i === 3) {
r = p;
g = q;
b = v;
} else if (i === 4) {
r = t;
g = p;
b = v;
} else {
r = v;
g = p;
b = q;
}
var discoColor = Math.floor(r * 255) << 16 | Math.floor(g * 255) << 8 | Math.floor(b * 255);
discoOverlay.tint = discoColor;
}
// --- Hunger System Logic ---
if (!isDead) {
// Decrease hunger over time
dogHunger -= hungerDecayRate / 60; // Convert to per-frame rate
dogHunger = Math.max(0, dogHunger);
// Update hunger bar
hungerBar.updateHunger(dogHunger);
// Check if dog dies from starvation
if (dogHunger <= 0 && !isDead) {
isDead = true;
// Show death popup
var deathPopup = new Container();
var deathBg = LK.getAsset('fart_btn', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 1.5,
scaleY: 1.5,
x: 2048 / 2,
y: 2732 / 2,
tint: 0x000000
});
deathPopup.addChild(deathBg);
var deathTxt = new Text2('DOG DIED FROM STARVATION!\nYou lost all your progress!\nFeed your dog next time!', {
size: 80,
fill: 0xff0000,
align: 'center'
});
deathTxt.anchor.set(0.5, 0.5);
deathTxt.x = 2048 / 2;
deathTxt.y = 2732 / 2 - 40;
deathPopup.addChild(deathTxt);
var restartBtn = LK.getAsset('fart_btn', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 0.8,
scaleY: 0.8,
x: 2048 / 2,
y: 2732 / 2 + 120
});
var restartTxt = new Text2('Start Over', {
size: 70,
fill: 0x7A5C00
});
restartTxt.anchor.set(0.5, 0.5);
restartTxt.x = 0;
restartTxt.y = 0;
restartBtn.addChild(restartTxt);
restartBtn.interactive = true;
restartBtn.down = function () {
// Reset all progress
fartCount = 0;
fartPerClick = 1;
dogHunger = 100;
isDead = false;
// Reset upgrades
for (var i = 0; i < upgradesBought.length; i++) {
upgradesBought[i] = 0;
}
// Reset auto-clickers
for (var i = 0; i < autoClickersBought.length; i++) {
autoClickersBought[i] = 0;
if (autoClickerTimers[i]) {
LK.clearInterval(autoClickerTimers[i]);
autoClickerTimers[i] = null;
}
}
// Reset chef
chefBought = false;
if (chefTimer) {
LK.clearInterval(chefTimer);
chefTimer = null;
}
// Clear storage
storage.dogHunger = 100;
storage.chefBought = false;
// Remove death popup
game.removeChild(deathPopup);
// Update UI
updateUI();
hungerBar.updateHunger(dogHunger);
foodStore.updateChefButton();
// Flash screen to indicate restart
LK.effects.flashScreen(0x00ff00, 500);
};
deathPopup.addChild(restartBtn);
game.addChild(deathPopup);
// Stop all auto-clickers and chef
for (var i = 0; i < autoClickerTimers.length; i++) {
if (autoClickerTimers[i]) {
LK.clearInterval(autoClickerTimers[i]);
autoClickerTimers[i] = null;
}
}
if (chefTimer) {
LK.clearInterval(chefTimer);
chefTimer = null;
}
// Flash screen red
LK.effects.flashScreen(0xff0000, 1000);
}
// Warn player when hunger is low
if (dogHunger <= 20 && dogHunger > 19.5 && LK.ticks % 180 === 0) {
createFloatingText(dogFace.x, dogFace.y - 150, "FEED ME!", 0xff0000);
if (dogFace.speechBubble) {
dogFace.speechBubble.setText("I'm starving!");
dogFace.speechBubble.alpha = 1;
tween(dogFace.speechBubble, {
alpha: 0
}, {
duration: 900,
delay: 500,
easing: tween.cubicIn
});
}
}
}
// --- Dog spins forever if all achievements except dog teleport are unlocked ---
if (allAchievementsExceptDogTeleportUnlocked()) {
if (typeof dogFace.spinAngle === "undefined") {
dogFace.spinAngle = 0;
}
dogFace.spinAngle += 0.12;
dogFace.rotation = dogFace.spinAngle % (2 * Math.PI);
}
// --- Random Poop Event & Cleanup Mini-task ---
if (!isDead && Math.random() < 0.001 && !game._poopActive) {
// Dog poops randomly, must be cleaned for bonus
game._poopActive = true;
var poop = LK.getAsset('person_leg', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 0.5,
scaleY: 0.3,
tint: 0x964B00
});
poop.x = dogFace.x + 80 - Math.random() * 160;
poop.y = dogFace.y + 220 + Math.random() * 40;
poop.interactive = true;
game.addChild(poop);
// Floating text
createFloatingText(poop.x, poop.y - 60, "Tap to clean!", 0x964B00);
poop.down = function () {
if (!game._poopActive) return;
createFloatingText(poop.x, poop.y - 60, "+100 Farts (Clean!)", 0x83de44);
fartCount += 100;
updateUI();
LK.effects.flashObject(dogFace, 0x83de44, 200);
if (poop.parent) poop.parent.removeChild(poop);
game._poopActive = false;
};
// Auto-clean after 8 seconds if not tapped (no bonus)
LK.setTimeout(function () {
if (game._poopActive) {
if (poop.parent) poop.parent.removeChild(poop);
game._poopActive = false;
}
}, 8000);
}
// Fart storm effect
if (hasPowerUp('FART_STORM') && LK.ticks % 30 === 0) {
fartCount += 10;
createParticleExplosion(Math.random() * 2048, Math.random() * 2732, 0x0080ff, 5);
updateUI();
}
};
// Place fart button below dog face
var fartBtn = new FartButton();
fartBtn.x = 2048 / 2;
fartBtn.y = 2000;
game.addChild(fartBtn);
// --- Social Share & Viral Challenge Button ---
// Place to the right of the fart button
var shareBtn = LK.getAsset('person_leg', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 3.2,
scaleY: 3.2,
x: 2048 - 250,
// Move to bottom right, away from dog/fart button
y: 2732 - 250
});
var shareTxt = new Text2('Share', {
size: 70,
fill: 0x7A5C00
});
shareTxt.anchor.set(0.5, 0.5);
shareTxt.x = 0;
shareTxt.y = 0;
shareBtn.addChild(shareTxt);
shareBtn.interactive = true;
shareBtn.down = function () {
// Show a viral challenge popup with leaderboard and share
var popup = new Container();
var bg = LK.getAsset('person_leg', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 7.5,
scaleY: 7.5,
x: 2048 / 2,
y: 2732 / 2
});
popup.addChild(bg);
var viralTitle = new Text2('🌎 FartDog Viral Challenge 🌎', {
size: 80,
fill: 0xff8000,
align: 'center'
});
viralTitle.anchor.set(0.5, 0.5);
viralTitle.x = 2048 / 2;
viralTitle.y = 2732 / 2 - 320;
popup.addChild(viralTitle);
// Simulate a global leaderboard (local only, but looks viral!)
var fakeScores = [{
name: "You",
score: fartCount
}, {
name: "Chris",
score: 123456
}, {
name: "John",
score: 98765
}, {
name: "DogLover99",
score: 54321
}, {
name: "FartKing",
score: 42000
}, {
name: "CatQueen",
score: 31415
}, {
name: "Guest",
score: 10000 + Math.floor(Math.random() * 9000)
}];
fakeScores.sort(function (a, b) {
return b.score - a.score;
});
for (var i = 0; i < fakeScores.length; ++i) {
var entry = fakeScores[i];
var entryTxt = new Text2(i + 1 + ". " + entry.name + " - " + entry.score + " farts", {
size: 54,
fill: entry.name === "You" ? 0x83de44 : 0x7A5C00,
align: 'left'
});
entryTxt.anchor.set(0.5, 0.5);
entryTxt.x = 2048 / 2;
entryTxt.y = 2732 / 2 - 200 + i * 60;
popup.addChild(entryTxt);
}
var viralTxt = new Text2('I made my dog react to ' + fartCount + ' farts!\nCan you beat me?\n#FartDog', {
size: 70,
fill: 0x7A5C00,
align: 'center'
});
viralTxt.anchor.set(0.5, 0.5);
viralTxt.x = 2048 / 2;
viralTxt.y = 2732 / 2 + 180;
popup.addChild(viralTxt);
var okBtn = LK.getAsset('fart_btn', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 0.7,
scaleY: 0.7,
x: 2048 / 2 - 180,
y: 2732 / 2 + 320
});
var okTxt = new Text2('OK', {
size: 70,
fill: 0x7A5C00
});
okTxt.anchor.set(0.5, 0.5);
okTxt.x = 0;
okTxt.y = 0;
okBtn.addChild(okTxt);
okBtn.interactive = true;
okBtn.down = function () {
game.removeChild(popup);
};
popup.addChild(okBtn);
// Add a "Challenge Friends" button
var challengeBtn = LK.getAsset('fart_btn', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 0.7,
scaleY: 0.7,
x: 2048 / 2 + 180,
y: 2732 / 2 + 320
});
var challengeTxt = new Text2('Challenge Friends', {
size: 54,
fill: 0xff8000
});
challengeTxt.anchor.set(0.5, 0.5);
challengeTxt.x = 0;
challengeTxt.y = 0;
challengeBtn.addChild(challengeTxt);
challengeBtn.interactive = true;
challengeBtn.down = function () {
// Show a popup with a "copy" message
var sharePopup = new Container();
var shareBg = LK.getAsset('person_leg', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 5.5,
scaleY: 2.5,
x: 2048 / 2,
y: 2732 / 2
});
sharePopup.addChild(shareBg);
var shareMsg = new Text2("Copy this challenge to your friends:\n\nI made my dog react to " + fartCount + " farts! Can you beat me? Play on FartDog! #FartDog", {
size: 54,
fill: 0x7A5C00,
align: 'center'
});
shareMsg.anchor.set(0.5, 0.5);
shareMsg.x = 2048 / 2;
shareMsg.y = 2732 / 2 - 40;
sharePopup.addChild(shareMsg);
var closeShareBtn = LK.getAsset('fart_btn', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 0.7,
scaleY: 0.7,
x: 2048 / 2,
y: 2732 / 2 + 120
});
var closeShareTxt = new Text2('OK', {
size: 54,
fill: 0x7A5C00
});
closeShareTxt.anchor.set(0.5, 0.5);
closeShareTxt.x = 0;
closeShareTxt.y = 0;
closeShareBtn.addChild(closeShareTxt);
closeShareBtn.interactive = true;
closeShareBtn.down = function () {
game.removeChild(sharePopup);
};
sharePopup.addChild(closeShareBtn);
game.addChild(sharePopup);
LK.effects.flashObject(shareBg, 0xfff7b2, 120);
};
popup.addChild(challengeBtn);
game.addChild(popup);
LK.effects.flashObject(bg, 0xfff7b2, 120);
};
game.addChild(shareBtn);
// --- Autism Mode Toggle Button ---
var autismModeBtn = LK.getAsset('fart_btn', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 0.65,
scaleY: 0.65,
x: 250,
y: 2732 - 350
});
var autismModeTxt = new Text2('Autism Mode\nOFF', {
size: 50,
fill: 0x7A5C00,
align: 'center'
});
autismModeTxt.anchor.set(0.5, 0.5);
autismModeTxt.x = 0;
autismModeTxt.y = 0;
autismModeBtn.addChild(autismModeTxt);
autismModeBtn.interactive = true;
autismModeBtn.down = function () {
autismMode = !autismMode;
storage.autismMode = autismMode;
autismModeTxt.setText('Autism Mode\n' + (autismMode ? 'ON' : 'OFF'));
autismModeTxt.fill = autismMode ? 0xff0000 : 0x7A5C00;
LK.effects.flashObject(autismModeBtn, autismMode ? 0xff0000 : 0x83de44, 200);
if (autismMode) {
// Flash screen rainbow to indicate chaos mode is on
var rainbowColors = [0xff0000, 0xffa500, 0xffff00, 0x00ff00, 0x0000ff, 0x4b0082, 0xee82ee];
var idx = 0;
var _rainbowFlash = function rainbowFlash() {
if (idx >= rainbowColors.length) return;
LK.effects.flashScreen(rainbowColors[idx], 120);
idx++;
LK.setTimeout(_rainbowFlash, 120);
};
_rainbowFlash();
// Start auto clicking every 200ms for maximum chaos (only if player has bought auto-clickers)
var hasAutoClickers = false;
for (var aci = 0; aci < autoClickersBought.length; ++aci) {
if (autoClickersBought[aci] > 0) {
hasAutoClickers = true;
break;
}
}
if (hasAutoClickers) {
autismModeAutoClickTimer = LK.setInterval(function () {
if (autismMode && fartBtn.down) {
fartBtn.down(0, 0, {});
}
}, 200);
}
} else {
// Stop auto clicking when autism mode is turned off
if (autismModeAutoClickTimer) {
LK.clearInterval(autismModeAutoClickTimer);
autismModeAutoClickTimer = null;
}
}
};
game.addChild(autismModeBtn);
// Update autism mode button text on load
autismModeTxt.setText('Autism Mode\n' + (autismMode ? 'ON' : 'OFF'));
autismModeTxt.fill = autismMode ? 0xff0000 : 0x7A5C00;
// Prevent accidental tap in top left (menu area): nothing is placed there
// Instructions text (top center, GUI)
var instrTxt = new Text2('Tap the FART button!', {
size: 90,
fill: 0x2D2D2D
});
instrTxt.anchor.set(0.5, 0);
LK.gui.top.addChild(instrTxt);
// --- Clicker Game State ---
var fartCount = 0;
var fartPerClick = 1;
// --- Hunger System Variables ---
var dogHunger = typeof storage.dogHunger === "number" ? storage.dogHunger : 100; // Start with full hunger
var hungerDecayRate = 0.5; // Hunger decreases by 0.5 per second (at 60fps)
var chefBought = !!storage.chefBought;
var chefTimer = null;
var isDead = false;
// --- Food Store Minimize/Show Logic ---
var foodStoreVisible = true;
var foodStoreMinBtn = LK.getAsset('fart_btn', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 0.4,
scaleY: 0.4,
// Move further up and right from the very bottom left, so it doesn't overlap achievements or the menu
x: 600,
y: 2732 - 1000
});
var foodStoreMinTxt = new Text2('Minimize', {
size: 44,
fill: 0x7A5C00
});
foodStoreMinTxt.anchor.set(0.5, 0.5);
foodStoreMinTxt.x = 0;
foodStoreMinTxt.y = 0;
foodStoreMinBtn.addChild(foodStoreMinTxt);
foodStoreMinBtn.interactive = true;
game.addChild(foodStoreMinBtn);
// Create food store, move further up and right, out of the way of achievements and menu
var foodStore = new FoodStore();
foodStore.x = 600;
foodStore.y = 2732 - 1000;
game.addChild(foodStore);
// Minimize/Show handler
foodStoreMinBtn.down = function () {
foodStoreVisible = !foodStoreVisible;
foodStore.visible = foodStoreVisible;
foodStoreMinTxt.setText(foodStoreVisible ? "Minimize" : "Show Food");
LK.effects.flashObject(foodStoreMinBtn, 0xfff7b2, 120);
};
foodStore.visible = true;
foodStoreMinTxt.setText("Minimize");
// If you want the food store to start minimized, uncomment below:
// foodStore.visible = false;
// foodStoreMinTxt.setText("Show Food");
// Create hunger bar
var hungerBar = new HungerBar();
hungerBar.x = 2048 / 2 - 350; // Center it above the dog
hungerBar.y = 900;
game.addChild(hungerBar);
// Initialize chef if already bought
if (chefBought && !chefTimer) {
chefTimer = LK.setInterval(function () {
if (dogHunger < 100 && !isDead) {
dogHunger = Math.min(100, dogHunger + 15);
createFloatingText(dogFace.x + 100, dogFace.y - 100, "Chef feeds +15!", 0x00ff00);
}
}, 3000);
}
// --- Prestige System Variables ---
var prestigeLevel = storage.prestigeLevel || 0;
var prestigePoints = storage.prestigePoints || 0;
var prestigeMultiplier = 1 + prestigeLevel * 0.5; // 50% bonus per prestige
// --- Weekly Challenge Display (moved here to define before updateUI) ---
var weeklyChallenge = {
target: 50000,
progress: 0,
completed: false,
timeLeft: 7 * 24 * 60 * 60 * 1000 // 7 days
};
var challengeTxt = new Text2('Weekly Challenge: ' + weeklyChallenge.target + ' Farts\nProgress: ' + weeklyChallenge.progress, {
size: 50,
fill: 0x2D2D2D
});
challengeTxt.anchor.set(0, 0);
challengeTxt.x = 50;
challengeTxt.y = 150;
LK.gui.top.addChild(challengeTxt);
// --- Prestige Info Display (moved here to define before updateUI) ---
var prestigeTxt = new Text2('Prestige Level: ' + prestigeLevel + ' (x' + prestigeMultiplier.toFixed(1) + ' bonus)', {
size: 50,
fill: 0xff4444
});
prestigeTxt.anchor.set(1, 0);
prestigeTxt.x = 0;
prestigeTxt.y = 150;
LK.gui.topRight.addChild(prestigeTxt);
// --- Prestige Button ---
var prestigeBtn = LK.getAsset('fart_btn', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 0.8,
scaleY: 0.8,
x: 2048 / 2,
y: 250
});
var prestigeBtnTxt = new Text2('PRESTIGE\n(Reset for Bonus)', {
size: 60,
fill: 0xff4444,
align: 'center'
});
prestigeBtnTxt.anchor.set(0.5, 0.5);
prestigeBtnTxt.x = 0;
prestigeBtnTxt.y = 0;
prestigeBtn.addChild(prestigeBtnTxt);
prestigeBtn.interactive = true;
game.addChild(prestigeBtn);
prestigeBtn.down = function () {
if (fartCount >= 1000000) {
// Can only prestige with 1M+ farts
var newPrestigePoints = Math.floor(fartCount / 100000);
prestigePoints += newPrestigePoints;
prestigeLevel++;
// Reset progress but keep prestige bonuses
fartCount = 0;
fartPerClick = 1;
for (var i = 0; i < upgradesBought.length; i++) {
upgradesBought[i] = 0;
}
for (var i = 0; i < autoClickersBought.length; i++) {
autoClickersBought[i] = 0;
if (autoClickerTimers[i]) {
LK.clearInterval(autoClickerTimers[i]);
autoClickerTimers[i] = null;
}
}
// Apply prestige multiplier
prestigeMultiplier = 1 + prestigeLevel * 0.5;
// Save to storage
storage.prestigeLevel = prestigeLevel;
storage.prestigePoints = prestigePoints;
// Celebration
LK.effects.flashScreen(0xffd700, 1000);
createFloatingText(2048 / 2, 1400, "PRESTIGE LEVEL " + prestigeLevel + "!\n+" + newPrestigePoints + " Prestige Points!", 0xffd700);
updateUI();
}
};
// --- Particle System ---
var particles = [];
// --- Dog Nap Event Logic ---
if (!dogNapping && !isDead && Math.random() < 0.0007) {
dogNapping = true;
// Show nap overlay on dog
if (!dogFace.napOverlay) {
dogFace.napOverlay = LK.getAsset('centerCircle', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 2.5,
scaleY: 1.2,
x: 0,
y: 0,
alpha: 0.5,
tint: 0xccccff
});
dogFace.addChild(dogFace.napOverlay);
}
dogFace.napOverlay.alpha = 0.7;
// Zzz text
if (!dogFace.napZzz) {
dogFace.napZzz = new Text2("Zzz...", {
size: 120,
fill: 0x4444ff
});
dogFace.napZzz.anchor.set(0.5, 0.5);
dogFace.napZzz.x = 0;
dogFace.napZzz.y = -300;
dogFace.addChild(dogFace.napZzz);
}
dogFace.napZzz.alpha = 1;
createFloatingText(dogFace.x, dogFace.y - 200, "Dog is napping!", 0x4444ff);
// Nap lasts 3-6 seconds
napTimeout = LK.setTimeout(function () {
dogNapping = false;
if (dogFace.napOverlay) dogFace.napOverlay.alpha = 0;
if (dogFace.napZzz) dogFace.napZzz.alpha = 0;
createFloatingText(dogFace.x, dogFace.y - 200, "Dog woke up!", 0x83de44);
}, 3000 + Math.random() * 3000);
}
var floatingTexts = [];
// Create particle explosion at position
function createParticleExplosion(x, y, color, count) {
count = count || 15;
for (var i = 0; i < count; i++) {
var particle = new Particle();
particle.x = x;
particle.y = y;
// Random velocity
var angle = Math.random() * 2 * Math.PI;
var speed = 5 + Math.random() * 10;
particle.vx = Math.cos(angle) * speed;
particle.vy = Math.sin(angle) * speed - 5; // Upward bias
// Set color
particle.children[0].tint = color || 0xffffff;
// Random life
particle.maxLife = 0.8 + Math.random() * 0.4;
particle.life = particle.maxLife;
particles.push(particle);
game.addChild(particle);
}
}
// Create floating score text
function createFloatingText(x, y, text, color) {
var floatText = new FloatingText();
floatText.x = x;
floatText.y = y;
floatText.setText(text);
floatText.textObj.fill = color || 0xffffff;
floatingTexts.push(floatText);
game.addChild(floatText);
}
// --- Screen shake system
var shakeIntensity = 0;
var shakeDecay = 0.9;
function addScreenShake(intensity) {
shakeIntensity = Math.max(shakeIntensity, intensity);
}
// --- Power-up System ---
var activePowerUps = [];
// Power-up types
var powerUpTypes = {
DOUBLE_FARTS: {
name: "Double Farts",
duration: 10000,
color: 0x00ff00
},
MEGA_COMBO: {
name: "Mega Combo",
duration: 15000,
color: 0xff8000
},
RAINBOW_MODE: {
name: "Rainbow Mode",
duration: 8000,
color: 0xff00ff
},
FART_STORM: {
name: "Fart Storm",
duration: 12000,
color: 0x0080ff
}
};
// Trigger random power-up
function triggerRandomPowerUp() {
var types = Object.keys(powerUpTypes);
var randomType = types[Math.floor(Math.random() * types.length)];
var powerUp = powerUpTypes[randomType];
// Add to active power-ups
activePowerUps.push({
type: randomType,
name: powerUp.name,
timeLeft: powerUp.duration,
color: powerUp.color
});
// Visual feedback
createFloatingText(2048 / 2, 1600, "POWER-UP!\n" + powerUp.name, powerUp.color);
LK.effects.flashScreen(powerUp.color, 500);
createParticleExplosion(2048 / 2, 1600, powerUp.color, 30);
addScreenShake(20);
}
// Check if power-up is active
function hasPowerUp(type) {
for (var i = 0; i < activePowerUps.length; i++) {
if (activePowerUps[i].type === type) return true;
}
return false;
}
// --- Autism Mode State ---
var autismMode = storage.autismMode || false;
var autismModeAutoClickTimer = null;
// --- Combo System ---
var comboCount = 0;
var comboMultiplier = 1;
var lastClickTime = 0;
var comboTimeout = null;
// Reset combo after 2 seconds of no clicking
function resetCombo() {
if (comboCount > 1) {
createFloatingText(2048 / 2, 1400, "Combo Reset!", 0xff6b6b);
}
comboCount = 0;
comboMultiplier = 1;
updateComboUI();
}
function updateComboMultiplier() {
if (comboCount >= 50) comboMultiplier = 5;else if (comboCount >= 25) comboMultiplier = 3;else if (comboCount >= 10) comboMultiplier = 2;else comboMultiplier = 1;
}
// Upgrade definitions: [amount, base cost, cost multiplier]
// Add Chris upgrade as the last upgrade (can only buy once)
var upgrades = [{
amount: 1,
base: 10,
mult: 1.15,
label: "x1"
}, {
amount: 10,
base: 20,
mult: 1.18,
label: "x10"
}, {
amount: 50,
base: 120,
mult: 1.22,
label: "x50"
}, {
amount: 100,
base: 600,
mult: 1.28,
label: "x100"
}, {
amount: 1000,
base: 4000,
mult: 1.35,
label: "x1000"
}, {
amount: 0,
// Chris doesn't increase fartPerClick, but triggers special effect
base: 100000,
mult: 1,
// Not used, can only buy once
label: "Chris (CAT!)"
}, {
// New John upgrade
amount: 10000,
// Drastically increase points per click
base: 50000,
mult: 1,
label: "John (BOOST!)"
}];
// Track how many times each upgrade was bought
var upgradesBought = [0, 0, 0, 0, 0, 0]; // Add slot for Chris
// --- UI Elements ---
var fartCountTxt = new Text2('Farts: 0', {
size: 150,
fill: 0x2D2D2D,
fontWeight: 'bold'
});
// Anchor to top right (right edge, top)
fartCountTxt.anchor.set(1, 0);
// Place at top right using LK.gui.topRight, which will always fit the right border regardless of device size
fartCountTxt.x = 0;
fartCountTxt.y = 40;
LK.gui.topRight.addChild(fartCountTxt);
var fartPerClickTxt = new Text2('Farts/click: 1', {
size: 60,
fill: 0x444444
});
fartPerClickTxt.anchor.set(0.5, 0);
fartPerClickTxt.x = 2048 / 2;
fartPerClickTxt.y = 340;
LK.gui.top.addChild(fartPerClickTxt);
// Combo display
var comboTxt = new Text2('Combo: 0x', {
size: 70,
fill: 0xff6b6b,
stroke: 0x222222,
strokeThickness: 3
});
comboTxt.anchor.set(0.5, 0);
comboTxt.x = 2048 / 2;
comboTxt.y = 420;
LK.gui.top.addChild(comboTxt);
function updateComboUI() {
comboTxt.setText('Combo: ' + comboCount + 'x (Multiplier: ' + comboMultiplier + 'x)');
if (comboCount >= 50) comboTxt.fill = 0xff0080; // Pink for mega combo
else if (comboCount >= 25) comboTxt.fill = 0x8000ff; // Purple for super combo
else if (comboCount >= 10) comboTxt.fill = 0xff8000; // Orange for combo
else comboTxt.fill = 0xff6b6b; // Red for small combo
}
// --- Upgrades UI ---
var upgradeButtons = [];
var upgradeTxts = [];
var upgradeCostTxts = [];
var upgradeYStart = 550;
var upgradeSpacing = 120;
// Shop toggle state
var shopVisible = false; // Start with shop closed
// Create upgrade shop toggle button
var shopBtn = LK.getAsset('fart_btn', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 0.45,
scaleY: 0.45,
// Make square: scaleX and scaleY are equal
x: 400,
y: upgradeYStart - 120
});
shopBtn.interactive = true;
var shopBtnTxt = new Text2('Upgrade Shop', {
size: 70,
fill: 0x7A5C00
});
shopBtnTxt.anchor.set(0.5, 0.5);
shopBtnTxt.x = 0;
shopBtnTxt.y = 0;
shopBtn.addChild(shopBtnTxt);
game.addChild(shopBtn);
// Create upgrade buttons (initially hidden)
for (var i = 0; i < upgrades.length; ++i) {
// Button
var btn = LK.getAsset('fart_btn', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 0.5,
scaleY: 0.5,
x: 400,
y: upgradeYStart + i * upgradeSpacing
});
btn.interactive = true;
// Label
var labelText = i === upgrades.length - 2 ? "John (BOOST!)" : i === upgrades.length - 1 ? "Chris (CAT!)" : 'Upgrade ' + upgrades[i].label;
var txt = new Text2(labelText, {
size: 60,
fill: 0x7A5C00
});
txt.anchor.set(0.5, 0.5);
txt.x = 0;
txt.y = -20;
btn.addChild(txt);
// Cost
var costTxt = new Text2('', {
size: 44,
fill: 0x444444
});
costTxt.anchor.set(0.5, 0.5);
costTxt.x = 0;
costTxt.y = 50;
btn.addChild(costTxt);
// Add to game
game.addChild(btn);
btn.visible = false; // Hide upgrade buttons initially
upgradeButtons.push(btn);
upgradeTxts.push(txt);
upgradeCostTxts.push(costTxt);
}
// --- Chris Cat Upgrade State ---
var chrisCatSpawned = false;
var chrisCatContainer = null;
// --- John Upgrade State ---
var johnSpawned = false;
var johnContainer = null;
var isShowingAchievement = false; // Flag to prevent multiple achievement popups
// --- Crown Trophy & Disco Effect State ---
var crownTrophyContainer = null;
var discoEffectActive = false;
var discoColorPhase = 0;
var discoOverlay = null;
// Shop toggle logic
shopBtn.down = function (x, y, obj) {
shopVisible = !shopVisible;
for (var i = 0; i < upgradeButtons.length; ++i) {
upgradeButtons[i].visible = shopVisible;
}
// Feedback: flash the shop button
LK.effects.flashObject(shopBtn, 0xfff7b2, 120);
};
// --- Helper: Calculate upgrade cost ---
function getUpgradeCost(idx) {
var u = upgrades[idx];
var n = upgradesBought[idx];
// Exponential cost scaling
return idx === upgrades.length - 1 ? 100000 : Math.floor(u.base * Math.pow(u.mult, n));
}
// --- Helper: Update all UI ---
function updateUI() {
fartCountTxt.setText('Farts: ' + fartCount);
fartPerClickTxt.setText('Farts/click: ' + Math.floor(fartPerClick * prestigeMultiplier));
// Update prestige button
if (fartCount >= 1000000) {
prestigeBtn.alpha = 1;
prestigeBtn.interactive = true;
var newPoints = Math.floor(fartCount / 100000);
prestigeBtnTxt.setText('PRESTIGE\n(+' + newPoints + ' Points)');
} else {
prestigeBtn.alpha = 0.5;
prestigeBtn.interactive = false;
prestigeBtnTxt.setText('PRESTIGE\n(Need 1M Farts)');
}
// Update challenge display
challengeTxt.setText('Weekly Challenge: ' + weeklyChallenge.target + ' Farts\nProgress: ' + Math.min(weeklyChallenge.progress, weeklyChallenge.target) + '/' + weeklyChallenge.target);
// Update prestige info
prestigeTxt.setText('Prestige Level: ' + prestigeLevel + ' (x' + prestigeMultiplier.toFixed(1) + ' bonus)\nLogin Streak: ' + loginStreak + ' days');
// Save hunger and chefBought to storage
if (!isDead) {
storage.dogHunger = dogHunger;
storage.chefBought = chefBought;
} else {
// If dead, reset hunger and chefBought in storage
storage.dogHunger = 100;
storage.chefBought = false;
}
// Update food store chef button
if (foodStore && foodStore.updateChefButton) {
foodStore.updateChefButton();
}
// Always keep food store minimize button on top
if (foodStoreMinBtn && foodStoreMinBtn.parent) {
foodStoreMinBtn.parent.removeChild(foodStoreMinBtn);
game.addChild(foodStoreMinBtn);
}
for (var i = 0; i < upgrades.length; ++i) {
var cost = getUpgradeCost(i);
// Apply prestige discount
var adjustedCost = Math.floor(cost / Math.max(1, prestigeLevel * 0.1 + 1));
upgradeCostTxts[i].setText('Cost: ' + (isNaN(adjustedCost) || adjustedCost === Infinity ? '100,000' : adjustedCost));
upgradeButtons[i].alpha = fartCount >= adjustedCost ? 1 : 0.5;
upgradeButtons[i].interactive = fartCount >= adjustedCost;
}
// Show cat if Chris bought
if (chrisCatSpawned && chrisCatContainer && !chrisCatContainer.parent) {
game.addChild(chrisCatContainer);
}
// Show John if bought
if (johnSpawned && johnContainer && !johnContainer.parent) {
game.addChild(johnContainer);
}
// --- Show Crown Trophy and Disco Effect if all achievements except dog teleport are unlocked ---
if (allAchievementsExceptDogTeleportUnlocked()) {
// Only create once
if (!crownTrophyContainer) {
crownTrophyContainer = new Container();
// Trophy base (use person_leg as base)
var trophyBase = LK.getAsset('person_leg', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 2.2,
scaleY: 0.7,
x: 0,
y: 180,
tint: 0xffd700 // gold
});
crownTrophyContainer.addChild(trophyBase);
// Trophy cup (use centerCircle as cup)
var trophyCup = LK.getAsset('centerCircle', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 2.2,
scaleY: 1.5,
x: 0,
y: 60,
tint: 0xffe066 // lighter gold
});
crownTrophyContainer.addChild(trophyCup);
// Dog face inside trophy
var dogInTrophy = LK.getAsset('dog_normal', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 0.7,
scaleY: 0.7,
x: 0,
y: 40
});
crownTrophyContainer.addChild(dogInTrophy);
// Crown (use person_phone as crown, yellow tint)
var crown = LK.getAsset('person_phone', {
anchorX: 0.5,
anchorY: 1,
scaleX: 1.2,
scaleY: 0.7,
x: 0,
y: -60,
tint: 0xffd700
});
crownTrophyContainer.addChild(crown);
// Place trophy above dog face
crownTrophyContainer.x = 2048 / 2;
crownTrophyContainer.y = 800;
game.addChild(crownTrophyContainer);
}
// Start disco effect if not already running
if (!discoEffectActive) {
discoEffectActive = true;
discoColorPhase = 0;
// Create overlay if not present
if (!discoOverlay) {
discoOverlay = LK.getAsset('centerCircle', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 20,
scaleY: 20,
x: 2048 / 2,
y: 1366,
alpha: 0.18,
tint: 0xff00ff
});
game.addChild(discoOverlay);
}
}
} else {
// Remove trophy and disco if not all achievements
if (crownTrophyContainer && crownTrophyContainer.parent) {
crownTrophyContainer.parent.removeChild(crownTrophyContainer);
}
crownTrophyContainer = null;
discoEffectActive = false;
if (discoOverlay && discoOverlay.parent) {
discoOverlay.parent.removeChild(discoOverlay);
}
discoOverlay = null;
}
}
updateUI();
// Start relaxing piano background music
LK.playMusic('relaxing_piano', {
loop: true,
fade: {
start: 0,
end: 0.3,
duration: 2000
}
});
// --- Music Control Button ---
var musicPlaying = true;
var musicBtn = LK.getAsset('fart_btn', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 0.45,
scaleY: 0.45,
x: 180,
y: 2732 - 120
});
var musicBtnTxt = new Text2('Music: ON', {
size: 50,
fill: 0x7A5C00
});
musicBtnTxt.anchor.set(0.5, 0.5);
musicBtnTxt.x = 0;
musicBtnTxt.y = 0;
musicBtn.addChild(musicBtnTxt);
musicBtn.interactive = true;
musicBtn.down = function () {
musicPlaying = !musicPlaying;
if (musicPlaying) {
LK.playMusic('relaxing_piano', {
loop: true,
fade: {
start: 0,
end: 0.3,
duration: 1000
}
});
musicBtnTxt.setText('Music: ON');
musicBtnTxt.fill = 0x7A5C00;
} else {
LK.stopMusic();
musicBtnTxt.setText('Music: OFF');
musicBtnTxt.fill = 0x888888;
}
LK.effects.flashObject(musicBtn, 0xfff7b2, 120);
};
game.addChild(musicBtn);
// --- Upgrade Button Handlers ---
for (var i = 0; i < upgrades.length; ++i) {
(function (idx) {
upgradeButtons[idx].down = function (x, y, obj) {
var cost = getUpgradeCost(idx);
// Chris upgrade (last one)
if (idx === upgrades.length - 1) {
if (fartCount >= cost) {
fartCount -= cost;
upgradesBought[idx]++;
// Spawn cat
if (!chrisCatSpawned) {
chrisCatSpawned = true;
// Create cat container
chrisCatContainer = new Container();
// Use Chris asset for cat body
var catBody = LK.getAsset('Chris', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 3.2,
scaleY: 2.2
});
chrisCatContainer.addChild(catBody);
// Cat face (text) - Removed
// var catFace = new Text2('😼', {
// size: 160,
// fill: 0x222222
// });
// catFace.anchor.set(0.5, 0.5);
// catFace.x = 0;
// catFace.y = -10;
// chrisCatContainer.addChild(catFace);
// Cat label
var catLabel = new Text2('Chris the Cat!', {
size: 60,
fill: 0x444444
});
catLabel.anchor.set(0.5, 0);
catLabel.x = 0;
catLabel.y = 110;
chrisCatContainer.addChild(catLabel);
// Place cat right under the fart button
chrisCatContainer.x = 2048 / 2;
chrisCatContainer.y = 2000 + 170; // Position below fart button
game.addChild(chrisCatContainer);
// Animate cat in
chrisCatContainer.alpha = 0;
tween(chrisCatContainer, {
alpha: 1
}, {
duration: 600,
easing: tween.cubicOut
});
// Drastically increase auto fart rate: multiply all autoClickers' amount by 5
for (var aci = 0; aci < autoClickers.length; ++aci) {
autoClickers[aci].amount *= 5;
}
// If any autoClicker is already running, clear and restart to apply new rate
for (var aci = 0; aci < autoClickers.length; ++aci) {
if (autoClickersBought[aci] > 0 && autoClickerTimers[aci]) {
LK.clearInterval(autoClickerTimers[aci]);
(function (aci2) {
autoClickerTimers[aci2] = LK.setInterval(function () {
fartCount += autoClickers[aci2].amount * autoClickersBought[aci2] * fartPerClick;
updateUI();
dogFace.react();
// Dog says a random gross word
if (!dogFace.speechBubble) {
var bubble = new Text2('', {
size: 90,
fill: 0xffffff,
stroke: 0x222222,
strokeThickness: 8,
wordWrap: true,
wordWrapWidth: 600,
align: 'center'
});
bubble.anchor.set(0.5, 1);
bubble.x = 0;
bubble.y = -420;
bubble.alpha = 0;
dogFace.addChild(bubble);
dogFace.speechBubble = bubble;
}
var grossWords = ["Yuck!", "Ew!", "Disgusting!", "Nasty!", "Foul!", "Repulsive!", "Stinky!", "Revolting!", "Pee-yew!", "Ugh!", "Gross!", "Barf!", "Ick!", "Putrid!", "Rank!", "Vile!", "Sickening!", "Odious!", "No way!", "Bleh!", "Cringe!", "Yikes!", "Gag!", "Pungent!", "Awful!", "Horrid!", "Stench!", "What is that?!", "Oh no!", "Why?!", "Ewww!", "Yeesh!", "Blech!", "GROSS!", "Noxious!", "Obnoxious!", "Yowza!", "Oof!", "Gnar!", "Yow!", "Eek!", "Yowch!", "Ooze!", "Funky!", "Rancid!", "Rotten!", "Whew!", "Stank!", "Phew!", "GROSS-out!", "Repugnant!", "Skunky!", "Malodorous!", "Putrescent!", "Fetid!", "Mephitic!", "Moldy!", "Dank!", "Manky!", "Cruddy!", "Crud!", "Yuuuck!", "Ew, dude!", "Stale!", "Funky town!", "Reek!", "Stale cheese!", "Cheesy!", "Mold!", "Ew, stinky!", "Ew, gross!", "Ew, nasty!", "Ew, barf!", "Ew, icky!", "Ew, yuck!", "Ew, blech!", "Ew, pew!", "Ew, phew!", "Ew, stank!", "Ew, rotten!", "Ew, rancid!", "Ew, vile!", "Ew, sick!", "Ew, odious!", "Ew, horrid!", "Ew, foul!", "Ew, revolting!", "Ew, repulsive!", "Ew, stench!", "Ew, noxious!", "Ew, obnoxious!", "Ew, gnarly!", "Ew, yowza!", "Ew, oof!", "Ew, yow!", "Ew, eek!", "Ew, yowch!", "Ew, ooze!", "Ew, funky!", "Ew, whew!", "Ew, gross-out!", "Ew, what is that?!", "Ew, oh no!", "Ew, why?!", "Ew, yeesh!", "Ew, yikes!", "Ew, cringe!", "Ew, gag!", "Ew, pungent!", "Ew, awful!", "Ew, stank!", "Ew, phew!", "Ew, barf!", "Ew, ick!", "Ew, putrid!", "Ew, rank!", "Ew, vile!", "Ew, sickening!", "Ew, odious!", "Ew, bleh!", "Ew, gross!", "Ew, stench!", "Ew, no way!", "Ew, yuck!", "Ew, ewww!", "Ew, blech!", "Ew, GROSS!", "Ew, yikes!", "Ew, cringe!", "Ew, gag!", "Ew, pungent!", "Ew, horrid!", "Ew, stench!", "Ew, what is that?!", "Ew, oh no!", "Ew, why?!", "Ew, yeesh!", "Ew, yikes!", "Ew, cringe!", "Ew, gag!", "Ew, pungent!", "Ew, awful!", "Ew, horrid!", "Ew, stench!", "Ew, what is that?!", "Ew, oh no!", "Ew, why?!", "Ew, ewww!", "Ew, yeesh!", "Ew, blech!", "Ew, GROSS!", "Ew, noxious!", "Ew, obnoxious!", "Ew, yowza!", "Ew, oof!", "Ew, gnar!", "Ew, yow!", "Ew, eek!", "Ew, yowch!", "Ew, ooze!", "Ew, funky!", "Ew, rancid!", "Ew, rotten!", "Ew, whew!", "Ew, stank!", "Ew, phew!", "Ew, GROSS-out!"];
var word = grossWords[Math.floor(Math.random() * grossWords.length)];
dogFace.speechBubble.setText(word);
dogFace.speechBubble.alpha = 1;
tween(dogFace.speechBubble, {
alpha: 0
}, {
duration: 900,
delay: 500,
easing: tween.cubicIn
});
dogFace.x = 2048 / 2;
dogFace.lastX = dogFace.x;
LK.getSound('fart_snd').play();
}, autoClickers[aci2].interval);
})(aci);
}
}
}
updateUI();
LK.effects.flashObject(upgradeButtons[idx], 0xeeeecc, 120);
}
return;
}
// John upgrade (second last one)
if (idx === upgrades.length - 2) {
if (fartCount >= cost) {
fartCount -= cost;
upgradesBought[idx]++;
// Spawn John
if (!johnSpawned) {
johnSpawned = true;
// Create John container
johnContainer = new Container();
// Use John asset for body
var johnBody = LK.getAsset('John', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 3.2,
scaleY: 2.2
});
johnContainer.addChild(johnBody);
// John label
var johnLabel = new Text2('John the Booster!', {
size: 60,
fill: 0x444444
});
johnLabel.anchor.set(0.5, 0);
johnLabel.x = 0;
johnLabel.y = 110;
johnContainer.addChild(johnLabel);
// Place John next to Chris under the fart button
johnContainer.x = 2048 / 2 + 150; // Position John next to Chris
johnContainer.y = 2000 + 170; // Align with Chris's Y position
game.addChild(johnContainer);
// Animate John in
johnContainer.alpha = 0;
tween(johnContainer, {
alpha: 1
}, {
duration: 600,
easing: tween.cubicOut
});
}
updateUI();
LK.effects.flashObject(upgradeButtons[idx], 0xeeeecc, 120);
}
return;
}
// Normal upgrades
if (fartCount >= cost) {
fartCount -= cost;
upgradesBought[idx]++;
fartPerClick += upgrades[idx].amount;
updateUI();
// Feedback
LK.effects.flashObject(upgradeButtons[idx], 0xeeeecc, 120);
}
};
})(i);
}
// --- Fart Button Handler (Clicker) ---
// Dog nap event: sometimes the dog naps and you can't fart for a few seconds
var dogNapping = false;
var napTimeout = null;
fartBtn.down = function (x, y, obj) {
if (dogNapping) {
createFloatingText(fartBtn.x, fartBtn.y - 120, "Dog is napping!", 0x888888);
LK.effects.flashObject(fartBtn, 0x888888, 120);
return;
}
// Animate button
fartBtn.animatePress();
// Button color flash for feedback
LK.effects.flashObject(fartBtn, 0xfff7b2, 120);
// Play fart sound
LK.getSound('fart_snd').play();
// --- COMBO SYSTEM ---
var now = Date.now();
if (now - lastClickTime < 2000) {
// Within 2 seconds
comboCount++;
} else {
comboCount = 1;
}
lastClickTime = now;
// Clear existing combo timeout
if (comboTimeout) {
LK.clearTimeout(comboTimeout);
}
// Set new combo timeout
comboTimeout = LK.setTimeout(resetCombo, 2000);
updateComboMultiplier();
updateComboUI();
// Add particle explosion at button
createParticleExplosion(fartBtn.x, fartBtn.y - 50, 0xfff7b2, 8 + Math.min(comboCount, 20));
// Add screen shake based on combo
addScreenShake(2 + Math.min(comboCount * 0.5, 15));
// Show combo floating text for milestone combos
if (comboCount % 10 === 0 && comboCount >= 10) {
createFloatingText(fartBtn.x + 150, fartBtn.y - 100, "COMBO x" + comboCount + "!", 0xff8000);
}
// --- CHAOS MODE: Every fart triggers a storm of effects when autism mode is ON! ---
if (autismMode) {
// 1. Rapid screen shake
var chaosShakeTimes = 16 + Math.floor(Math.random() * 8);
var _chaosShake = function chaosShake(n) {
if (n <= 0) {
game.x = 0;
return;
}
game.x = n % 2 === 0 ? 40 + Math.random() * 30 : -40 - Math.random() * 30;
game.y = n % 3 === 0 ? 30 + Math.random() * 20 : -30 - Math.random() * 20;
LK.setTimeout(function () {
_chaosShake(n - 1);
}, 18 + Math.floor(Math.random() * 10));
};
_chaosShake(chaosShakeTimes);
// 2. Random color strobe on dog face and fart button
var chaosStrobeColors = [0xff0000, 0x00ff00, 0x0000ff, 0xffff00, 0xff00ff, 0x00ffff, 0xffffff, 0x7ec850, 0xf06292, 0xffeb3b, 0x9c27b0, 0xff5722, 0x00bcd4, 0xe91e63];
var chaosStrobeIdx = 0;
var chaosStrobeMax = 10 + Math.floor(Math.random() * 6);
var chaosDogParts = [];
if (dogFace.children && dogFace.children.length > 0) {
for (var i = 0; i < dogFace.children.length; ++i) {
if (dogFace.children[i] && typeof dogFace.children[i].tint !== "undefined") {
chaosDogParts.push(dogFace.children[i]);
}
}
}
var chaosBtnParts = [];
if (fartBtn.children && fartBtn.children.length > 0) {
for (var i = 0; i < fartBtn.children.length; ++i) {
if (fartBtn.children[i] && typeof fartBtn.children[i].tint !== "undefined") {
chaosBtnParts.push(fartBtn.children[i]);
}
}
}
var chaosOriginalDogTints = [];
for (var i = 0; i < chaosDogParts.length; ++i) {
chaosOriginalDogTints.push(chaosDogParts[i].tint);
}
var chaosOriginalBtnTints = [];
for (var i = 0; i < chaosBtnParts.length; ++i) {
chaosOriginalBtnTints.push(chaosBtnParts[i].tint);
}
var _chaosStrobe = function chaosStrobe() {
if (chaosStrobeIdx >= chaosStrobeMax) {
// Restore original tints
for (var i = 0; i < chaosDogParts.length; ++i) {
chaosDogParts[i].tint = chaosOriginalDogTints[i];
}
for (var i = 0; i < chaosBtnParts.length; ++i) {
chaosBtnParts[i].tint = chaosOriginalBtnTints[i];
}
return;
}
var color = chaosStrobeColors[Math.floor(Math.random() * chaosStrobeColors.length)];
for (var i = 0; i < chaosDogParts.length; ++i) {
chaosDogParts[i].tint = color;
}
for (var i = 0; i < chaosBtnParts.length; ++i) {
chaosBtnParts[i].tint = color;
}
// Quick screen flash for extra chaos
LK.effects.flashScreen(color, 40 + Math.floor(Math.random() * 30));
chaosStrobeIdx++;
LK.setTimeout(_chaosStrobe, 40 + Math.floor(Math.random() * 30));
};
_chaosStrobe();
// 3. Emoji explosion: spawn a burst of random emojis from the dog face
var chaosEmojis = ["💥", "💨", "😂", "🤪", "😱", "😜", "🤯", "🔥", "💩", "🐶", "🌈", "⭐", "✨", "😵", "😆", "😹", "😛", "😲", "😬", "😺", "😻", "😈", "👻", "🦴", "🍔", "🍕", "🍟", "🍭", "🍦", "🍉", "🍌", "🍩", "🍪", "🥨", "🥓", "🥚", "🥑", "🥕", "🥦", "🥒", "🥬", "🥥", "🥜", "🥨", "🥯", "🥞", "🥩", "🥠", "🥡", "🥢", "🥤", "🥣", "🥧", "🥨", "🥚", "🥓", "🥩", "🥞", "🥯", "🥠", "🥡", "🥢", "🥤", "🥣", "🥧"];
var chaosEmojiCount = 0;
var chaosEmojiMax = 12 + Math.floor(Math.random() * 8);
var _chaosEmoji = function chaosEmoji() {
if (chaosEmojiCount >= chaosEmojiMax) return;
var emoji = chaosEmojis[Math.floor(Math.random() * chaosEmojis.length)];
var emojiTxt = new Text2(emoji, {
size: 90 + Math.floor(Math.random() * 60),
fill: 0xffffff,
align: 'center'
});
emojiTxt.anchor.set(0.5, 0.5);
emojiTxt.x = dogFace.x + (-120 + Math.random() * 240);
emojiTxt.y = dogFace.y + (-120 + Math.random() * 240);
emojiTxt.alpha = 1;
game.addChild(emojiTxt);
// Animate flying out in a random direction
var dx = -400 + Math.random() * 800;
var dy = -600 + Math.random() * 1200;
tween(emojiTxt, {
x: emojiTxt.x + dx,
y: emojiTxt.y + dy,
alpha: 0
}, {
duration: 700 + Math.random() * 400,
easing: tween.cubicOut,
onFinish: function onFinish() {
if (emojiTxt.parent) emojiTxt.parent.removeChild(emojiTxt);
}
});
chaosEmojiCount++;
LK.setTimeout(_chaosEmoji, 30 + Math.floor(Math.random() * 30));
};
_chaosEmoji();
// 4. Randomly pulse the background color
var chaosBgColors = [0xffe066, 0x7ec850, 0x4fc3f7, 0xf06292, 0xffeb3b, 0x9c27b0, 0xff5722, 0x00bcd4, 0x8bc34a, 0xe91e63, 0xffffff, 0x000000];
var chaosBgIdx = 0;
var chaosBgMax = 6 + Math.floor(Math.random() * 4);
var originalBgChaos = 0xE3F6FF;
var _chaosBgPulse = function chaosBgPulse() {
if (chaosBgIdx >= chaosBgMax) {
game.setBackgroundColor(originalBgChaos);
return;
}
var color = chaosBgColors[Math.floor(Math.random() * chaosBgColors.length)];
game.setBackgroundColor(color);
chaosBgIdx++;
LK.setTimeout(_chaosBgPulse, 50 + Math.floor(Math.random() * 40));
};
_chaosBgPulse();
// 5. Randomly scale and rotate the dog face for a moment
var chaosScale = 0.7 + Math.random() * 1.6;
var chaosRot = -Math.PI + Math.random() * (2 * Math.PI);
tween(dogFace, {
scaleX: chaosScale,
scaleY: chaosScale,
rotation: chaosRot
}, {
duration: 120,
easing: tween.cubicIn,
onFinish: function onFinish() {
tween(dogFace, {
scaleX: 1,
scaleY: 1,
rotation: 0
}, {
duration: 180,
easing: tween.cubicOut
});
}
});
// 6. Randomly move the fart button for a moment
var fartBtnOrigX = fartBtn.x;
var fartBtnOrigY = fartBtn.y;
var chaosBtnDX = -80 + Math.random() * 160;
var chaosBtnDY = -60 + Math.random() * 120;
tween(fartBtn, {
x: fartBtnOrigX + chaosBtnDX,
y: fartBtnOrigY + chaosBtnDY
}, {
duration: 90,
easing: tween.cubicIn,
onFinish: function onFinish() {
tween(fartBtn, {
x: fartBtnOrigX,
y: fartBtnOrigY
}, {
duration: 120,
easing: tween.cubicOut
});
}
});
// 7. Occasionally (10% chance) spawn a huge emoji in the center that fades out
if (Math.random() < 0.1) {
var bigEmoji = chaosEmojis[Math.floor(Math.random() * chaosEmojis.length)];
var bigEmojiTxt = new Text2(bigEmoji, {
size: 400 + Math.floor(Math.random() * 200),
fill: 0xffffff,
align: 'center'
});
bigEmojiTxt.anchor.set(0.5, 0.5);
bigEmojiTxt.x = 2048 / 2;
bigEmojiTxt.y = 2732 / 2;
bigEmojiTxt.alpha = 1;
game.addChild(bigEmojiTxt);
tween(bigEmojiTxt, {
alpha: 0,
scaleX: 2,
scaleY: 2
}, {
duration: 700,
easing: tween.cubicOut,
onFinish: function onFinish() {
if (bigEmojiTxt.parent) bigEmojiTxt.parent.removeChild(bigEmojiTxt);
}
});
}
} // End autism mode chaos effects
// --- MEGA FART SPECIAL EFFECTS ---
if (comboCount >= 100) {
// MEGA FART at 100+ combo!
LK.effects.flashScreen(0xffffff, 300);
createParticleExplosion(dogFace.x, dogFace.y, 0xffffff, 50);
addScreenShake(30);
// Bonus farts for mega combo
fartCount += 1000;
createFloatingText(dogFace.x, dogFace.y - 200, "MEGA FART BONUS!\n+1000 Farts!", 0xffffff);
// Dog reaction
if (!dogFace.speechBubble) {
var bubble = new Text2('', {
size: 90,
fill: 0xffffff,
stroke: 0x222222,
strokeThickness: 8,
wordWrap: true,
wordWrapWidth: 600,
align: 'center'
});
bubble.anchor.set(0.5, 1);
bubble.x = 0;
bubble.y = -420;
bubble.alpha = 0;
dogFace.addChild(bubble);
dogFace.speechBubble = bubble;
}
dogFace.speechBubble.setText("MEGA FART!!!\nI CAN'T TAKE IT!");
dogFace.speechBubble.alpha = 1;
tween(dogFace.speechBubble, {
alpha: 0
}, {
duration: 1500,
delay: 1000,
easing: tween.cubicIn
});
}
// Dog reacts
// --- Fun: Randomize dog face (normal, react, or silly) and rare golden fart event ---
var goldenFart = false;
if (Math.random() < 0.01) {
// 1% chance for golden fart
goldenFart = true;
fartCount += 1000;
// Golden fart effect: flash screen gold, show special text
LK.effects.flashScreen(0xffe066, 800);
if (!dogFace.speechBubble) {
var bubble = new Text2('', {
size: 90,
fill: 0xffffff,
stroke: 0x222222,
strokeThickness: 8,
wordWrap: true,
wordWrapWidth: 600,
align: 'center'
});
bubble.anchor.set(0.5, 1);
bubble.x = 0;
bubble.y = -420;
bubble.alpha = 0;
dogFace.addChild(bubble);
dogFace.speechBubble = bubble;
}
dogFace.speechBubble.setText("💛 GOLDEN FART! 💛\n+1000 Farts!");
dogFace.speechBubble.alpha = 1;
tween(dogFace.speechBubble, {
alpha: 0
}, {
duration: 1200,
delay: 800,
easing: tween.cubicIn
});
// Dog face flashes gold
tween(dogFace, {
alpha: 0.5
}, {
duration: 100,
yoyo: true,
repeat: 1,
onFinish: function onFinish() {
dogFace.alpha = 1;
}
});
} else {
// 10% chance for silly face (react stays longer)
if (Math.random() < 0.1) {
dogFace.showReact();
LK.setTimeout(function () {
dogFace.showNormal();
dogFace.x = 2048 / 2;
}, 1200);
} else {
dogFace.react();
}
}
// Dog says a random synonym for 'gross'
if (!dogFace.speechBubble) {
// Create speech bubble if not already present
var bubble = new Text2('', {
size: 90,
fill: 0xffffff,
stroke: 0x222222,
strokeThickness: 8,
wordWrap: true,
wordWrapWidth: 600,
align: 'center'
});
bubble.anchor.set(0.5, 1);
bubble.x = 0;
bubble.y = -420;
bubble.alpha = 0;
dogFace.addChild(bubble);
dogFace.speechBubble = bubble;
}
// Check if dog is wearing the top hat (fancy mode)
var isWearingTopHat = false;
if (hatStore && hatStore.equippedHat) {
isWearingTopHat = true;
}
var grossWords;
if (isWearingTopHat) {
// Fancy synonyms for gross while wearing top hat
grossWords = ["Absolutely abhorrent!", "Utterly reprehensible!", "Quite unsavory!", "Most disagreeable!", "Thoroughly distasteful!", "Decidedly unpalatable!", "Exceedingly offensive!", "Remarkably repugnant!", "Profoundly disturbing!", "Extraordinarily vile!", "Supremely loathsome!", "Undeniably detestable!", "Monumentally revolting!", "Categorically objectionable!", "Fundamentally deplorable!", "Intrinsically nauseating!", "Quintessentially abominable!", "Indubitably repulsive!", "Unquestionably offensive!", "Irrefutably disgusting!", "Good heavens!", "My word!", "How unseemly!", "Quite dreadful!", "Most unbecoming!", "Rather appalling!", "Terribly vulgar!", "Frightfully crude!", "Awfully uncouth!", "Shockingly improper!", "Disgracefully crass!", "Regrettably tactless!", "Lamentably coarse!", "Woefully inappropriate!", "Deplorably unrefined!", "Insufferably boorish!", "Intolerably barbaric!", "Unacceptably gauche!", "Abhorrently uncivilized!", "Contemptibly lowbrow!"];
} else {
// Regular gross words for normal mode
grossWords = ["Yuck!", "Ew!", "Disgusting!", "Nasty!", "Foul!", "Repulsive!", "Stinky!", "Revolting!", "Pee-yew!", "Ugh!", "Gross!", "Barf!", "Ick!", "Putrid!", "Rank!", "Vile!", "Sickening!", "Odious!", "No way!", "Bleh!", "Cringe!", "Yikes!", "Gag!", "Pungent!", "Awful!", "Horrid!", "Stench!", "What is that?!", "Oh no!", "Why?!", "Ewww!", "Yeesh!", "Blech!", "GROSS!", "Noxious!", "Obnoxious!", "Yowza!", "Oof!", "Gnar!", "Yow!", "Eek!", "Yowch!", "Ooze!", "Funky!", "Rancid!", "Rotten!", "Whew!", "Stank!", "Phew!", "GROSS-out!",
// More synonyms
"Repugnant!", "Skunky!", "Malodorous!", "Putrescent!", "Fetid!", "Mephitic!", "Moldy!", "Dank!", "Manky!", "Cruddy!", "Crud!", "Yuuuck!", "Ew, dude!", "Stale!", "Funky town!", "Reek!", "Stale cheese!", "Cheesy!", "Mold!", "Ew, stinky!", "Ew, gross!", "Ew, nasty!", "Ew, barf!", "Ew, icky!", "Ew, yuck!", "Ew, blech!", "Ew, pew!", "Ew, phew!", "Ew, stank!", "Ew, rotten!", "Ew, rancid!", "Ew, vile!", "Ew, sick!", "Ew, odious!", "Ew, horrid!", "Ew, foul!", "Ew, revolting!", "Ew, repulsive!", "Ew, stench!", "Ew, noxious!", "Ew, obnoxious!", "Ew, gnarly!", "Ew, yowza!", "Ew, oof!", "Ew, yow!", "Ew, eek!", "Ew, yowch!", "Ew, ooze!", "Ew, funky!", "Ew, whew!", "Ew, gross-out!", "Ew, what is that?!", "Ew, oh no!", "Ew, why?!", "Ew, yeesh!", "Ew, yikes!", "Ew, cringe!", "Ew, gag!", "Ew, pungent!", "Ew, awful!", "Ew, stank!", "Ew, phew!", "Ew, barf!", "Ew, ick!", "Ew, putrid!", "Ew, rank!", "Ew, vile!", "Ew, sickening!", "Ew, odious!", "Ew, bleh!", "Ew, gross!", "Ew, stench!", "Ew, no way!", "Ew, yuck!", "Ew, ewww!", "Ew, blech!", "Ew, GROSS!", "Ew, yikes!", "Ew, cringe!", "Ew, gag!", "Ew, pungent!", "Ew, horrid!", "Ew, stench!", "Ew, what is that?!", "Ew, oh no!", "Ew, why?!", "Ew, yeesh!", "Ew, yikes!", "Ew, cringe!", "Ew, gag!", "Ew, pungent!", "Ew, awful!", "Ew, horrid!", "Ew, stench!", "Ew, what is that?!", "Ew, oh no!", "Ew, why?!", "Ew, ewww!", "Ew, yeesh!", "Ew, blech!", "Ew, GROSS!", "Ew, noxious!", "Ew, obnoxious!", "Ew, yowza!", "Ew, oof!", "Ew, gnar!", "Ew, yow!", "Ew, eek!", "Ew, yowch!", "Ew, ooze!", "Ew, funky!", "Ew, rancid!", "Ew, rotten!", "Ew, whew!", "Ew, stank!", "Ew, phew!", "Ew, GROSS-out!"];
}
var word = grossWords[Math.floor(Math.random() * grossWords.length)];
dogFace.speechBubble.setText(word);
dogFace.speechBubble.alpha = 1;
tween(dogFace.speechBubble, {
alpha: 0
}, {
duration: 900,
delay: 500,
easing: tween.cubicIn
});
// Dog teleports to center and stops sliding for a moment
dogFace.x = 2048 / 2;
dogFace.lastX = dogFace.x;
// --- Fun: Rare rainbow fart event (0.5% chance) ---
if (Math.random() < 0.005) {
// Rainbow fart: flash screen rainbow, show rainbow text, dog face rainbow overlay
var rainbowColors = [0xff0000, 0xffa500, 0xffff00, 0x00ff00, 0x0000ff, 0x4b0082, 0xee82ee];
var idx = 0;
var _rainbowFlash = function rainbowFlash() {
if (idx >= rainbowColors.length) return;
LK.effects.flashScreen(rainbowColors[idx], 120);
idx++;
LK.setTimeout(_rainbowFlash, 120);
};
_rainbowFlash();
if (!dogFace.speechBubble) {
var bubble = new Text2('', {
size: 90,
fill: 0xffffff,
stroke: 0x222222,
strokeThickness: 8,
wordWrap: true,
wordWrapWidth: 600,
align: 'center'
});
bubble.anchor.set(0.5, 1);
bubble.x = 0;
bubble.y = -420;
bubble.alpha = 0;
dogFace.addChild(bubble);
dogFace.speechBubble = bubble;
}
dogFace.speechBubble.setText("🌈 RAINBOW FART! 🌈");
dogFace.speechBubble.alpha = 1;
tween(dogFace.speechBubble, {
alpha: 0
}, {
duration: 1200,
delay: 800,
easing: tween.cubicIn
});
// Rainbow overlay on dog face
if (!dogFace.rainbowOverlay) {
dogFace.rainbowOverlay = LK.getAsset('centerCircle', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 8,
scaleY: 8,
x: 0,
y: 0,
alpha: 0.4,
tint: 0xffffff
});
dogFace.addChild(dogFace.rainbowOverlay);
}
dogFace.rainbowOverlay.alpha = 0.7;
var rainbowIdx = 0;
var _rainbowTint = function rainbowTint() {
if (rainbowIdx >= rainbowColors.length) {
dogFace.rainbowOverlay.alpha = 0;
return;
}
dogFace.rainbowOverlay.tint = rainbowColors[rainbowIdx];
rainbowIdx++;
LK.setTimeout(_rainbowTint, 120);
};
_rainbowTint();
}
// --- Rare Event System ---
var rareEvents = ['GOLDEN_DOG', 'FART_TORNADO', 'RAINBOW_EXPLOSION', 'TIME_WARP', 'MEGA_MULTIPLIER'];
var rareEventChance = 0.001 + prestigeLevel * 0.0005; // Increases with prestige
if (Math.random() < rareEventChance) {
var event = rareEvents[Math.floor(Math.random() * rareEvents.length)];
switch (event) {
case 'GOLDEN_DOG':
fartCount += 10000 * prestigeMultiplier;
createFloatingText(dogFace.x, dogFace.y - 200, "GOLDEN DOG EVENT!\n+10,000 Farts!", 0xffd700);
LK.effects.flashScreen(0xffd700, 800);
// Turn dog golden temporarily
for (var i = 0; i < dogFace.children.length; i++) {
if (dogFace.children[i] && typeof dogFace.children[i].tint !== "undefined") {
var part = dogFace.children[i];
var oldTint = part.tint;
part.tint = 0xffd700;
LK.setTimeout(function (p, t) {
return function () {
p.tint = t;
};
}(part, oldTint), 3000);
}
}
break;
case 'FART_TORNADO':
comboCount += 50;
updateComboMultiplier();
createFloatingText(2048 / 2, 1500, "FART TORNADO!\n+50 Combo!", 0x0080ff);
// Create tornado effect
for (var t = 0; t < 20; t++) {
(function (index) {
LK.setTimeout(function () {
createParticleExplosion(2048 / 2 + Math.cos(index * 0.3) * 200, 1500 + Math.sin(index * 0.3) * 100, 0x0080ff, 8);
}, index * 50);
})(t);
}
break;
case 'TIME_WARP':
// Boost all auto-clickers for 30 seconds
createFloatingText(2048 / 2, 1600, "TIME WARP!\nAuto-Clickers x5 for 30s!", 0xff00ff);
activePowerUps.push({
type: 'TIME_WARP',
name: 'Time Warp',
timeLeft: 30000,
color: 0xff00ff
});
break;
}
}
// Apply combo multiplier and power-up bonuses to fart gain calculation
var totalGain = fartPerClick * comboMultiplier * prestigeMultiplier;
// Double farts power-up
if (hasPowerUp('DOUBLE_FARTS')) {
totalGain *= 2;
}
// Mega combo power-up
if (hasPowerUp('MEGA_COMBO')) {
totalGain *= 1 + comboCount * 0.1;
}
// Time warp bonus
if (hasPowerUp('TIME_WARP')) {
totalGain *= 3;
}
// Weekly challenge progress
weeklyChallenge.progress += Math.floor(totalGain);
if (weeklyChallenge.progress >= weeklyChallenge.target && !weeklyChallenge.completed) {
weeklyChallenge.completed = true;
var reward = 50000 + prestigeLevel * 10000;
fartCount += reward;
createFloatingText(2048 / 2, 1200, "WEEKLY CHALLENGE COMPLETE!\n+" + reward + " Farts!", 0x00ff00);
storage.weeklyCompleted = true;
}
fartCount += Math.floor(totalGain);
// Show floating score for big gains
if (totalGain > fartPerClick) {
createFloatingText(fartBtn.x - 150, fartBtn.y - 100, "+" + totalGain + " Farts!", 0x83de44);
}
// Trigger random power-up chance (2% base, increases with combo)
var powerUpChance = 0.02 + comboCount * 0.001;
if (Math.random() < powerUpChance) {
triggerRandomPowerUp();
}
// --- Fun: Every 17th fart, color strobe and screen flash for visual stimulation ---
// Only trigger this effect in autism mode!
if (autismMode && fartCount > 0 && fartCount % 17 === 0) {
// Color strobe on dog face
var strobeColors = [0xff0000, 0x00ff00, 0x0000ff, 0xffff00, 0xff00ff, 0x00ffff, 0xffffff];
var strobeIdx = 0;
var strobeMax = 7;
var strobeDogParts = [];
if (dogFace.children && dogFace.children.length > 0) {
for (var i = 0; i < dogFace.children.length; ++i) {
if (dogFace.children[i] && typeof dogFace.children[i].tint !== "undefined") {
strobeDogParts.push(dogFace.children[i]);
}
}
}
var strobeOriginalTints = [];
for (var i = 0; i < strobeDogParts.length; ++i) {
strobeOriginalTints.push(strobeDogParts[i].tint);
}
var _doStrobe = function doStrobe() {
// Check if autism mode is still active before continuing strobe
if (!autismMode || strobeIdx >= strobeMax) {
// Restore original tints
for (var i = 0; i < strobeDogParts.length; ++i) {
strobeDogParts[i].tint = strobeOriginalTints[i];
}
return;
}
var color = strobeColors[strobeIdx % strobeColors.length];
for (var i = 0; i < strobeDogParts.length; ++i) {
strobeDogParts[i].tint = color;
}
// Quick screen flash for extra stimulation
LK.effects.flashScreen(color, 60);
strobeIdx++;
LK.setTimeout(_doStrobe, 60);
};
_doStrobe();
}
// --- Fun: Every 33rd fart, dog face wiggles side to side ---
if (fartCount > 0 && fartCount % 33 === 0) {
var _doWiggle = function doWiggle() {
if (wiggleCount >= maxWiggles) {
dogFace.x = originalX;
return;
}
var offset = wiggleCount % 2 === 0 ? 40 : -40;
tween(dogFace, {
x: originalX + offset
}, {
duration: 60,
easing: tween.cubicIn,
onFinish: function onFinish() {
tween(dogFace, {
x: originalX
}, {
duration: 60,
easing: tween.cubicOut,
onFinish: function onFinish() {
wiggleCount++;
_doWiggle();
}
});
}
});
};
// Wiggle dog face left and right 4 times
var wiggleCount = 0;
var maxWiggles = 4;
var originalX = dogFace.x;
_doWiggle();
}
// --- Fun: Every 25th fart, dog face gets a random color for a while ---
if (fartCount > 0 && fartCount % 25 === 0) {
// Pick a fun random color (not too dark)
var funColors = [0xffb347, 0x7ec850, 0x4fc3f7, 0xf06292, 0xffeb3b, 0x9c27b0, 0xff5722, 0x00bcd4, 0x8bc34a, 0xe91e63];
var color = funColors[Math.floor(Math.random() * funColors.length)];
// Animate both faces if present
if (dogFace.children && dogFace.children.length > 0) {
for (var i = 0; i < dogFace.children.length; ++i) {
if (dogFace.children[i] && typeof dogFace.children[i].tint !== "undefined") {
var facePart = dogFace.children[i];
var oldTint = facePart.tint;
facePart.tint = color;
// Animate back to normal after 1.2s
LK.setTimeout(function (part, tint) {
return function () {
part.tint = tint;
};
}(facePart, oldTint), 1200);
}
}
}
}
// --- Fun: Every 50th fart, dog gets a random hat or glasses for a while ---
if (fartCount > 0 && fartCount % 50 === 0) {
if (!dogFace.accessory) {
dogFace.accessory = new Container();
dogFace.addChild(dogFace.accessory);
}
// Remove old accessory
dogFace.accessory.removeChildren();
var accType = Math.random() < 0.5 ? "hat" : "glasses";
if (accType === "hat") {
// Use person_phone as a silly hat
var hat = LK.getAsset('person_phone', {
anchorX: 0.5,
anchorY: 1,
scaleX: 2.2,
scaleY: 1.2,
x: 0,
y: -420,
tint: 0x7A5C00
});
dogFace.accessory.addChild(hat);
} else {
// Use person_leg as glasses
var glasses = LK.getAsset('person_leg', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 1.2,
scaleY: 0.4,
x: 0,
y: -120,
tint: 0x222222
});
dogFace.accessory.addChild(glasses);
}
// Remove accessory after 2 seconds
LK.setTimeout(function () {
if (dogFace.accessory) dogFace.accessory.removeChildren();
}, 2000);
}
// --- Fun: Every 99th fart, background color pulse for visual stimulation ---
if (fartCount > 0 && fartCount % 99 === 0) {
var bgPulseColors = [0xffe066, 0x7ec850, 0x4fc3f7, 0xf06292, 0xffeb3b, 0x9c27b0, 0xff5722, 0x00bcd4, 0x8bc34a, 0xe91e63];
var bgPulseIdx = 0;
var bgPulseMax = 8;
var originalBg = 0xE3F6FF;
var _doBgPulse = function doBgPulse() {
if (bgPulseIdx >= bgPulseMax) {
game.setBackgroundColor(originalBg);
return;
}
var color = bgPulseColors[bgPulseIdx % bgPulseColors.length];
game.setBackgroundColor(color);
bgPulseIdx++;
LK.setTimeout(_doBgPulse, 80);
};
_doBgPulse();
}
// --- Fun: Every 150th fart, dog face gets a random funny mustache for a while ---
if (fartCount > 0 && fartCount % 150 === 0) {
if (!dogFace.mustache) {
dogFace.mustache = new Container();
dogFace.addChild(dogFace.mustache);
}
// Remove old mustache
dogFace.mustache.removeChildren();
// Use person_leg as a mustache, randomize color and position
var mustacheColors = [0x222222, 0x7A5C00, 0x964B00, 0xFFD700, 0xC0C0C0];
var color = mustacheColors[Math.floor(Math.random() * mustacheColors.length)];
var mustache = LK.getAsset('person_leg', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 1.1 + Math.random() * 0.7,
scaleY: 0.35 + Math.random() * 0.2,
x: 0,
y: 120 + Math.random() * 30,
tint: color
});
dogFace.mustache.addChild(mustache);
// Remove mustache after 2.2 seconds
LK.setTimeout(function () {
if (dogFace.mustache) dogFace.mustache.removeChildren();
}, 2200);
}
// --- Fun: Every 77th fart, emoji rain for visual stimulation ---
if (fartCount > 0 && fartCount % 77 === 0) {
var emojiRainEmojis = ["🌈", "⭐", "💖", "✨", "🎉", "😃", "🐶", "🦄", "🍀", "🎈", "😺", "😎", "🥳", "😆", "😻"];
var emojiRainCount = 0;
var emojiRainMax = 18;
var _emojiRain = function emojiRain() {
if (emojiRainCount >= emojiRainMax) return;
var emoji = emojiRainEmojis[Math.floor(Math.random() * emojiRainEmojis.length)];
var emojiTxt = new Text2(emoji, {
size: 120 + Math.floor(Math.random() * 40),
fill: 0xffffff,
align: 'center'
});
emojiTxt.anchor.set(0.5, 0.5);
emojiTxt.x = 400 + Math.random() * (2048 - 800);
emojiTxt.y = -100;
emojiTxt.alpha = 1;
game.addChild(emojiTxt);
// Animate falling down
tween(emojiTxt, {
y: 2732 + 100,
alpha: 0.7 + Math.random() * 0.3
}, {
duration: 1200 + Math.random() * 400,
easing: tween.cubicIn,
onFinish: function onFinish() {
if (emojiTxt.parent) emojiTxt.parent.removeChild(emojiTxt);
}
});
emojiRainCount++;
LK.setTimeout(_emojiRain, 60);
};
_emojiRain();
}
// --- Fun: Every 75th fart, dog face flips upside down for a moment ---
if (fartCount > 0 && fartCount % 75 === 0) {
// Animate dog face rotation to upside down and back
tween(dogFace, {
rotation: Math.PI
}, {
duration: 220,
easing: tween.cubicIn,
onFinish: function onFinish() {
LK.setTimeout(function () {
tween(dogFace, {
rotation: 0
}, {
duration: 220,
easing: tween.cubicOut
});
}, 900);
}
});
}
// --- Fun: Every 333rd fart, dog face spins 360 degrees ---
if (fartCount > 0 && fartCount % 333 === 0) {
tween(dogFace, {
rotation: 2 * Math.PI
}, {
duration: 700,
easing: tween.cubicInOut,
onFinish: function onFinish() {
dogFace.rotation = 0;
}
});
}
updateUI();
// --- Fun: Every 111th fart, dog sneezes and face flashes white ---
if (fartCount > 0 && fartCount % 111 === 0) {
// Sneeze text
if (!dogFace.speechBubble) {
var bubble = new Text2('', {
size: 90,
fill: 0xffffff,
stroke: 0x222222,
strokeThickness: 8,
wordWrap: true,
wordWrapWidth: 600,
align: 'center'
});
bubble.anchor.set(0.5, 1);
bubble.x = 0;
bubble.y = -420;
bubble.alpha = 0;
dogFace.addChild(bubble);
dogFace.speechBubble = bubble;
}
dogFace.speechBubble.setText("ACHOO!");
dogFace.speechBubble.alpha = 1;
tween(dogFace.speechBubble, {
alpha: 0
}, {
duration: 900,
delay: 500,
easing: tween.cubicIn
});
// Face flashes white
for (var i = 0; i < dogFace.children.length; ++i) {
if (dogFace.children[i] && typeof dogFace.children[i].tint !== "undefined") {
var facePart = dogFace.children[i];
var oldTint = facePart.tint;
facePart.tint = 0xffffff;
LK.setTimeout(function (part, tint) {
return function () {
part.tint = tint;
};
}(facePart, oldTint), 400);
}
}
}
// --- Fun: Every 555th fart, dog face gets a random emoji sticker for a while ---
if (fartCount > 0 && fartCount % 555 === 0) {
if (!dogFace.sticker) {
dogFace.sticker = new Container();
dogFace.addChild(dogFace.sticker);
}
// Remove old sticker
dogFace.sticker.removeChildren();
// Pick a random emoji
var emojis = ["😂", "😎", "🤪", "😍", "😱", "🥳", "😜", "😇", "🤩", "😏", "😬", "😳", "😺", "🐶", "💩", "🌈", "🔥", "⭐", "🎉"];
var emoji = emojis[Math.floor(Math.random() * emojis.length)];
var stickerTxt = new Text2(emoji, {
size: 160 + Math.floor(Math.random() * 40),
fill: 0xffffff,
align: 'center'
});
stickerTxt.anchor.set(0.5, 0.5);
stickerTxt.x = -180 + Math.random() * 360;
stickerTxt.y = -180 + Math.random() * 360;
dogFace.sticker.addChild(stickerTxt);
// Remove sticker after 2.5 seconds
LK.setTimeout(function () {
if (dogFace.sticker) dogFace.sticker.removeChildren();
}, 2500);
}
// --- Fun: Every 444th fart, dog face grows and shrinks ---
if (fartCount > 0 && fartCount % 444 === 0) {
tween(dogFace, {
scaleX: 1.5,
scaleY: 1.5
}, {
duration: 180,
easing: tween.cubicOut,
onFinish: function onFinish() {
tween(dogFace, {
scaleX: 1,
scaleY: 1
}, {
duration: 180,
easing: tween.cubicIn
});
}
});
}
// --- Fun: Every 222nd fart, dog face bounces up and down ---
if (fartCount > 0 && fartCount % 222 === 0) {
var originalY = dogFace.y;
var bounceCount = 0;
var maxBounces = 4;
var _doBounce = function doBounce() {
if (bounceCount >= maxBounces) {
dogFace.y = originalY;
return;
}
var offset = bounceCount % 2 === 0 ? -60 : 60;
tween(dogFace, {
y: originalY + offset
}, {
duration: 70,
easing: tween.cubicIn,
onFinish: function onFinish() {
tween(dogFace, {
y: originalY
}, {
duration: 70,
easing: tween.cubicOut,
onFinish: function onFinish() {
bounceCount++;
_doBounce();
}
});
}
});
};
_doBounce();
}
// --- Fun: Every 200th fart, dog barks and screen shakes ---
if (fartCount > 0 && fartCount % 200 === 0) {
// Bark text
if (!dogFace.speechBubble) {
var bubble = new Text2('', {
size: 90,
fill: 0xffffff,
stroke: 0x222222,
strokeThickness: 8,
wordWrap: true,
wordWrapWidth: 600,
align: 'center'
});
bubble.anchor.set(0.5, 1);
bubble.x = 0;
bubble.y = -420;
bubble.alpha = 0;
dogFace.addChild(bubble);
dogFace.speechBubble = bubble;
}
dogFace.speechBubble.setText("🐶 WOOF! 🐶");
dogFace.speechBubble.alpha = 1;
tween(dogFace.speechBubble, {
alpha: 0
}, {
duration: 900,
delay: 500,
easing: tween.cubicIn
});
// Screen shake effect
var shakeTimes = 10;
var _shake = function shake(n) {
if (n <= 0) {
game.x = 0;
return;
}
game.x = n % 2 === 0 ? 20 : -20;
LK.setTimeout(function () {
_shake(n - 1);
}, 30);
};
_shake(shakeTimes);
}
// --- Achievements: First 100 Farts ---
if (!window._first100FartsShown && fartCount >= 100 && !isShowingAchievement) {
window._first100FartsShown = true;
isShowingAchievement = true;
// Show achievement popup
var achPopup = new Container();
var achBg = LK.getAsset('fart_btn', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 1.1,
scaleY: 1.1,
x: 2048 / 2,
y: 2732 / 2
});
achPopup.addChild(achBg);
var achTxt = new Text2('Achievement Unlocked!\nFirst 100 Farts!', {
size: 80,
fill: 0x7A5C00,
align: 'center'
});
achTxt.anchor.set(0.5, 0.5);
achTxt.x = 2048 / 2;
achTxt.y = 2732 / 2 - 40;
achPopup.addChild(achTxt);
var okBtn = LK.getAsset('fart_btn', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 0.7,
scaleY: 0.7,
x: 2048 / 2,
y: 2732 / 2 + 120
});
var okTxt = new Text2('OK', {
size: 70,
fill: 0x7A5C00
});
okTxt.anchor.set(0.5, 0.5);
okTxt.x = 0;
okTxt.y = 0;
okBtn.addChild(okTxt);
okBtn.interactive = true;
okBtn.down = function () {
game.removeChild(achPopup);
isShowingAchievement = false;
};
achPopup.addChild(okBtn);
game.addChild(achPopup);
LK.effects.flashObject(achBg, 0xfff7b2, 120);
}
// --- Achievements: 1000 Farts ---
if (!window._first1000FartsShown && fartCount >= 1000 && !isShowingAchievement) {
window._first1000FartsShown = true;
isShowingAchievement = true;
var achPopup = new Container();
var achBg = LK.getAsset('fart_btn', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 1.1,
scaleY: 1.1,
x: 2048 / 2,
y: 2732 / 2
});
achPopup.addChild(achBg);
var achTxt = new Text2('Achievement Unlocked!\n1000 Farts!\nDog is a Fart Legend!', {
size: 80,
fill: 0x7A5C00,
align: 'center'
});
achTxt.anchor.set(0.5, 0.5);
achTxt.x = 2048 / 2;
achTxt.y = 2732 / 2 - 40;
achPopup.addChild(achTxt);
var okBtn = LK.getAsset('fart_btn', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 0.7,
scaleY: 0.7,
x: 2048 / 2,
y: 2732 / 2 + 120
});
var okTxt = new Text2('OK', {
size: 70,
fill: 0x7A5C00
});
okTxt.anchor.set(0.5, 0.5);
okTxt.x = 0;
okTxt.y = 0;
okBtn.addChild(okTxt);
okBtn.interactive = true;
okBtn.down = function () {
game.removeChild(achPopup);
isShowingAchievement = false;
};
achPopup.addChild(okBtn);
game.addChild(achPopup);
LK.effects.flashObject(achBg, 0xfff7b2, 120);
}
// --- Achievements: 10,000 Farts ---
if (!window._first10kFartsShown && fartCount >= 10000 && !isShowingAchievement) {
window._first10kFartsShown = true;
isShowingAchievement = true;
var achPopup = new Container();
var achBg = LK.getAsset('fart_btn', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 1.1,
scaleY: 1.1,
x: 2048 / 2,
y: 2732 / 2
});
achPopup.addChild(achBg);
var achTxt = new Text2('Achievement Unlocked!\n10,000 Farts!\nDog is a Fart GOD!', {
size: 80,
fill: 0x7A5C00,
align: 'center'
});
achTxt.anchor.set(0.5, 0.5);
achTxt.x = 2048 / 2;
achTxt.y = 2732 / 2 - 40;
achPopup.addChild(achTxt);
var okBtn = LK.getAsset('fart_btn', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 0.7,
scaleY: 0.7,
x: 2048 / 2,
y: 2732 / 2 + 120
});
var okTxt = new Text2('OK', {
size: 70,
fill: 0x7A5C00
});
okTxt.anchor.set(0.5, 0.5);
okTxt.x = 0;
okTxt.y = 0;
okBtn.addChild(okTxt);
okBtn.interactive = true;
okBtn.down = function () {
game.removeChild(achPopup);
isShowingAchievement = false;
};
achPopup.addChild(okBtn);
game.addChild(achPopup);
LK.effects.flashObject(achBg, 0xfff7b2, 120);
}
// --- Achievements: 1,000,000 Farts ---
if (!window._first1MFartsShown && fartCount >= 1000000 && !isShowingAchievement) {
window._first1MFartsShown = true;
isShowingAchievement = true;
var achPopup = new Container();
var achBg = LK.getAsset('fart_btn', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 1.1,
scaleY: 1.1,
x: 2048 / 2,
y: 2732 / 2
});
achPopup.addChild(achBg);
var achTxt = new Text2('Achievement Unlocked!\n1,000,000 Farts!\nDog Ascends to Fart Heaven!', {
size: 80,
fill: 0x7A5C00,
align: 'center'
});
achTxt.anchor.set(0.5, 0.5);
achTxt.x = 2048 / 2;
achTxt.y = 2732 / 2 - 40;
achPopup.addChild(achTxt);
var okBtn = LK.getAsset('fart_btn', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 0.7,
scaleY: 0.7,
x: 2048 / 2,
y: 2732 / 2 + 120
});
var okTxt = new Text2('OK', {
size: 70,
fill: 0x7A5C00
});
okTxt.anchor.set(0.5, 0.5);
okTxt.x = 0;
okTxt.y = 0;
okBtn.addChild(okTxt);
okBtn.interactive = true;
okBtn.down = function () {
game.removeChild(achPopup);
isShowingAchievement = false;
};
achPopup.addChild(okBtn);
game.addChild(achPopup);
LK.effects.flashObject(achBg, 0xfff7b2, 120);
}
// --- Fun: Achievement for buying Chris the Cat ---
if (!window._chrisCatAchievement && chrisCatSpawned && !isShowingAchievement) {
window._chrisCatAchievement = true;
isShowingAchievement = true;
var achPopup = new Container();
var achBg = LK.getAsset('fart_btn', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 1.1,
scaleY: 1.1,
x: 2048 / 2,
y: 2732 / 2
});
achPopup.addChild(achBg);
var achTxt = new Text2('Achievement Unlocked!\nChris the Cat!\nFeline Fart Power!', {
size: 80,
fill: 0x7A5C00,
align: 'center'
});
achTxt.anchor.set(0.5, 0.5);
achTxt.x = 2048 / 2;
achTxt.y = 2732 / 2 - 40;
achPopup.addChild(achTxt);
var okBtn = LK.getAsset('fart_btn', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 0.7,
scaleY: 0.7,
x: 2048 / 2,
y: 2732 / 2 + 120
});
var okTxt = new Text2('OK', {
size: 70,
fill: 0x7A5C00
});
okTxt.anchor.set(0.5, 0.5);
okTxt.x = 0;
okTxt.y = 0;
okBtn.addChild(okTxt);
okBtn.interactive = true;
okBtn.down = function () {
game.removeChild(achPopup);
isShowingAchievement = false;
};
achPopup.addChild(okBtn);
game.addChild(achPopup);
LK.effects.flashObject(achBg, 0xfff7b2, 120);
}
// --- Fun: Achievement for buying John the Booster ---
if (!window._johnAchievement && johnSpawned && !isShowingAchievement) {
window._johnAchievement = true;
isShowingAchievement = true;
var achPopup = new Container();
var achBg = LK.getAsset('fart_btn', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 1.1,
scaleY: 1.1,
x: 2048 / 2,
y: 2732 / 2
});
achPopup.addChild(achBg);
var achTxt = new Text2('Achievement Unlocked!\nJohn the Booster!\nFart Power Overload!', {
size: 80,
fill: 0x7A5C00,
align: 'center'
});
achTxt.anchor.set(0.5, 0.5);
achTxt.x = 2048 / 2;
achTxt.y = 2732 / 2 - 40;
achPopup.addChild(achTxt);
var okBtn = LK.getAsset('fart_btn', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 0.7,
scaleY: 0.7,
x: 2048 / 2,
y: 2732 / 2 + 120
});
var okTxt = new Text2('OK', {
size: 70,
fill: 0x7A5C00
});
okTxt.anchor.set(0.5, 0.5);
okTxt.x = 0;
okTxt.y = 0;
okBtn.addChild(okTxt);
okBtn.interactive = true;
okBtn.down = function () {
game.removeChild(achPopup);
isShowingAchievement = false;
};
achPopup.addChild(okBtn);
game.addChild(achPopup);
LK.effects.flashObject(achBg, 0xfff7b2, 120);
}
};
// Make the button big and easy to tap: handle press anywhere on the button
fartBtn.interactive = true;
// --- Auto Clicker Upgrades ---
// Each auto clicker has: label, base cost, cost multiplier, interval (ms), amount per tick
var autoClickers = [{
label: "Auto 1s",
base: 100,
mult: 1.18,
interval: 1000,
amount: 1
}, {
label: "Auto 0.5s",
base: 500,
mult: 1.22,
interval: 500,
amount: 2
}, {
label: "Auto 0.2s",
base: 2000,
mult: 1.28,
interval: 200,
amount: 5
}];
var autoClickersBought = [0, 0, 0];
var autoClickerTimers = [null, null, null];
// --- UI for Auto Clickers ---
var autoClickerButtons = [];
var autoClickerTxts = [];
var autoClickerCostTxts = [];
var autoClickerYStart = upgradeYStart + upgrades.length * upgradeSpacing + 80;
var autoClickerSpacing = 120;
for (var i = 0; i < autoClickers.length; ++i) {
var btn = LK.getAsset('fart_btn', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 0.5,
scaleY: 0.5,
x: 400,
y: autoClickerYStart + i * autoClickerSpacing
});
btn.interactive = true;
var txt = new Text2(autoClickers[i].label, {
size: 60,
fill: 0x7A5C00
});
txt.anchor.set(0.5, 0.5);
txt.x = 0;
txt.y = -20;
btn.addChild(txt);
var costTxt = new Text2('', {
size: 44,
fill: 0x444444
});
costTxt.anchor.set(0.5, 0.5);
costTxt.x = 0;
costTxt.y = 50;
btn.addChild(costTxt);
game.addChild(btn);
btn.visible = false;
autoClickerButtons.push(btn);
autoClickerTxts.push(txt);
autoClickerCostTxts.push(costTxt);
}
// --- Helper: Calculate auto clicker cost ---
function getAutoClickerCost(idx) {
var ac = autoClickers[idx];
var n = autoClickersBought[idx];
return Math.floor(ac.base * Math.pow(ac.mult, n));
}
// --- Update UI: add auto clickers ---
var _oldUpdateUI = updateUI;
updateUI = function updateUI() {
_oldUpdateUI();
for (var i = 0; i < autoClickers.length; ++i) {
var cost = getAutoClickerCost(i);
autoClickerCostTxts[i].setText('Cost: ' + cost + ' | Owned: ' + autoClickersBought[i]);
if (fartCount >= cost) {
autoClickerButtons[i].alpha = 1;
} else {
autoClickerButtons[i].alpha = 0.5;
}
}
};
// --- Shop toggle: show/hide auto clickers too ---
var _oldShopBtnDown = shopBtn.down;
shopBtn.down = function (x, y, obj) {
_oldShopBtnDown(x, y, obj);
for (var i = 0; i < autoClickerButtons.length; ++i) {
autoClickerButtons[i].visible = shopVisible;
}
};
// Weekly challenge target adjusted by prestige level
weeklyChallenge.target = 50000 + prestigeLevel * 10000;
weeklyChallenge.progress = storage.weeklyProgress || 0;
weeklyChallenge.completed = storage.weeklyCompleted || false;
weeklyChallenge.timeLeft = storage.weeklyTimeLeft || 7 * 24 * 60 * 60 * 1000;
// --- Streak System ---
var loginStreak = storage.loginStreak || 0;
var lastLoginDate = storage.lastLoginDate || null;
// Check login streak
var today = new Date().toDateString();
if (lastLoginDate !== today) {
var yesterday = new Date();
yesterday.setDate(yesterday.getDate() - 1);
if (lastLoginDate === yesterday.toDateString()) {
loginStreak++;
} else if (lastLoginDate !== today) {
loginStreak = 1;
}
storage.lastLoginDate = today;
storage.loginStreak = loginStreak;
// Streak bonus
if (loginStreak > 1) {
var streakBonus = loginStreak * 100;
fartCount += streakBonus;
createFloatingText(2048 / 2, 1300, "Login Streak x" + loginStreak + "!\n+" + streakBonus + " Farts!", 0xffd700);
}
}
// --- Auto Clicker Button Handlers ---
for (var i = 0; i < autoClickers.length; ++i) {
(function (idx) {
autoClickerButtons[idx].down = function (x, y, obj) {
var cost = getAutoClickerCost(idx);
if (fartCount >= cost) {
fartCount -= cost;
autoClickersBought[idx]++;
updateUI();
LK.effects.flashObject(autoClickerButtons[idx], 0xeeeecc, 120);
// Level up celebration for every 5th purchase
if (autoClickersBought[idx] % 5 === 0) {
createParticleExplosion(autoClickerButtons[idx].x, autoClickerButtons[idx].y, 0xffd700, 20);
createFloatingText(autoClickerButtons[idx].x, autoClickerButtons[idx].y - 100, "LEVEL UP!", 0xffd700);
LK.effects.flashScreen(0xffd700, 300);
}
// If this is the first purchase, start the timer
if (autoClickersBought[idx] === 1) {
autoClickerTimers[idx] = LK.setInterval(function () {
// Each auto clicker tick: add (amount * owned * fartPerClick) to fartCount
fartCount += autoClickers[idx].amount * autoClickersBought[idx] * fartPerClick;
updateUI();
// Fun: dog reacts every time
dogFace.react();
// Dog says a random synonym for 'gross' (same as fartBtn.down)
if (!dogFace.speechBubble) {
// Create speech bubble if not already present
var bubble = new Text2('', {
size: 90,
fill: 0xffffff,
stroke: 0x222222,
strokeThickness: 8,
wordWrap: true,
wordWrapWidth: 600,
align: 'center'
});
bubble.anchor.set(0.5, 1);
bubble.x = 0;
bubble.y = -420;
bubble.alpha = 0;
dogFace.addChild(bubble);
dogFace.speechBubble = bubble;
}
// Check if dog is wearing the top hat (fancy mode)
var isWearingTopHat = false;
if (hatStore && hatStore.equippedHat) {
isWearingTopHat = true;
}
var grossWords;
if (isWearingTopHat) {
// Fancy synonyms for gross while wearing top hat
grossWords = ["Absolutely abhorrent!", "Utterly reprehensible!", "Quite unsavory!", "Most disagreeable!", "Thoroughly distasteful!", "Decidedly unpalatable!", "Exceedingly offensive!", "Remarkably repugnant!", "Profoundly disturbing!", "Extraordinarily vile!", "Supremely loathsome!", "Undeniably detestable!", "Monumentally revolting!", "Categorically objectionable!", "Fundamentally deplorable!", "Intrinsically nauseating!", "Quintessentially abominable!", "Indubitably repulsive!", "Unquestionably offensive!", "Irrefutably disgusting!", "Good heavens!", "My word!", "How unseemly!", "Quite dreadful!", "Most unbecoming!", "Rather appalling!", "Terribly vulgar!", "Frightfully crude!", "Awfully uncouth!", "Shockingly improper!", "Disgracefully crass!", "Regrettably tactless!", "Lamentably coarse!", "Woefully inappropriate!", "Deplorably unrefined!", "Insufferably boorish!", "Intolerably barbaric!", "Unacceptably gauche!", "Abhorrently uncivilized!", "Contemptibly lowbrow!"];
} else {
// Regular gross words for normal mode
grossWords = ["Yuck!", "Ew!", "Disgusting!", "Nasty!", "Foul!", "Repulsive!", "Stinky!", "Revolting!", "Pee-yew!", "Ugh!", "Gross!", "Barf!", "Ick!", "Putrid!", "Rank!", "Vile!", "Sickening!", "Odious!", "No way!", "Bleh!", "Cringe!", "Yikes!", "Gag!", "Pungent!", "Awful!", "Horrid!", "Stench!", "What is that?!", "Oh no!", "Why?!", "Ewww!", "Yeesh!", "Blech!", "GROSS!", "Noxious!", "Obnoxious!", "Yowza!", "Oof!", "Gnar!", "Yow!", "Eek!", "Yowch!", "Ooze!", "Funky!", "Rancid!", "Rotten!", "Whew!", "Stank!", "Phew!", "GROSS-out!",
// More synonyms
"Repugnant!", "Skunky!", "Malodorous!", "Putrescent!", "Fetid!", "Mephitic!", "Moldy!", "Dank!", "Manky!", "Cruddy!", "Crud!", "Yuuuck!", "Ew, dude!", "Stale!", "Funky town!", "Reek!", "Stale cheese!", "Cheesy!", "Mold!", "Ew, stinky!", "Ew, gross!", "Ew, nasty!", "Ew, barf!", "Ew, icky!", "Ew, yuck!", "Ew, blech!", "Ew, pew!", "Ew, phew!", "Ew, stank!", "Ew, rotten!", "Ew, rancid!", "Ew, vile!", "Ew, sick!", "Ew, odious!", "Ew, horrid!", "Ew, foul!", "Ew, revolting!", "Ew, repulsive!", "Ew, stench!", "Ew, noxious!", "Ew, obnoxious!", "Ew, gnarly!", "Ew, yowza!", "Ew, oof!", "Ew, yow!", "Ew, eek!", "Ew, yowch!", "Ew, ooze!", "Ew, funky!", "Ew, whew!", "Ew, gross-out!", "Ew, what is that?!", "Ew, oh no!", "Ew, why?!", "Ew, yeesh!", "Ew, yikes!", "Ew, cringe!", "Ew, gag!", "Ew, pungent!", "Ew, awful!", "Ew, stank!", "Ew, phew!", "Ew, barf!", "Ew, ick!", "Ew, putrid!", "Ew, rank!", "Ew, vile!", "Ew, sickening!", "Ew, odious!", "Ew, bleh!", "Ew, gross!", "Ew, stench!", "Ew, no way!", "Ew, yuck!", "Ew, ewww!", "Ew, blech!", "Ew, GROSS!", "Ew, yikes!", "Ew, cringe!", "Ew, gag!", "Ew, pungent!", "Ew, horrid!", "Ew, stench!", "Ew, what is that?!", "Ew, oh no!", "Ew, why?!", "Ew, yeesh!", "Ew, yikes!", "Ew, cringe!", "Ew, gag!", "Ew, pungent!", "Ew, awful!", "Ew, horrid!", "Ew, stench!", "Ew, what is that?!", "Ew, oh no!", "Ew, why?!", "Ew, ewww!", "Ew, yeesh!", "Ew, blech!", "Ew, GROSS!", "Ew, noxious!", "Ew, obnoxious!", "Ew, yowza!", "Ew, oof!", "Ew, gnar!", "Ew, yow!", "Ew, eek!", "Ew, yowch!", "Ew, ooze!", "Ew, funky!", "Ew, rancid!", "Ew, rotten!", "Ew, whew!", "Ew, stank!", "Ew, phew!", "Ew, GROSS-out!"];
}
var word = grossWords[Math.floor(Math.random() * grossWords.length)];
dogFace.speechBubble.setText(word);
dogFace.speechBubble.alpha = 1;
tween(dogFace.speechBubble, {
alpha: 0
}, {
duration: 900,
delay: 500,
easing: tween.cubicIn
});
// Dog teleports to center and stops sliding for a moment
dogFace.x = 2048 / 2;
dogFace.lastX = dogFace.x;
LK.getSound('fart_snd').play();
}, autoClickers[idx].interval);
}
}
};
})(i);
}
// --- Simple Click Counter Button ---
// (Removed: click counter button and handler, as clicks are now counted via the FART button);
// --- Social Competition Features ---
var dailyLeaderboard = [{
name: "You",
score: fartCount,
prestige: prestigeLevel
}, {
name: "FartMaster",
score: 2500000 + Math.floor(Math.random() * 500000),
prestige: 5
}, {
name: "GoldenDog",
score: 1800000 + Math.floor(Math.random() * 400000),
prestige: 4
}, {
name: "ComboKing",
score: 1200000 + Math.floor(Math.random() * 300000),
prestige: 3
}, {
name: "ChrisFan",
score: 900000 + Math.floor(Math.random() * 200000),
prestige: 2
}, {
name: "JohnLover",
score: 600000 + Math.floor(Math.random() * 150000),
prestige: 1
}, {
name: "NewPlayer",
score: 100000 + Math.floor(Math.random() * 50000),
prestige: 0
}];
// Sort leaderboard
dailyLeaderboard.sort(function (a, b) {
if (a.prestige !== b.prestige) return b.prestige - a.prestige;
return b.score - a.score;
});
// Add leaderboard button
var leaderboardBtn = LK.getAsset('fart_btn', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 0.6,
scaleY: 0.6,
x: 2048 - 400,
y: 2732 - 350
});
var leaderboardBtnTxt = new Text2('Leaderboard', {
size: 54,
fill: 0x7A5C00
});
leaderboardBtnTxt.anchor.set(0.5, 0.5);
leaderboardBtnTxt.x = 0;
leaderboardBtnTxt.y = 0;
leaderboardBtn.addChild(leaderboardBtnTxt);
leaderboardBtn.interactive = true;
game.addChild(leaderboardBtn);
leaderboardBtn.down = function () {
// Update your score in leaderboard
dailyLeaderboard[0] = {
name: "You",
score: fartCount,
prestige: prestigeLevel
};
dailyLeaderboard.sort(function (a, b) {
if (a.prestige !== b.prestige) return b.prestige - a.prestige;
return b.score - a.score;
});
// Show leaderboard popup (similar to viral challenge)
var popup = new Container();
var bg = LK.getAsset('person_leg', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 7.5,
scaleY: 7.5,
x: 2048 / 2,
y: 2732 / 2
});
popup.addChild(bg);
var title = new Text2('Daily Leaderboard', {
size: 80,
fill: 0xff8000,
align: 'center'
});
title.anchor.set(0.5, 0.5);
title.x = 2048 / 2;
title.y = 2732 / 2 - 320;
popup.addChild(title);
for (var i = 0; i < Math.min(7, dailyLeaderboard.length); i++) {
var entry = dailyLeaderboard[i];
var rankColor = entry.name === "You" ? 0x83de44 : 0x7A5C00;
var entryTxt = new Text2(i + 1 + ". " + entry.name + " - " + entry.score + " farts (P" + entry.prestige + ")", {
size: 54,
fill: rankColor,
align: 'left'
});
entryTxt.anchor.set(0.5, 0.5);
entryTxt.x = 2048 / 2;
entryTxt.y = 2732 / 2 - 200 + i * 60;
popup.addChild(entryTxt);
}
var closeBtn = LK.getAsset('fart_btn', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 0.7,
scaleY: 0.7,
x: 2048 / 2,
y: 2732 / 2 + 280
});
var closeTxt = new Text2('Close', {
size: 70,
fill: 0x7A5C00
});
closeTxt.anchor.set(0.5, 0.5);
closeTxt.x = 0;
closeTxt.y = 0;
closeBtn.addChild(closeTxt);
closeBtn.interactive = true;
closeBtn.down = function () {
game.removeChild(popup);
};
popup.addChild(closeBtn);
game.addChild(popup);
};
// --- Special Milestone Celebrations ---
if (fartCount > 0 && fartCount % 100000 === 0) {
// Major milestone celebration
createFloatingText(2048 / 2, 1300, "MAJOR MILESTONE!\n" + fartCount + " FARTS!\nYou're a legend!", 0xffd700);
// Fireworks effect
for (var f = 0; f < 15; f++) {
(function (index) {
LK.setTimeout(function () {
createParticleExplosion(400 + Math.random() * 1200, 400 + Math.random() * 800, [0xff0000, 0x00ff00, 0x0000ff, 0xffff00, 0xff00ff, 0x00ffff][index % 6], 25);
}, index * 100);
})(f);
}
LK.effects.flashScreen(0xffffff, 500);
}
// --- Leaderboard Button removed ---;
// --- Achievements List UI ---
// Define all achievements with their unlock condition and description
var achievements = [{
key: "first100Farts",
name: "First 100 Farts",
desc: "Reach 100 farts.",
unlocked: function unlocked() {
return fartCount >= 100 || !!window._first100FartsShown;
}
}, {
key: "first1000Farts",
name: "Fart Legend",
desc: "Reach 1,000 farts.",
unlocked: function unlocked() {
return fartCount >= 1000 || !!window._first1000FartsShown;
}
}, {
key: "first10kFarts",
name: "Fart GOD",
desc: "Reach 10,000 farts.",
unlocked: function unlocked() {
return fartCount >= 10000 || !!window._first10kFartsShown;
}
}, {
key: "first1MFarts",
name: "Fart Heaven",
desc: "Reach 1,000,000 farts.",
unlocked: function unlocked() {
return fartCount >= 1000000 || !!window._first1MFartsShown;
}
}, {
key: "dogTeleport",
name: "Dog Teleport",
desc: "Make the dog run away (hit left edge).",
unlocked: function unlocked() {
return !!window._firstDogTeleport;
}
}, {
key: "chrisCat",
name: "Chris the Cat",
desc: "Buy Chris the Cat upgrade.",
unlocked: function unlocked() {
return chrisCatSpawned || !!window._chrisCatAchievement;
}
}, {
key: "johnBooster",
name: "John the Booster",
desc: "Buy John the Booster upgrade.",
unlocked: function unlocked() {
return johnSpawned || !!window._johnAchievement;
}
}];
// --- Helper: Check if all achievements except dog teleport are unlocked ---
// Ensure achievements is defined before this function is used
function allAchievementsExceptDogTeleportUnlocked() {
if (typeof achievements === "undefined" || !achievements) return false;
// dogTeleport is removed, so check all others
for (var i = 0; i < achievements.length; ++i) {
if (achievements[i].key === "dogTeleport") continue;
if (!achievements[i].unlocked()) return false;
}
return true;
}
// Achievements list popup container (hidden by default)
var achievementsPopup = null;
// Achievements button (bottom left, out of dog's way)
var achievementsBtn = LK.getAsset('fart_btn', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 0.6,
scaleY: 0.6,
// Move up and right from the very bottom left, so it doesn't overlap food store or menu
x: 180,
y: 2732 - 400
});
var achievementsBtnTxt = new Text2('Achievements', {
size: 54,
fill: 0x7A5C00
});
achievementsBtnTxt.anchor.set(0.5, 0.5);
achievementsBtnTxt.x = 0;
achievementsBtnTxt.y = 0;
achievementsBtn.addChild(achievementsBtnTxt);
achievementsBtn.interactive = true;
game.addChild(achievementsBtn);
// Show/hide achievements popup
achievementsBtn.down = function () {
if (isShowingAchievement) {
return;
}
if (achievementsPopup && achievementsPopup.parent) {
game.removeChild(achievementsPopup);
return;
}
if (achievementsPopup) {
game.addChild(achievementsPopup);
updateAchievementsList();
return;
}
// Create popup
achievementsPopup = new Container();
var bg = LK.getAsset('fart_btn', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 2.2,
scaleY: 2.7,
x: 2048 / 2,
y: 2732 / 2
});
achievementsPopup.addChild(bg);
var title = new Text2('Achievements', {
size: 90,
fill: 0x7A5C00,
align: 'center'
});
title.anchor.set(0.5, 0);
title.x = 2048 / 2;
title.y = 2732 / 2 - 540;
achievementsPopup.addChild(title);
// --- SCROLLABLE LIST CONTAINER ---
var listContainer = new Container();
listContainer.x = 0;
listContainer.y = 0;
achievementsPopup.addChild(listContainer);
// List container Y start and row height
var listY = 2732 / 2 - 400;
var rowHeight = 120;
achievementsPopup.achRows = [];
for (var i = 0; i < achievements.length; ++i) {
var ach = achievements[i];
var row = new Container();
row.x = 2048 / 2 - 500;
row.y = listY + i * rowHeight;
var status = new Text2('', {
size: 60,
fill: 0x7A5C00
});
status.anchor.set(0, 0.5);
status.x = 0;
status.y = 0;
row.status = status;
row.addChild(status);
var name = new Text2(ach.name, {
size: 60,
fill: 0x222222
});
name.anchor.set(0, 0.5);
name.x = 90;
name.y = 0;
row.addChild(name);
var desc = new Text2(ach.desc, {
size: 38,
fill: 0x444444
});
desc.anchor.set(0, 0.5);
desc.x = 90;
desc.y = 38;
row.addChild(desc);
listContainer.addChild(row);
achievementsPopup.achRows.push(row);
}
// --- SCROLL LOGIC ---
var maxVisibleRows = 7;
var totalRows = achievements.length;
var visibleHeight = maxVisibleRows * rowHeight;
var minY = listY;
var maxY = listY + Math.max(0, (totalRows - maxVisibleRows) * rowHeight);
listContainer.y = 0;
achievementsPopup._scrollOffset = 0;
achievementsPopup._dragStartY = null;
achievementsPopup._dragLastY = null;
achievementsPopup.interactive = true;
achievementsPopup.down = function (x, y, obj) {
achievementsPopup._dragStartY = y;
achievementsPopup._dragLastY = y;
achievementsPopup._startScrollOffset = achievementsPopup._scrollOffset;
};
achievementsPopup.move = function (x, y, obj) {
if (achievementsPopup._dragStartY !== null) {
var dy = y - achievementsPopup._dragLastY;
achievementsPopup._dragLastY = y;
achievementsPopup._scrollOffset += dy;
// Clamp scroll
if (achievementsPopup._scrollOffset > 0) achievementsPopup._scrollOffset = 0;
if (achievementsPopup._scrollOffset < -(maxY - minY)) achievementsPopup._scrollOffset = -(maxY - minY);
listContainer.y = achievementsPopup._scrollOffset;
}
};
achievementsPopup.up = function (x, y, obj) {
achievementsPopup._dragStartY = null;
achievementsPopup._dragLastY = null;
};
// Close button
var closeBtn = LK.getAsset('fart_btn', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 0.7,
scaleY: 0.7,
x: 2048 / 2,
y: 2732 / 2 + 600
});
var closeTxt = new Text2('Close', {
size: 70,
fill: 0x7A5C00
});
closeTxt.anchor.set(0.5, 0.5);
closeTxt.x = 0;
closeTxt.y = 0;
closeBtn.addChild(closeTxt);
closeBtn.interactive = true;
closeBtn.down = function () {
game.removeChild(achievementsPopup);
isShowingAchievement = false;
};
achievementsPopup.addChild(closeBtn);
game.addChild(achievementsPopup);
isShowingAchievement = true;
updateAchievementsList();
};
// Helper to update achievements list UI
function updateAchievementsList() {
if (!achievementsPopup || !achievementsPopup.achRows) return;
for (var i = 0; i < achievements.length; ++i) {
var ach = achievements[i];
var row = achievementsPopup.achRows[i];
// Remove old background if present
if (row.achBg) {
row.removeChild(row.achBg);
row.achBg = null;
}
// Add red square background behind status icon
var achBg = LK.getAsset('person_leg', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 1.2,
scaleY: 1.2,
x: 30,
y: 0,
tint: 0xd83318 // strong red
});
row.addChildAt(achBg, 0);
row.achBg = achBg;
if (ach.unlocked()) {
row.status.setText("✔️");
row.status.fill = 0x83de44;
row.alpha = 1;
} else {
row.status.setText("❌");
row.status.fill = 0xcd544e;
row.alpha = 0.5;
}
}
}
// Update achievements list UI whenever UI updates
var _oldUpdateUI_ach = updateUI;
updateUI = function updateUI() {
_oldUpdateUI_ach();
updateAchievementsList();
};
// --- Prestige System Variables ---
var prestigeLevel = storage.prestigeLevel || 0;
var prestigePoints = storage.prestigePoints || 0;
var prestigeMultiplier = 1 + prestigeLevel * 0.5; // 50% bonus per prestige
// --- Prestige Button ---
var prestigeBtn = LK.getAsset('fart_btn', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 0.8,
scaleY: 0.8,
x: 2048 / 2,
y: 250
});
var prestigeBtnTxt = new Text2('PRESTIGE\n(Reset for Bonus)', {
size: 60,
fill: 0xff4444,
align: 'center'
});
prestigeBtnTxt.anchor.set(0.5, 0.5);
prestigeBtnTxt.x = 0;
prestigeBtnTxt.y = 0;
prestigeBtn.addChild(prestigeBtnTxt);
prestigeBtn.interactive = true;
game.addChild(prestigeBtn);
prestigeBtn.down = function () {
if (fartCount >= 1000000) {
// Can only prestige with 1M+ farts
var newPrestigePoints = Math.floor(fartCount / 100000);
prestigePoints += newPrestigePoints;
prestigeLevel++;
// Reset progress but keep prestige bonuses
fartCount = 0;
fartPerClick = 1;
for (var i = 0; i < upgradesBought.length; i++) {
upgradesBought[i] = 0;
}
for (var i = 0; i < autoClickersBought.length; i++) {
autoClickersBought[i] = 0;
if (autoClickerTimers[i]) {
LK.clearInterval(autoClickerTimers[i]);
autoClickerTimers[i] = null;
}
}
// Apply prestige multiplier
prestigeMultiplier = 1 + prestigeLevel * 0.5;
// Save to storage
storage.prestigeLevel = prestigeLevel;
storage.prestigePoints = prestigePoints;
// Celebration
LK.effects.flashScreen(0xffd700, 1000);
createFloatingText(2048 / 2, 1400, "PRESTIGE LEVEL " + prestigeLevel + "!\n+" + newPrestigePoints + " Prestige Points!", 0xffd700);
updateUI();
}
};
// --- Weekly Challenge Display (moved earlier to prevent undefined error) ---
// Update Log Button and Popup ---
var updateLogBtn = LK.getAsset('fart_btn', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 0.6,
scaleY: 0.6,
x: 2048 - 180,
// Bottom right, near share button
y: 2732 - 220
});
var updateLogBtnTxt = new Text2('Update Log', {
size: 54,
fill: 0x7A5C00
});
updateLogBtnTxt.anchor.set(0.5, 0.5);
updateLogBtnTxt.x = 0;
updateLogBtnTxt.y = 0;
updateLogBtn.addChild(updateLogBtnTxt);
updateLogBtn.interactive = true;
game.addChild(updateLogBtn);
// --- Music Control Button ---
var musicPlaying = true;
var musicBtn = LK.getAsset('fart_btn', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 0.45,
scaleY: 0.45,
x: 180,
y: 2732 - 120
});
var musicBtnTxt = new Text2('Music: ON', {
size: 50,
fill: 0x7A5C00
});
musicBtnTxt.anchor.set(0.5, 0.5);
musicBtnTxt.x = 0;
musicBtnTxt.y = 0;
musicBtn.addChild(musicBtnTxt);
musicBtn.interactive = true;
musicBtn.down = function () {
musicPlaying = !musicPlaying;
if (musicPlaying) {
LK.playMusic('relaxing_piano', {
loop: true,
fade: {
start: 0,
end: 0.3,
duration: 1000
}
});
musicBtnTxt.setText('Music: ON');
musicBtnTxt.fill = 0x7A5C00;
} else {
LK.stopMusic();
musicBtnTxt.setText('Music: OFF');
musicBtnTxt.fill = 0x888888;
}
LK.effects.flashObject(musicBtn, 0xfff7b2, 120);
};
game.addChild(musicBtn);
var updateLogPopup = null;
var updateLogEntries = ["v1.0: Initial Release!", "v1.1: Added dog reactions and fart sound.", "v1.2: Implemented basic clicker functionality.", "v1.3: Added fart button and UI.", "v1.4: Added sliding dog and teleport.", "v1.5: Added Person standing and recording.", "v1.6: Introduced achievements.", "v1.7: Added particle system and floating text.", "v1.8: Added combo system and UI.", "v1.9: Implemented screen shake.", "v2.0: Added Mega Fart special effect.", "v2.1: Introduced power-up system.", "v2.2: Added daily reward.", "v2.3: Implemented upgrade shop.", "v2.4: Added Auto Clicker upgrades.", "v2.5: Added Chris the Cat upgrade and special effect.", "v2.6: Added John the Booster upgrade and effect.", "v2.7: Added Autism Mode with chaos effects.", "v2.8: Added social share/viral challenge popup.", "v2.9: Added achievement list UI.", "v3.0: Minor bug fixes and performance improvements."];
updateLogBtn.down = function () {
if (updateLogPopup && updateLogPopup.parent) {
game.removeChild(updateLogPopup);
return;
}
if (updateLogPopup) {
game.addChild(updateLogPopup);
return;
}
updateLogPopup = new Container();
var bg = LK.getAsset('fart_btn', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 2.2,
scaleY: 2.7,
x: 2048 / 2,
y: 2732 / 2
});
updateLogPopup.addChild(bg);
var title = new Text2('Update Log', {
size: 90,
fill: 0x7A5C00,
align: 'center'
});
title.anchor.set(0.5, 0);
title.x = 2048 / 2;
title.y = 2732 / 2 - 540;
updateLogPopup.addChild(title);
// --- SCROLLABLE LIST CONTAINER ---
var listContainer = new Container();
listContainer.x = 2048 / 2 - 500; // Align left edge of the text
listContainer.y = 2732 / 2 - 400;
updateLogPopup.addChild(listContainer);
var rowHeight = 60; // Smaller row height for log entries
updateLogPopup.logRows = [];
for (var i = 0; i < updateLogEntries.length; ++i) {
var entry = updateLogEntries[i];
var row = new Container();
row.y = i * rowHeight;
var entryTxt = new Text2(entry, {
size: 54,
fill: 0x222222,
align: 'left'
});
entryTxt.anchor.set(0, 0.5); // Anchor left center
entryTxt.x = 0;
entryTxt.y = 0;
row.addChild(entryTxt);
listContainer.addChild(row);
updateLogPopup.logRows.push(row);
}
// --- SCROLL LOGIC ---
var maxVisibleRows = 10; // Adjust based on the log length
var totalRows = updateLogEntries.length;
var visibleHeight = maxVisibleRows * rowHeight;
var minY = 2732 / 2 - 400; // Start Y of the list container
var maxY = minY + Math.max(0, (totalRows - maxVisibleRows) * rowHeight);
updateLogPopup._scrollOffset = 0;
updateLogPopup._dragStartY = null;
updateLogPopup._dragLastY = null;
updateLogPopup.interactive = true;
// Use the popup's interactive area for dragging
updateLogPopup.down = function (x, y, obj) {
// Convert global tap coordinates to local popup coordinates
var localPos = updateLogPopup.toLocal({
x: x,
y: y
});
updateLogPopup._dragStartY = localPos.y;
updateLogPopup._dragLastY = localPos.y;
updateLogPopup._startScrollOffset = listContainer.y; // Use listContainer.y for scroll offset
};
updateLogPopup.move = function (x, y, obj) {
if (updateLogPopup._dragStartY !== null) {
// Convert global drag coordinates to local popup coordinates
var localPos = updateLogPopup.toLocal({
x: x,
y: y
});
var dy = localPos.y - updateLogPopup._dragLastY;
updateLogPopup._dragLastY = localPos.y;
listContainer.y += dy;
// Clamp scroll
if (listContainer.y > minY) listContainer.y = minY; // Clamp to the initial Y
if (listContainer.y < minY - (totalRows * rowHeight - visibleHeight)) {
listContainer.y = minY - (totalRows * rowHeight - visibleHeight);
}
// If total rows are less than visible rows, don't allow scrolling below initial position
if (totalRows <= maxVisibleRows) {
if (listContainer.y < minY) listContainer.y = minY;
}
}
};
updateLogPopup.up = function (x, y, obj) {
updateLogPopup._dragStartY = null;
updateLogPopup._dragLastY = null;
};
// Close button
var closeBtn = LK.getAsset('fart_btn', {
anchorX: 0.5,
anchorY: 0.5,
scaleX: 0.7,
scaleY: 0.7,
x: 2048 / 2,
y: 2732 / 2 + 600
});
var closeTxt = new Text2('Close', {
size: 70,
fill: 0x7A5C00
});
closeTxt.anchor.set(0.5, 0.5);
closeTxt.x = 0;
closeTxt.y = 0;
closeBtn.addChild(closeTxt);
closeBtn.interactive = true;
closeBtn.down = function () {
game.removeChild(updateLogPopup);
};
updateLogPopup.addChild(closeBtn);
game.addChild(updateLogPopup);
}; ===================================================================
--- original.js
+++ change.js
@@ -6,8 +6,28 @@
/****
* Classes
****/
+// --- Dog Walk & Collectible Bones Gameplay ---
+// Dog will occasionally go for a walk and bones will appear to collect for bonus farts
+// Bone class
+var Bone = Container.expand(function () {
+ var self = Container.call(this);
+ var boneShape = self.attachAsset('person_phone', {
+ anchorX: 0.5,
+ anchorY: 0.5,
+ scaleX: 0.7,
+ scaleY: 0.3,
+ tint: 0xffffff
+ });
+ self.collected = false;
+ self.update = function () {
+ // Bones can have a little bounce
+ self.y += Math.sin(LK.ticks / 10 + self.x) * 0.5;
+ };
+ return self;
+});
+// Dog walk state
// Dog face class
var DogFace = Container.expand(function () {
var self = Container.call(this);
// Normal face
@@ -603,555 +623,93 @@
dogFace.x = 2048 / 2;
dogFace.y = 1100;
dogFace.lastX = dogFace.x; // Track lastX for edge detection
game.addChild(dogFace);
-// --- DOG WALK MINI-GAME SYSTEM ---
-// Mini-game state
-var dogWalkActive = false;
-var dogWalkObstacles = [];
-var dogWalkDog = null;
-var dogWalkScore = 0;
-var dogWalkTimer = null;
-var dogWalkPopup = null;
-// --- POOP CLEANING MINI-GAME SYSTEM ---
-var poopCleanActive = false;
-var poopCleanPoops = [];
-var poopCleanScore = 0;
-var poopCleanTimer = null;
-var poopCleanPopup = null;
-// --- DOG NAP MINI-GAME SYSTEM ---
-var dogNapActive = false;
-var dogNapPopup = null;
-var dogNapTimer = null;
-var dogNapFailed = false;
-// Start the mini-game at random intervals (every 120-240 seconds)
-function scheduleDogNapMiniGame() {
- var delay = 120000 + Math.random() * 120000;
- LK.setTimeout(function () {
- if (!dogNapActive && !isDead) startDogNapMiniGame();
- scheduleDogNapMiniGame();
- }, delay);
+// Add person standing and recording at the left side
+var person = new PersonRecording();
+person.x = 400;
+person.y = 1200;
+game.addChild(person);
+// Dog walk state
+var dogWalking = false;
+var walkTargetX = 2048 / 2;
+var walkTargetY = 1100;
+var walkStartX = 2048 / 2;
+var walkStartY = 1100;
+var walkProgress = 0;
+var walkDuration = 180; // 3 seconds at 60fps
+var walkBone = null;
+var walkBoneCollected = false;
+var walkCooldown = 0;
+// Helper to start a dog walk
+function startDogWalk() {
+ if (dogWalking || isDead) return;
+ dogWalking = true;
+ walkStartX = dogFace.x;
+ walkStartY = dogFace.y;
+ // Pick a random target location (avoid center)
+ walkTargetX = 300 + Math.random() * (2048 - 600);
+ walkTargetY = 900 + Math.random() * 800;
+ walkProgress = 0;
+ walkBoneCollected = false;
+ // Spawn a bone at the target
+ walkBone = new Bone();
+ walkBone.x = walkTargetX;
+ walkBone.y = walkTargetY + 120;
+ game.addChild(walkBone);
}
-scheduleDogNapMiniGame();
-function startDogNapMiniGame() {
- dogNapActive = true;
- dogNapFailed = false;
- // Hide main UI elements
- fartBtn.visible = false;
- if (hatStore) hatStore.visible = false;
- if (foodStore) foodStore.visible = false;
- if (shopBtn) shopBtn.visible = false;
- if (autismModeBtn) autismModeBtn.visible = false;
- if (leaderboardBtn) leaderboardBtn.visible = false;
- if (updateLogBtn) updateLogBtn.visible = false;
- if (musicBtn) musicBtn.visible = false;
- if (achievementsBtn) achievementsBtn.visible = false;
- if (foodStoreMinBtn) foodStoreMinBtn.visible = false;
- // Show popup
- dogNapPopup = new Container();
- var bg = LK.getAsset('fart_btn', {
- anchorX: 0.5,
- anchorY: 0.5,
- scaleX: 2.2,
- scaleY: 2.7,
- x: 2048 / 2,
- y: 2732 / 2
- });
- dogNapPopup.addChild(bg);
- var title = new Text2('Dog Nap! Don\'t tap for 7 seconds!', {
- size: 80,
- fill: 0x7A5C00,
- align: 'center'
- });
- title.anchor.set(0.5, 0.5);
- title.x = 2048 / 2;
- title.y = 2732 / 2 - 400;
- dogNapPopup.addChild(title);
- // Timer text
- var napTimerTxt = new Text2('7', {
- size: 120,
- fill: 0x2D2D2D
- });
- napTimerTxt.anchor.set(0.5, 0.5);
- napTimerTxt.x = 2048 / 2;
- napTimerTxt.y = 2732 / 2 - 200;
- dogNapPopup.addChild(napTimerTxt);
- // Listen for tap (fail if tapped)
- dogNapPopup.interactive = true;
- dogNapPopup.down = function () {
- if (!dogNapFailed) {
- dogNapFailed = true;
- endDogNapMiniGame(false, napTimerTxt);
- }
- };
- // Countdown
- var napTimeLeft = 7;
- dogNapTimer = LK.setInterval(function () {
- napTimeLeft--;
- napTimerTxt.setText(napTimeLeft > 0 ? napTimeLeft : '');
- if (napTimeLeft <= 0 && !dogNapFailed) {
- endDogNapMiniGame(true, napTimerTxt);
- }
- }, 1000);
- // Add to game
- game.addChild(dogNapPopup);
+// Helper to end a dog walk
+function endDogWalk() {
+ dogWalking = false;
+ walkProgress = 0;
+ if (walkBone && walkBone.parent) walkBone.parent.removeChild(walkBone);
+ walkBone = null;
+ walkCooldown = 600 + Math.floor(Math.random() * 600); // 10-20s cooldown
}
-function endDogNapMiniGame(success, napTimerTxt) {
- dogNapActive = false;
- if (dogNapTimer) {
- LK.clearInterval(dogNapTimer);
- dogNapTimer = null;
+// Add to game.update
+var _oldGameUpdate = game.update;
+game.update = function () {
+ _oldGameUpdate && _oldGameUpdate();
+ // Dog walk logic
+ if (!dogWalking && !isDead && walkCooldown <= 0 && Math.random() < 0.002) {
+ startDogWalk();
}
- // Remove popup
- if (dogNapPopup && dogNapPopup.parent) game.removeChild(dogNapPopup);
- // Show result
- var resultPopup = new Container();
- var bg = LK.getAsset('fart_btn', {
- anchorX: 0.5,
- anchorY: 0.5,
- scaleX: 1.5,
- scaleY: 1.5,
- x: 2048 / 2,
- y: 2732 / 2
- });
- resultPopup.addChild(bg);
- var msg = success ? "Dog Rested!\n+80 Farts!" : "You woke the dog!\n+5 Farts";
- var color = success ? 0x00ff00 : 0xff0000;
- var txt = new Text2(msg, {
- size: 80,
- fill: color,
- align: 'center'
- });
- txt.anchor.set(0.5, 0.5);
- txt.x = 2048 / 2;
- txt.y = 2732 / 2 - 40;
- resultPopup.addChild(txt);
- var okBtn = LK.getAsset('fart_btn', {
- anchorX: 0.5,
- anchorY: 0.5,
- scaleX: 0.7,
- scaleY: 0.7,
- x: 2048 / 2,
- y: 2732 / 2 + 120
- });
- var okTxt = new Text2('OK', {
- size: 70,
- fill: 0x7A5C00
- });
- okTxt.anchor.set(0.5, 0.5);
- okTxt.x = 0;
- okTxt.y = 0;
- okBtn.addChild(okTxt);
- okBtn.interactive = true;
- okBtn.down = function () {
- if (resultPopup && resultPopup.parent) game.removeChild(resultPopup);
- // Restore UI
- fartBtn.visible = true;
- if (hatStore) hatStore.visible = true;
- if (foodStore) foodStore.visible = true;
- if (shopBtn) shopBtn.visible = true;
- if (autismModeBtn) autismModeBtn.visible = true;
- if (leaderboardBtn) leaderboardBtn.visible = true;
- if (updateLogBtn) updateLogBtn.visible = true;
- if (musicBtn) musicBtn.visible = true;
- if (achievementsBtn) achievementsBtn.visible = true;
- if (foodStoreMinBtn) foodStoreMinBtn.visible = true;
- updateUI();
- };
- resultPopup.addChild(okBtn);
- game.addChild(resultPopup);
- // Reward
- if (success) {
- fartCount += 80;
- createFloatingText(2048 / 2, 2732 / 2 - 200, "+80 Farts!", 0x00ff00);
- } else {
- fartCount += 5;
- createFloatingText(2048 / 2, 2732 / 2 - 200, "+5 Farts", 0xff0000);
- }
- updateUI();
-}
-// Start the mini-game at random intervals (every 90-180 seconds)
-function schedulePoopCleanMiniGame() {
- var delay = 90000 + Math.random() * 90000;
- LK.setTimeout(function () {
- if (!poopCleanActive && !isDead) startPoopCleanMiniGame();
- schedulePoopCleanMiniGame();
- }, delay);
-}
-schedulePoopCleanMiniGame();
-function startPoopCleanMiniGame() {
- poopCleanActive = true;
- poopCleanScore = 0;
- poopCleanPoops = [];
- // Hide main UI elements
- fartBtn.visible = false;
- if (hatStore) hatStore.visible = false;
- if (foodStore) foodStore.visible = false;
- if (shopBtn) shopBtn.visible = false;
- if (autismModeBtn) autismModeBtn.visible = false;
- if (leaderboardBtn) leaderboardBtn.visible = false;
- if (updateLogBtn) updateLogBtn.visible = false;
- if (musicBtn) musicBtn.visible = false;
- if (achievementsBtn) achievementsBtn.visible = false;
- if (foodStoreMinBtn) foodStoreMinBtn.visible = false;
- // Show popup
- poopCleanPopup = new Container();
- var bg = LK.getAsset('fart_btn', {
- anchorX: 0.5,
- anchorY: 0.5,
- scaleX: 2.2,
- scaleY: 2.7,
- x: 2048 / 2,
- y: 2732 / 2
- });
- poopCleanPopup.addChild(bg);
- var title = new Text2('Clean the Poop! Tap all poops!', {
- size: 80,
- fill: 0x7A5C00,
- align: 'center'
- });
- title.anchor.set(0.5, 0.5);
- title.x = 2048 / 2;
- title.y = 2732 / 2 - 400;
- poopCleanPopup.addChild(title);
- // Score text
- var poopScoreTxt = new Text2('Poops left: 0', {
- size: 60,
- fill: 0x2D2D2D
- });
- poopScoreTxt.anchor.set(0.5, 0.5);
- poopScoreTxt.x = 2048 / 2;
- poopScoreTxt.y = 2732 / 2 - 320;
- poopCleanPopup.addChild(poopScoreTxt);
- // Add poops at random positions
- var poopCount = 6 + Math.floor(Math.random() * 4);
- for (var i = 0; i < poopCount; i++) {
- var poop = LK.getAsset('person_leg', {
- anchorX: 0.5,
- anchorY: 0.5,
- scaleX: 0.5 + Math.random() * 0.3,
- scaleY: 0.4 + Math.random() * 0.2,
- x: 600 + Math.random() * 900,
- y: 1100 + Math.random() * 900,
- tint: 0x7A5C00
- });
- poop.interactive = true;
- poop.down = function (p) {
- return function () {
- if (!poopCleanActive) return;
- if (p.parent) poopCleanPopup.removeChild(p);
- var idx = poopCleanPoops.indexOf(p);
- if (idx !== -1) poopCleanPoops.splice(idx, 1);
- poopScoreTxt.setText('Poops left: ' + poopCleanPoops.length);
- if (poopCleanPoops.length === 0) {
- endPoopCleanMiniGame(true, poopScoreTxt);
+ if (walkCooldown > 0) walkCooldown--;
+ if (dogWalking && !isDead) {
+ walkProgress++;
+ // Move dog towards target
+ var t = Math.min(1, walkProgress / walkDuration);
+ dogFace.x = walkStartX + (walkTargetX - walkStartX) * t;
+ dogFace.y = walkStartY + (walkTargetY - walkStartY) * t;
+ // Check for bone collection (dog intersects bone)
+ if (walkBone && !walkBoneCollected && dogFace.intersects(walkBone)) {
+ walkBoneCollected = true;
+ walkBone.collected = true;
+ createFloatingText(walkBone.x, walkBone.y - 60, "+250 Farts!", 0xffd700);
+ fartCount += 250;
+ updateUI();
+ LK.effects.flashObject(dogFace, 0xffd700, 300);
+ if (walkBone && walkBone.parent) walkBone.parent.removeChild(walkBone);
+ walkBone = null;
+ }
+ // End walk when reached target
+ if (walkProgress >= walkDuration) {
+ // Animate dog back to center
+ tween(dogFace, {
+ x: 2048 / 2,
+ y: 1100
+ }, {
+ duration: 400,
+ easing: tween.cubicOut,
+ onFinish: function onFinish() {
+ dogFace.x = 2048 / 2;
+ dogFace.y = 1100;
}
- };
- }(poop);
- poopCleanPopup.addChild(poop);
- poopCleanPoops.push(poop);
- }
- poopScoreTxt.setText('Poops left: ' + poopCleanPoops.length);
- // Add to game
- game.addChild(poopCleanPopup);
- // End after 15 seconds if not finished
- poopCleanTimer = LK.setTimeout(function () {
- if (poopCleanActive) endPoopCleanMiniGame(false, poopScoreTxt);
- }, 15000);
-}
-function endPoopCleanMiniGame(success, poopScoreTxt) {
- poopCleanActive = false;
- if (poopCleanTimer) {
- LK.clearTimeout(poopCleanTimer);
- poopCleanTimer = null;
- }
- // Remove popup
- if (poopCleanPopup && poopCleanPopup.parent) game.removeChild(poopCleanPopup);
- // Show result
- var resultPopup = new Container();
- var bg = LK.getAsset('fart_btn', {
- anchorX: 0.5,
- anchorY: 0.5,
- scaleX: 1.5,
- scaleY: 1.5,
- x: 2048 / 2,
- y: 2732 / 2
- });
- resultPopup.addChild(bg);
- var msg = success ? "Cleaned up!\n+60 Farts!" : "Too slow!\n+5 Farts";
- var color = success ? 0x00ff00 : 0xff0000;
- var txt = new Text2(msg, {
- size: 80,
- fill: color,
- align: 'center'
- });
- txt.anchor.set(0.5, 0.5);
- txt.x = 2048 / 2;
- txt.y = 2732 / 2 - 40;
- resultPopup.addChild(txt);
- var okBtn = LK.getAsset('fart_btn', {
- anchorX: 0.5,
- anchorY: 0.5,
- scaleX: 0.7,
- scaleY: 0.7,
- x: 2048 / 2,
- y: 2732 / 2 + 120
- });
- var okTxt = new Text2('OK', {
- size: 70,
- fill: 0x7A5C00
- });
- okTxt.anchor.set(0.5, 0.5);
- okTxt.x = 0;
- okTxt.y = 0;
- okBtn.addChild(okTxt);
- okBtn.interactive = true;
- okBtn.down = function () {
- if (resultPopup && resultPopup.parent) game.removeChild(resultPopup);
- // Restore UI
- fartBtn.visible = true;
- if (hatStore) hatStore.visible = true;
- if (foodStore) foodStore.visible = true;
- if (shopBtn) shopBtn.visible = true;
- if (autismModeBtn) autismModeBtn.visible = true;
- if (leaderboardBtn) leaderboardBtn.visible = true;
- if (updateLogBtn) updateLogBtn.visible = true;
- if (musicBtn) musicBtn.visible = true;
- if (achievementsBtn) achievementsBtn.visible = true;
- if (foodStoreMinBtn) foodStoreMinBtn.visible = true;
- updateUI();
- };
- resultPopup.addChild(okBtn);
- game.addChild(resultPopup);
- // Reward
- if (success) {
- fartCount += 60;
- createFloatingText(2048 / 2, 2732 / 2 - 200, "+60 Farts!", 0x00ff00);
- } else {
- fartCount += 5;
- createFloatingText(2048 / 2, 2732 / 2 - 200, "+5 Farts", 0xff0000);
- }
- updateUI();
-}
-// Start the mini-game at random intervals (every 60-120 seconds)
-function scheduleDogWalkMiniGame() {
- var delay = 60000 + Math.random() * 60000;
- LK.setTimeout(function () {
- if (!dogWalkActive && !isDead) startDogWalkMiniGame();
- scheduleDogWalkMiniGame();
- }, delay);
-}
-scheduleDogWalkMiniGame();
-function startDogWalkMiniGame() {
- dogWalkActive = true;
- dogWalkScore = 0;
- dogWalkObstacles = [];
- // Hide main UI elements
- fartBtn.visible = false;
- if (hatStore) hatStore.visible = false;
- if (foodStore) foodStore.visible = false;
- if (shopBtn) shopBtn.visible = false;
- if (autismModeBtn) autismModeBtn.visible = false;
- if (leaderboardBtn) leaderboardBtn.visible = false;
- if (updateLogBtn) updateLogBtn.visible = false;
- if (musicBtn) musicBtn.visible = false;
- if (achievementsBtn) achievementsBtn.visible = false;
- if (foodStoreMinBtn) foodStoreMinBtn.visible = false;
- // Show popup
- dogWalkPopup = new Container();
- var bg = LK.getAsset('fart_btn', {
- anchorX: 0.5,
- anchorY: 0.5,
- scaleX: 2.2,
- scaleY: 2.7,
- x: 2048 / 2,
- y: 2732 / 2
- });
- dogWalkPopup.addChild(bg);
- var title = new Text2('Dog Walk! Tap to Jump Obstacles!', {
- size: 80,
- fill: 0x7A5C00,
- align: 'center'
- });
- title.anchor.set(0.5, 0.5);
- title.x = 2048 / 2;
- title.y = 2732 / 2 - 400;
- dogWalkPopup.addChild(title);
- // Add dog
- dogWalkDog = LK.getAsset('dog_normal', {
- anchorX: 0.5,
- anchorY: 0.5,
- scaleX: 0.7,
- scaleY: 0.7,
- x: 2048 / 2 - 500,
- y: 2732 / 2 + 200
- });
- dogWalkDog.groundY = dogWalkDog.y;
- dogWalkDog.vy = 0;
- dogWalkDog.jumping = false;
- dogWalkPopup.addChild(dogWalkDog);
- // Score text
- var walkScoreTxt = new Text2('Score: 0', {
- size: 60,
- fill: 0x2D2D2D
- });
- walkScoreTxt.anchor.set(0.5, 0.5);
- walkScoreTxt.x = 2048 / 2;
- walkScoreTxt.y = 2732 / 2 - 320;
- dogWalkPopup.addChild(walkScoreTxt);
- // Add tap to jump
- dogWalkPopup.interactive = true;
- dogWalkPopup.down = function () {
- if (!dogWalkDog.jumping) {
- dogWalkDog.vy = -38;
- dogWalkDog.jumping = true;
- LK.getSound('fart_snd').play();
+ });
+ endDogWalk();
}
- };
- // Add obstacles every 1.2s
- dogWalkTimer = LK.setInterval(function () {
- var obs = LK.getAsset('person_leg', {
- anchorX: 0.5,
- anchorY: 0.5,
- scaleX: 0.7 + Math.random() * 0.5,
- scaleY: 0.7 + Math.random() * 0.5,
- x: 2048 / 2 + 600,
- y: dogWalkDog.groundY + 40,
- tint: 0xcd544e
- });
- obs.passed = false;
- dogWalkPopup.addChild(obs);
- dogWalkObstacles.push(obs);
- }, 1200);
- // Add update loop
- dogWalkPopup.update = function () {
- // Move dog
- if (dogWalkDog.jumping) {
- dogWalkDog.y += dogWalkDog.vy;
- dogWalkDog.vy += 4.2;
- if (dogWalkDog.y >= dogWalkDog.groundY) {
- dogWalkDog.y = dogWalkDog.groundY;
- dogWalkDog.vy = 0;
- dogWalkDog.jumping = false;
- }
- }
- // Move obstacles
- for (var i = dogWalkObstacles.length - 1; i >= 0; i--) {
- var obs = dogWalkObstacles[i];
- obs.x -= 22;
- // Check for collision
- if (!obs.passed && obs.x < dogWalkDog.x + 60 && obs.x > dogWalkDog.x - 60 && Math.abs(obs.y - dogWalkDog.y) < 90) {
- // COLLISION! End mini-game
- endDogWalkMiniGame(false, walkScoreTxt);
- return;
- }
- // Score for passing
- if (!obs.passed && obs.x < dogWalkDog.x - 80) {
- obs.passed = true;
- dogWalkScore++;
- walkScoreTxt.setText('Score: ' + dogWalkScore);
- }
- // Remove off-screen
- if (obs.x < 2048 / 2 - 800) {
- dogWalkPopup.removeChild(obs);
- dogWalkObstacles.splice(i, 1);
- }
- }
- };
- // Add to game
- game.addChild(dogWalkPopup);
- // Add to update loop
- dogWalkPopup._updateListener = function () {
- if (dogWalkActive && dogWalkPopup && dogWalkPopup.update) dogWalkPopup.update();
- };
- LK.on('tick', dogWalkPopup._updateListener);
-}
-function endDogWalkMiniGame(success, walkScoreTxt) {
- dogWalkActive = false;
- if (dogWalkTimer) {
- LK.clearInterval(dogWalkTimer);
- dogWalkTimer = null;
}
- LK.off('tick', dogWalkPopup._updateListener);
- // Remove popup
- if (dogWalkPopup && dogWalkPopup.parent) game.removeChild(dogWalkPopup);
- // Show result
- var resultPopup = new Container();
- var bg = LK.getAsset('fart_btn', {
- anchorX: 0.5,
- anchorY: 0.5,
- scaleX: 1.5,
- scaleY: 1.5,
- x: 2048 / 2,
- y: 2732 / 2
- });
- resultPopup.addChild(bg);
- var msg = success ? "Walk Complete!\n+100 Farts!" : "Dog Tripped!\nScore: " + dogWalkScore + "\n+10 Farts";
- var color = success ? 0x00ff00 : 0xff0000;
- var txt = new Text2(msg, {
- size: 80,
- fill: color,
- align: 'center'
- });
- txt.anchor.set(0.5, 0.5);
- txt.x = 2048 / 2;
- txt.y = 2732 / 2 - 40;
- resultPopup.addChild(txt);
- var okBtn = LK.getAsset('fart_btn', {
- anchorX: 0.5,
- anchorY: 0.5,
- scaleX: 0.7,
- scaleY: 0.7,
- x: 2048 / 2,
- y: 2732 / 2 + 120
- });
- var okTxt = new Text2('OK', {
- size: 70,
- fill: 0x7A5C00
- });
- okTxt.anchor.set(0.5, 0.5);
- okTxt.x = 0;
- okTxt.y = 0;
- okBtn.addChild(okTxt);
- okBtn.interactive = true;
- okBtn.down = function () {
- if (resultPopup && resultPopup.parent) game.removeChild(resultPopup);
- // Restore UI
- fartBtn.visible = true;
- if (hatStore) hatStore.visible = true;
- if (foodStore) foodStore.visible = true;
- if (shopBtn) shopBtn.visible = true;
- if (autismModeBtn) autismModeBtn.visible = true;
- if (leaderboardBtn) leaderboardBtn.visible = true;
- if (updateLogBtn) updateLogBtn.visible = true;
- if (musicBtn) musicBtn.visible = true;
- if (achievementsBtn) achievementsBtn.visible = true;
- if (foodStoreMinBtn) foodStoreMinBtn.visible = true;
- updateUI();
- };
- resultPopup.addChild(okBtn);
- game.addChild(resultPopup);
- // Reward
- if (success) {
- fartCount += 100;
- createFloatingText(2048 / 2, 2732 / 2 - 200, "+100 Farts!", 0x00ff00);
- } else {
- fartCount += 10;
- createFloatingText(2048 / 2, 2732 / 2 - 200, "+10 Farts", 0xff0000);
- }
- updateUI();
-}
-// End mini-game after 30 seconds if not failed
-LK.setInterval(function () {
- if (dogWalkActive && dogWalkPopup) {
- endDogWalkMiniGame(true);
- }
-}, 30000);
-// Add person standing and recording at the left side
-var person = new PersonRecording();
-person.x = 400;
-person.y = 1200;
-game.addChild(person);
+};
// --- Dog sliding and teleport logic ---
dogFace.slideSpeed = -12; // Negative: slides left
game.update = function () {
// Save lastX for edge detection
@@ -1408,8 +966,42 @@
}
dogFace.spinAngle += 0.12;
dogFace.rotation = dogFace.spinAngle % (2 * Math.PI);
}
+ // --- Random Poop Event & Cleanup Mini-task ---
+ if (!isDead && Math.random() < 0.001 && !game._poopActive) {
+ // Dog poops randomly, must be cleaned for bonus
+ game._poopActive = true;
+ var poop = LK.getAsset('person_leg', {
+ anchorX: 0.5,
+ anchorY: 0.5,
+ scaleX: 0.5,
+ scaleY: 0.3,
+ tint: 0x964B00
+ });
+ poop.x = dogFace.x + 80 - Math.random() * 160;
+ poop.y = dogFace.y + 220 + Math.random() * 40;
+ poop.interactive = true;
+ game.addChild(poop);
+ // Floating text
+ createFloatingText(poop.x, poop.y - 60, "Tap to clean!", 0x964B00);
+ poop.down = function () {
+ if (!game._poopActive) return;
+ createFloatingText(poop.x, poop.y - 60, "+100 Farts (Clean!)", 0x83de44);
+ fartCount += 100;
+ updateUI();
+ LK.effects.flashObject(dogFace, 0x83de44, 200);
+ if (poop.parent) poop.parent.removeChild(poop);
+ game._poopActive = false;
+ };
+ // Auto-clean after 8 seconds if not tapped (no bonus)
+ LK.setTimeout(function () {
+ if (game._poopActive) {
+ if (poop.parent) poop.parent.removeChild(poop);
+ game._poopActive = false;
+ }
+ }, 8000);
+ }
// Fart storm effect
if (hasPowerUp('FART_STORM') && LK.ticks % 30 === 0) {
fartCount += 10;
createParticleExplosion(Math.random() * 2048, Math.random() * 2732, 0x0080ff, 5);
@@ -1809,8 +1401,47 @@
}
};
// --- Particle System ---
var particles = [];
+// --- Dog Nap Event Logic ---
+if (!dogNapping && !isDead && Math.random() < 0.0007) {
+ dogNapping = true;
+ // Show nap overlay on dog
+ if (!dogFace.napOverlay) {
+ dogFace.napOverlay = LK.getAsset('centerCircle', {
+ anchorX: 0.5,
+ anchorY: 0.5,
+ scaleX: 2.5,
+ scaleY: 1.2,
+ x: 0,
+ y: 0,
+ alpha: 0.5,
+ tint: 0xccccff
+ });
+ dogFace.addChild(dogFace.napOverlay);
+ }
+ dogFace.napOverlay.alpha = 0.7;
+ // Zzz text
+ if (!dogFace.napZzz) {
+ dogFace.napZzz = new Text2("Zzz...", {
+ size: 120,
+ fill: 0x4444ff
+ });
+ dogFace.napZzz.anchor.set(0.5, 0.5);
+ dogFace.napZzz.x = 0;
+ dogFace.napZzz.y = -300;
+ dogFace.addChild(dogFace.napZzz);
+ }
+ dogFace.napZzz.alpha = 1;
+ createFloatingText(dogFace.x, dogFace.y - 200, "Dog is napping!", 0x4444ff);
+ // Nap lasts 3-6 seconds
+ napTimeout = LK.setTimeout(function () {
+ dogNapping = false;
+ if (dogFace.napOverlay) dogFace.napOverlay.alpha = 0;
+ if (dogFace.napZzz) dogFace.napZzz.alpha = 0;
+ createFloatingText(dogFace.x, dogFace.y - 200, "Dog woke up!", 0x83de44);
+ }, 3000 + Math.random() * 3000);
+}
var floatingTexts = [];
// Create particle explosion at position
function createParticleExplosion(x, y, color, count) {
count = count || 15;
@@ -2447,9 +2078,17 @@
};
})(i);
}
// --- Fart Button Handler (Clicker) ---
+// Dog nap event: sometimes the dog naps and you can't fart for a few seconds
+var dogNapping = false;
+var napTimeout = null;
fartBtn.down = function (x, y, obj) {
+ if (dogNapping) {
+ createFloatingText(fartBtn.x, fartBtn.y - 120, "Dog is napping!", 0x888888);
+ LK.effects.flashObject(fartBtn, 0x888888, 120);
+ return;
+ }
// Animate button
fartBtn.animatePress();
// Button color flash for feedback
LK.effects.flashObject(fartBtn, 0xfff7b2, 120);