User prompt
Change text that says drag and aim to launch the chicken to say " Look out for X2 and X5 bonuses"
User prompt
Speed up popcorn and give popcorn Rendon movement ↪💡 Consider importing and using the following plugins: @upit/tween.v1
User prompt
Make popcorn move faster and give it random movement patterns ↪💡 Consider importing and using the following plugins: @upit/tween.v1
User prompt
Speed up popcorn movement and make them have random movement patterns
User prompt
Make popcorn move faster
User prompt
Change instruction text when chicken jockey returns to centre to " What's the highest score you can get?"
User prompt
Change the main instruction text to say " Swipe or flick Chicken Jockey to launch!
User prompt
Move TEXT in instructions screen left 100
User prompt
Move instructions text left 100
User prompt
Use multiple lines to make instruction text fit in the text background
User prompt
Change instructions to say " 1: Swipe or flick any direction to launch Chicken Jockey. 2: Aim Chicken Jockey at the popcorn pieces to eat popcorn. 3: If you miss the popcorn, it will be GAME OVER. 4: Scoring system starts at 1 point per popcorn, but a multiplier increases the score per popcorn every 10 launches. 5: Look out for X2 and X5 bonuses to maximise your total score, but be careful... if you miss the popcorn it will be game over so be patient and wait till the popcorn is in the right place before launching towards these bonuses. 6: Good luck!
User prompt
Remove number 3 and 5 from instructions list
User prompt
Remove number 1 from instructions list
User prompt
Update instructions
User prompt
Move instructions text left 600
User prompt
Add instructions screen and button on title screen
User prompt
Move launch counter text down 120
User prompt
Move launch text down 120
User prompt
Move launches text down 120
User prompt
Make popcorn disappear after 10 seconds ↪💡 Consider importing and using the following plugins: @upit/tween.v1
User prompt
Create a X5 bonus that appears every 26 launches and only stays in arena for 5 seconds. If player hits the X5 it increases their total score X5 .
User prompt
Please fix the bug: 'TypeError: Cannot read properties of null (reading 'parent')' in or related to this line: 'if (x2Bonus.parent) {' Line Number: 133
User prompt
Add a variable to track the x2 bonus instance. ✅ Check for collision with the x2 bonus and collect it. ✅ Create the x2 bonus every 13 launches. ✅ Add a function to create the x2 bonus. ✅ Update the update loop to include the x2 bonus. ✅ Clear the x2 bonus on game initialization.
User prompt
Make x2 pop up every 10 seconds
User prompt
Add 3 popcorn instead of one
/**** 
* Plugins
****/ 
var tween = LK.import("@upit/tween.v1");
var storage = LK.import("@upit/storage.v1");
/**** 
* Classes
****/ 
var ChickenJockey = Container.expand(function () {
	var self = Container.call(this);
	// Create and attach chicken asset
	var chickenGraphics = self.attachAsset('chicken', {
		anchorX: 0.5,
		anchorY: 0.5
	});
	// Physics properties
	self.vx = 0;
	self.vy = 0;
	self.gravity = 0;
	self.bounceDecay = 0.7; // Reduced bounce decay for more sustained bounces
	self.friction = 0.998; // Increased horizontal friction for less horizontal drift
	self.launched = false;
	self.bounceCount = 0;
	self.maxBounces = 5; // Allow 5 bounces per swipe
	// Rotation properties
	self.rotationSpeed = 0;
	self.launch = function (power, angle) {
		// Convert angle to radians
		var radians = angle * Math.PI / 180;
		// Set initial velocity based on power and angle
		self.vx = Math.cos(radians) * power;
		self.vy = Math.sin(radians) * power;
		// Set rotation speed based on velocity
		self.rotationSpeed = power / 50;
		self.launched = true;
		self.bounceCount = 0;
		// Play launch sound
		LK.getSound('launch').play();
	};
	self.reset = function () {
		self.vx = 0;
		self.vy = 0;
		self.rotation = 0;
		self.rotationSpeed = 0;
		self.launched = false;
		self.bounceCount = 0;
		self.maxBounces = 300; // Set the max bounces here too
	};
	self.update = function () {
		if (!self.launched) {
			return;
		}
		// Apply physics with speed limiting
		self.vy += self.gravity;
		// Cap maximum velocity to prevent freezing
		var maxSpeed = 30;
		self.vx = Math.max(-maxSpeed, Math.min(maxSpeed, self.vx));
		self.vy = Math.max(-maxSpeed, Math.min(maxSpeed, self.vy));
		self.x += self.vx;
		self.y += self.vy;
		self.vx *= self.friction;
		// Apply rotation with speed limiting
		self.rotationSpeed = Math.max(-0.2, Math.min(0.2, self.rotationSpeed));
		self.rotation += self.rotationSpeed;
		// Check if stopped
		if (Math.abs(self.vx) < 0.5 && Math.abs(self.vy) < 0.5 && self.bounceCount > 0) {
			self.launched = false;
			// Notify game that chicken jockey has stopped
			if (typeof game.onChickenJockeyStop === 'function') {
				game.onChickenJockeyStop();
			}
		}
		// Track last intersecting state for popcorn collision
		if (typeof self.lastIntersectsPopcorn === 'undefined') {
			self.lastIntersectsPopcorn = false;
		}
		// Track last intersecting state for x2 collision
		if (typeof self.lastIntersectsX2 === 'undefined') {
			self.lastIntersectsX2 = false;
		}
		// Check for collision with popcorn
		if (popcorn !== null) {
			var currentIntersects = self.intersects(popcorn);
			if (currentIntersects) {
				// Collect popcorn
				if (game.x2Collected) {
					// Double the total score if x2 was collected
					game.addScore(game.totalScore);
					// Reset x2 collection status
					game.x2Collected = false;
					// Show message
					showMessage("TOTAL SCORE DOUBLED!", 0xFFD700);
				} else {
					popcorn.collect();
				}
				// Set to null (will be recreated on stop)
				popcorn = null;
			}
			self.lastIntersectsPopcorn = currentIntersects;
			// Check for collision with additional popcorn
			if (popcorn && popcorn.additionalPopcorns) {
				for (var i = 0; i < popcorn.additionalPopcorns.length; i++) {
					var extraPopcorn = popcorn.additionalPopcorns[i];
					if (extraPopcorn && self.intersects(extraPopcorn)) {
						extraPopcorn.collect();
						popcorn.additionalPopcorns[i] = null;
					}
				}
			}
		}
		// Check for collision with x2 multiplier
		if (x2Multiplier !== null) {
			var currentIntersectsX2 = self.intersects(x2Multiplier);
			if (currentIntersectsX2) {
				// Collect x2 multiplier
				x2Multiplier.collect();
				// Set to null
				x2Multiplier = null;
			}
			self.lastIntersectsX2 = currentIntersectsX2;
		}
		// Track previous positions before bounce
		var prevX = self.x;
		var prevY = self.y;
		// Track previous positions for more accurate collision detection
		var prevX = self.x;
		var prevY = self.y;
		// Improved boundary bounce handling with minimum velocity thresholds
		// Horizontal boundaries with more dramatic bounce effect
		if (self.x <= bounds.left) {
			self.x = bounds.left;
			if (self.vx < 0 && Math.abs(self.vx) > 1) {
				// Enhance bounce effect with slightly more force
				self.vx = -self.vx * (self.bounceDecay + 0.1);
				self.bounceCount++;
				LK.getSound('bounce').play();
				// Add slight vertical boost for more interesting motion
				self.vy -= 2 * Math.random();
			}
		} else if (self.x >= bounds.right) {
			self.x = bounds.right;
			if (self.vx > 0 && Math.abs(self.vx) > 1) {
				// Enhance bounce effect with slightly more force
				self.vx = -self.vx * (self.bounceDecay + 0.1);
				self.bounceCount++;
				LK.getSound('bounce').play();
				game.addScore(2000);
				// Add slight vertical boost for more interesting motion
				self.vy -= 2 * Math.random();
			}
		}
		// Vertical boundary bounce handling with more dramatic effect
		if (self.y <= bounds.top) {
			self.y = bounds.top;
			if (self.vy < 0 && Math.abs(self.vy) > 1) {
				// Enhance bounce effect with slightly more force
				self.vy = -self.vy * (self.bounceDecay + 0.1);
				self.bounceCount++;
				LK.getSound('bounce').play();
				// Add slight horizontal boost for more interesting motion
				self.vx += (Math.random() - 0.5) * 4;
			}
		} else if (self.y >= bounds.bottom) {
			self.y = bounds.bottom;
			if (self.vy > 0 && Math.abs(self.vy) > 1) {
				// Enhance bounce effect with slightly more force
				self.vy = -self.vy * (self.bounceDecay + 0.1);
				self.bounceCount++;
				LK.getSound('bounce').play();
				// Add slight horizontal boost for more interesting motion
				self.vx += (Math.random() - 0.5) * 4;
			}
		}
		// Check if max bounces reached
		if (self.bounceCount >= self.maxBounces) {
			self.launched = false;
			// Notify game that max bounces reached
			if (typeof game.onMaxBouncesReached === 'function') {
				game.onMaxBouncesReached();
			}
		}
	};
	return self;
});
var HighScoreTally = Container.expand(function () {
	var self = Container.call(this);
	// Background container
	var background = self.attachAsset('Hiscorebackdrop', {
		anchorX: 0.5,
		anchorY: 0.5
	});
	background.width = 1400;
	background.height = 1200;
	background.alpha = 0.8;
	// Title text
	var titleText = new Text2("HIGH SCORES", {
		size: 100,
		fill: 0xFFD700
	});
	titleText.anchor.set(0.5, 0);
	titleText.y = -background.height / 2 + 100;
	self.addChild(titleText);
	// Score entries container
	var scoreEntries = [];
	self.updateScores = function (highScores) {
		// Clear existing entries
		for (var i = 0; i < scoreEntries.length; i++) {
			if (scoreEntries[i].parent) {
				scoreEntries[i].parent.removeChild(scoreEntries[i]);
			}
		}
		scoreEntries = [];
		// Create new entries
		var startY = -background.height / 2 + 250;
		var padding = 80;
		for (var i = 0; i < highScores.length && i < 5; i++) {
			var entry = new Container();
			// Rank
			var rankText = new Text2(i + 1 + ".", {
				size: 70,
				fill: 0xFFFFFF
			});
			rankText.anchor.set(0, 0.5);
			rankText.x = -background.width / 2 + 200;
			entry.addChild(rankText);
			// Score
			var scoreText = new Text2(highScores[i] ? highScores[i].toLocaleString() : "0", {
				size: 70,
				fill: 0xFFD700
			});
			scoreText.anchor.set(1, 0.5);
			scoreText.x = background.width / 2 - 200;
			entry.addChild(scoreText);
			// Position entry
			entry.y = startY + i * padding;
			self.addChild(entry);
			scoreEntries.push(entry);
		}
		// If no scores available
		if (highScores.length === 0) {
			var noScoreText = new Text2("No scores yet!", {
				size: 70,
				fill: 0xFFFFFF
			});
			noScoreText.anchor.set(0.5, 0.5);
			noScoreText.y = 0;
			self.addChild(noScoreText);
			scoreEntries.push(noScoreText);
		}
	};
	// Start button
	var startButton = new Container();
	var buttonBg = startButton.attachAsset('rope', {
		anchorX: 0.5,
		anchorY: 0.5
	});
	buttonBg.width = 600;
	buttonBg.height = 150;
	buttonBg.tint = 0x00AA00;
	var buttonText = new Text2("PLAY GAME", {
		size: 70,
		fill: 0xFFFFFF
	});
	buttonText.anchor.set(0.5, 0.5);
	startButton.addChild(buttonText);
	startButton.y = background.height / 2 - 200;
	self.addChild(startButton);
	startButton.interactive = true;
	startButton.down = function () {
		buttonBg.tint = 0x007700;
	};
	startButton.up = function () {
		buttonBg.tint = 0x00AA00;
		if (typeof self.onStart === 'function') {
			self.onStart();
		}
	};
	// Reset high scores button
	var resetButton = new Container();
	var resetBg = resetButton.attachAsset('rope', {
		anchorX: 0.5,
		anchorY: 0.5
	});
	resetBg.width = 600;
	resetBg.height = 150;
	resetBg.tint = 0xAA0000;
	var resetText = new Text2("RESET SCORES", {
		size: 70,
		fill: 0xFFFFFF
	});
	resetText.anchor.set(0.5, 0.5);
	resetButton.addChild(resetText);
	resetButton.y = background.height / 2 - 400;
	self.addChild(resetButton);
	resetButton.interactive = true;
	resetButton.down = function () {
		resetBg.tint = 0x770000;
	};
	resetButton.up = function () {
		resetBg.tint = 0xAA0000;
		if (typeof self.onResetScores === 'function') {
			self.onResetScores();
		}
	};
	// Make container position in center of screen
	self.x = 2048 / 2;
	self.y = 2732 / 2;
	return self;
});
var PathTracer = Container.expand(function () {
	var self = Container.call(this);
	self.points = [];
	self.maxPoints = 50;
	self.lineWidth = 5;
	self.lineColor = 0xFFFFFF;
	self.active = false;
	// Create visual representation of the path
	var pathGraphics = self.attachAsset('rope', {
		anchorX: 0.5,
		anchorY: 0.5
	});
	// Initialize path graphics
	pathGraphics.alpha = 0.5;
	pathGraphics.width = 0;
	pathGraphics.height = 0;
	self.startTracing = function (x, y) {
		self.points = [{
			x: x,
			y: y
		}];
		self.active = true;
	};
	self.addPoint = function (x, y) {
		if (!self.active) {
			return;
		}
		// Only add point if it's significantly different from last point
		var lastPoint = self.points[self.points.length - 1];
		var dx = x - lastPoint.x;
		var dy = y - lastPoint.y;
		var distance = Math.sqrt(dx * dx + dy * dy);
		if (distance > 20) {
			self.points.push({
				x: x,
				y: y
			});
			// Limit number of points
			if (self.points.length > self.maxPoints) {
				self.points.shift();
			}
		}
	};
	self.stopTracing = function () {
		self.active = false;
		return self.points.length >= 2 ? self.points : null;
	};
	self.clear = function () {
		self.points = [];
		self.active = false;
	};
	self.update = function () {
		// Update path visualization based on current points
		if (self.points.length < 2) {
			pathGraphics.alpha = 0;
			return;
		}
		pathGraphics.alpha = 0.5;
		// Calculate path visual representation
		var firstPoint = self.points[0];
		var lastPoint = self.points[self.points.length - 1];
		// Position at midpoint of path
		self.x = (firstPoint.x + lastPoint.x) / 2;
		self.y = (firstPoint.y + lastPoint.y) / 2;
		// Calculate path length and angle
		var dx = lastPoint.x - firstPoint.x;
		var dy = lastPoint.y - firstPoint.y;
		var length = Math.sqrt(dx * dx + dy * dy);
		var angle = Math.atan2(dy, dx);
		// Update path graphics
		pathGraphics.width = length;
		pathGraphics.height = self.lineWidth;
		pathGraphics.rotation = angle;
	};
	return self;
});
var Popcorn = Container.expand(function () {
	var self = Container.call(this);
	// Create and attach popcorn asset with smaller size
	var popcornGraphics = self.attachAsset('popcorn', {
		anchorX: 0.5,
		anchorY: 0.5,
		scaleX: 1.5,
		scaleY: 1.5
	});
	// Popcorn properties
	self.collected = false;
	self.baseY = 0;
	self.animationOffset = Math.random() * Math.PI * 2;
	self.animationSpeed = 0.05 + Math.random() * 0.03;
	self.collect = function () {
		// Play collect sound
		LK.getSound('collect').play();
		// Flash effect
		LK.effects.flashObject(self, 0xFFFFFF, 300);
		// Animate collection
		tween(self, {
			y: self.y - 150,
			alpha: 0,
			scaleX: 4.5,
			scaleY: 4.5
		}, {
			duration: 600,
			easing: tween.easeOut,
			onFinish: function onFinish() {
				// Remove from parent
				if (self.parent) {
					self.parent.removeChild(self);
				}
			}
		});
		// Add points
		if (typeof game.addScore === 'function') {
			game.addScore(1);
		}
		self.collected = true;
	};
	self.update = function () {
		// Hover animation
		if (self.baseY === 0) {
			self.baseY = self.y;
			// Start movement tween when popcorn is created
			self.startMovementTween();
		}
		// Vertical hover
		self.y = self.baseY + Math.sin(LK.ticks * self.animationSpeed + self.animationOffset) * 8;
	};
	// Method to start the popcorn moving around the arena
	self.startMovementTween = function () {
		// Calculate a random position within the arena bounds
		var randomX = bounds.left + 150 + Math.random() * (arena.width - 300);
		var randomY = bounds.top + 150 + Math.random() * (arena.height - 300);
		// Move to the new position over a few seconds
		tween(self, {
			x: randomX
			// Update baseY to keep hover effect consistent
		}, {
			duration: popcornMoveSpeed + Math.random() * 1000,
			// Use global popcorn speed variable plus some randomness
			easing: tween.easeInOut,
			onFinish: function onFinish() {
				// When movement completes, start a new movement
				if (self.parent) {
					self.startMovementTween();
				}
			}
		});
	};
	return self;
});
var PowerUp = Container.expand(function () {
	var self = Container.call(this);
	// Create and attach power-up asset (using popcorn as base)
	var powerUpGraphics = self.attachAsset('popcorn', {
		anchorX: 0.5,
		anchorY: 0.5
	});
	// Make it visually distinct
	powerUpGraphics.tint = 0x00FFFF;
	// PowerUp properties
	self.type = "multiplier"; // Default type
	self.value = 2; // Default multiplier value
	self.duration = 10000; // 10 seconds
	self.active = false;
	// Animation properties
	self.animationOffset = Math.random() * Math.PI * 2;
	self.animationSpeed = 0.05 + Math.random() * 0.03;
	self.baseY = 0;
	self.scale = 1.5; // Make power-ups slightly larger
	// Pulse animation
	self.pulseDirection = 1;
	self.pulseSpeed = 0.02;
	self.minScale = 1.3;
	self.maxScale = 1.7;
	self.collect = function () {
		// Play collect sound with higher pitch
		var sound = LK.getSound('collect');
		sound.play();
		// Flash effect
		LK.effects.flashObject(self, 0xFFFFFF, 300);
		// Animate collection (flying up)
		tween(self, {
			y: self.y - 150,
			alpha: 0,
			scaleX: 2,
			scaleY: 2
		}, {
			duration: 600,
			easing: tween.easeOut,
			onFinish: function onFinish() {
				// Remove from parent
				if (self.parent) {
					self.parent.removeChild(self);
				}
			}
		});
		// Activate the powerup effect
		if (typeof game.activatePowerUp === 'function') {
			game.activatePowerUp(self.type, self.value, self.duration);
		}
	};
	self.update = function () {
		// Hover animation
		if (self.baseY === 0) {
			self.baseY = self.y;
		}
		// Vertical hover
		self.y = self.baseY + Math.sin(LK.ticks * self.animationSpeed + self.animationOffset) * 8;
		// Pulsing animation
		var currentScale = self.scale;
		currentScale += self.pulseDirection * self.pulseSpeed;
		if (currentScale > self.maxScale) {
			currentScale = self.maxScale;
			self.pulseDirection = -1;
		} else if (currentScale < self.minScale) {
			currentScale = self.minScale;
			self.pulseDirection = 1;
		}
		self.scale = currentScale;
		self.scaleX = self.scale;
		self.scaleY = self.scale;
	};
	return self;
});
var Rope = Container.expand(function () {
	var self = Container.call(this);
	// Create and attach rope asset
	var ropeGraphics = self.attachAsset('rope', {
		anchorX: 0.5,
		anchorY: 0.5
	});
	// Rope properties
	self.tension = 0.8; // Increased tension for more springy, elastic bounces
	self.bounce = function (chickenJockey) {
		// Store original position for rope displacement effect
		var originalX = self.x;
		var originalY = self.y;
		// Calculate normal angle (perpendicular to rope)
		var normalAngle = Math.atan2(chickenJockey.y - self.y, chickenJockey.x - self.x);
		// Account for rope rotation when calculating normal
		normalAngle += self.rotation + Math.PI / 2;
		// Calculate velocity components
		var speed = Math.sqrt(chickenJockey.vx * chickenJockey.vx + chickenJockey.vy * chickenJockey.vy);
		var incomingAngle = Math.atan2(chickenJockey.vy, chickenJockey.vx);
		// Calculate angle of reflection
		var bounceAngle = 2 * normalAngle - incomingAngle;
		// Calculate new velocity with enhanced force based on incoming speed
		// Higher incoming speed = stronger bounce back effect
		var bounceForce = speed * self.tension * (1 + Math.min(0.5, speed / 40));
		// Reduce random angle variation for more predictable wrestling-style bounces
		var angleVariation = (Math.random() - 0.5) * 0.1; // Smaller random angle adjustment
		bounceAngle += angleVariation;
		// Better two-phase bounce: complete stop, then dramatic spring-off
		// First phase: completely stop the chicken to simulate "sticking" to rope
		chickenJockey.vx = 0;
		chickenJockey.vy = 0;
		// Add a slightly longer delay for more dramatic pause before the spring-off
		LK.setTimeout(function () {
			// Second phase: apply a much stronger bounce force with enhanced velocity
			var enhancedForce = bounceForce * 1.5; // Significantly increase spring force
			chickenJockey.vx = Math.cos(bounceAngle) * enhancedForce * chickenJockey.bounceDecay;
			chickenJockey.vy = Math.sin(bounceAngle) * enhancedForce * chickenJockey.bounceDecay;
			// Add a more dramatic burst of rotation to simulate impact force
			chickenJockey.rotationSpeed = (Math.random() - 0.5) * 0.25;
			// Play a sound to enhance the spring effect
			LK.getSound('bounce').play();
		}, 200); // Slightly longer delay for more dramatic effect
		// Create much more dramatic bounce visual effect with exaggerated rope "give"
		tween(self, {
			scaleY: 2.2,
			// More extreme stretch
			alpha: 0.7,
			// Add more significant displacement in direction of impact
			x: originalX + Math.cos(incomingAngle) * 20,
			y: originalY + Math.sin(incomingAngle) * 20
		}, {
			duration: 300,
			// Longer stretch duration for more dramatic effect
			easing: tween.easeOut,
			onFinish: function onFinish() {
				// Snap the rope back with way more dramatic effect
				tween(self, {
					scaleY: 1.0,
					alpha: 1.0,
					x: originalX,
					y: originalY
				}, {
					duration: 800,
					//{3l} // Much longer snap-back for even more visual impact
					easing: tween.elasticOut,
					amplitude: 2.0 // Higher amplitude for more dramatic snap back
				});
			}
		});
		// Increment bounce count
		chickenJockey.bounceCount++;
		// Create a more dramatic visual and audio experience
		// Play bounce sound with slightly randomized pitch for variety
		var bounceSound = LK.getSound('bounce');
		bounceSound.play();
		// More dramatic flash effect on the rope
		LK.effects.flashObject(self, 0xFFFFFF, 300);
		// Create a "pow" text effect at collision point
		var powText = new Text2("nomnomnom", {
			size: 120,
			fill: 0xFFFF00
		});
		powText.anchor.set(0.5, 0.5);
		powText.x = chickenJockey.x;
		powText.y = chickenJockey.y - 80;
		game.addChild(powText);
		// Animate the text
		tween(powText, {
			y: powText.y - 100,
			alpha: 0,
			scaleX: 1.5,
			scaleY: 1.5
		}, {
			duration: 600,
			easing: tween.easeOut,
			onFinish: function onFinish() {
				if (powText.parent) {
					powText.parent.removeChild(powText);
				}
			}
		});
	};
	self.intersectsWithPoint = function (x, y) {
		var halfWidth = ropeGraphics.width / 2;
		var halfHeight = ropeGraphics.height / 2;
		// Check if point is within the rope's bounding box
		return x >= self.x - halfWidth && x <= self.x + halfWidth && y >= self.y - halfHeight && y <= self.y + halfHeight;
	};
	return self;
});
var TitleScreen = Container.expand(function () {
	var self = Container.call(this);
	// Create and attach title screen background
	var titleGraphics = self.attachAsset('Titlescreen', {
		anchorX: 0.5,
		anchorY: 0.5
	});
	// Start button
	var startButton = new Container();
	var buttonBg = startButton.attachAsset('rope', {
		anchorX: 0.5,
		anchorY: 0.5
	});
	buttonBg.width = 600;
	buttonBg.height = 150;
	buttonBg.tint = 0x00AA00;
	var buttonText = new Text2("START GAME", {
		size: 70,
		fill: 0xFFFFFF
	});
	buttonText.anchor.set(0.5, 0.5);
	startButton.addChild(buttonText);
	startButton.y = 200;
	self.addChild(startButton);
	// Make button interactive
	startButton.interactive = true;
	startButton.down = function () {
		buttonBg.tint = 0x007700;
	};
	startButton.up = function () {
		buttonBg.tint = 0x00AA00;
		// Call start game function if defined
		if (typeof self.onStart === 'function') {
			self.onStart();
		}
	};
	// High scores button
	var scoresButton = new Container();
	var scoresBg = scoresButton.attachAsset('rope', {
		anchorX: 0.5,
		anchorY: 0.5
	});
	scoresBg.width = 600;
	scoresBg.height = 150;
	scoresBg.tint = 0x0000AA;
	var scoresText = new Text2("HIGH SCORES", {
		size: 70,
		fill: 0xFFFFFF
	});
	scoresText.anchor.set(0.5, 0.5);
	scoresButton.addChild(scoresText);
	scoresButton.y = 400;
	self.addChild(scoresButton);
	// Make button interactive
	scoresButton.interactive = true;
	scoresButton.down = function () {
		scoresBg.tint = 0x000077;
	};
	scoresButton.up = function () {
		scoresBg.tint = 0x0000AA;
		// Call show high scores function if defined
		if (typeof self.onHighScores === 'function') {
			self.onHighScores();
		}
	};
	// Position in center of screen
	self.x = 2048 / 2;
	self.y = 2732 / 2;
	return self;
});
var X2Multiplier = Container.expand(function () {
	var self = Container.call(this);
	// Create and attach X2 asset
	var x2Graphics = self.attachAsset('X2', {
		anchorX: 0.5,
		anchorY: 0.5
	});
	// X2 properties
	self.collected = false;
	self.baseY = 0;
	self.animationOffset = Math.random() * Math.PI * 2;
	self.animationSpeed = 0.05 + Math.random() * 0.03;
	// Pulse animation
	self.pulseDirection = 1;
	self.pulseSpeed = 0.02;
	self.minScale = 0.9;
	self.maxScale = 1.1;
	self.scale = 1.0;
	self.collect = function () {
		// Play collect sound
		LK.getSound('collect').play();
		// Flash effect
		LK.effects.flashObject(self, 0xFFFFFF, 300);
		// Animate collection
		tween(self, {
			y: self.y - 150,
			alpha: 0,
			scaleX: 2,
			scaleY: 2
		}, {
			duration: 600,
			easing: tween.easeOut,
			onFinish: function onFinish() {
				// Remove from parent
				if (self.parent) {
					self.parent.removeChild(self);
				}
			}
		});
		self.collected = true;
		game.x2Collected = true;
		showMessage("X2 Collected! Catch popcorn for double score!", 0xFFFF00);
	};
	self.update = function () {
		// Hover animation
		if (self.baseY === 0) {
			self.baseY = self.y;
		}
		// Vertical hover
		self.y = self.baseY + Math.sin(LK.ticks * self.animationSpeed + self.animationOffset) * 8;
		// Pulsing animation
		var currentScale = self.scale;
		currentScale += self.pulseDirection * self.pulseSpeed;
		if (currentScale > self.maxScale) {
			currentScale = self.maxScale;
			self.pulseDirection = -1;
		} else if (currentScale < self.minScale) {
			currentScale = self.minScale;
			self.pulseDirection = 1;
		}
		self.scale = currentScale;
		self.scaleX = self.scale;
		self.scaleY = self.scale;
	};
	return self;
});
/**** 
* Initialize Game
****/ 
var game = new LK.Game({
	backgroundColor: 0x000000 // Black background
});
/**** 
* Game Code
****/ 
// Game state
var gameState = "ready"; // ready, aiming, launched, gameOver
var score = 0;
var launches = 0;
var maxLaunches = 5;
var ropes = [];
var powerUps = [];
var popcorn = null; // Track the active popcorn
var x2Multiplier = null; // Track the active x2 multiplier
var scoreMultiplier = 1;
var multiplierEndTime = 0;
var launchMultiplier = 1; // Track multiplier from launches
var popcornMoveSpeed = 5000; // Base popcorn movement duration in ms
var highScoresKey = 'chickenJockeyHighScores';
var pathTracer = game.addChild(new PathTracer());
game.x2Collected = false; // Track if x2 has been collected
// Add backdrop first
var backdrop = game.addChild(LK.getAsset('Backdrop', {
	anchorX: 0.5,
	anchorY: 0.5,
	x: 2048 / 2,
	y: 2732 / 2
}));
// Create wrestling arena
var arena = game.addChild(LK.getAsset('arena', {
	anchorX: 0.5,
	anchorY: 0.5,
	x: 2048 / 2,
	y: 2732 / 2
}));
// Create chicken jockey
var chickenJockey = game.addChild(new ChickenJockey());
// Game boundaries
var bounds = {
	left: arena.x - arena.width / 2,
	right: arena.x + arena.width / 2,
	top: arena.y - arena.height / 2,
	bottom: arena.y + arena.height / 2
};
// Create GUI elements
var scoreText = new Text2("Score: 0", {
	size: 70,
	fill: 0xFFFFFF
});
scoreText.anchor.set(0.5, 0);
LK.gui.top.addChild(scoreText);
var launchesText = new Text2("Launches: 0/" + maxLaunches, {
	size: 50,
	fill: 0xFFFFFF
});
launchesText.anchor.set(0, 0);
launchesText.x = 120; // Avoid top-left corner
launchesText.y = 20;
LK.gui.topLeft.addChild(launchesText);
var instructionText = new Text2("Drag to aim and launch the chicken!", {
	size: 40,
	fill: 0xFFFFFF
});
instructionText.anchor.set(0.5, 0);
instructionText.y = 100;
LK.gui.top.addChild(instructionText);
// Initialize game
function initGame() {
	// Reset variables
	score = 0;
	launches = 0;
	maxLaunches = 5;
	scoreMultiplier = 1;
	multiplierEndTime = 0;
	popcornMoveSpeed = 5000; // Reset popcorn movement speed
	game.x2Collected = false; // Reset x2 collected status
	gameState = "ready";
	// Update UI
	scoreText.setText("Score: " + score);
	launchesText.setText("Launches: " + launches);
	instructionText.setText("Swipe and flick the chicken to collect as much popcorn as possible!");
	// Reset chicken jockey
	resetChickenJockey();
	// Clear existing popcorn and ropes
	clearPopcornsAndRopes();
	// Create ropes around the arena
	createRopes();
	// Create a few power-ups
	for (var i = 0; i < 3; i++) {
		createPowerUp();
	}
	// Create the initial popcorn
	createPopcorn();
	// Create X2 multiplier with a random chance
	if (Math.random() < 0.7) {
		createX2Multiplier();
	}
	// Play game start sound
	LK.getSound('Gamestart').play();
	// Play background music after a short delay to ensure it starts after the game start sound
	LK.setTimeout(function () {
		LK.playMusic('gameMusic', {
			loop: true
		});
	}, 1000); // Delay of 1000ms (1 second)
}
function resetChickenJockey() {
	chickenJockey.reset();
	// Position chicken in the center of the arena
	chickenJockey.x = arena.x;
	chickenJockey.y = arena.y;
}
function clearPopcornsAndRopes() {
	// Remove all ropes
	for (var i = 0; i < ropes.length; i++) {
		if (ropes[i].parent) {
			ropes[i].parent.removeChild(ropes[i]);
		}
	}
	ropes = [];
	// Remove all power-ups
	for (var i = 0; i < powerUps.length; i++) {
		if (powerUps[i].parent) {
			powerUps[i].parent.removeChild(powerUps[i]);
		}
	}
	powerUps = [];
	// Remove x2 multiplier if exists
	if (x2Multiplier && x2Multiplier.parent) {
		x2Multiplier.parent.removeChild(x2Multiplier);
	}
	x2Multiplier = null;
	// Remove additional popcorns if they exist
	if (popcorn && popcorn.additionalPopcorns) {
		for (var i = 0; i < popcorn.additionalPopcorns.length; i++) {
			var extraPopcorn = popcorn.additionalPopcorns[i];
			if (extraPopcorn && extraPopcorn.parent) {
				extraPopcorn.parent.removeChild(extraPopcorn);
			}
		}
		popcorn.additionalPopcorns = null;
	}
}
function createRopes() {
	// Create top rope
	var topRope = new Rope();
	topRope.x = arena.x;
	topRope.y = bounds.top + 100;
	game.addChild(topRope);
	ropes.push(topRope);
	// Create right rope
	var rightRope = new Rope();
	rightRope.x = bounds.right - 100;
	rightRope.y = arena.y;
	rightRope.rotation = Math.PI / 2; // Rotate 90 degrees
	game.addChild(rightRope);
	ropes.push(rightRope);
	// Create bottom rope
	var bottomRope = new Rope();
	bottomRope.x = arena.x;
	bottomRope.y = bounds.bottom - 100;
	game.addChild(bottomRope);
	ropes.push(bottomRope);
	// Create left rope
	var leftRope = new Rope();
	leftRope.x = bounds.left + 100;
	leftRope.y = arena.y;
	leftRope.rotation = Math.PI / 2; // Rotate 90 degrees
	game.addChild(leftRope);
	ropes.push(leftRope);
	// Center horizontal rope removed
}
function createPowerUp() {
	var powerUp = new PowerUp();
	// Random position within arena bounds
	powerUp.x = bounds.left + 150 + Math.random() * (arena.width - 300);
	powerUp.y = bounds.top + 150 + Math.random() * (arena.height - 300);
	// Random power-up type
	var types = ["multiplier", "extraLaunch", "superBounce"];
	var randomType = types[Math.floor(Math.random() * types.length)];
	powerUp.type = randomType;
	// Configure based on type
	if (randomType === "multiplier") {
		powerUp.tint = 0x00FFFF; // Cyan
		powerUp.value = 2 + Math.floor(Math.random() * 3); // 2x to 4x multiplier
	} else if (randomType === "extraLaunch") {
		powerUp.tint = 0xFF00FF; // Purple
		powerUp.value = 1; // Extra launch
	} else if (randomType === "superBounce") {
		powerUp.tint = 0xFFFF00; // Yellow
		powerUp.value = 2; // Double bounce points
	}
	// Add to game
	game.addChild(powerUp);
	powerUps.push(powerUp);
}
function createX2Multiplier() {
	// Only create if no x2Multiplier exists
	if (x2Multiplier === null && !game.x2Collected) {
		var newX2 = new X2Multiplier();
		// Random position within arena bounds
		newX2.x = bounds.left + 150 + Math.random() * (arena.width - 300);
		newX2.y = bounds.top + 150 + Math.random() * (arena.height - 300);
		// Add to game
		game.addChild(newX2);
		x2Multiplier = newX2;
	}
}
function createPopcorn() {
	// Only create if no popcorn exists
	if (popcorn === null) {
		// Create array to hold 3 popcorn instances
		var popcorns = [];
		// Create 3 popcorn instances
		for (var i = 0; i < 3; i++) {
			var newPopcorn = new Popcorn();
			// Random position within arena bounds
			newPopcorn.x = bounds.left + 150 + Math.random() * (arena.width - 300);
			newPopcorn.y = bounds.top + 150 + Math.random() * (arena.height - 300);
			// Add to game
			game.addChild(newPopcorn);
			popcorns.push(newPopcorn);
		}
		// Assign the first popcorn to the global popcorn variable
		popcorn = popcorns[0];
		// Add properties to track additional popcorns
		popcorn.additionalPopcorns = [popcorns[1], popcorns[2]];
	}
}
// Game events
game.onChickenJockeyStop = function () {
	// If popcorn exists when the chicken stops, it's game over
	if (popcorn !== null) {
		gameState = "gameOver";
		instructionText.setText("Game Over! You missed the popcorn!");
		// Show game over screen
		LK.showGameOver();
		return;
	} else {
		gameState = "ready";
		// Occasionally add a power-up when chicken stops
		if (Math.random() < 0.3 && powerUps.length < 5) {
			createPowerUp();
		}
		// Check if chicken is close to the center of the arena
		var centerX = arena.x;
		var centerY = arena.y;
		var distanceToCenter = Math.sqrt(Math.pow(chickenJockey.x - centerX, 2) + Math.pow(chickenJockey.y - centerY, 2));
		var centerThreshold = 200; // Threshold distance to consider "at center"
		if (distanceToCenter <= centerThreshold) {
			// Create a new popcorn only when player is near the center
			createPopcorn();
			instructionText.setText("New popcorn appeared! Drag to aim and launch the chicken!");
		} else {
			instructionText.setText("Return to the center of the ring to make popcorn appear!");
		}
		// Instead of checking if out of launches, increase max launches
		maxLaunches++; // Increase max launches with each launch
		// Reset for next launch
		resetChickenJockey();
	}
};
game.onMaxBouncesReached = function () {
	// Same as onChickenJockeyStop for now
	game.onChickenJockeyStop();
};
// Input handling
var dragStartX = 0;
var dragStartY = 0;
var dragEndX = 0;
var dragEndY = 0;
game.down = function (x, y, obj) {
	if (gameState === "ready") {
		gameState = "aiming";
		dragStartX = x;
		dragStartY = y;
		pathTracer.startTracing(x, y);
		instructionText.setText("Draw a path for the chicken!");
	}
};
game.move = function (x, y, obj) {
	if (gameState === "aiming") {
		pathTracer.addPoint(x, y);
	}
};
game.up = function (x, y, obj) {
	if (gameState === "aiming") {
		// Get the path from the path tracer
		var path = pathTracer.stopTracing();
		// Only launch if we have a valid path
		if (path && path.length >= 2) {
			// Record drag end position
			dragEndX = x;
			dragEndY = y;
			// Calculate direction from the path
			var firstPoint = path[0];
			var lastPoint = path[path.length - 1];
			var dx = lastPoint.x - firstPoint.x;
			var dy = lastPoint.y - firstPoint.y;
			var distance = Math.sqrt(dx * dx + dy * dy);
			// Calculate power based on path length (with a more controlled range)
			var power = Math.min(distance, 200) * 0.2;
			// Calculate angle based on path direction
			var angle = Math.atan2(dy, dx) * 180 / Math.PI;
			chickenJockey.launch(power, angle);
			// Update game state
			gameState = "launched";
			launches++;
			// Update launch multiplier (1x for first 10, 2x for 11-20, etc.)
			var newMultiplier = Math.floor(launches / 10) + 1;
			// If multiplier changed, speed up popcorn movement
			if (newMultiplier > launchMultiplier) {
				popcornMoveSpeed = Math.max(2000, popcornMoveSpeed - 500); // Speed up by 500ms each level, minimum 2000ms
				// Play Bogerk sound every 10 launches
				LK.getSound('Bogerk').play();
			}
			launchMultiplier = newMultiplier;
			launchesText.setText("Launches: " + launches);
			instructionText.setText("Watch the chicken bounce!");
		} else {
			// Cancel the launch if the path was too short
			gameState = "ready";
		}
		// Clear the path tracer regardless
		pathTracer.clear();
	}
};
// Add helper to update score
game.addScore = function (points) {
	// Apply multiplier if active
	var finalPoints = points;
	if (Date.now() < multiplierEndTime) {
		finalPoints = Math.floor(points * scoreMultiplier);
	}
	// Apply launch multiplier
	finalPoints = Math.floor(finalPoints * launchMultiplier);
	score += finalPoints;
	// Track total score for x2 feature
	game.totalScore = score;
	scoreText.setText("Score: " + score);
	LK.setScore(score);
};
// Power-up activation function
game.activatePowerUp = function (type, value, duration) {
	// Visual feedback for power-up activation
	LK.effects.flashScreen(0x00FFFF, 500);
	if (type === "multiplier") {
		// Set score multiplier
		scoreMultiplier = value;
		// Display message
		showMessage("Score x" + value + " for " + duration / 1000 + "s!", 0x00FFFF);
		// Set timer to end effect
		multiplierEndTime = Date.now() + duration;
	} else if (type === "extraLaunch") {
		// Add extra launches
		maxLaunches += value;
		launches = Math.max(0, launches - value); // Refund a launch
		launchesText.setText("Launches: " + launches);
		// Display message
		showMessage("+" + value + " Extra Launch!", 0xFF00FF);
	} else if (type === "superBounce") {
		// Temporarily increase bounce values
		var oldBounceDecay = chickenJockey.bounceDecay;
		chickenJockey.bounceDecay = Math.min(1.0, chickenJockey.bounceDecay * 1.3);
		// Display message
		showMessage("Super Bounce for " + duration / 1000 + "s!", 0xFFFF00);
		// Set timer to end effect
		LK.setTimeout(function () {
			chickenJockey.bounceDecay = oldBounceDecay;
		}, duration);
	}
};
// Helper function to show temporary messages
function showMessage(text, color) {
	var message = new Text2(text, {
		size: 60,
		fill: color || 0xFFFFFF
	});
	message.anchor.set(0.5, 0.5);
	message.x = 2048 / 2;
	message.y = 400;
	LK.gui.center.addChild(message);
	// Animate in
	message.alpha = 0;
	message.scaleX = 0.5;
	message.scaleY = 0.5;
	tween(message, {
		alpha: 1,
		scaleX: 1,
		scaleY: 1
	}, {
		duration: 300,
		easing: tween.easeOut
	});
	// Animate out after delay
	LK.setTimeout(function () {
		tween(message, {
			alpha: 0,
			y: message.y - 100
		}, {
			duration: 500,
			easing: tween.easeIn,
			onFinish: function onFinish() {
				if (message.parent) {
					message.parent.removeChild(message);
				}
			}
		});
	}, 2000);
}
// Main game loop
game.update = function () {
	// Update all game objects
	if (gameState === "launched") {
		chickenJockey.update();
		// Check for collisions with arena boundaries - only detect boundaries
		// Horizontal boundaries are handled in ChickenJockey class
		if (chickenJockey.x < bounds.left) {
			chickenJockey.x = bounds.left;
		} else if (chickenJockey.x > bounds.right) {
			chickenJockey.x = bounds.right;
		}
		// Check vertical boundaries - only detect boundaries
		// Vertical boundaries are handled in ChickenJockey class
		if (chickenJockey.y < bounds.top) {
			chickenJockey.y = bounds.top;
		} else if (chickenJockey.y > bounds.bottom) {
			chickenJockey.y = bounds.bottom;
		}
		// Track last collision time for all ropes to prevent multiple bounces
		if (!chickenJockey.lastCollisionTime) {
			chickenJockey.lastCollisionTime = 0;
		}
		// Improved collision detection for ropes with proper cooldown
		var currentTime = Date.now();
		var collisionCooldown = 1000; // 1 second cooldown between any rope bounces
		var canBounce = currentTime - chickenJockey.lastCollisionTime > collisionCooldown;
		// Only check for rope collisions if cooldown period has passed
		if (canBounce && chickenJockey.launched && Math.abs(chickenJockey.vx) + Math.abs(chickenJockey.vy) > 1) {
			for (var i = 0; i < ropes.length; i++) {
				if (chickenJockey.intersects(ropes[i])) {
					// Perform the bounce
					ropes[i].bounce(chickenJockey);
					// Record collision time
					chickenJockey.lastCollisionTime = currentTime;
					// Flash screen slightly to emphasize impact
					LK.effects.flashScreen(0xFFFFFF, 100, 0.3);
					// Only bounce on one rope per cooldown period
					break;
				}
			}
		}
		// Check for collisions with power-ups
		for (var i = powerUps.length - 1; i >= 0; i--) {
			if (chickenJockey.intersects(powerUps[i])) {
				// Collect power-up
				powerUps[i].collect();
				// Remove from array
				powerUps.splice(i, 1);
			}
		}
		// Update popcorn baseY when its position changes from tween
		if (popcorn !== null && popcorn.baseY !== 0 && Math.abs(popcorn.baseY - popcorn.y) > 10) {
			popcorn.baseY = popcorn.y;
		}
		// Create a new popcorn after a delay if popcorn is null
		if (popcorn === null && gameState === "launched") {
			LK.setTimeout(function () {
				createPopcorn();
			}, 1000); // 1 second delay before creating new popcorn
		}
	}
	// Update power-up animations
	for (var i = 0; i < powerUps.length; i++) {
		powerUps[i].update();
	}
	// Update popcorn animation
	if (popcorn !== null) {
		popcorn.update();
		// Update additional popcorn animations
		if (popcorn.additionalPopcorns) {
			for (var i = 0; i < popcorn.additionalPopcorns.length; i++) {
				var extraPopcorn = popcorn.additionalPopcorns[i];
				if (extraPopcorn) {
					extraPopcorn.update();
				}
			}
		}
	}
	// Update x2 multiplier animation
	if (x2Multiplier !== null) {
		x2Multiplier.update();
	}
	// Randomly spawn new power-ups (rare)
	if (gameState === "launched" && Math.random() < 0.001 && powerUps.length < 5) {
		createPowerUp();
	}
	// Randomly spawn new x2 multiplier (even more rare)
	if (gameState === "launched" && Math.random() < 0.0005 && x2Multiplier === null && !game.x2Collected) {
		createX2Multiplier();
	}
	// Update path tracer
	pathTracer.update();
	// Update score multiplier UI if active or if launch multiplier is greater than 1
	if (Date.now() < multiplierEndTime && scoreMultiplier > 1 || launchMultiplier > 1) {
		var multiplierString = "x" + launchMultiplier;
		if (Date.now() < multiplierEndTime && scoreMultiplier > 1) {
			var remainingSecs = Math.ceil((multiplierEndTime - Date.now()) / 1000);
			multiplierString += " (x" + scoreMultiplier + " for " + remainingSecs + "s)";
		}
		scoreText.setText("Score: " + score + " (" + multiplierString + ")");
	} else {
		scoreText.setText("Score: " + score);
	}
	// Award extra launch for every million points
	if (score >= 1000000 && score % 1000000 < 10000) {
		// Only award once when crossing each million point threshold
		if (!game.lastMillionMark || Math.floor(score / 1000000) > Math.floor(game.lastMillionMark / 1000000)) {
			maxLaunches++;
			showMessage("Extra Launch for 1,000,000 points!", 0xFFFF00);
			launchesText.setText("Launches: " + launches);
			game.lastMillionMark = score;
			// Create animated free launch text
			var freeText = new Text2("FREE LAUNCH!", {
				size: 100,
				fill: 0xFFFF00
			});
			freeText.anchor.set(0.5, 0.5);
			freeText.x = 2048 / 2;
			freeText.y = 2732 / 2;
			freeText.alpha = 0;
			freeText.scaleX = 0.5;
			freeText.scaleY = 0.5;
			LK.gui.center.addChild(freeText);
			// Animate in with bounce effect
			tween(freeText, {
				alpha: 1,
				scaleX: 1.2,
				scaleY: 1.2
			}, {
				duration: 500,
				easing: tween.elasticOut,
				onFinish: function onFinish() {
					// Pulse animation
					tween(freeText, {
						scaleX: 1,
						scaleY: 1
					}, {
						duration: 500,
						easing: tween.easeInOut,
						onFinish: function onFinish() {
							// Animate out with upward movement
							tween(freeText, {
								alpha: 0,
								y: freeText.y - 200
							}, {
								duration: 800,
								easing: tween.easeIn,
								onFinish: function onFinish() {
									if (freeText.parent) {
										freeText.parent.removeChild(freeText);
									}
								}
							});
						}
					});
				}
			});
		}
	}
};
// High score management functions
function getHighScores() {
	return storage[highScoresKey] || [];
}
function saveHighScore(score) {
	var highScores = getHighScores();
	highScores.push(score);
	// Sort in descending order
	highScores.sort(function (a, b) {
		return b - a;
	});
	// Keep only top 10 scores
	if (highScores.length > 10) {
		highScores = highScores.slice(0, 10);
	}
	// Save to storage
	storage[highScoresKey] = highScores;
}
// Create high score tally
var highScoreTally = new HighScoreTally();
highScoreTally.visible = true;
highScoreTally.onStart = function () {
	game.removeChild(highScoreTally);
	initGame();
};
// Add reset scores functionality
highScoreTally.onResetScores = function () {
	// Clear high scores from storage
	storage[highScoresKey] = [];
	// Update display with empty scores
	highScoreTally.updateScores([]);
	// Show confirmation message
	var confirmText = new Text2("High scores reset!", {
		size: 60,
		fill: 0xFF0000
	});
	confirmText.anchor.set(0.5, 0.5);
	confirmText.x = 2048 / 2;
	confirmText.y = 2732 / 2 + 200;
	LK.gui.center.addChild(confirmText);
	// Animate and remove after delay
	tween(confirmText, {
		alpha: 1,
		scaleX: 1.2,
		scaleY: 1.2
	}, {
		duration: 300,
		easing: tween.easeOut,
		onFinish: function onFinish() {
			LK.setTimeout(function () {
				tween(confirmText, {
					alpha: 0,
					y: confirmText.y - 100
				}, {
					duration: 500,
					easing: tween.easeIn,
					onFinish: function onFinish() {
						if (confirmText.parent) {
							confirmText.parent.removeChild(confirmText);
						}
					}
				});
			}, 1500);
		}
	});
};
// Create and show title screen at start
var titleScreen = new TitleScreen();
game.addChild(titleScreen);
// Set up title screen event handlers
titleScreen.onStart = function () {
	// Hide title screen and start game
	game.removeChild(titleScreen);
	initGame();
	// Play start sound
	LK.getSound('Gamestart').play();
};
titleScreen.onHighScores = function () {
	// Hide title screen and show high scores
	game.removeChild(titleScreen);
	game.addChild(highScoreTally);
	highScoreTally.updateScores(getHighScores());
};
// Add a way to return to title screen from high scores
var originalOnStart = highScoreTally.onStart;
highScoreTally.onStart = function () {
	game.removeChild(highScoreTally);
	game.addChild(titleScreen);
};
// Modified game over handling
var originalOnChickenJockeyStop = game.onChickenJockeyStop;
game.onChickenJockeyStop = function () {
	// Call original function first
	originalOnChickenJockeyStop();
	// If game over, save score
	if (gameState === "gameOver") {
		saveHighScore(score);
		// We'll show high scores after game over in LK.showGameOver callback
	}
};
// Handle game over
LK.onGameOver = function () {
	// Save high score
	saveHighScore(score);
	// Show high score tally after game over
	game.addChild(highScoreTally);
	highScoreTally.updateScores(getHighScores());
	// Back button to return to title screen
	highScoreTally.onStart = function () {
		game.removeChild(highScoreTally);
		game.addChild(titleScreen);
	};
}; /**** 
* Plugins
****/ 
var tween = LK.import("@upit/tween.v1");
var storage = LK.import("@upit/storage.v1");
/**** 
* Classes
****/ 
var ChickenJockey = Container.expand(function () {
	var self = Container.call(this);
	// Create and attach chicken asset
	var chickenGraphics = self.attachAsset('chicken', {
		anchorX: 0.5,
		anchorY: 0.5
	});
	// Physics properties
	self.vx = 0;
	self.vy = 0;
	self.gravity = 0;
	self.bounceDecay = 0.7; // Reduced bounce decay for more sustained bounces
	self.friction = 0.998; // Increased horizontal friction for less horizontal drift
	self.launched = false;
	self.bounceCount = 0;
	self.maxBounces = 5; // Allow 5 bounces per swipe
	// Rotation properties
	self.rotationSpeed = 0;
	self.launch = function (power, angle) {
		// Convert angle to radians
		var radians = angle * Math.PI / 180;
		// Set initial velocity based on power and angle
		self.vx = Math.cos(radians) * power;
		self.vy = Math.sin(radians) * power;
		// Set rotation speed based on velocity
		self.rotationSpeed = power / 50;
		self.launched = true;
		self.bounceCount = 0;
		// Play launch sound
		LK.getSound('launch').play();
	};
	self.reset = function () {
		self.vx = 0;
		self.vy = 0;
		self.rotation = 0;
		self.rotationSpeed = 0;
		self.launched = false;
		self.bounceCount = 0;
		self.maxBounces = 300; // Set the max bounces here too
	};
	self.update = function () {
		if (!self.launched) {
			return;
		}
		// Apply physics with speed limiting
		self.vy += self.gravity;
		// Cap maximum velocity to prevent freezing
		var maxSpeed = 30;
		self.vx = Math.max(-maxSpeed, Math.min(maxSpeed, self.vx));
		self.vy = Math.max(-maxSpeed, Math.min(maxSpeed, self.vy));
		self.x += self.vx;
		self.y += self.vy;
		self.vx *= self.friction;
		// Apply rotation with speed limiting
		self.rotationSpeed = Math.max(-0.2, Math.min(0.2, self.rotationSpeed));
		self.rotation += self.rotationSpeed;
		// Check if stopped
		if (Math.abs(self.vx) < 0.5 && Math.abs(self.vy) < 0.5 && self.bounceCount > 0) {
			self.launched = false;
			// Notify game that chicken jockey has stopped
			if (typeof game.onChickenJockeyStop === 'function') {
				game.onChickenJockeyStop();
			}
		}
		// Track last intersecting state for popcorn collision
		if (typeof self.lastIntersectsPopcorn === 'undefined') {
			self.lastIntersectsPopcorn = false;
		}
		// Track last intersecting state for x2 collision
		if (typeof self.lastIntersectsX2 === 'undefined') {
			self.lastIntersectsX2 = false;
		}
		// Check for collision with popcorn
		if (popcorn !== null) {
			var currentIntersects = self.intersects(popcorn);
			if (currentIntersects) {
				// Collect popcorn
				if (game.x2Collected) {
					// Double the total score if x2 was collected
					game.addScore(game.totalScore);
					// Reset x2 collection status
					game.x2Collected = false;
					// Show message
					showMessage("TOTAL SCORE DOUBLED!", 0xFFD700);
				} else {
					popcorn.collect();
				}
				// Set to null (will be recreated on stop)
				popcorn = null;
			}
			self.lastIntersectsPopcorn = currentIntersects;
			// Check for collision with additional popcorn
			if (popcorn && popcorn.additionalPopcorns) {
				for (var i = 0; i < popcorn.additionalPopcorns.length; i++) {
					var extraPopcorn = popcorn.additionalPopcorns[i];
					if (extraPopcorn && self.intersects(extraPopcorn)) {
						extraPopcorn.collect();
						popcorn.additionalPopcorns[i] = null;
					}
				}
			}
		}
		// Check for collision with x2 multiplier
		if (x2Multiplier !== null) {
			var currentIntersectsX2 = self.intersects(x2Multiplier);
			if (currentIntersectsX2) {
				// Collect x2 multiplier
				x2Multiplier.collect();
				// Set to null
				x2Multiplier = null;
			}
			self.lastIntersectsX2 = currentIntersectsX2;
		}
		// Track previous positions before bounce
		var prevX = self.x;
		var prevY = self.y;
		// Track previous positions for more accurate collision detection
		var prevX = self.x;
		var prevY = self.y;
		// Improved boundary bounce handling with minimum velocity thresholds
		// Horizontal boundaries with more dramatic bounce effect
		if (self.x <= bounds.left) {
			self.x = bounds.left;
			if (self.vx < 0 && Math.abs(self.vx) > 1) {
				// Enhance bounce effect with slightly more force
				self.vx = -self.vx * (self.bounceDecay + 0.1);
				self.bounceCount++;
				LK.getSound('bounce').play();
				// Add slight vertical boost for more interesting motion
				self.vy -= 2 * Math.random();
			}
		} else if (self.x >= bounds.right) {
			self.x = bounds.right;
			if (self.vx > 0 && Math.abs(self.vx) > 1) {
				// Enhance bounce effect with slightly more force
				self.vx = -self.vx * (self.bounceDecay + 0.1);
				self.bounceCount++;
				LK.getSound('bounce').play();
				game.addScore(2000);
				// Add slight vertical boost for more interesting motion
				self.vy -= 2 * Math.random();
			}
		}
		// Vertical boundary bounce handling with more dramatic effect
		if (self.y <= bounds.top) {
			self.y = bounds.top;
			if (self.vy < 0 && Math.abs(self.vy) > 1) {
				// Enhance bounce effect with slightly more force
				self.vy = -self.vy * (self.bounceDecay + 0.1);
				self.bounceCount++;
				LK.getSound('bounce').play();
				// Add slight horizontal boost for more interesting motion
				self.vx += (Math.random() - 0.5) * 4;
			}
		} else if (self.y >= bounds.bottom) {
			self.y = bounds.bottom;
			if (self.vy > 0 && Math.abs(self.vy) > 1) {
				// Enhance bounce effect with slightly more force
				self.vy = -self.vy * (self.bounceDecay + 0.1);
				self.bounceCount++;
				LK.getSound('bounce').play();
				// Add slight horizontal boost for more interesting motion
				self.vx += (Math.random() - 0.5) * 4;
			}
		}
		// Check if max bounces reached
		if (self.bounceCount >= self.maxBounces) {
			self.launched = false;
			// Notify game that max bounces reached
			if (typeof game.onMaxBouncesReached === 'function') {
				game.onMaxBouncesReached();
			}
		}
	};
	return self;
});
var HighScoreTally = Container.expand(function () {
	var self = Container.call(this);
	// Background container
	var background = self.attachAsset('Hiscorebackdrop', {
		anchorX: 0.5,
		anchorY: 0.5
	});
	background.width = 1400;
	background.height = 1200;
	background.alpha = 0.8;
	// Title text
	var titleText = new Text2("HIGH SCORES", {
		size: 100,
		fill: 0xFFD700
	});
	titleText.anchor.set(0.5, 0);
	titleText.y = -background.height / 2 + 100;
	self.addChild(titleText);
	// Score entries container
	var scoreEntries = [];
	self.updateScores = function (highScores) {
		// Clear existing entries
		for (var i = 0; i < scoreEntries.length; i++) {
			if (scoreEntries[i].parent) {
				scoreEntries[i].parent.removeChild(scoreEntries[i]);
			}
		}
		scoreEntries = [];
		// Create new entries
		var startY = -background.height / 2 + 250;
		var padding = 80;
		for (var i = 0; i < highScores.length && i < 5; i++) {
			var entry = new Container();
			// Rank
			var rankText = new Text2(i + 1 + ".", {
				size: 70,
				fill: 0xFFFFFF
			});
			rankText.anchor.set(0, 0.5);
			rankText.x = -background.width / 2 + 200;
			entry.addChild(rankText);
			// Score
			var scoreText = new Text2(highScores[i] ? highScores[i].toLocaleString() : "0", {
				size: 70,
				fill: 0xFFD700
			});
			scoreText.anchor.set(1, 0.5);
			scoreText.x = background.width / 2 - 200;
			entry.addChild(scoreText);
			// Position entry
			entry.y = startY + i * padding;
			self.addChild(entry);
			scoreEntries.push(entry);
		}
		// If no scores available
		if (highScores.length === 0) {
			var noScoreText = new Text2("No scores yet!", {
				size: 70,
				fill: 0xFFFFFF
			});
			noScoreText.anchor.set(0.5, 0.5);
			noScoreText.y = 0;
			self.addChild(noScoreText);
			scoreEntries.push(noScoreText);
		}
	};
	// Start button
	var startButton = new Container();
	var buttonBg = startButton.attachAsset('rope', {
		anchorX: 0.5,
		anchorY: 0.5
	});
	buttonBg.width = 600;
	buttonBg.height = 150;
	buttonBg.tint = 0x00AA00;
	var buttonText = new Text2("PLAY GAME", {
		size: 70,
		fill: 0xFFFFFF
	});
	buttonText.anchor.set(0.5, 0.5);
	startButton.addChild(buttonText);
	startButton.y = background.height / 2 - 200;
	self.addChild(startButton);
	startButton.interactive = true;
	startButton.down = function () {
		buttonBg.tint = 0x007700;
	};
	startButton.up = function () {
		buttonBg.tint = 0x00AA00;
		if (typeof self.onStart === 'function') {
			self.onStart();
		}
	};
	// Reset high scores button
	var resetButton = new Container();
	var resetBg = resetButton.attachAsset('rope', {
		anchorX: 0.5,
		anchorY: 0.5
	});
	resetBg.width = 600;
	resetBg.height = 150;
	resetBg.tint = 0xAA0000;
	var resetText = new Text2("RESET SCORES", {
		size: 70,
		fill: 0xFFFFFF
	});
	resetText.anchor.set(0.5, 0.5);
	resetButton.addChild(resetText);
	resetButton.y = background.height / 2 - 400;
	self.addChild(resetButton);
	resetButton.interactive = true;
	resetButton.down = function () {
		resetBg.tint = 0x770000;
	};
	resetButton.up = function () {
		resetBg.tint = 0xAA0000;
		if (typeof self.onResetScores === 'function') {
			self.onResetScores();
		}
	};
	// Make container position in center of screen
	self.x = 2048 / 2;
	self.y = 2732 / 2;
	return self;
});
var PathTracer = Container.expand(function () {
	var self = Container.call(this);
	self.points = [];
	self.maxPoints = 50;
	self.lineWidth = 5;
	self.lineColor = 0xFFFFFF;
	self.active = false;
	// Create visual representation of the path
	var pathGraphics = self.attachAsset('rope', {
		anchorX: 0.5,
		anchorY: 0.5
	});
	// Initialize path graphics
	pathGraphics.alpha = 0.5;
	pathGraphics.width = 0;
	pathGraphics.height = 0;
	self.startTracing = function (x, y) {
		self.points = [{
			x: x,
			y: y
		}];
		self.active = true;
	};
	self.addPoint = function (x, y) {
		if (!self.active) {
			return;
		}
		// Only add point if it's significantly different from last point
		var lastPoint = self.points[self.points.length - 1];
		var dx = x - lastPoint.x;
		var dy = y - lastPoint.y;
		var distance = Math.sqrt(dx * dx + dy * dy);
		if (distance > 20) {
			self.points.push({
				x: x,
				y: y
			});
			// Limit number of points
			if (self.points.length > self.maxPoints) {
				self.points.shift();
			}
		}
	};
	self.stopTracing = function () {
		self.active = false;
		return self.points.length >= 2 ? self.points : null;
	};
	self.clear = function () {
		self.points = [];
		self.active = false;
	};
	self.update = function () {
		// Update path visualization based on current points
		if (self.points.length < 2) {
			pathGraphics.alpha = 0;
			return;
		}
		pathGraphics.alpha = 0.5;
		// Calculate path visual representation
		var firstPoint = self.points[0];
		var lastPoint = self.points[self.points.length - 1];
		// Position at midpoint of path
		self.x = (firstPoint.x + lastPoint.x) / 2;
		self.y = (firstPoint.y + lastPoint.y) / 2;
		// Calculate path length and angle
		var dx = lastPoint.x - firstPoint.x;
		var dy = lastPoint.y - firstPoint.y;
		var length = Math.sqrt(dx * dx + dy * dy);
		var angle = Math.atan2(dy, dx);
		// Update path graphics
		pathGraphics.width = length;
		pathGraphics.height = self.lineWidth;
		pathGraphics.rotation = angle;
	};
	return self;
});
var Popcorn = Container.expand(function () {
	var self = Container.call(this);
	// Create and attach popcorn asset with smaller size
	var popcornGraphics = self.attachAsset('popcorn', {
		anchorX: 0.5,
		anchorY: 0.5,
		scaleX: 1.5,
		scaleY: 1.5
	});
	// Popcorn properties
	self.collected = false;
	self.baseY = 0;
	self.animationOffset = Math.random() * Math.PI * 2;
	self.animationSpeed = 0.05 + Math.random() * 0.03;
	self.collect = function () {
		// Play collect sound
		LK.getSound('collect').play();
		// Flash effect
		LK.effects.flashObject(self, 0xFFFFFF, 300);
		// Animate collection
		tween(self, {
			y: self.y - 150,
			alpha: 0,
			scaleX: 4.5,
			scaleY: 4.5
		}, {
			duration: 600,
			easing: tween.easeOut,
			onFinish: function onFinish() {
				// Remove from parent
				if (self.parent) {
					self.parent.removeChild(self);
				}
			}
		});
		// Add points
		if (typeof game.addScore === 'function') {
			game.addScore(1);
		}
		self.collected = true;
	};
	self.update = function () {
		// Hover animation
		if (self.baseY === 0) {
			self.baseY = self.y;
			// Start movement tween when popcorn is created
			self.startMovementTween();
		}
		// Vertical hover
		self.y = self.baseY + Math.sin(LK.ticks * self.animationSpeed + self.animationOffset) * 8;
	};
	// Method to start the popcorn moving around the arena
	self.startMovementTween = function () {
		// Calculate a random position within the arena bounds
		var randomX = bounds.left + 150 + Math.random() * (arena.width - 300);
		var randomY = bounds.top + 150 + Math.random() * (arena.height - 300);
		// Move to the new position over a few seconds
		tween(self, {
			x: randomX
			// Update baseY to keep hover effect consistent
		}, {
			duration: popcornMoveSpeed + Math.random() * 1000,
			// Use global popcorn speed variable plus some randomness
			easing: tween.easeInOut,
			onFinish: function onFinish() {
				// When movement completes, start a new movement
				if (self.parent) {
					self.startMovementTween();
				}
			}
		});
	};
	return self;
});
var PowerUp = Container.expand(function () {
	var self = Container.call(this);
	// Create and attach power-up asset (using popcorn as base)
	var powerUpGraphics = self.attachAsset('popcorn', {
		anchorX: 0.5,
		anchorY: 0.5
	});
	// Make it visually distinct
	powerUpGraphics.tint = 0x00FFFF;
	// PowerUp properties
	self.type = "multiplier"; // Default type
	self.value = 2; // Default multiplier value
	self.duration = 10000; // 10 seconds
	self.active = false;
	// Animation properties
	self.animationOffset = Math.random() * Math.PI * 2;
	self.animationSpeed = 0.05 + Math.random() * 0.03;
	self.baseY = 0;
	self.scale = 1.5; // Make power-ups slightly larger
	// Pulse animation
	self.pulseDirection = 1;
	self.pulseSpeed = 0.02;
	self.minScale = 1.3;
	self.maxScale = 1.7;
	self.collect = function () {
		// Play collect sound with higher pitch
		var sound = LK.getSound('collect');
		sound.play();
		// Flash effect
		LK.effects.flashObject(self, 0xFFFFFF, 300);
		// Animate collection (flying up)
		tween(self, {
			y: self.y - 150,
			alpha: 0,
			scaleX: 2,
			scaleY: 2
		}, {
			duration: 600,
			easing: tween.easeOut,
			onFinish: function onFinish() {
				// Remove from parent
				if (self.parent) {
					self.parent.removeChild(self);
				}
			}
		});
		// Activate the powerup effect
		if (typeof game.activatePowerUp === 'function') {
			game.activatePowerUp(self.type, self.value, self.duration);
		}
	};
	self.update = function () {
		// Hover animation
		if (self.baseY === 0) {
			self.baseY = self.y;
		}
		// Vertical hover
		self.y = self.baseY + Math.sin(LK.ticks * self.animationSpeed + self.animationOffset) * 8;
		// Pulsing animation
		var currentScale = self.scale;
		currentScale += self.pulseDirection * self.pulseSpeed;
		if (currentScale > self.maxScale) {
			currentScale = self.maxScale;
			self.pulseDirection = -1;
		} else if (currentScale < self.minScale) {
			currentScale = self.minScale;
			self.pulseDirection = 1;
		}
		self.scale = currentScale;
		self.scaleX = self.scale;
		self.scaleY = self.scale;
	};
	return self;
});
var Rope = Container.expand(function () {
	var self = Container.call(this);
	// Create and attach rope asset
	var ropeGraphics = self.attachAsset('rope', {
		anchorX: 0.5,
		anchorY: 0.5
	});
	// Rope properties
	self.tension = 0.8; // Increased tension for more springy, elastic bounces
	self.bounce = function (chickenJockey) {
		// Store original position for rope displacement effect
		var originalX = self.x;
		var originalY = self.y;
		// Calculate normal angle (perpendicular to rope)
		var normalAngle = Math.atan2(chickenJockey.y - self.y, chickenJockey.x - self.x);
		// Account for rope rotation when calculating normal
		normalAngle += self.rotation + Math.PI / 2;
		// Calculate velocity components
		var speed = Math.sqrt(chickenJockey.vx * chickenJockey.vx + chickenJockey.vy * chickenJockey.vy);
		var incomingAngle = Math.atan2(chickenJockey.vy, chickenJockey.vx);
		// Calculate angle of reflection
		var bounceAngle = 2 * normalAngle - incomingAngle;
		// Calculate new velocity with enhanced force based on incoming speed
		// Higher incoming speed = stronger bounce back effect
		var bounceForce = speed * self.tension * (1 + Math.min(0.5, speed / 40));
		// Reduce random angle variation for more predictable wrestling-style bounces
		var angleVariation = (Math.random() - 0.5) * 0.1; // Smaller random angle adjustment
		bounceAngle += angleVariation;
		// Better two-phase bounce: complete stop, then dramatic spring-off
		// First phase: completely stop the chicken to simulate "sticking" to rope
		chickenJockey.vx = 0;
		chickenJockey.vy = 0;
		// Add a slightly longer delay for more dramatic pause before the spring-off
		LK.setTimeout(function () {
			// Second phase: apply a much stronger bounce force with enhanced velocity
			var enhancedForce = bounceForce * 1.5; // Significantly increase spring force
			chickenJockey.vx = Math.cos(bounceAngle) * enhancedForce * chickenJockey.bounceDecay;
			chickenJockey.vy = Math.sin(bounceAngle) * enhancedForce * chickenJockey.bounceDecay;
			// Add a more dramatic burst of rotation to simulate impact force
			chickenJockey.rotationSpeed = (Math.random() - 0.5) * 0.25;
			// Play a sound to enhance the spring effect
			LK.getSound('bounce').play();
		}, 200); // Slightly longer delay for more dramatic effect
		// Create much more dramatic bounce visual effect with exaggerated rope "give"
		tween(self, {
			scaleY: 2.2,
			// More extreme stretch
			alpha: 0.7,
			// Add more significant displacement in direction of impact
			x: originalX + Math.cos(incomingAngle) * 20,
			y: originalY + Math.sin(incomingAngle) * 20
		}, {
			duration: 300,
			// Longer stretch duration for more dramatic effect
			easing: tween.easeOut,
			onFinish: function onFinish() {
				// Snap the rope back with way more dramatic effect
				tween(self, {
					scaleY: 1.0,
					alpha: 1.0,
					x: originalX,
					y: originalY
				}, {
					duration: 800,
					//{3l} // Much longer snap-back for even more visual impact
					easing: tween.elasticOut,
					amplitude: 2.0 // Higher amplitude for more dramatic snap back
				});
			}
		});
		// Increment bounce count
		chickenJockey.bounceCount++;
		// Create a more dramatic visual and audio experience
		// Play bounce sound with slightly randomized pitch for variety
		var bounceSound = LK.getSound('bounce');
		bounceSound.play();
		// More dramatic flash effect on the rope
		LK.effects.flashObject(self, 0xFFFFFF, 300);
		// Create a "pow" text effect at collision point
		var powText = new Text2("nomnomnom", {
			size: 120,
			fill: 0xFFFF00
		});
		powText.anchor.set(0.5, 0.5);
		powText.x = chickenJockey.x;
		powText.y = chickenJockey.y - 80;
		game.addChild(powText);
		// Animate the text
		tween(powText, {
			y: powText.y - 100,
			alpha: 0,
			scaleX: 1.5,
			scaleY: 1.5
		}, {
			duration: 600,
			easing: tween.easeOut,
			onFinish: function onFinish() {
				if (powText.parent) {
					powText.parent.removeChild(powText);
				}
			}
		});
	};
	self.intersectsWithPoint = function (x, y) {
		var halfWidth = ropeGraphics.width / 2;
		var halfHeight = ropeGraphics.height / 2;
		// Check if point is within the rope's bounding box
		return x >= self.x - halfWidth && x <= self.x + halfWidth && y >= self.y - halfHeight && y <= self.y + halfHeight;
	};
	return self;
});
var TitleScreen = Container.expand(function () {
	var self = Container.call(this);
	// Create and attach title screen background
	var titleGraphics = self.attachAsset('Titlescreen', {
		anchorX: 0.5,
		anchorY: 0.5
	});
	// Start button
	var startButton = new Container();
	var buttonBg = startButton.attachAsset('rope', {
		anchorX: 0.5,
		anchorY: 0.5
	});
	buttonBg.width = 600;
	buttonBg.height = 150;
	buttonBg.tint = 0x00AA00;
	var buttonText = new Text2("START GAME", {
		size: 70,
		fill: 0xFFFFFF
	});
	buttonText.anchor.set(0.5, 0.5);
	startButton.addChild(buttonText);
	startButton.y = 200;
	self.addChild(startButton);
	// Make button interactive
	startButton.interactive = true;
	startButton.down = function () {
		buttonBg.tint = 0x007700;
	};
	startButton.up = function () {
		buttonBg.tint = 0x00AA00;
		// Call start game function if defined
		if (typeof self.onStart === 'function') {
			self.onStart();
		}
	};
	// High scores button
	var scoresButton = new Container();
	var scoresBg = scoresButton.attachAsset('rope', {
		anchorX: 0.5,
		anchorY: 0.5
	});
	scoresBg.width = 600;
	scoresBg.height = 150;
	scoresBg.tint = 0x0000AA;
	var scoresText = new Text2("HIGH SCORES", {
		size: 70,
		fill: 0xFFFFFF
	});
	scoresText.anchor.set(0.5, 0.5);
	scoresButton.addChild(scoresText);
	scoresButton.y = 400;
	self.addChild(scoresButton);
	// Make button interactive
	scoresButton.interactive = true;
	scoresButton.down = function () {
		scoresBg.tint = 0x000077;
	};
	scoresButton.up = function () {
		scoresBg.tint = 0x0000AA;
		// Call show high scores function if defined
		if (typeof self.onHighScores === 'function') {
			self.onHighScores();
		}
	};
	// Position in center of screen
	self.x = 2048 / 2;
	self.y = 2732 / 2;
	return self;
});
var X2Multiplier = Container.expand(function () {
	var self = Container.call(this);
	// Create and attach X2 asset
	var x2Graphics = self.attachAsset('X2', {
		anchorX: 0.5,
		anchorY: 0.5
	});
	// X2 properties
	self.collected = false;
	self.baseY = 0;
	self.animationOffset = Math.random() * Math.PI * 2;
	self.animationSpeed = 0.05 + Math.random() * 0.03;
	// Pulse animation
	self.pulseDirection = 1;
	self.pulseSpeed = 0.02;
	self.minScale = 0.9;
	self.maxScale = 1.1;
	self.scale = 1.0;
	self.collect = function () {
		// Play collect sound
		LK.getSound('collect').play();
		// Flash effect
		LK.effects.flashObject(self, 0xFFFFFF, 300);
		// Animate collection
		tween(self, {
			y: self.y - 150,
			alpha: 0,
			scaleX: 2,
			scaleY: 2
		}, {
			duration: 600,
			easing: tween.easeOut,
			onFinish: function onFinish() {
				// Remove from parent
				if (self.parent) {
					self.parent.removeChild(self);
				}
			}
		});
		self.collected = true;
		game.x2Collected = true;
		showMessage("X2 Collected! Catch popcorn for double score!", 0xFFFF00);
	};
	self.update = function () {
		// Hover animation
		if (self.baseY === 0) {
			self.baseY = self.y;
		}
		// Vertical hover
		self.y = self.baseY + Math.sin(LK.ticks * self.animationSpeed + self.animationOffset) * 8;
		// Pulsing animation
		var currentScale = self.scale;
		currentScale += self.pulseDirection * self.pulseSpeed;
		if (currentScale > self.maxScale) {
			currentScale = self.maxScale;
			self.pulseDirection = -1;
		} else if (currentScale < self.minScale) {
			currentScale = self.minScale;
			self.pulseDirection = 1;
		}
		self.scale = currentScale;
		self.scaleX = self.scale;
		self.scaleY = self.scale;
	};
	return self;
});
/**** 
* Initialize Game
****/ 
var game = new LK.Game({
	backgroundColor: 0x000000 // Black background
});
/**** 
* Game Code
****/ 
// Game state
var gameState = "ready"; // ready, aiming, launched, gameOver
var score = 0;
var launches = 0;
var maxLaunches = 5;
var ropes = [];
var powerUps = [];
var popcorn = null; // Track the active popcorn
var x2Multiplier = null; // Track the active x2 multiplier
var scoreMultiplier = 1;
var multiplierEndTime = 0;
var launchMultiplier = 1; // Track multiplier from launches
var popcornMoveSpeed = 5000; // Base popcorn movement duration in ms
var highScoresKey = 'chickenJockeyHighScores';
var pathTracer = game.addChild(new PathTracer());
game.x2Collected = false; // Track if x2 has been collected
// Add backdrop first
var backdrop = game.addChild(LK.getAsset('Backdrop', {
	anchorX: 0.5,
	anchorY: 0.5,
	x: 2048 / 2,
	y: 2732 / 2
}));
// Create wrestling arena
var arena = game.addChild(LK.getAsset('arena', {
	anchorX: 0.5,
	anchorY: 0.5,
	x: 2048 / 2,
	y: 2732 / 2
}));
// Create chicken jockey
var chickenJockey = game.addChild(new ChickenJockey());
// Game boundaries
var bounds = {
	left: arena.x - arena.width / 2,
	right: arena.x + arena.width / 2,
	top: arena.y - arena.height / 2,
	bottom: arena.y + arena.height / 2
};
// Create GUI elements
var scoreText = new Text2("Score: 0", {
	size: 70,
	fill: 0xFFFFFF
});
scoreText.anchor.set(0.5, 0);
LK.gui.top.addChild(scoreText);
var launchesText = new Text2("Launches: 0/" + maxLaunches, {
	size: 50,
	fill: 0xFFFFFF
});
launchesText.anchor.set(0, 0);
launchesText.x = 120; // Avoid top-left corner
launchesText.y = 20;
LK.gui.topLeft.addChild(launchesText);
var instructionText = new Text2("Drag to aim and launch the chicken!", {
	size: 40,
	fill: 0xFFFFFF
});
instructionText.anchor.set(0.5, 0);
instructionText.y = 100;
LK.gui.top.addChild(instructionText);
// Initialize game
function initGame() {
	// Reset variables
	score = 0;
	launches = 0;
	maxLaunches = 5;
	scoreMultiplier = 1;
	multiplierEndTime = 0;
	popcornMoveSpeed = 5000; // Reset popcorn movement speed
	game.x2Collected = false; // Reset x2 collected status
	gameState = "ready";
	// Update UI
	scoreText.setText("Score: " + score);
	launchesText.setText("Launches: " + launches);
	instructionText.setText("Swipe and flick the chicken to collect as much popcorn as possible!");
	// Reset chicken jockey
	resetChickenJockey();
	// Clear existing popcorn and ropes
	clearPopcornsAndRopes();
	// Create ropes around the arena
	createRopes();
	// Create a few power-ups
	for (var i = 0; i < 3; i++) {
		createPowerUp();
	}
	// Create the initial popcorn
	createPopcorn();
	// Create X2 multiplier with a random chance
	if (Math.random() < 0.7) {
		createX2Multiplier();
	}
	// Play game start sound
	LK.getSound('Gamestart').play();
	// Play background music after a short delay to ensure it starts after the game start sound
	LK.setTimeout(function () {
		LK.playMusic('gameMusic', {
			loop: true
		});
	}, 1000); // Delay of 1000ms (1 second)
}
function resetChickenJockey() {
	chickenJockey.reset();
	// Position chicken in the center of the arena
	chickenJockey.x = arena.x;
	chickenJockey.y = arena.y;
}
function clearPopcornsAndRopes() {
	// Remove all ropes
	for (var i = 0; i < ropes.length; i++) {
		if (ropes[i].parent) {
			ropes[i].parent.removeChild(ropes[i]);
		}
	}
	ropes = [];
	// Remove all power-ups
	for (var i = 0; i < powerUps.length; i++) {
		if (powerUps[i].parent) {
			powerUps[i].parent.removeChild(powerUps[i]);
		}
	}
	powerUps = [];
	// Remove x2 multiplier if exists
	if (x2Multiplier && x2Multiplier.parent) {
		x2Multiplier.parent.removeChild(x2Multiplier);
	}
	x2Multiplier = null;
	// Remove additional popcorns if they exist
	if (popcorn && popcorn.additionalPopcorns) {
		for (var i = 0; i < popcorn.additionalPopcorns.length; i++) {
			var extraPopcorn = popcorn.additionalPopcorns[i];
			if (extraPopcorn && extraPopcorn.parent) {
				extraPopcorn.parent.removeChild(extraPopcorn);
			}
		}
		popcorn.additionalPopcorns = null;
	}
}
function createRopes() {
	// Create top rope
	var topRope = new Rope();
	topRope.x = arena.x;
	topRope.y = bounds.top + 100;
	game.addChild(topRope);
	ropes.push(topRope);
	// Create right rope
	var rightRope = new Rope();
	rightRope.x = bounds.right - 100;
	rightRope.y = arena.y;
	rightRope.rotation = Math.PI / 2; // Rotate 90 degrees
	game.addChild(rightRope);
	ropes.push(rightRope);
	// Create bottom rope
	var bottomRope = new Rope();
	bottomRope.x = arena.x;
	bottomRope.y = bounds.bottom - 100;
	game.addChild(bottomRope);
	ropes.push(bottomRope);
	// Create left rope
	var leftRope = new Rope();
	leftRope.x = bounds.left + 100;
	leftRope.y = arena.y;
	leftRope.rotation = Math.PI / 2; // Rotate 90 degrees
	game.addChild(leftRope);
	ropes.push(leftRope);
	// Center horizontal rope removed
}
function createPowerUp() {
	var powerUp = new PowerUp();
	// Random position within arena bounds
	powerUp.x = bounds.left + 150 + Math.random() * (arena.width - 300);
	powerUp.y = bounds.top + 150 + Math.random() * (arena.height - 300);
	// Random power-up type
	var types = ["multiplier", "extraLaunch", "superBounce"];
	var randomType = types[Math.floor(Math.random() * types.length)];
	powerUp.type = randomType;
	// Configure based on type
	if (randomType === "multiplier") {
		powerUp.tint = 0x00FFFF; // Cyan
		powerUp.value = 2 + Math.floor(Math.random() * 3); // 2x to 4x multiplier
	} else if (randomType === "extraLaunch") {
		powerUp.tint = 0xFF00FF; // Purple
		powerUp.value = 1; // Extra launch
	} else if (randomType === "superBounce") {
		powerUp.tint = 0xFFFF00; // Yellow
		powerUp.value = 2; // Double bounce points
	}
	// Add to game
	game.addChild(powerUp);
	powerUps.push(powerUp);
}
function createX2Multiplier() {
	// Only create if no x2Multiplier exists
	if (x2Multiplier === null && !game.x2Collected) {
		var newX2 = new X2Multiplier();
		// Random position within arena bounds
		newX2.x = bounds.left + 150 + Math.random() * (arena.width - 300);
		newX2.y = bounds.top + 150 + Math.random() * (arena.height - 300);
		// Add to game
		game.addChild(newX2);
		x2Multiplier = newX2;
	}
}
function createPopcorn() {
	// Only create if no popcorn exists
	if (popcorn === null) {
		// Create array to hold 3 popcorn instances
		var popcorns = [];
		// Create 3 popcorn instances
		for (var i = 0; i < 3; i++) {
			var newPopcorn = new Popcorn();
			// Random position within arena bounds
			newPopcorn.x = bounds.left + 150 + Math.random() * (arena.width - 300);
			newPopcorn.y = bounds.top + 150 + Math.random() * (arena.height - 300);
			// Add to game
			game.addChild(newPopcorn);
			popcorns.push(newPopcorn);
		}
		// Assign the first popcorn to the global popcorn variable
		popcorn = popcorns[0];
		// Add properties to track additional popcorns
		popcorn.additionalPopcorns = [popcorns[1], popcorns[2]];
	}
}
// Game events
game.onChickenJockeyStop = function () {
	// If popcorn exists when the chicken stops, it's game over
	if (popcorn !== null) {
		gameState = "gameOver";
		instructionText.setText("Game Over! You missed the popcorn!");
		// Show game over screen
		LK.showGameOver();
		return;
	} else {
		gameState = "ready";
		// Occasionally add a power-up when chicken stops
		if (Math.random() < 0.3 && powerUps.length < 5) {
			createPowerUp();
		}
		// Check if chicken is close to the center of the arena
		var centerX = arena.x;
		var centerY = arena.y;
		var distanceToCenter = Math.sqrt(Math.pow(chickenJockey.x - centerX, 2) + Math.pow(chickenJockey.y - centerY, 2));
		var centerThreshold = 200; // Threshold distance to consider "at center"
		if (distanceToCenter <= centerThreshold) {
			// Create a new popcorn only when player is near the center
			createPopcorn();
			instructionText.setText("New popcorn appeared! Drag to aim and launch the chicken!");
		} else {
			instructionText.setText("Return to the center of the ring to make popcorn appear!");
		}
		// Instead of checking if out of launches, increase max launches
		maxLaunches++; // Increase max launches with each launch
		// Reset for next launch
		resetChickenJockey();
	}
};
game.onMaxBouncesReached = function () {
	// Same as onChickenJockeyStop for now
	game.onChickenJockeyStop();
};
// Input handling
var dragStartX = 0;
var dragStartY = 0;
var dragEndX = 0;
var dragEndY = 0;
game.down = function (x, y, obj) {
	if (gameState === "ready") {
		gameState = "aiming";
		dragStartX = x;
		dragStartY = y;
		pathTracer.startTracing(x, y);
		instructionText.setText("Draw a path for the chicken!");
	}
};
game.move = function (x, y, obj) {
	if (gameState === "aiming") {
		pathTracer.addPoint(x, y);
	}
};
game.up = function (x, y, obj) {
	if (gameState === "aiming") {
		// Get the path from the path tracer
		var path = pathTracer.stopTracing();
		// Only launch if we have a valid path
		if (path && path.length >= 2) {
			// Record drag end position
			dragEndX = x;
			dragEndY = y;
			// Calculate direction from the path
			var firstPoint = path[0];
			var lastPoint = path[path.length - 1];
			var dx = lastPoint.x - firstPoint.x;
			var dy = lastPoint.y - firstPoint.y;
			var distance = Math.sqrt(dx * dx + dy * dy);
			// Calculate power based on path length (with a more controlled range)
			var power = Math.min(distance, 200) * 0.2;
			// Calculate angle based on path direction
			var angle = Math.atan2(dy, dx) * 180 / Math.PI;
			chickenJockey.launch(power, angle);
			// Update game state
			gameState = "launched";
			launches++;
			// Update launch multiplier (1x for first 10, 2x for 11-20, etc.)
			var newMultiplier = Math.floor(launches / 10) + 1;
			// If multiplier changed, speed up popcorn movement
			if (newMultiplier > launchMultiplier) {
				popcornMoveSpeed = Math.max(2000, popcornMoveSpeed - 500); // Speed up by 500ms each level, minimum 2000ms
				// Play Bogerk sound every 10 launches
				LK.getSound('Bogerk').play();
			}
			launchMultiplier = newMultiplier;
			launchesText.setText("Launches: " + launches);
			instructionText.setText("Watch the chicken bounce!");
		} else {
			// Cancel the launch if the path was too short
			gameState = "ready";
		}
		// Clear the path tracer regardless
		pathTracer.clear();
	}
};
// Add helper to update score
game.addScore = function (points) {
	// Apply multiplier if active
	var finalPoints = points;
	if (Date.now() < multiplierEndTime) {
		finalPoints = Math.floor(points * scoreMultiplier);
	}
	// Apply launch multiplier
	finalPoints = Math.floor(finalPoints * launchMultiplier);
	score += finalPoints;
	// Track total score for x2 feature
	game.totalScore = score;
	scoreText.setText("Score: " + score);
	LK.setScore(score);
};
// Power-up activation function
game.activatePowerUp = function (type, value, duration) {
	// Visual feedback for power-up activation
	LK.effects.flashScreen(0x00FFFF, 500);
	if (type === "multiplier") {
		// Set score multiplier
		scoreMultiplier = value;
		// Display message
		showMessage("Score x" + value + " for " + duration / 1000 + "s!", 0x00FFFF);
		// Set timer to end effect
		multiplierEndTime = Date.now() + duration;
	} else if (type === "extraLaunch") {
		// Add extra launches
		maxLaunches += value;
		launches = Math.max(0, launches - value); // Refund a launch
		launchesText.setText("Launches: " + launches);
		// Display message
		showMessage("+" + value + " Extra Launch!", 0xFF00FF);
	} else if (type === "superBounce") {
		// Temporarily increase bounce values
		var oldBounceDecay = chickenJockey.bounceDecay;
		chickenJockey.bounceDecay = Math.min(1.0, chickenJockey.bounceDecay * 1.3);
		// Display message
		showMessage("Super Bounce for " + duration / 1000 + "s!", 0xFFFF00);
		// Set timer to end effect
		LK.setTimeout(function () {
			chickenJockey.bounceDecay = oldBounceDecay;
		}, duration);
	}
};
// Helper function to show temporary messages
function showMessage(text, color) {
	var message = new Text2(text, {
		size: 60,
		fill: color || 0xFFFFFF
	});
	message.anchor.set(0.5, 0.5);
	message.x = 2048 / 2;
	message.y = 400;
	LK.gui.center.addChild(message);
	// Animate in
	message.alpha = 0;
	message.scaleX = 0.5;
	message.scaleY = 0.5;
	tween(message, {
		alpha: 1,
		scaleX: 1,
		scaleY: 1
	}, {
		duration: 300,
		easing: tween.easeOut
	});
	// Animate out after delay
	LK.setTimeout(function () {
		tween(message, {
			alpha: 0,
			y: message.y - 100
		}, {
			duration: 500,
			easing: tween.easeIn,
			onFinish: function onFinish() {
				if (message.parent) {
					message.parent.removeChild(message);
				}
			}
		});
	}, 2000);
}
// Main game loop
game.update = function () {
	// Update all game objects
	if (gameState === "launched") {
		chickenJockey.update();
		// Check for collisions with arena boundaries - only detect boundaries
		// Horizontal boundaries are handled in ChickenJockey class
		if (chickenJockey.x < bounds.left) {
			chickenJockey.x = bounds.left;
		} else if (chickenJockey.x > bounds.right) {
			chickenJockey.x = bounds.right;
		}
		// Check vertical boundaries - only detect boundaries
		// Vertical boundaries are handled in ChickenJockey class
		if (chickenJockey.y < bounds.top) {
			chickenJockey.y = bounds.top;
		} else if (chickenJockey.y > bounds.bottom) {
			chickenJockey.y = bounds.bottom;
		}
		// Track last collision time for all ropes to prevent multiple bounces
		if (!chickenJockey.lastCollisionTime) {
			chickenJockey.lastCollisionTime = 0;
		}
		// Improved collision detection for ropes with proper cooldown
		var currentTime = Date.now();
		var collisionCooldown = 1000; // 1 second cooldown between any rope bounces
		var canBounce = currentTime - chickenJockey.lastCollisionTime > collisionCooldown;
		// Only check for rope collisions if cooldown period has passed
		if (canBounce && chickenJockey.launched && Math.abs(chickenJockey.vx) + Math.abs(chickenJockey.vy) > 1) {
			for (var i = 0; i < ropes.length; i++) {
				if (chickenJockey.intersects(ropes[i])) {
					// Perform the bounce
					ropes[i].bounce(chickenJockey);
					// Record collision time
					chickenJockey.lastCollisionTime = currentTime;
					// Flash screen slightly to emphasize impact
					LK.effects.flashScreen(0xFFFFFF, 100, 0.3);
					// Only bounce on one rope per cooldown period
					break;
				}
			}
		}
		// Check for collisions with power-ups
		for (var i = powerUps.length - 1; i >= 0; i--) {
			if (chickenJockey.intersects(powerUps[i])) {
				// Collect power-up
				powerUps[i].collect();
				// Remove from array
				powerUps.splice(i, 1);
			}
		}
		// Update popcorn baseY when its position changes from tween
		if (popcorn !== null && popcorn.baseY !== 0 && Math.abs(popcorn.baseY - popcorn.y) > 10) {
			popcorn.baseY = popcorn.y;
		}
		// Create a new popcorn after a delay if popcorn is null
		if (popcorn === null && gameState === "launched") {
			LK.setTimeout(function () {
				createPopcorn();
			}, 1000); // 1 second delay before creating new popcorn
		}
	}
	// Update power-up animations
	for (var i = 0; i < powerUps.length; i++) {
		powerUps[i].update();
	}
	// Update popcorn animation
	if (popcorn !== null) {
		popcorn.update();
		// Update additional popcorn animations
		if (popcorn.additionalPopcorns) {
			for (var i = 0; i < popcorn.additionalPopcorns.length; i++) {
				var extraPopcorn = popcorn.additionalPopcorns[i];
				if (extraPopcorn) {
					extraPopcorn.update();
				}
			}
		}
	}
	// Update x2 multiplier animation
	if (x2Multiplier !== null) {
		x2Multiplier.update();
	}
	// Randomly spawn new power-ups (rare)
	if (gameState === "launched" && Math.random() < 0.001 && powerUps.length < 5) {
		createPowerUp();
	}
	// Randomly spawn new x2 multiplier (even more rare)
	if (gameState === "launched" && Math.random() < 0.0005 && x2Multiplier === null && !game.x2Collected) {
		createX2Multiplier();
	}
	// Update path tracer
	pathTracer.update();
	// Update score multiplier UI if active or if launch multiplier is greater than 1
	if (Date.now() < multiplierEndTime && scoreMultiplier > 1 || launchMultiplier > 1) {
		var multiplierString = "x" + launchMultiplier;
		if (Date.now() < multiplierEndTime && scoreMultiplier > 1) {
			var remainingSecs = Math.ceil((multiplierEndTime - Date.now()) / 1000);
			multiplierString += " (x" + scoreMultiplier + " for " + remainingSecs + "s)";
		}
		scoreText.setText("Score: " + score + " (" + multiplierString + ")");
	} else {
		scoreText.setText("Score: " + score);
	}
	// Award extra launch for every million points
	if (score >= 1000000 && score % 1000000 < 10000) {
		// Only award once when crossing each million point threshold
		if (!game.lastMillionMark || Math.floor(score / 1000000) > Math.floor(game.lastMillionMark / 1000000)) {
			maxLaunches++;
			showMessage("Extra Launch for 1,000,000 points!", 0xFFFF00);
			launchesText.setText("Launches: " + launches);
			game.lastMillionMark = score;
			// Create animated free launch text
			var freeText = new Text2("FREE LAUNCH!", {
				size: 100,
				fill: 0xFFFF00
			});
			freeText.anchor.set(0.5, 0.5);
			freeText.x = 2048 / 2;
			freeText.y = 2732 / 2;
			freeText.alpha = 0;
			freeText.scaleX = 0.5;
			freeText.scaleY = 0.5;
			LK.gui.center.addChild(freeText);
			// Animate in with bounce effect
			tween(freeText, {
				alpha: 1,
				scaleX: 1.2,
				scaleY: 1.2
			}, {
				duration: 500,
				easing: tween.elasticOut,
				onFinish: function onFinish() {
					// Pulse animation
					tween(freeText, {
						scaleX: 1,
						scaleY: 1
					}, {
						duration: 500,
						easing: tween.easeInOut,
						onFinish: function onFinish() {
							// Animate out with upward movement
							tween(freeText, {
								alpha: 0,
								y: freeText.y - 200
							}, {
								duration: 800,
								easing: tween.easeIn,
								onFinish: function onFinish() {
									if (freeText.parent) {
										freeText.parent.removeChild(freeText);
									}
								}
							});
						}
					});
				}
			});
		}
	}
};
// High score management functions
function getHighScores() {
	return storage[highScoresKey] || [];
}
function saveHighScore(score) {
	var highScores = getHighScores();
	highScores.push(score);
	// Sort in descending order
	highScores.sort(function (a, b) {
		return b - a;
	});
	// Keep only top 10 scores
	if (highScores.length > 10) {
		highScores = highScores.slice(0, 10);
	}
	// Save to storage
	storage[highScoresKey] = highScores;
}
// Create high score tally
var highScoreTally = new HighScoreTally();
highScoreTally.visible = true;
highScoreTally.onStart = function () {
	game.removeChild(highScoreTally);
	initGame();
};
// Add reset scores functionality
highScoreTally.onResetScores = function () {
	// Clear high scores from storage
	storage[highScoresKey] = [];
	// Update display with empty scores
	highScoreTally.updateScores([]);
	// Show confirmation message
	var confirmText = new Text2("High scores reset!", {
		size: 60,
		fill: 0xFF0000
	});
	confirmText.anchor.set(0.5, 0.5);
	confirmText.x = 2048 / 2;
	confirmText.y = 2732 / 2 + 200;
	LK.gui.center.addChild(confirmText);
	// Animate and remove after delay
	tween(confirmText, {
		alpha: 1,
		scaleX: 1.2,
		scaleY: 1.2
	}, {
		duration: 300,
		easing: tween.easeOut,
		onFinish: function onFinish() {
			LK.setTimeout(function () {
				tween(confirmText, {
					alpha: 0,
					y: confirmText.y - 100
				}, {
					duration: 500,
					easing: tween.easeIn,
					onFinish: function onFinish() {
						if (confirmText.parent) {
							confirmText.parent.removeChild(confirmText);
						}
					}
				});
			}, 1500);
		}
	});
};
// Create and show title screen at start
var titleScreen = new TitleScreen();
game.addChild(titleScreen);
// Set up title screen event handlers
titleScreen.onStart = function () {
	// Hide title screen and start game
	game.removeChild(titleScreen);
	initGame();
	// Play start sound
	LK.getSound('Gamestart').play();
};
titleScreen.onHighScores = function () {
	// Hide title screen and show high scores
	game.removeChild(titleScreen);
	game.addChild(highScoreTally);
	highScoreTally.updateScores(getHighScores());
};
// Add a way to return to title screen from high scores
var originalOnStart = highScoreTally.onStart;
highScoreTally.onStart = function () {
	game.removeChild(highScoreTally);
	game.addChild(titleScreen);
};
// Modified game over handling
var originalOnChickenJockeyStop = game.onChickenJockeyStop;
game.onChickenJockeyStop = function () {
	// Call original function first
	originalOnChickenJockeyStop();
	// If game over, save score
	if (gameState === "gameOver") {
		saveHighScore(score);
		// We'll show high scores after game over in LK.showGameOver callback
	}
};
// Handle game over
LK.onGameOver = function () {
	// Save high score
	saveHighScore(score);
	// Show high score tally after game over
	game.addChild(highScoreTally);
	highScoreTally.updateScores(getHighScores());
	// Back button to return to title screen
	highScoreTally.onStart = function () {
		game.removeChild(highScoreTally);
		game.addChild(titleScreen);
	};
};
:quality(85)/https://cdn.frvr.ai/680e2cb731e90df6e3a79663.png%3F3) 
 :quality(85)/https://cdn.frvr.ai/680f25b74b91ed99c0c93065.png%3F3) 
 :quality(85)/https://cdn.frvr.ai/68107d72af890f4678fa3c0c.png%3F3) 
 :quality(85)/https://cdn.frvr.ai/6811f7e547f9689b747b894b.png%3F3) 
 X5 symbol. In-Game asset. 2d. High contrast. No shadows
:quality(85)/https://cdn.frvr.ai/6811f84547f9689b747b8951.png%3F3) 
 X2 symbol. In-Game asset. 2d. High contrast. No shadows
:quality(85)/https://cdn.frvr.ai/6812d11c31e90df6e3a797a7.png%3F3) 
 :quality(85)/https://cdn.frvr.ai/6812d23e21b2d4faceef26d6.png%3F3) 
 Super popcorn yellow. In-Game asset. 2d. High contrast. No shadows
:quality(85)/https://cdn.frvr.ai/6814a4059dcd06d468edb7f4.png%3F3) 
 :quality(85)/https://cdn.frvr.ai/6814a730211045a0f483816f.png%3F3) 
 :quality(85)/https://cdn.frvr.ai/6814a81e211045a0f4838182.png%3F3) 
 :quality(85)/https://cdn.frvr.ai/6814a94a211045a0f483818b.png%3F3) 
 :quality(85)/https://cdn.frvr.ai/6814aa19211045a0f4838190.png%3F3) 
 :quality(85)/https://cdn.frvr.ai/6814aae1211045a0f4838194.png%3F3) 
 :quality(85)/https://cdn.frvr.ai/6814dcf6bef1291d4e518ee7.png%3F3) 
 :quality(85)/https://cdn.frvr.ai/6814e89f0e23fbc7292fa249.png%3F3) 
 Start button. In-Game asset. 2d. High contrast. No shadows
:quality(85)/https://cdn.frvr.ai/6814e9750e23fbc7292fa26a.png%3F3) 
 High score button. In-Game asset. 2d. High contrast. No shadows
:quality(85)/https://cdn.frvr.ai/6814ea630e23fbc7292fa285.png%3F3) 
 Back button. In-Game asset. 2d. High contrast. No shadows
:quality(85)/https://cdn.frvr.ai/6814eb8e0e23fbc7292fa299.png%3F3) 
 SELECT YOUR CHARACTER button. In-Game asset. 2d. High contrast. No shadows
:quality(85)/https://cdn.frvr.ai/6814ed0e0e23fbc7292fa2b0.png%3F3) 
 Launches button. In-Game asset. 2d. High contrast. No shadows
:quality(85)/https://cdn.frvr.ai/6814f180fb90c04ce18c733a.png%3F3) 
 How to play button. In-Game asset. 2d. High contrast. No shadows
:quality(85)/https://cdn.frvr.ai/6814f1d4fb90c04ce18c733e.png%3F3) 
 Score button. In-Game asset. 2d. High contrast. No shadows
:quality(85)/https://cdn.frvr.ai/6814fcd30e23fbc7292fa369.png%3F3) 
 High Scores button. In-Game asset. 2d. High contrast. No shadows
:quality(85)/https://cdn.frvr.ai/6814fe1d0e23fbc7292fa377.png%3F3) 
 Transparent padlock. In-Game asset. 2d. High contrast. No shadows
:quality(85)/https://cdn.frvr.ai/6814ff160e23fbc7292fa382.png%3F3) 
 Chicken jockey character. In-Game asset. 2d. High contrast. No shadows
:quality(85)/https://cdn.frvr.ai/6815cc2e1a2f31aebc36772c.png%3F3) 
 Reset scores button. In-Game asset. 2d. High contrast. No shadows
:quality(85)/https://cdn.frvr.ai/6815e8706137896f737201af.png%3F3) 
 :quality(85)/https://cdn.frvr.ai/6816d35ae16864a155151a6f.png%3F3) 
 :quality(85)/https://cdn.frvr.ai/6816db39d574efc6b10a8c23.png%3F3) 
 Spider jockey unlocked button. In-Game asset. 2d. High contrast. No shadows
:quality(85)/https://cdn.frvr.ai/6816dba1d574efc6b10a8c2b.png%3F3) 
 Minecraft Steve unlocked button. In-Game asset. 2d. High contrast. No shadows
:quality(85)/https://cdn.frvr.ai/6816dc6cd574efc6b10a8c3b.png%3F3) 
 Piglin unlocked button. In-Game asset. 2d. High contrast. No shadows
:quality(85)/https://cdn.frvr.ai/6816dcafd574efc6b10a8c41.png%3F3) 
 Minecraft skeleton unlocked button. In-Game asset. 2d. High contrast. No shadows
:quality(85)/https://cdn.frvr.ai/6816dd05d574efc6b10a8c49.png%3F3) 
 Minecraft villager unlocked button. In-Game asset. 2d. High contrast. No shadows
:quality(85)/https://cdn.frvr.ai/6817072827945e34d88365bf.png%3F3) 
 :quality(85)/https://cdn.frvr.ai/6817077827945e34d88365c7.png%3F3) 
 Star. In-Game asset. 2d. High contrast. No shadows
:quality(85)/https://cdn.frvr.ai/681707d227945e34d88365cd.png%3F3) 
 White star. In-Game asset. 2d. High contrast. No shadows
:quality(85)/https://cdn.frvr.ai/681709c927945e34d88365da.png%3F3) 
 :quality(85)/https://cdn.frvr.ai/68170ba127945e34d88365fe.png%3F3) 
 Red heart. In-Game asset. 2d. High contrast. No shadows
:quality(85)/https://cdn.frvr.ai/68170bea27945e34d8836604.png%3F3) 
 Purple heart. In-Game asset. 2d. High contrast. No shadows
:quality(85)/https://cdn.frvr.ai/68170c3730f9a3ca3143c36b.png%3F3) 
 :quality(85)/https://cdn.frvr.ai/68170df027945e34d8836617.png%3F3) 
 A peanut. In-Game asset. 2d. High contrast. No shadows
:quality(85)/https://cdn.frvr.ai/68170e3627945e34d883661c.png%3F3) 
 Cashew nut. In-Game asset. 2d. High contrast. No shadows
:quality(85)/https://cdn.frvr.ai/6817137327945e34d883666e.png%3F3) 
 :quality(85)/https://cdn.frvr.ai/681717d45557ee2046ecc2f7.png%3F3) 
 :quality(85)/https://cdn.frvr.ai/68171a3c27945e34d883669c.png%3F3) 
 Grimace shake. In-Game asset. 2d. High contrast. No shadows
:quality(85)/https://cdn.frvr.ai/68171a8627945e34d88366a8.png%3F3) 
 MacDonald's fries. In-Game asset. 2d. High contrast. No shadows
:quality(85)/https://cdn.frvr.ai/68172b1b527b05c35818e92d.png%3F3) 
 Grimace unlocked button. In-Game asset. 2d. High contrast. No shadows
:quality(85)/https://cdn.frvr.ai/68176ba74a0979b918f7a043.png%3F3) 
 Michael Jackson unlocked button. In-Game asset. 2d. High contrast. No shadows
:quality(85)/https://cdn.frvr.ai/68176bfb4a0979b918f7a047.png%3F3) 
 John Cena unlocked button. In-Game asset. 2d. High contrast. No shadows
:quality(85)/https://cdn.frvr.ai/681848065557ee2046ecc355.png%3F3) 
 :quality(85)/https://cdn.frvr.ai/681852a92383a43353c7548b.png%3F3) 
 Deez nuts unlocked button. In-Game asset. 2d. High contrast. No shadows
:quality(85)/https://cdn.frvr.ai/681852f02383a43353c75498.png%3F3) 
 Shooting stars unlocked button. In-Game asset. 2d. High contrast. No shadows
:quality(85)/https://cdn.frvr.ai/68185b748a0e5c4bce224097.png%3F3) 
 :quality(85)/https://cdn.frvr.ai/681875d52be3391f326409d8.png%3F3) 
 Rick roll unlocked button. In-Game asset. 2d. High contrast. No shadows
:quality(85)/https://cdn.frvr.ai/681952795557ee2046ecc397.png%3F3) 
 :quality(85)/https://cdn.frvr.ai/6819530ee4bfd0bbff165058.png%3F3) 
 :quality(85)/https://cdn.frvr.ai/681c8c14c433709b9f3496bb.png%3F3) 
 :quality(85)/https://cdn.frvr.ai/681c9e526135700112f879bd.png%3F3) 
 :quality(85)/https://cdn.frvr.ai/681d93b51b9e5a67ebab2a52.png%3F3) 
 :quality(85)/https://cdn.frvr.ai/681d95da1b9e5a67ebab2a5f.png%3F3) 
 :quality(85)/https://cdn.frvr.ai/681e1884c7ebd23c4bdd5928.png%3F3) 
 Popcorn chicken. In-Game asset. 2d. High contrast. No shadows
:quality(85)/https://cdn.frvr.ai/681e18f9c7ebd23c4bdd5939.png%3F3) 
 Fried chicken drumstick. In-Game asset. 2d. High contrast. No shadows
:quality(85)/https://cdn.frvr.ai/681eb5fbce5c2130acf291bd.png%3F3) 
 :quality(85)/https://cdn.frvr.ai/681eb6868578d3fadb9cac49.png%3F3) 
 :quality(85)/https://cdn.frvr.ai/681eb95249de8df9599c5b97.png%3F3) 
 :quality(85)/https://cdn.frvr.ai/681ebb3049de8df9599c5ba9.png%3F3) 
 :quality(85)/https://cdn.frvr.ai/681ee624b1146135aaefe63c.png%3F3) 
 Amazing digital circus button. In-Game asset. 2d. High contrast. No shadows
:quality(85)/https://cdn.frvr.ai/681ef7e841b5fb6826081a28.png%3F3) 
 :quality(85)/https://cdn.frvr.ai/681ef98cce5c2130acf291c1.png%3F3) 
 :quality(85)/https://cdn.frvr.ai/681ef9efce5c2130acf291c3.png%3F3) 
 :quality(85)/https://cdn.frvr.ai/681f82fa4de4664a77b8eb6f.png%3F3) 
 :quality(85)/https://cdn.frvr.ai/6826b332054039919f0a089c.png%3F3) 
 Select game mode button. In-Game asset. 2d. High contrast. No shadows
:quality(85)/https://cdn.frvr.ai/6826bbff97a2158c01b6e945.png%3F3) 
 Diamond shaped colourful classic mode button. In-Game asset. 2d. High contrast. No shadows
:quality(85)/https://cdn.frvr.ai/6826c2d197a2158c01b6e963.png%3F3) 
 Diamond shaped colourful mini games button. In-Game asset. 2d. High contrast. No shadows
:quality(85)/https://cdn.frvr.ai/6827168900c54e0648f3278d.png%3F3) 
 Same picture in high definition
:quality(85)/https://cdn.frvr.ai/6827414625df75ae7a4de4a6.png%3F3) 
 Diamond shaped colourful button that says sling shot mode. In-Game asset. 2d. High contrast. No shadows
:quality(85)/https://cdn.frvr.ai/682548fd80be55c1986a9d45.png%3F3) 
 Make picture transparent
:quality(85)/https://cdn.frvr.ai/6827dcc4f0da5bc629928468.png%3F3) 
 :quality(85)/https://cdn.frvr.ai/6827fd58f0da5bc629928492.png%3F3) 
 Bullet. In-Game asset. 2d. High contrast. No shadows
:quality(85)/https://cdn.frvr.ai/6827fdd2f0da5bc6299284a3.png%3F3) 
 :quality(85)/https://cdn.frvr.ai/6828170b80d2c88911cb1d24.png%3F3) 
 Start game button. In-Game asset. 2d. High contrast. No shadows
:quality(85)/https://cdn.frvr.ai/682b446c031377340829c968.png%3F3) 
 :quality(85)/https://cdn.frvr.ai/682b45b0031377340829ca5d.png%3F3) 
 Shooting gallery button. In-Game asset. 2d. High contrast. No shadows
:quality(85)/https://cdn.frvr.ai/682ec3c623c50e12668ce9bd.png%3F3) 
 Chain reaction button. In-Game asset. 2d. High contrast. No shadows
:quality(85)/https://cdn.frvr.ai/682ecaa723c50e12668cea01.png%3F3) 
 Realistic space backdrop. In-Game asset. 2d. High contrast. No shadows
launch
Sound effect
Gamestart
Sound effect
collect
Sound effect
gameMusic
Music
Gamemusic
Sound effect
Bogerk
Sound effect
pop
Sound effect
Pignoise
Sound effect
Steve
Sound effect
Villager
Sound effect
Spider
Sound effect
Skeleton
Sound effect
Shootingstars
Music
Maccas
Sound effect
Grimace
Sound effect
Thriller
Music
MJ
Sound effect
Cenaentrance
Music
Johncena
Sound effect
Chickencluck
Sound effect
Deeznuts
Sound effect
Deeznutstrap
Music
Rickroll
Sound effect
Nevergonna
Music
Starz
Sound effect
Grimaceshake
Music
Joenugget
Sound effect
gegagedi
Music
Shrek
Sound effect
Raveswamp
Music
Pomni
Sound effect
Digcircus
Music
Runandgo
Music
Gunshot
Sound effect
Reelbadman
Sound effect
Tinggoes
Music